{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "31f8a182-d324-1d50-3218-f61b054c9597",
          "code": "DTXSID60849619",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60849619",
          "code_system": "EPA CompTox",
          "references": [
            "28ac5357-3cbb-074b-310a-c26efcfe8630"
          ]
        },
        {
          "uuid": "cd7cbb24-ab98-f027-4c32-e5d8ba533ba3",
          "code": "131853786",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/131853786",
          "code_system": "PUBCHEM",
          "references": [
            "67084138-926b-636e-efa2-d999df11534d"
          ]
        },
        {
          "uuid": "2fce4877-6aa7-45b0-b902-21be2f7bc9d4",
          "code": "ZV2N527BBJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "265a25c3-182a-44bc-8037-b21f9cdcda32",
          "code": "41312-47-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=41312-47-4",
          "code_system": "CAS"
        }
      ],
      "relationships": [
        {
          "uuid": "0d3782de-b31b-4b72-9c20-3081129177fc",
          "amount": {
            "uuid": "3795d8cb-252d-43c6-83cb-4a11be4e0457"
          },
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "696385c6-ce37-4a67-8ea8-76a3ab00e19c"
          ],
          "related_substance": {
            "uuid": "013d4fd8-8be4-4688-a5d9-9ddbb24d1f0d",
            "refuuid": "27e0342b-6aff-4f50-a0c4-20d774b4a7c3",
            "name": "HUMAN MILK OLIGOSACCHARIDES",
            "unii": "5M7GRZ07LW",
            "linking_id": "5M7GRZ07LW",
            "ref_pname": "HUMAN MILK OLIGOSACCHARIDES",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6fa22144-a47a-44e1-b5ad-d2c9cd2a9b63",
          "name": "3-O-α-L-Fucopyranosyllactose",
          "stdName": "3-O-.ALPHA.-L-FUCOPYRANOSYLLACTOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67c10e93-ca53-4362-a3bc-d497fa9ebbba"
          ],
          "display_name": true
        },
        {
          "uuid": "3a2f7024-4389-4af9-b4ca-ddaa2d7ff628",
          "name": "3-O-α-L-Fucosyllactose",
          "stdName": "3-O-.ALPHA.-L-FUCOSYLLACTOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67c10e93-ca53-4362-a3bc-d497fa9ebbba",
            "71fd953d-ba4c-4d85-9d80-73c69c876997"
          ],
          "display_name": false
        },
        {
          "uuid": "00c558a8-03cc-4a5d-81d8-2a7f6f21e338",
          "name": "D-Glucose, O-6-deoxy-α-L-galactopyranosyl-(1→3)-O-[β-D-galactopyranosyl-(1→4)]-",
          "stdName": "D-GLUCOSE, O-6-DEOXY-.ALPHA.-L-GALACTOPYRANOSYL-(1->3)-O-(.BETA.-D-GALACTOPYRANOSYL-(1->4))-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67c10e93-ca53-4362-a3bc-d497fa9ebbba"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "696385c6-ce37-4a67-8ea8-76a3ab00e19c",
          "citation": "Zhang, Wenyuan, et al. \"Comparison of twelve human milk oligosaccharides in mature milk from different areas in China in the Chinese Human Milk Project (CHMP) study.\" Food Chemistry 395 (2022): 133554.",
          "url": "https://www.sciencedirect.com/science/article/pii/S0308814622015163",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "67084138-926b-636e-efa2-d999df11534d",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "71fd953d-ba4c-4d85-9d80-73c69c876997",
          "citation": "Zhang, Wenyuan, et al. \"Comparison of twelve human milk oligosaccharides in mature milk from different areas in China in the Chinese Human Milk Project (CHMP) study.\" Food Chemistry 395 (2022): 133554.",
          "url": "https://www.sciencedirect.com/science/article/pii/S0308814622015163",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "67c10e93-ca53-4362-a3bc-d497fa9ebbba",
          "citation": "stn",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "28ac5357-3cbb-074b-310a-c26efcfe8630",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "11ed914e-2ade-99db-e31d-6e807eea09ed",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "99ba5b65-e1eb-49dc-8d07-5386ed7bc961",
          "id": "99ba5b65-e1eb-49dc-8d07-5386ed7bc961",
          "molfile": "\n  Marvin  01042317272D          \n\n 35 36  0  0  1  0            999 V2000\n    5.3324   -6.4189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3324   -4.7689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3324   -3.9439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9035   -7.2439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4745   -6.4189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7614   -7.2439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4745   -4.7689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1903   -6.4189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7614   -3.9439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4759   -3.5314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1903   -4.7689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1312   -9.2538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4461  -10.2506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1725   -7.9731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9668   -9.6102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6179   -6.0064    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.6179   -5.1814    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.9035   -6.4189    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.9035   -4.7689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1890   -6.0064    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.1890   -5.1814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0469   -6.0064    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.7614   -6.4189    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.0469   -5.1814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4759   -6.0064    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.7614   -4.7689    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.4759   -5.1814    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.9944   -8.1151    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.8915   -8.9336    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.7547   -7.7949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5490   -9.4321    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.4122   -8.2933    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.3093   -9.1119    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.0469   -6.8314    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2341   -8.4353    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n 16  1  1  1  0  0  0\n 22  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 17  2  1  6  0  0  0\n 18  4  1  6  0  0  0\n 28  4  1  0  0  0  0\n 20  5  1  1  0  0  0\n 23  6  1  1  0  0  0\n  7 21  2  0  0  0  0\n 25  8  1  6  0  0  0\n  9 10  1  0  0  0  0\n 26  9  1  6  0  0  0\n 27 11  1  6  0  0  0\n 29 12  1  6  0  0  0\n 31 13  1  1  0  0  0\n 32 14  1  1  0  0  0\n 33 15  1  1  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 22 34  1  1  0  0  0\n 23 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 26 27  1  0  0  0  0\n 28 29  1  0  0  0  0\n 28 30  1  0  0  0  0\n 28 35  1  1  0  0  0\n 29 31  1  0  0  0  0\n 30 32  1  0  0  0  0\n 31 33  1  0  0  0  0\n 32 33  1  0  0  0  0\nM  END",
          "smiles": "C[C@H]1[C@H]([C@H]([C@@H]([C@@]([H])(O1)O[C@H]([C@H](C=O)O)[C@@H]([C@@H](CO)O)O[C@@]2([H])[C@@H]([C@H]([C@H]([C@@H](CO)O2)O)O)O)O)O)O",
          "formula": "C18H32O15",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7fc368a8-b0c5-43f0-a6d7-bed34496a351"
          },
          "defined_stereo": 14,
          "ez_centers": 0,
          "molecular_weight": "488.4384",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 14
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "756707c8-c1f9-41e5-8f48-2756c85a92f5",
      "version": "7",
      "structure": {
        "id": "58f138e0-44a8-416b-be63-7b97a66e17d0",
        "molfile": "O-6-Deoxy-?-L-galactopyranosyl-(1?3)-O-?-D-galactopyranosyl-(1?4)-D-glucopyra...\n   JSDraw201042317272D\n\n 35 36  0  0  1  0              0 V2000\n   25.2618   -7.0200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2618   -3.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2618   -2.3400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5599   -8.5800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8578   -7.0200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9639   -8.5800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8578   -3.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   30.6658   -7.0200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9639   -2.3400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.3149   -1.5600    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   30.6658   -3.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.0995  -12.3806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5858  -14.2654    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.8504   -9.9589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.4613  -13.0546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9108   -6.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9108   -4.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5599   -7.0200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5599   -3.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2088   -6.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2088   -4.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6128   -6.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9639   -7.0200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6128   -4.6800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.3149   -6.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9639   -3.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.3149   -4.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.7318  -10.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5372  -11.7752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1695   -9.6219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7804  -12.7177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.4127  -10.5643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2181  -12.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6128   -7.8000    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2940  -10.8328    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n 16  1  1  1  0  0  0\n 22  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 17  2  1  6  0  0  0\n 18  4  1  6  0  0  0\n 20  5  1  1  0  0  0\n 23  6  1  1  0  0  0\n  7 21  2  0  0  0  0\n 25  8  1  6  0  0  0\n  9 10  1  0  0  0  0\n 26  9  1  6  0  0  0\n 27 11  1  6  0  0  0\n 29 12  1  6  0  0  0\n 31 13  1  1  0  0  0\n 32 14  1  1  0  0  0\n 33 15  1  1  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 23 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 26 27  1  0  0  0  0\n 28 29  1  0  0  0  0\n 28 30  1  0  0  0  0\n 29 31  1  0  0  0  0\n 30 32  1  0  0  0  0\n 31 33  1  0  0  0  0\n 32 33  1  0  0  0  0\n 22 34  1  1  0  0  0\n 28 35  1  1  0  0  0\n 28  4  1  0  0  0  0\nM  END",
        "smiles": "C[C@H]1[C@H]([C@H]([C@@H]([C@@]([H])(O1)O[C@H]([C@H](C=O)O)[C@@H]([C@@H](CO)O)O[C@@]2([H])[C@@H]([C@H]([C@H]([C@@H](CO)O2)O)O)O)O)O)O",
        "formula": "C18H32O15",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 14,
        "ez_centers": 0,
        "molecular_weight": "488.4384",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "67c10e93-ca53-4362-a3bc-d497fa9ebbba",
          "71fd953d-ba4c-4d85-9d80-73c69c876997"
        ],
        "stereo_centers": 14
      },
      "unii": "ZV2N527BBJ"
    }
  ]
}