{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e50dc8f5-a5b6-4b72-bcd5-81d7c8d4deb3",
          "code": "306-91-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=306-91-2",
          "code_system": "CAS",
          "references": [
            "bb2ea157-47f9-4c74-b8d4-d01d7e59bb56",
            "5ceb2a27-07a6-4d42-8192-3e400eb59943"
          ]
        },
        {
          "uuid": "7c06a089-dd02-46c4-8603-5b2f70de4fcb",
          "code": "1540875",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1540875/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "bb2ea157-47f9-4c74-b8d4-d01d7e59bb56"
          ]
        },
        {
          "uuid": "bde44c95-44f5-45b6-bd3d-66859741e4e4",
          "code": "78972",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/78972",
          "code_system": "PUBCHEM",
          "references": [
            "bb2ea157-47f9-4c74-b8d4-d01d7e59bb56"
          ]
        },
        {
          "uuid": "84fe3ae4-e205-9d73-94a6-7ace0e4dfab2",
          "code": "DTXSID1047029",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1047029",
          "code_system": "EPA CompTox",
          "references": [
            "55993b82-1961-fe3b-24ef-bd9b401ba083"
          ]
        },
        {
          "uuid": "708cae9b-ffe3-4619-8d4e-936e1038e228",
          "code": "ZZ3T53GWV9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "460b9561-c4c3-e5ce-0cb9-d4e93caac86c",
          "code": "39423",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:39423",
          "code_system": "CHEBI",
          "references": [
            "3e694cfa-963a-4add-db82-0cb416512183"
          ]
        },
        {
          "uuid": "e589e6f1-bc78-d23f-50c3-549f3a6b68e1",
          "code": "ZZ3T53GWV9",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=ZZ3T53GWV9",
          "code_system": "DAILYMED",
          "references": [
            "fd4b5d0a-0fd2-b425-90a0-f182745d3f5b"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "42b2e29f-5d5c-4116-b124-577813691c57",
          "name": "FIFLOW 180",
          "stdName": "FIFLOW 180",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9636ec35-702a-4910-906e-10a41635aed3",
            "4c1bdf4c-aa70-4c6e-89d7-22f08cb8e26c"
          ],
          "display_name": false
        },
        {
          "uuid": "b051135f-5f45-48d6-8079-786fd0c848d1",
          "name": "FIFLOW 220",
          "stdName": "FIFLOW 220",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9636ec35-702a-4910-906e-10a41635aed3",
            "4c1bdf4c-aa70-4c6e-89d7-22f08cb8e26c"
          ],
          "display_name": false
        },
        {
          "uuid": "03cd9f68-5275-484e-842a-8177bc803232",
          "name": "FLUTEC PC-11",
          "stdName": "FLUTEC PC-11",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9636ec35-702a-4910-906e-10a41635aed3",
            "4c1bdf4c-aa70-4c6e-89d7-22f08cb8e26c"
          ],
          "display_name": false
        },
        {
          "uuid": "226a0a20-a8ae-49b2-964d-b79ecc405ec9",
          "name": "FLUTEC PP 11",
          "stdName": "FLUTEC PP 11",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c1bdf4c-aa70-4c6e-89d7-22f08cb8e26c",
            "8cb5523e-c360-44b8-9efe-1f2a97717040"
          ],
          "display_name": false
        },
        {
          "uuid": "57bd589d-7baf-4fac-bea8-0be58c243257",
          "name": "PERFLUORINATED TETRADECAHYDROPHENANTHRENE",
          "stdName": "PERFLUORINATED TETRADECAHYDROPHENANTHRENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c1bdf4c-aa70-4c6e-89d7-22f08cb8e26c",
            "8cb5523e-c360-44b8-9efe-1f2a97717040"
          ],
          "display_name": false
        },
        {
          "uuid": "27c7cd07-e6df-4626-bb6b-41e10e44c0db",
          "name": "PERFLUOROPERHYDROPHENANTHRENE",
          "stdName": "PERFLUOROPERHYDROPHENANTHRENE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9636ec35-702a-4910-906e-10a41635aed3",
            "4c1bdf4c-aa70-4c6e-89d7-22f08cb8e26c",
            "43c720f2-463d-4ba8-a637-bb67b138487c"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "34525b01-f730-42d6-af22-f27b3d14d02d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "5ee38e04-b514-40fe-ba15-d36b0ef54518",
          "name": "PERFLUOROTETRADECAHYDROPHENANTHRENE",
          "stdName": "PERFLUOROTETRADECAHYDROPHENANTHRENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c1bdf4c-aa70-4c6e-89d7-22f08cb8e26c",
            "8cb5523e-c360-44b8-9efe-1f2a97717040"
          ],
          "display_name": false
        },
        {
          "uuid": "7b274c2e-90ff-49b8-b3e5-d524ba9cae8c",
          "name": "PHENANTHRENE, 1,1,2,2,3,3,4,4,4A,4B,5,5,6,6,7,7,8,8,8A,9,9,10,10,10A-TETRACOSAFLUOROTETRADECAHYDRO-",
          "stdName": "PHENANTHRENE, 1,1,2,2,3,3,4,4,4A,4B,5,5,6,6,7,7,8,8,8A,9,9,10,10,10A-TETRACOSAFLUOROTETRADECAHYDRO-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c1bdf4c-aa70-4c6e-89d7-22f08cb8e26c",
            "8cb5523e-c360-44b8-9efe-1f2a97717040"
          ],
          "display_name": false
        },
        {
          "uuid": "449fa851-8ed7-4fdd-8cfb-d51d805b47f9",
          "name": "PHENANTHRENE, TETRACOSAFLUOROTETRADECAHYDRO-",
          "stdName": "PHENANTHRENE, TETRACOSAFLUOROTETRADECAHYDRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c1bdf4c-aa70-4c6e-89d7-22f08cb8e26c",
            "8cb5523e-c360-44b8-9efe-1f2a97717040"
          ],
          "display_name": false
        },
        {
          "uuid": "5f723ccb-1f3a-4827-ae50-1017e51f9308",
          "name": "TETRACOSAFLUOROTETRADECAHYDROPHENANTHRENE",
          "stdName": "TETRACOSAFLUOROTETRADECAHYDROPHENANTHRENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8ed6f40-a632-4514-b818-f76d1956eed3",
            "4c1bdf4c-aa70-4c6e-89d7-22f08cb8e26c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9636ec35-702a-4910-906e-10a41635aed3",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4c1bdf4c-aa70-4c6e-89d7-22f08cb8e26c",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8cb5523e-c360-44b8-9efe-1f2a97717040",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8ed6f40-a632-4514-b818-f76d1956eed3",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb2ea157-47f9-4c74-b8d4-d01d7e59bb56",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391892000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a31c8bc-dc8e-4878-93bc-847bad4baf23",
          "citation": "SRS import [ZZ3T53GWV9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ZZ3T53GWV9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391892000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43c720f2-463d-4ba8-a637-bb67b138487c",
          "citation": "PERFLUOROPERHYDROPHENANTHRENE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "55993b82-1961-fe3b-24ef-bd9b401ba083",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=306-91-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5ceb2a27-07a6-4d42-8192-3e400eb59943",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3e694cfa-963a-4add-db82-0cb416512183",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "fd4b5d0a-0fd2-b425-90a0-f182745d3f5b",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "305d4415-dc44-40e5-a759-af826c522555",
          "id": "305d4415-dc44-40e5-a759-af826c522555",
          "molfile": "\n  Marvin  01132102362D          \n\n 38 40  0  0  0  0            999 V2000\n    0.0714   -1.6476    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7345   -2.1373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.3337    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1426   -2.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8570   -3.5911    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2321   -2.9994    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0302   -2.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7394   -3.6650    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5505   -3.2162    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4561   -2.1883    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.7216   -2.1883    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0659   -1.4538    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.6859   -0.8111    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1809   -1.4538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4846   -1.1324    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0432   -0.7142    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4969   -0.7345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9384   -0.1224    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7086    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2697   -0.7345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1550    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9431   -0.1454    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6753   -1.4538    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.0808   -0.8366    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5628   -1.4538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7745   -0.7575    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3943   -1.3033    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8995   -2.2113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8380   -1.7981    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7615   -2.5862    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4710   -2.8769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3307   -3.6421    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2591   -3.2391    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5962   -2.8769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7365   -3.6421    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9560   -3.3437    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2085   -2.1883    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.9634   -2.1883    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  2 14  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  1  0  0  0  0\n  4  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  1  0  0  0  0\n  7 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 12  1  0  0  0  0\n 37 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\n 17 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 17  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 20  1  0  0  0  0\n 23 20  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 23  1  0  0  0  0\n 23 37  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 25  1  0  0  0  0\n 28 25  1  0  0  0  0\n 29 28  1  0  0  0  0\n 30 28  1  0  0  0  0\n 28 31  1  0  0  0  0\n 32 31  1  0  0  0  0\n 33 31  1  0  0  0  0\n 31 34  1  0  0  0  0\n 35 34  1  0  0  0  0\n 36 34  1  0  0  0  0\n 34 37  1  0  0  0  0\n 38 37  1  0  0  0  0\nM  END",
          "smiles": "C12(C3(C(C(C(C1(C(C(C(C2(F)F)(F)F)(F)F)(F)F)F)(F)F)(F)F)(C(C(C(C3(F)F)(F)F)(F)F)(F)F)F)F)F",
          "formula": "C14F24",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4e3ea4e6-3e60-4834-ba84-65ff8f28c7a8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "624.112",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b627e01d-e08b-48a7-9f66-dd0b06f3456e",
      "version": "7",
      "structure": {
        "id": "5f8051d8-6b2c-4881-b8ee-1d49560a7772",
        "molfile": "\n  Marvin  01132104562D          \n\n 38 40  0  0  0  0            999 V2000\n    2.0659   -1.4538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6753   -1.4538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4561   -2.1883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2085   -2.1883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4969   -0.7345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2697   -0.7345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1809   -1.4538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5628   -1.4538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5962   -2.8769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0302   -2.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7345   -2.1373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4710   -2.8769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8995   -2.2113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1426   -2.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9384   -0.1224    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7086    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1550    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9431   -0.1454    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4846   -1.1324    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0432   -0.7142    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7745   -0.7575    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3943   -1.3033    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7365   -3.6421    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9560   -3.3437    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7394   -3.6650    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5505   -3.2162    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6859   -0.8111    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0808   -0.8366    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9634   -2.1883    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7216   -2.1883    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3307   -3.6421    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2591   -3.2391    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0714   -1.6476    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.3337    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8570   -3.5911    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2321   -2.9994    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8380   -1.7981    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7615   -2.5862    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  6  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11  7  1  0  0  0  0\n 12  9  1  0  0  0  0\n 13  8  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15  5  1  0  0  0  0\n 16  5  1  0  0  0  0\n 17  6  1  0  0  0  0\n 18  6  1  0  0  0  0\n 19  7  1  0  0  0  0\n 20  7  1  0  0  0  0\n 21  8  1  0  0  0  0\n 22  8  1  0  0  0  0\n 23  9  1  0  0  0  0\n 24  9  1  0  0  0  0\n 25 10  1  0  0  0  0\n 26 10  1  0  0  0  0\n 27  1  1  0  0  0  0\n 28  2  1  0  0  0  0\n 29  4  1  0  0  0  0\n 30  3  1  0  0  0  0\n 31 12  1  0  0  0  0\n 32 12  1  0  0  0  0\n 33 11  1  0  0  0  0\n 34 11  1  0  0  0  0\n 35 14  1  0  0  0  0\n 36 14  1  0  0  0  0\n 37 13  1  0  0  0  0\n 38 13  1  0  0  0  0\n  2  4  1  0  0  0  0\n 14 10  1  0  0  0  0\n 13 12  1  0  0  0  0\nM  END",
        "smiles": "C12(C3(C(C(C(C1(C(C(C(C2(F)F)(F)F)(F)F)(F)F)F)(F)F)(F)F)(C(C(C(C3(F)F)(F)F)(F)F)(F)F)F)F)F",
        "formula": "C14F24",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "624.112",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "8cb5523e-c360-44b8-9efe-1f2a97717040",
          "9a31c8bc-dc8e-4878-93bc-847bad4baf23"
        ],
        "stereo_centers": 4
      },
      "unii": "ZZ3T53GWV9"
    }
  ]
}