{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8eb9d058-38ad-451a-8d18-8ea3401db6dd", "code": "17354-14-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=17354-14-2", "code_system": "CAS", "references": [ "1d5d8550-12fe-4f3e-b47c-6aa455fa197f", "ebddfc12-6314-4793-aad6-71a908544231" ] }, { "uuid": "a89cceb4-6b28-470e-9013-f27f2285f86b", "code": "241-379-4", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.037.602", "code_system": "ECHA (EC/EINECS)", "references": [ "1d5d8550-12fe-4f3e-b47c-6aa455fa197f" ] }, { "uuid": "4a608b76-9fbb-4621-81f1-2b57952a1232", "code": "3766139", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3766139", "code_system": "PUBCHEM", "references": [ "1d5d8550-12fe-4f3e-b47c-6aa455fa197f" ] }, { "uuid": "c590101c-7b32-48ae-a39f-c7987747ecac", "code": "12769-17-4", "type": "SUPERSEDED", "url": "https://commonchemistry.cas.org/detail?cas_rn=12769-17-4", "code_system": "CAS", "references": [ "ebddfc12-6314-4793-aad6-71a908544231" ] }, { "uuid": "71704b44-12e7-ae00-bb0f-20d5d285bb25", "code": "DTXSID5044605", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5044605", "code_system": "EPA CompTox", "references": [ "32bd1494-e76a-c3df-0a76-56e426a7223e" ] }, { "uuid": "62549a12-9a80-4b03-ac97-a13d44b1b647", "code": "ZVT4Q30OQY", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "dc13077c-f2df-88ec-dae4-f166512e3a6b", "code": "Oil Blue 35", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Oil_Blue_35", "code_system": "WIKIPEDIA", "references": [ "ba823b79-8877-94f4-7fe4-a8972e25511b" ] } ], "substance_class": "chemical", "names": [ { "uuid": "b7a863ff-7330-e402-742b-e390de5e0ca0", "name": "1,4-BIS(BUTYLAMINO)-9,10-ANTHRACENEDIONE", "stdName": "1,4-BIS(BUTYLAMINO)-9,10-ANTHRACENEDIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ebddfc12-6314-4793-aad6-71a908544231" ], "display_name": false }, { "uuid": "0717ffe8-f09d-9b4f-ca96-5d965dcb6f2c", "name": "1,4-BIS(BUTYLAMINO)ANTHRAQUINONE", "stdName": "1,4-BIS(BUTYLAMINO)ANTHRAQUINONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ebddfc12-6314-4793-aad6-71a908544231" ], "display_name": false }, { "uuid": "b12028e0-167a-42d7-8337-8a174be4fe5b", "name": "9,10-ANTHRACENEDIONE, 1,4-BIS(BUTYLAMINO)-", "stdName": "9,10-ANTHRACENEDIONE, 1,4-BIS(BUTYLAMINO)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ebddfc12-6314-4793-aad6-71a908544231" ], "display_name": false }, { "uuid": "13c3742a-7964-51a9-07fd-6ddc3a2cfc62", "name": "ANTHRAQUINONE, 1,4-BIS(BUTYLAMINO)-", "stdName": "ANTHRAQUINONE, 1,4-BIS(BUTYLAMINO)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ebddfc12-6314-4793-aad6-71a908544231" ], "display_name": false }, { "uuid": "b0300bf5-668b-e0bf-09ed-0337632e4795", "name": "C.I. 61554", "stdName": "C.I. 61554", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ebddfc12-6314-4793-aad6-71a908544231" ], "display_name": false }, { "uuid": "2d3dcd62-b631-4afd-b90f-23e2803fbb77", "name": "C.I. SOLVENT BLUE 35", "stdName": "C.I. SOLVENT BLUE 35", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "107c19d8-ced7-4528-9516-8b0d1f89ed3c" ], "display_name": false }, { "uuid": "458a78ec-06b8-b384-2c16-5baffb69b4bf", "name": "CI 61554", "stdName": "CI 61554", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ebddfc12-6314-4793-aad6-71a908544231" ], "display_name": false }, { "uuid": "7236c2ff-f483-6ad9-aba5-4ec588991f5d", "name": "SOLVENT BLUE 35", "stdName": "SOLVENT BLUE 35", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "58a7a428-c488-1fb4-468f-76afa5df299e" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "35b6a8fb-0597-450d-ba83-84da185236f2", "name_org": "INCI" } ] } ], "references": [ { "uuid": "107c19d8-ced7-4528-9516-8b0d1f89ed3c", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1d5d8550-12fe-4f3e-b47c-6aa455fa197f", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392160000, "tags": [ "NOMEN" ] }, { "uuid": "32bd1494-e76a-c3df-0a76-56e426a7223e", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=17354-14-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "58a7a428-c488-1fb4-468f-76afa5df299e", "citation": "PCPC", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ebddfc12-6314-4793-aad6-71a908544231", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ba823b79-8877-94f4-7fe4-a8972e25511b", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "fd610d8b-b476-4ace-aea1-f4317e5d6605", "id": "fd610d8b-b476-4ace-aea1-f4317e5d6605", "molfile": "\n Marvin 01132113072D \n\n 26 28 0 0 0 0 999 V2000\n 6.4258 -0.4576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7104 -0.0194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9950 -0.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3053 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5835 -0.4061 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5835 -1.2310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3182 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3182 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5835 -2.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5835 -3.7124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3053 -4.1184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9950 -3.6931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7297 -4.0862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4451 -3.6737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8745 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1591 -2.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1591 -3.7124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4308 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7283 -2.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7283 -1.2310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4308 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1591 -1.2310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1591 -0.4061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8745 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 26 6 2 0 0 0 0\n 7 8 2 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 15 9 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 26 15 1 0 0 0 0\n 16 17 2 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 23 2 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 22 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 24 25 2 0 0 0 0\n 26 24 1 0 0 0 0\nM END", "smiles": "CCCCNc1ccc(c2c1C(=O)c3ccccc3C2=O)NCCCC", "formula": "C22H26N2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "dd0928b5-dd90-4a12-b172-707ff9cee8a8" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "350.4549", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "654b8c08-a694-419c-9a4e-7666f08843c7", "version": "7", "structure": { "id": "2dc32c59-77ee-4f85-a918-bd7b236dc1bf", "molfile": "\n Marvin 01132102282D \n\n 26 28 0 0 0 0 999 V2000\n 2.8745 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8745 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1591 -1.2310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1591 -2.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4308 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4308 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5835 -2.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5835 -1.2310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1591 -0.4061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1591 -3.7124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3182 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3182 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5835 -3.7124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5835 -0.4061 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7283 -1.2310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7283 -2.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3053 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3053 -4.1184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9950 -0.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9950 -3.6931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7104 -0.0194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7297 -4.0862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4258 -0.4576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4451 -3.6737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 3 1 0 0 0 0\n 1 8 1 0 0 0 0\n 2 4 1 0 0 0 0\n 2 7 1 0 0 0 0\n 3 6 1 0 0 0 0\n 3 9 2 0 0 0 0\n 4 10 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 16 1 0 0 0 0\n 6 15 1 0 0 0 0\n 7 13 1 0 0 0 0\n 7 12 2 0 0 0 0\n 8 11 2 0 0 0 0\n 8 14 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 18 1 0 0 0 0\n 14 17 1 0 0 0 0\n 15 24 2 0 0 0 0\n 16 23 2 0 0 0 0\n 17 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 20 22 1 0 0 0 0\n 21 25 1 0 0 0 0\n 22 26 1 0 0 0 0\n 23 24 1 0 0 0 0\nM END", "smiles": "CCCCNc1ccc(c2c1C(=O)c3ccccc3C2=O)NCCCC", "formula": "C22H26N2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "350.4549", "optical_activity": "NONE", "references": [ "107c19d8-ced7-4528-9516-8b0d1f89ed3c", "58a7a428-c488-1fb4-468f-76afa5df299e" ], "stereo_centers": 0 }, "unii": "ZVT4Q30OQY" } ] }