{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0bd2276b-5ff1-437e-8ecc-e4f68addc5f4",
          "code": "886-50-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=886-50-0",
          "code_system": "CAS",
          "references": [
            "e6c1c092-0ab9-4d58-81a8-43e9efed85f7",
            "f1b56e02-409a-4d6e-abe7-724e72f0b36d"
          ]
        },
        {
          "uuid": "620993d2-1f0e-4559-9cb0-6b761adaa551",
          "code": "C010347",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67010347",
          "code_system": "MESH",
          "references": [
            "e6c1c092-0ab9-4d58-81a8-43e9efed85f7"
          ]
        },
        {
          "uuid": "866ef903-9f2f-47ae-870a-39b747408cd3",
          "code": "80813",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3995",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "e6c1c092-0ab9-4d58-81a8-43e9efed85f7"
          ]
        },
        {
          "uuid": "8833fddb-239f-4d98-9586-07205e9188ec",
          "code": "212-950-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.011.773",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e6c1c092-0ab9-4d58-81a8-43e9efed85f7"
          ]
        },
        {
          "uuid": "6d39f20e-ff53-4cc6-ae47-1ac55a5789cc",
          "code": "13450",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13450",
          "code_system": "PUBCHEM",
          "references": [
            "e6c1c092-0ab9-4d58-81a8-43e9efed85f7"
          ]
        },
        {
          "uuid": "8ab54a8a-e22f-00d1-a53b-9790712c14b6",
          "code": "1525",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1525",
          "code_system": "HSDB",
          "references": [
            "0ed02250-0171-3f56-ff6d-3baaf7090c88"
          ]
        },
        {
          "uuid": "4901af4d-fb47-f818-d234-43b4b800eaef",
          "code": "DTXSID3024318",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3024318",
          "code_system": "EPA CompTox",
          "references": [
            "24951ead-39e5-2a46-4aef-39c190d1bf2f"
          ]
        },
        {
          "uuid": "5efbd646-3039-489a-b5cc-180c9c2aa9ed",
          "code": "ZXL474TLFP",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "544f4795-0f07-57fd-05ce-6fd35ec596c6",
          "code": "DB08215",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB08215",
          "code_system": "DRUG BANK",
          "references": [
            "87d65d9e-88df-0f0a-bf4b-4f004cca09f6"
          ]
        },
        {
          "uuid": "348d309a-b42c-d748-aeb5-5d11e1d0f087",
          "code": "44156",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:44156",
          "code_system": "CHEBI",
          "references": [
            "87d65d9e-88df-0f0a-bf4b-4f004cca09f6"
          ]
        },
        {
          "uuid": "595371b4-acb7-2863-a6a3-3118ecf7c6cc",
          "code": "terbutryn",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/terbutryn.html",
          "code_system": "ALANWOOD",
          "references": [
            "85f6e606-2924-5d22-db17-d3144b06b1db"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "de1b231b-41e4-4323-b4ad-7f9605adf92b",
          "type": "METABOLITE->PARENT",
          "references": [
            "5b76f2a9-b66f-436b-a6cd-0a6ab14198fa"
          ],
          "related_substance": {
            "uuid": "1f8ab50a-77c0-4cc0-9b2d-1a4cb41b3e22",
            "refuuid": "09999f4b-05bf-4b22-8f76-348bf0b84e97",
            "name": "GS-26575",
            "unii": "C8NP55C94V",
            "linking_id": "C8NP55C94V",
            "ref_pname": "GS-26575"
          }
        },
        {
          "uuid": "52797076-b74a-46ce-91de-b0204e4f7e06",
          "type": "METABOLITE->PARENT",
          "references": [
            "44cb9dc9-76dc-4157-be93-89b78dc5d846"
          ],
          "related_substance": {
            "uuid": "7acc726e-696b-4c1d-93f0-8bc3f77d5d3f",
            "refuuid": "01544731-d326-46ec-974f-1dd2e51c870b",
            "name": "TERBUTRYNESULFOXIDE",
            "unii": "GO7T1T347C",
            "linking_id": "GO7T1T347C",
            "ref_pname": "TERBUTRYNESULFOXIDE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f1c33b7f-e705-418a-95eb-c18b54cb2427",
          "name": "IGRAN",
          "stdName": "IGRAN",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5956c215-d50d-4313-9e37-af7a0369227c",
            "13931ae4-ec04-47ee-b26b-33cdecb708eb"
          ],
          "display_name": false
        },
        {
          "uuid": "69fc947c-279e-4f75-9da5-ed52d0f1020b",
          "name": "N(SUP 2)-TERT-BUTYL-N(SUP 4)-ETHYL-6-METHYLTHIO-1,3,5-TRIAZINE-2,4-DIAMINE",
          "stdName": "N(SUP 2)-TERT-BUTYL-N(SUP 4)-ETHYL-6-METHYLTHIO-1,3,5-TRIAZINE-2,4-DIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1a31bbe-74dd-4a21-92e5-714081593382",
            "8b86bb13-57e2-427b-b40e-fe4deebeb6b3"
          ],
          "display_name": false
        },
        {
          "uuid": "e4862632-a251-48e2-9397-3505aaee9c85",
          "name": "N-(1,1-DIMETHYLETHYL)-N'-ETHYL-6-(METHYLTHIO)-1,3,5-TRIAZINE-2,4-DIAMINE",
          "stdName": "N-(1,1-DIMETHYLETHYL)-N'-ETHYL-6-(METHYLTHIO)-1,3,5-TRIAZINE-2,4-DIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4272b261-71f8-4b9a-98ee-5797c96f81ed",
            "8b86bb13-57e2-427b-b40e-fe4deebeb6b3"
          ],
          "display_name": false
        },
        {
          "uuid": "47852f51-dc50-46c4-8be3-4dfa159e5a7e",
          "name": "TERBUTRYN",
          "stdName": "TERBUTRYN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b260484e-da8a-4c6a-9c58-9d9a1396228d",
            "8ef7ab46-d1d2-4268-a2e1-449b7c3e2f80",
            "5956c215-d50d-4313-9e37-af7a0369227c",
            "7ccac43b-9ed2-4426-bbb4-18046b275c74",
            "2368bf29-8693-4252-90cf-0a167f009d2d",
            "13931ae4-ec04-47ee-b26b-33cdecb708eb"
          ],
          "display_name": true
        },
        {
          "uuid": "56402797-974e-48bf-984e-3850448bf731",
          "name": "TERBUTRYN [HSDB]",
          "stdName": "TERBUTRYN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ef7ab46-d1d2-4268-a2e1-449b7c3e2f80",
            "13931ae4-ec04-47ee-b26b-33cdecb708eb"
          ],
          "display_name": false
        },
        {
          "uuid": "1a9f2753-90ab-4df5-989f-9231a3dbbe4b",
          "name": "TERBUTRYN [ISO]",
          "stdName": "TERBUTRYN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5956c215-d50d-4313-9e37-af7a0369227c",
            "13931ae4-ec04-47ee-b26b-33cdecb708eb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8b86bb13-57e2-427b-b40e-fe4deebeb6b3",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f1a31bbe-74dd-4a21-92e5-714081593382",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4272b261-71f8-4b9a-98ee-5797c96f81ed",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ccac43b-9ed2-4426-bbb4-18046b275c74",
          "citation": "ALANWOOD.NET 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ef7ab46-d1d2-4268-a2e1-449b7c3e2f80",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13931ae4-ec04-47ee-b26b-33cdecb708eb",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5956c215-d50d-4313-9e37-af7a0369227c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6c1c092-0ab9-4d58-81a8-43e9efed85f7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390983000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d989079-f340-42c5-9a13-48d314e4d1e6",
          "citation": "SRS import [ZXL474TLFP]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ZXL474TLFP",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390983000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f933ea43-dfb4-4445-9e64-f17be1643e55",
          "citation": "CHEMID  2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2368bf29-8693-4252-90cf-0a167f009d2d",
          "citation": "TERBUTRYN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b260484e-da8a-4c6a-9c58-9d9a1396228d",
          "citation": "TERBUTRYN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0ed02250-0171-3f56-ff6d-3baaf7090c88",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+886-50-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "24951ead-39e5-2a46-4aef-39c190d1bf2f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=886-50-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "44cb9dc9-76dc-4157-be93-89b78dc5d846",
          "citation": "Lang, Dieter, et al. \"In vitro metabolism of atrazine, terbuthylazine, ametryne, and terbutryne in rats, pigs, and humans.\" Drug Metabolism and Disposition 24.8 (1996): 859-865.",
          "url": "https://dmd.aspetjournals.org/content/dmd/24/8/859.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5b76f2a9-b66f-436b-a6cd-0a6ab14198fa",
          "citation": "Lang, Dieter, et al. \"In vitro metabolism of atrazine, terbuthylazine, ametryne, and terbutryne in rats, pigs, and humans.\" Drug Metabolism and Disposition 24.8 (1996): 859-865.",
          "url": "https://dmd.aspetjournals.org/content/dmd/24/8/859.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "85f6e606-2924-5d22-db17-d3144b06b1db",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "87d65d9e-88df-0f0a-bf4b-4f004cca09f6",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "f1b56e02-409a-4d6e-abe7-724e72f0b36d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "81058b18-0abf-4f92-a341-70b27975372f",
          "id": "81058b18-0abf-4f92-a341-70b27975372f",
          "molfile": "\n  Marvin  01132106422D          \n\n 16 16  0  0  0  0            999 V2000\n    9.5753   -5.8352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8614   -5.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1475   -5.8352    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4188   -5.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7049   -5.8352    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9864   -5.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2553   -5.8352    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2553   -6.6629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2553   -7.4898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0794   -6.6629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4320   -6.6629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9864   -4.5775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7049   -4.1678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7049   -3.3373    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9864   -2.9202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4188   -4.5775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 16  2  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  6 12  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 16  1  0  0  0  0\n 14 15  1  0  0  0  0\nM  END",
          "smiles": "CCNc1nc(nc(n1)SC)NC(C)(C)C",
          "formula": "C10H19N5S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b2236ea9-1ab1-4b41-a2d7-5e24266c1fcd"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "241.3578",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e044c24a-b6cc-4145-a6ec-9157709c3c49",
      "version": "9",
      "structure": {
        "id": "715a8c85-391c-48a2-9ab1-ba3599605a2b",
        "molfile": "\n  Marvin  01132105532D          \n\n 16 16  0  0  0  0            999 V2000\n    5.9864   -5.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7049   -5.8352    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4188   -5.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4188   -4.5775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7049   -4.1678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9864   -4.5775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7049   -3.3373    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9864   -2.9202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1475   -5.8352    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8614   -5.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5753   -5.8352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2553   -5.8352    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2553   -6.6629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2553   -7.4898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0794   -6.6629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4320   -6.6629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  3  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n  1 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\nM  END",
        "smiles": "CCNc1nc(nc(n1)SC)NC(C)(C)C",
        "formula": "C10H19N5S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "241.3578",
        "optical_activity": "NONE",
        "references": [
          "f933ea43-dfb4-4445-9e64-f17be1643e55",
          "1d989079-f340-42c5-9a13-48d314e4d1e6"
        ],
        "stereo_centers": 0
      },
      "unii": "ZXL474TLFP"
    }
  ]
}