{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "76836097-4521-47fd-b074-a904d1f64775",
          "code": "38697-94-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=38697-94-8",
          "code_system": "CAS",
          "references": [
            "ad0c98f4-c3da-4341-a2bf-bf8659fc48f1",
            "69357119-a93f-4d03-afde-bd064b846363"
          ]
        },
        {
          "uuid": "d8e8cc41-50df-411d-aba8-8fb13512d25c",
          "code": "1314856",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1314856/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "ad0c98f4-c3da-4341-a2bf-bf8659fc48f1"
          ]
        },
        {
          "uuid": "25b8e364-a066-4b62-a442-629bd843efea",
          "code": "44155820",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44155820",
          "code_system": "PUBCHEM",
          "references": [
            "ad0c98f4-c3da-4341-a2bf-bf8659fc48f1"
          ]
        },
        {
          "uuid": "0e55eac4-f26a-401b-b332-f8cbae16c828",
          "code": "ZV6O50F5CP",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "dcef0c5b-bb9a-a0ed-28a8-5e07dd647cae",
          "code": "ZV6O50F5CP",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=ZV6O50F5CP",
          "code_system": "DAILYMED",
          "references": [
            "1f12dadb-f465-f1d5-2890-81edb5762eb3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "03bab468-d332-4524-9a32-4b1e20845aa9",
          "name": "CYCLOHEXANECARBOXAMIDE, 4-(AMINOMETHYL)-N-METHYL-, HYDROCHLORIDE (1:1), TRANS-",
          "stdName": "CYCLOHEXANECARBOXAMIDE, 4-(AMINOMETHYL)-N-METHYL-, HYDROCHLORIDE (1:1), TRANS-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57e886d7-ce41-4978-86e9-30416b376af9",
            "4de1431c-7c53-486f-a810-b0943596fc90"
          ],
          "display_name": false
        },
        {
          "uuid": "7461ab1e-de21-4d54-92f2-17c348955380",
          "name": "CYCLOHEXANECARBOXAMIDE, 4-(AMINOMETHYL)-N-METHYL-, MONOHYDROCHLORIDE, TRANS-",
          "stdName": "CYCLOHEXANECARBOXAMIDE, 4-(AMINOMETHYL)-N-METHYL-, MONOHYDROCHLORIDE, TRANS-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57e886d7-ce41-4978-86e9-30416b376af9",
            "4de1431c-7c53-486f-a810-b0943596fc90"
          ],
          "display_name": false
        },
        {
          "uuid": "da276331-f9f3-410f-8571-b2450bfb8d7e",
          "name": "MAKS",
          "stdName": "MAKS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a964edeb-e213-4cde-a7eb-51350fb62579",
            "57e886d7-ce41-4978-86e9-30416b376af9"
          ],
          "display_name": false
        },
        {
          "uuid": "54989ba4-f6d1-40cd-b1b3-a67a739a0942",
          "name": "METHYL AMINOMETHYLCYCLOHEXANE CARBOXAMIDE HCL",
          "stdName": "METHYL AMINOMETHYLCYCLOHEXANE CARBOXAMIDE HCL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "a964edeb-e213-4cde-a7eb-51350fb62579",
            "57e886d7-ce41-4978-86e9-30416b376af9",
            "630147bb-7350-4dda-836f-78e3555bc01c"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "92fbfc30-2b9d-4a49-a7b8-e4ce8862ca2b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "76116776-d32f-434f-bfd0-ebb49a7147e5",
          "name": "METHYL AMINOMETHYLCYCLOHEXANE CARBOXAMIDE HYDROCHLORIDE",
          "stdName": "METHYL AMINOMETHYLCYCLOHEXANE CARBOXAMIDE HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a964edeb-e213-4cde-a7eb-51350fb62579",
            "57e886d7-ce41-4978-86e9-30416b376af9"
          ],
          "display_name": true
        },
        {
          "uuid": "15c8e34d-38ed-4573-9744-0f574cb6d289",
          "name": "SEBLAEN",
          "stdName": "SEBLAEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57e886d7-ce41-4978-86e9-30416b376af9",
            "4de1431c-7c53-486f-a810-b0943596fc90"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a964edeb-e213-4cde-a7eb-51350fb62579",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "57e886d7-ce41-4978-86e9-30416b376af9",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4de1431c-7c53-486f-a810-b0943596fc90",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad0c98f4-c3da-4341-a2bf-bf8659fc48f1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391527000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6679f03-8054-4807-b9ea-ac84f4a3de1a",
          "citation": "SRS import [ZV6O50F5CP]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ZV6O50F5CP",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391527000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "630147bb-7350-4dda-836f-78e3555bc01c",
          "citation": "METHYL AMINOMETHYLCYCLOHEXANE CARBOXAMIDE HCL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "69357119-a93f-4d03-afde-bd064b846363",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1f12dadb-f465-f1d5-2890-81edb5762eb3",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "19cbd7d6-70ce-4a04-af11-6e8f933fccd5",
          "id": "19cbd7d6-70ce-4a04-af11-6e8f933fccd5",
          "molfile": "\n  Marvin  01132101312D          \n\n  1  0  0  0  1  0            999 V2000\n   10.1719   -6.4830    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4c405d29-d9d2-4ab6-8a8e-fc3859dd5687"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "1163d136-31d0-4393-bca1-28321f07ee96",
          "id": "1163d136-31d0-4393-bca1-28321f07ee96",
          "molfile": "\n  Marvin  01132101072D          \n\n 12 12  0  0  1  0            999 V2000\n   10.7219   -3.5910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0074   -4.0035    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0074   -4.8285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7219   -5.2410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2929   -5.2410    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.2929   -6.0660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5785   -6.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8640   -6.0660    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.1496   -6.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1496   -7.3035    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8640   -5.2410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5785   -4.8285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  1  0  0  0\n  6  5  1  0  0  0  0\n  5 12  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  6  0  0  0\n 11  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 12  1  0  0  0  0\nM  END",
          "smiles": "CNC(=O)[C@H]1CC[C@@H](CC1)CN",
          "formula": "C9H18N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "149335ab-7996-411f-b9d8-b64e12735df6"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "170.2524",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9543ab78-437c-4c37-ae4b-10b0e4b2c617",
      "version": "5",
      "structure": {
        "id": "5aa5b3d1-b987-4eee-997d-ae6176c2d7d2",
        "molfile": "\n  Marvin  01132104422D          \n\n 13 12  0  0  1  0            999 V2000\n   10.1719   -6.4830    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.8640   -5.2410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5785   -4.8285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2929   -5.2410    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.2929   -6.0660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5785   -6.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8640   -6.0660    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.1496   -6.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0074   -4.8285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0074   -4.0035    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7219   -3.5910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1496   -7.3035    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7219   -5.2410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  6  0  0  0\n  4  9  1  1  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n  8 12  1  0  0  0  0\n  9 13  2  0  0  0  0\nM  END",
        "smiles": "CNC(=O)[C@H]1CC[C@@H](CC1)CN.Cl",
        "formula": "C9H18N2O.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "206.7132",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "a6679f03-8054-4807-b9ea-ac84f4a3de1a",
          "4de1431c-7c53-486f-a810-b0943596fc90"
        ],
        "stereo_centers": 2
      },
      "unii": "ZV6O50F5CP"
    }
  ]
}