{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c2f774c5-ae45-41fc-9876-2f0eb54a350b", "code": "4948-15-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=4948-15-6", "code_system": "CAS", "references": [ "0eef730b-cd54-4826-9e85-f34ab7e66f3d", "3002cf45-a3cd-47f2-8667-25753ce22141" ] }, { "uuid": "20fc0203-1351-442f-a03a-ae5657ec526e", "code": "FCN NO. 115", "comments": "FCN|COLORANT|POLYMERS", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=115", "code_system": "Food Contact Sustance Notif, (FCN No.)", "references": [ "0eef730b-cd54-4826-9e85-f34ab7e66f3d" ] }, { "uuid": "e7a896d4-0953-49ed-adb4-0d27bff15d37", "code": "225-590-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.023.264", "code_system": "ECHA (EC/EINECS)", "references": [ "0eef730b-cd54-4826-9e85-f34ab7e66f3d" ] }, { "uuid": "eef85e27-3ba5-4f28-806e-e47b6baa15b9", "code": "62555", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/62555", "code_system": "PUBCHEM", "references": [ "0eef730b-cd54-4826-9e85-f34ab7e66f3d" ] }, { "uuid": "214f5637-dd26-f028-a19a-dd29a7d4db0b", "code": "DTXSID4052130", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4052130", "code_system": "EPA CompTox", "references": [ "09ff7b47-937d-033b-3cdf-e8c6517e9f38" ] }, { "uuid": "00153b3e-46df-4dbd-86e0-f538ca6de3d0", "code": "ZZA8XO3AWA", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "a35e3743-7d22-f618-bf28-40d1df9d5e17", "code": "Pigment Red 149", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Pigment_Red_149", "code_system": "WIKIPEDIA", "references": [ "28762b51-493b-b4f1-73b4-cfe4c6ac1e7c" ] } ], "substance_class": "chemical", "names": [ { "uuid": "dd1010ab-bc79-4ad8-b07f-0f07bdeb0f09", "name": "2,9-BIS(3,5-DIMETHYLPHENYL)ANTHRA(2,1,9-DEF:6,5,10- D'E'F')DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRONE", "stdName": "2,9-BIS(3,5-DIMETHYLPHENYL)ANTHRA(2,1,9-DEF:6,5,10- D'E'F')DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6f18c73e-e81d-47b0-b523-5e2a4c31d419", "070fbebb-b404-4c7e-9292-3bac08e73b2a" ], "display_name": false }, { "uuid": "6aaa5d87-141d-4a8e-8455-2b4dee9a8401", "name": "2,9-BIS(3,5-DIMETHYLPHENYL)ANTHRA(2,1,9-DEF:6,5,10-D'E'F')DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRONE", "stdName": "2,9-BIS(3,5-DIMETHYLPHENYL)ANTHRA(2,1,9-DEF:6,5,10-D'E'F')DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "dcd8ec32-8ce3-4435-881f-00691ed23dae", "070fbebb-b404-4c7e-9292-3bac08e73b2a" ], "display_name": false }, { "uuid": "55c6c78d-342c-44e4-8d78-a809f9a19cbb", "name": "ANTHRA(2,1,9-DEF:6,5,10-D'E'F')DIISOQUINOLINE- 1,3,8,10(2H,9H)-TETRONE, 2,9-BIS(3,5-DIMETHYLPHENYL)-", "stdName": "ANTHRA(2,1,9-DEF:6,5,10-D'E'F')DIISOQUINOLINE- 1,3,8,10(2H,9H)-TETRONE, 2,9-BIS(3,5-DIMETHYLPHENYL)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6f18c73e-e81d-47b0-b523-5e2a4c31d419", "070fbebb-b404-4c7e-9292-3bac08e73b2a" ], "display_name": false }, { "uuid": "c4f21b02-26e0-4eff-bbf5-8a1e9739419e", "name": "C.I. PIGMENT RED 149", "stdName": "C.I. PIGMENT RED 149", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6f18c73e-e81d-47b0-b523-5e2a4c31d419", "070fbebb-b404-4c7e-9292-3bac08e73b2a" ], "display_name": false }, { "uuid": "766ed9a5-b50c-41fb-80b6-b46b4ee58835", "name": "PIGMENT RED 149", "stdName": "PIGMENT RED 149", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "070fbebb-b404-4c7e-9292-3bac08e73b2a", "6d1cf838-c8bd-4e41-827e-34c8f4cfcc96" ], "display_name": true } ], "references": [ { "uuid": "6f18c73e-e81d-47b0-b523-5e2a4c31d419", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "070fbebb-b404-4c7e-9292-3bac08e73b2a", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dcd8ec32-8ce3-4435-881f-00691ed23dae", "citation": "CEDI", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6d1cf838-c8bd-4e41-827e-34c8f4cfcc96", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0eef730b-cd54-4826-9e85-f34ab7e66f3d", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390315000, "tags": [ "NOMEN" ] }, { "uuid": "342b3d65-b83e-4c29-8c0e-167500a5ec96", "citation": "SRS import [ZZA8XO3AWA]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ZZA8XO3AWA", "doc_type": "SRS", "public_domain": true, "document_date": 1493390315000, "tags": [ "NOMEN" ] }, { "uuid": "09ff7b47-937d-033b-3cdf-e8c6517e9f38", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4948-15-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "28762b51-493b-b4f1-73b4-cfe4c6ac1e7c", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "3002cf45-a3cd-47f2-8667-25753ce22141", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "0d703bf9-a3fc-4f0f-b83d-c236f5ec569f", "id": "0d703bf9-a3fc-4f0f-b83d-c236f5ec569f", "molfile": "\n Marvin 01132100562D \n\n 46 54 0 0 0 0 999 V2000\n -4.2863 -4.1266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2863 -3.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0008 -2.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0008 -2.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7152 -1.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2863 -1.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5718 -2.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5718 -2.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8573 -1.6516 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1429 -2.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1429 -2.8891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4291 -1.6505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 -2.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0001 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0004 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7135 -0.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4285 -0.8231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1427 -0.4102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1427 0.4148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4275 0.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4275 1.6509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7130 2.0634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0015 1.6509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0015 0.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7153 0.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4299 0.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1442 0.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1440 -0.4132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4293 -0.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7150 -0.4127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8579 -0.8266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5724 -0.4141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7130 0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1422 2.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1422 2.8880 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8573 1.6516 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5718 2.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5718 2.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2863 3.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2863 4.1266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0008 2.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0008 2.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7152 1.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2863 1.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8576 0.8266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5721 0.4141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 8 2 0 0 0 0\n 4 3 2 0 0 0 0\n 4 5 1 0 0 0 0\n 6 4 1 0 0 0 0\n 7 6 2 0 0 0 0\n 7 8 1 0 0 0 0\n 9 7 1 0 0 0 0\n 10 9 1 0 0 0 0\n 9 31 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 29 12 2 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 30 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 33 16 2 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 2 0 0 0 0\n 45 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 33 1 0 0 0 0\n 22 21 2 0 0 0 0\n 34 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 2 0 0 0 0\n 24 25 1 0 0 0 0\n 33 24 1 0 0 0 0\n 26 25 2 0 0 0 0\n 30 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 2 0 0 0 0\n 28 29 1 0 0 0 0\n 31 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 31 32 2 0 0 0 0\n 34 35 2 0 0 0 0\n 34 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 36 45 1 0 0 0 0\n 37 38 1 0 0 0 0\n 37 44 2 0 0 0 0\n 39 38 2 0 0 0 0\n 39 40 1 0 0 0 0\n 41 39 1 0 0 0 0\n 42 41 2 0 0 0 0\n 42 43 1 0 0 0 0\n 44 42 1 0 0 0 0\n 45 46 2 0 0 0 0\nM END", "smiles": "Cc1cc(C)cc(c1)N2C(=O)c3ccc4c5ccc6c7c(ccc(c8ccc(c3c48)C2=O)c57)C(=O)N(c9cc(C)cc(C)c9)C6=O", "formula": "C40H26N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e493b7e0-d845-472c-8291-6d34740c9c58" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "598.6469", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "22b1a736-b0e6-4521-9832-d6742087af5c", "version": "5", "structure": { "id": "97d8dd37-3b75-4c6e-85f1-6c307092de90", "molfile": "\n Marvin 01132107532D \n\n 46 54 0 0 0 0 999 V2000\n 2.1422 2.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8573 1.6516 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8576 0.8266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1427 0.4148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4275 0.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7130 0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0015 0.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0015 1.6509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7130 2.0634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4275 1.6509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1429 -2.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8573 -1.6516 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8579 -0.8266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1440 -0.4132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4293 -0.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7150 -0.4127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0004 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0001 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 -2.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4291 -1.6505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1427 -0.4102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4285 -0.8231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7135 -0.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1442 0.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4299 0.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7153 0.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1422 2.8880 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5721 0.4141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1429 -2.8891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5724 -0.4141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5718 -2.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2863 -1.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0008 -2.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0008 -2.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2863 -3.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5718 -2.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2863 -4.1266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7152 -1.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5718 2.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2863 1.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0008 2.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0008 2.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2863 3.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5718 2.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2863 4.1266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7152 1.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 1 10 1 0 0 0 0\n 5 10 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 11 20 1 0 0 0 0\n 15 20 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 4 21 2 0 0 0 0\n 6 23 1 0 0 0 0\n 7 26 1 0 0 0 0\n 14 24 2 0 0 0 0\n 16 26 1 0 0 0 0\n 17 23 1 0 0 0 0\n 1 27 2 0 0 0 0\n 3 28 2 0 0 0 0\n 11 29 2 0 0 0 0\n 13 30 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 2 0 0 0 0\n 35 36 1 0 0 0 0\n 31 36 2 0 0 0 0\n 35 37 1 0 0 0 0\n 33 38 1 0 0 0 0\n 12 31 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 2 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 2 0 0 0 0\n 43 44 1 0 0 0 0\n 39 44 2 0 0 0 0\n 43 45 1 0 0 0 0\n 41 46 1 0 0 0 0\n 2 39 1 0 0 0 0\nM END", "smiles": "Cc1cc(C)cc(c1)N2C(=O)c3ccc4c5ccc6c7c(ccc(c8ccc(c3c48)C2=O)c57)C(=O)N(c9cc(C)cc(C)c9)C6=O", "formula": "C40H26N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "598.6469", "optical_activity": "NONE", "references": [ "6f18c73e-e81d-47b0-b523-5e2a4c31d419", "342b3d65-b83e-4c29-8c0e-167500a5ec96" ], "stereo_centers": 0 }, "unii": "ZZA8XO3AWA" } ] }