{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0000d3e1-c842-412b-99b0-6cc4d98e4c97",
          "code": "4075-07-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4075-07-4",
          "code_system": "CAS",
          "references": [
            "98baa6ca-f874-4e5c-a7a2-5b504f56fc29",
            "230bd67e-b59b-4287-ba97-8827d3bd3888"
          ]
        },
        {
          "uuid": "d38e4f7d-48cb-492c-af7e-b18925f7d0e4",
          "code": "ANDROSTADIENONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Androstadienone",
          "code_system": "WIKIPEDIA",
          "references": [
            "98baa6ca-f874-4e5c-a7a2-5b504f56fc29"
          ]
        },
        {
          "uuid": "d874e6a4-4d90-4579-8527-3537a8c7d9a9",
          "code": "92979",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/92979",
          "code_system": "PUBCHEM",
          "references": [
            "98baa6ca-f874-4e5c-a7a2-5b504f56fc29"
          ]
        },
        {
          "uuid": "58657965-6543-4008-83f6-afc708185efb",
          "code": "ZUZ4FHD36E",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6fd4e42b-774a-b864-7529-90ab865c2ada",
          "code": "93234",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=93234",
          "code_system": "NSC",
          "references": [
            "178f210f-2853-2c1e-0a37-9ff534b226ce"
          ]
        },
        {
          "uuid": "44233409-a995-e449-f1d9-270504be1918",
          "code": "DTXSID00863314",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00863314",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "21740268-c3d9-4cc3-acfb-db439fddcc73",
          "name": "(+)-ANDROSTADIENONE",
          "stdName": "(+)-ANDROSTADIENONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3365a12-e689-42bb-8491-dcaf195eb203"
          ],
          "display_name": false
        },
        {
          "uuid": "55349dd0-13ce-4c6a-8ee3-f4acac99afd4",
          "name": ".DELTA.4,16-ANDROSTADIEN-3-ONE",
          "stdName": ".DELTA.4,16-ANDROSTADIEN-3-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff744d79-c9be-427f-9f95-f78121f3b01c"
          ],
          "display_name": false
        },
        {
          "uuid": "aa7bb761-f239-45bf-a4b3-5afd9fea10bc",
          "name": "4,16-ANDROSTADIEN-3-ONE",
          "stdName": "4,16-ANDROSTADIEN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff744d79-c9be-427f-9f95-f78121f3b01c"
          ],
          "display_name": false
        },
        {
          "uuid": "c3704469-960d-4ec5-9af9-73b2390bf3d2",
          "name": "ANDROSTA-4,16-DIEN-3-ONE",
          "stdName": "ANDROSTA-4,16-DIEN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff744d79-c9be-427f-9f95-f78121f3b01c"
          ],
          "display_name": false
        },
        {
          "uuid": "0419b2d7-bb44-4508-93ae-6801f6dfc7e5",
          "name": "ANDROSTADIENONE",
          "stdName": "ANDROSTADIENONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5af49c1-e874-4562-8a9f-38c69c361882",
            "eda2f516-ef90-4e18-9060-cd771db5a901"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "1fd804a2-1c98-4500-bab1-cc1497583c2c",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "41e823cf-57d7-4974-9e1e-fc13decd9fcb",
          "name": "NSC-93234",
          "stdName": "NSC-93234",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff744d79-c9be-427f-9f95-f78121f3b01c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e3365a12-e689-42bb-8491-dcaf195eb203",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "eda2f516-ef90-4e18-9060-cd771db5a901",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff744d79-c9be-427f-9f95-f78121f3b01c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98baa6ca-f874-4e5c-a7a2-5b504f56fc29",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391097000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81f8dfac-8d10-41a0-8223-585eab4f56b4",
          "citation": "SRS import [ZUZ4FHD36E]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ZUZ4FHD36E",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391097000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a5af49c1-e874-4562-8a9f-38c69c361882",
          "citation": "ANDROSTADIENONE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "230bd67e-b59b-4287-ba97-8827d3bd3888",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "178f210f-2853-2c1e-0a37-9ff534b226ce",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "27f85210-2ccf-12f5-ec5d-b0886e096052",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a381746c-8527-498d-8e19-dd9fa4daea44",
          "id": "a381746c-8527-498d-8e19-dd9fa4daea44",
          "molfile": "\n  Marvin  01132108302D          \n\n 20 23  0  0  1  0            999 V2000\n    7.9116   -4.5685    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.7087   -4.8159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1759   -4.1562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7087   -3.4692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9116   -3.7440    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.9116   -2.9194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1970   -3.3317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4824   -3.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4824   -4.5685    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.1970   -4.9808    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.1970   -5.8054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4824   -6.2177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7678   -5.8054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0531   -6.2177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3385   -5.8054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6239   -6.2177    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3385   -4.9808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0531   -4.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7678   -4.9808    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.7678   -4.1562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  5  1  0  0  0  0\n 10  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  1  0  0  0\n 10  9  1  0  0  0  0\n  9 19  1  0  0  0  0\n 10 11  1  6  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 19 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  1  0  0  0\nM  END",
          "smiles": "C[C@]12C=CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC1",
          "formula": "C19H26O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "29244fb7-1574-4b75-9459-5fe07360f73a"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "270.4098",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "09b3f753-67d4-4fa9-a64f-3c6150091c38",
      "version": "8",
      "structure": {
        "id": "2751c6ca-2e32-4e65-98f0-587fbc4b9c8f",
        "molfile": "\n  Marvin  01132102102D          \n\n 23 26  0  0  1  0            999 V2000\n    4.3385   -5.8054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3385   -4.9808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0531   -4.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7678   -4.9808    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.4824   -4.5685    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4824   -3.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1970   -3.3317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9116   -3.7440    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.7087   -3.4692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1759   -4.1562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7087   -4.8159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9116   -4.5685    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.1970   -4.9808    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.1970   -5.8054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4824   -6.2177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7678   -5.8054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0531   -6.2177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1970   -4.1562    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9116   -5.3931    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9116   -2.9194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4824   -5.3931    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7678   -4.1562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6239   -6.2177    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12  8  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13  5  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16  4  1  0  0  0  0\n  1 17  1  0  0  0  0\n 17 16  2  0  0  0  0\n 13 18  1  1  0  0  0\n 12 19  1  6  0  0  0\n  8 20  1  1  0  0  0\n  5 21  1  6  0  0  0\n  4 22  1  1  0  0  0\n  1 23  2  0  0  0  0\nM  END",
        "smiles": "C[C@]12C=CC[C@@]2([H])[C@]3([H])CCC4=CC(=O)CC[C@]4(C)[C@@]3([H])CC1",
        "formula": "C19H26O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "270.4098",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ff744d79-c9be-427f-9f95-f78121f3b01c",
          "81f8dfac-8d10-41a0-8223-585eab4f56b4"
        ],
        "stereo_centers": 5
      },
      "unii": "ZUZ4FHD36E"
    }
  ]
}