{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "52c9f52c-2a52-43fe-b403-e90ba8ceeaf5", "code": "Dieckol", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Dieckol", "code_system": "WIKIPEDIA", "references": [ "0cb7a5fa-1542-2701-3a79-98a68f889a07" ] }, { "uuid": "41404b8d-d27a-41e4-8374-17c59a292024", "code": "88095-77-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=88095-77-6", "code_system": "CAS", "references": [ "75e490ca-7e45-632a-a306-f075001be95b" ] }, { "uuid": "4e950691-92ea-af37-659c-661323cf00db", "code": "3008868", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3008868", "code_system": "PUBCHEM", "references": [ "ad71a9de-53ad-aa4a-a385-6d129ea57d35" ] }, { "uuid": "928b20d9-0da7-4f93-9cbe-2c34beac42f5", "code": "ZU0ESU4399", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "854efb70-9ba7-50dd-b438-7a0e75c59e0f", "code": "DTXSID10388366", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10388366", "code_system": "EPA CompTox" } ], "relationships": [ { "uuid": "3e85472f-ecd6-4918-807d-9d7f31f2bab1", "type": "PARENT->CONSTITUENT ALWAYS PRESENT", "references": [ "2989c6ab-cec3-4690-9a78-43a343206e6a" ], "related_substance": { "uuid": "6126859c-1f44-430f-b0dc-6c3cc9ef381b", "refuuid": "0b00c31c-efb9-419a-a420-1bf9f0f96120", "name": "ECKLONIA CAVA", "unii": "UXX2N5V39P", "linking_id": "UXX2N5V39P", "ref_pname": "ECKLONIA CAVA", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "c8c98685-6d35-f6ff-e3ed-21826fc45ff5", "name": "4-(4-((6-(3,5-DIHYDROXYPHENOXY)-4,7,9-TRIHYDROXYDIBENZO(B,E)(1,4)DIOXIN-2-YL)OXY)-3,5-DIHYDROXYPHENOXY)DIBENZO(B,E)(1,4)DIOXIN-1,3,6,8-TETROL", "stdName": "4-(4-((6-(3,5-DIHYDROXYPHENOXY)-4,7,9-TRIHYDROXYDIBENZO(B,E)(1,4)DIOXIN-2-YL)OXY)-3,5-DIHYDROXYPHENOXY)DIBENZO(B,E)(1,4)DIOXIN-1,3,6,8-TETROL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "75e490ca-7e45-632a-a306-f075001be95b" ], "display_name": false }, { "uuid": "84268bf0-4b89-a93a-ec46-5b00890733ec", "name": "8,4'''-DIECKOL", "stdName": "8,4'''-DIECKOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "75e490ca-7e45-632a-a306-f075001be95b" ], "display_name": false }, { "uuid": "6084e24c-5bef-6d04-2293-2b437352c07f", "name": "DIBENZO(B,E)(1,4)DIOXIN-1,3,6,8-TETROL, 4-(4-((6-(3,5-DIHYDROXYPHENOXY)-4,7,9-TRIHYDROXYDIBENZO(B,E)(1,4)DIOXIN-2-YL)OXY)-3,5-DIHYDROXYPHENOXY)-", "stdName": "DIBENZO(B,E)(1,4)DIOXIN-1,3,6,8-TETROL, 4-(4-((6-(3,5-DIHYDROXYPHENOXY)-4,7,9-TRIHYDROXYDIBENZO(B,E)(1,4)DIOXIN-2-YL)OXY)-3,5-DIHYDROXYPHENOXY)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "75e490ca-7e45-632a-a306-f075001be95b" ], "display_name": false }, { "uuid": "89ee1b34-44ec-5d6e-493a-1b17146f6906", "name": "DIECKOL", "stdName": "DIECKOL", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "dad5b4bb-10cf-05be-c7ab-fc06cae0b6d2" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "4fed8a23-9008-422f-a847-98533bd950e6", "name_org": "INCI" } ] } ], "references": [ { "uuid": "0cb7a5fa-1542-2701-3a79-98a68f889a07", "citation": "Dieckol", "url": "https://en.wikipedia.org/wiki/Dieckol", "doc_type": "WIKI", "public_domain": true }, { "uuid": "dad5b4bb-10cf-05be-c7ab-fc06cae0b6d2", "citation": "Isaza Martínez, José Hipólito, and Harlen Gerardo Torres Castañeda. \"Preparation and chromatographic analysis of phlorotannins.\" Journal of chromatographic science 51.8 (2013): 825-838.", "url": "https://academic.oup.com/chromsci/article/51/8/825/322292", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "75e490ca-7e45-632a-a306-f075001be95b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "d8ec54b0-872b-4cd2-abf3-04d5da5ecdda", "citation": "Li, Yong, et al. \"Chemical components and its antioxidant properties in vitro: an edible marine brown alga, Ecklonia cava.\" Bioorganic & Medicinal Chemistry 17.5 (2009): 1963-1973.", "url": "https://www.sciencedirect.com/science/article/pii/S0968089609000613", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ad71a9de-53ad-aa4a-a385-6d129ea57d35", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "2989c6ab-cec3-4690-9a78-43a343206e6a", "citation": "Li, Yong, et al. \"Chemical components and its antioxidant properties in vitro: an edible marine brown alga, Ecklonia cava.\" Bioorganic & Medicinal Chemistry 17.5 (2009): 1963-1973.", "url": "https://www.sciencedirect.com/science/article/pii/S0968089609000613", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "72936b90-e5f4-a7a0-8b20-2e766a03a34a", "id": "72936b90-e5f4-a7a0-8b20-2e766a03a34a", "molfile": "\n Marvin 01132105562D \n\n 54 61 0 0 0 0 999 V2000\n 33.4618 -3.8052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.7723 -3.4155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.7723 -2.6211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0528 -2.1788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0378 -1.3319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3353 -2.5802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3107 -3.4230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5987 -3.8052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6062 -4.6671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3632 -5.0643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0378 -4.6297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3332 -5.8888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6587 -6.2935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5987 -7.1031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9242 -5.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1747 -6.2786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4851 -5.8813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8256 -6.2786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0386 -5.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.3266 -6.2786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.3191 -7.2454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0161 -7.6426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7357 -7.2080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0461 -8.4371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2818 -8.8662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.3116 -9.6813 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0386 -10.1160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7656 -9.7038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7357 -8.8569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4851 -10.1460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4402 -10.9704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1597 -11.3302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7656 -11.3526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7357 -12.1697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0536 -12.5968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0461 -13.4138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.3416 -13.8485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.3116 -14.6430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6071 -13.3838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.5996 -12.5744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.8876 -12.1697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.3116 -12.1996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.3116 -11.3452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0386 -10.9629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6370 -8.4671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6071 -7.6426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.8876 -7.2080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0761 -5.0494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7581 -4.6671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7506 -3.8052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5076 -5.0568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1747 -4.6297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9242 -5.0643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0828 -3.8202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 54 2 2 0 0 0 0\n 4 3 2 0 0 0 0\n 4 5 1 0 0 0 0\n 4 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 7 54 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 53 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 10 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 53 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 51 17 2 0 0 0 0\n 19 18 2 0 0 0 0\n 19 20 1 0 0 0 0\n 19 48 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 46 2 0 0 0 0\n 22 23 1 0 0 0 0\n 24 22 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 45 2 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 27 44 2 0 0 0 0\n 28 29 1 0 0 0 0\n 28 30 2 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 31 2 0 0 0 0\n 34 33 1 0 0 0 0\n 44 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 35 42 2 0 0 0 0\n 37 36 2 0 0 0 0\n 37 38 1 0 0 0 0\n 37 39 1 0 0 0 0\n 39 40 2 0 0 0 0\n 40 41 1 0 0 0 0\n 40 42 1 0 0 0 0\n 43 42 1 0 0 0 0\n 44 43 1 0 0 0 0\n 46 45 1 0 0 0 0\n 46 47 1 0 0 0 0\n 49 48 2 0 0 0 0\n 49 50 1 0 0 0 0\n 49 51 1 0 0 0 0\n 52 51 1 0 0 0 0\n 53 52 1 0 0 0 0\nM END", "smiles": "c1c(cc(cc1O)Oc2c(cc(c3c2Oc4c(cc(cc4O3)Oc5c(cc(cc5O)Oc6c(cc(c7c6Oc8c(cc(cc8O7)O)O)O)O)O)O)O)O)O", "formula": "C36H22O18", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "35a265cb-6f3a-4a30-9006-88ae299b10bc" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "742.5505", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "7d86aa73-c2c4-400e-952c-9dde81d3b907", "version": "14", "structure": { "id": "2fcc1a5e-49d1-c4bb-975b-1ae0ae89f7aa", "molfile": "\n Marvin 01132102342D \n\n 54 61 0 0 0 0 999 V2000\n 30.9590 -1.6721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2414 -2.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2168 -2.9164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.9891 -3.3136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5048 -3.2987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5123 -4.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8301 -4.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2393 -5.3825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5648 -5.7873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9442 -5.3900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2321 -5.7723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9517 -7.9312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1874 -8.3603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6713 -9.1979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9442 -9.6102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9442 -10.4572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2171 -10.8396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2471 -13.3431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9517 -12.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6638 -4.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9816 -4.5430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2246 -6.7393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.5125 -7.1366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8301 -5.3900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0806 -5.7723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9218 -7.1366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6414 -6.7019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7313 -5.7723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2171 -9.1754 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.5125 -12.8784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9592 -12.0913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6414 -11.6641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2171 -14.1377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.3682 -3.2987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.6785 -2.9089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.9440 -4.1233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2693 -4.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0806 -4.1233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4134 -4.5504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3909 -5.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6564 -3.2987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5048 -6.5969 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6414 -8.3509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6713 -10.8470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.7930 -6.7019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0656 -10.8246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3460 -10.4647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.5050 -12.0688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.7930 -11.6641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.9440 -0.8251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2171 -11.6940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.5424 -7.9611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.6785 -2.1143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3909 -9.6403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23 52 2 0 0 0 0\n 46 47 1 0 0 0 0\n 15 16 1 0 0 0 0\n 12 26 1 0 0 0 0\n 14 43 1 0 0 0 0\n 8 37 1 0 0 0 0\n 4 35 1 0 0 0 0\n 36 37 1 0 0 0 0\n 20 21 2 0 0 0 0\n 24 25 1 0 0 0 0\n 10 21 1 0 0 0 0\n 9 42 1 0 0 0 0\n 2 3 1 0 0 0 0\n 11 22 1 0 0 0 0\n 14 15 2 0 0 0 0\n 25 40 1 0 0 0 0\n 18 19 2 0 0 0 0\n 6 7 1 0 0 0 0\n 9 24 1 0 0 0 0\n 8 9 2 0 0 0 0\n 14 54 1 0 0 0 0\n 15 29 1 0 0 0 0\n 7 38 1 0 0 0 0\n 10 28 2 0 0 0 0\n 1 53 1 0 0 0 0\n 1 50 1 0 0 0 0\n 44 47 1 0 0 0 0\n 20 41 1 0 0 0 0\n 48 49 1 0 0 0 0\n 31 51 2 0 0 0 0\n 35 53 2 0 0 0 0\n 13 52 1 0 0 0 0\n 48 51 1 0 0 0 0\n 18 30 1 0 0 0 0\n 6 37 2 0 0 0 0\n 34 35 1 0 0 0 0\n 16 44 2 0 0 0 0\n 38 39 1 0 0 0 0\n 28 40 1 0 0 0 0\n 19 31 1 0 0 0 0\n 17 51 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 20 39 1 0 0 0 0\n 1 2 2 0 0 0 0\n 23 45 1 0 0 0 0\n 30 48 2 0 0 0 0\n 3 4 2 0 0 0 0\n 3 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 12 13 2 0 0 0 0\n 16 17 1 0 0 0 0\n 39 40 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 44 1 0 0 0 0\n 18 33 1 0 0 0 0\n 7 24 2 0 0 0 0\n 13 29 1 0 0 0 0\n 47 54 2 0 0 0 0\n 10 11 1 0 0 0 0\nM END", "smiles": "c1c(cc(cc1O)Oc2c(cc(c3c2Oc4c(cc(cc4O3)Oc5c(cc(cc5O)Oc6c(cc(c7c6Oc8c(cc(cc8O7)O)O)O)O)O)O)O)O)O", "formula": "C36H22O18", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "742.5505", "optical_activity": "NONE", "references": [ "dad5b4bb-10cf-05be-c7ab-fc06cae0b6d2", "75e490ca-7e45-632a-a306-f075001be95b" ], "stereo_centers": 0 }, "unii": "ZU0ESU4399" } ] }