{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9ee00d92-f0e0-4138-ac2c-f75d0cb68d9c",
          "code": "N0000175928",
          "comments": "Established Pharmacologic Class [EPC]|Adrenal Steroid Synthesis Inhibitor [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175928",
          "code_system": "NDF-RT",
          "references": [
            "7d6a22f3-0112-435d-8a80-17b78c4b6da4"
          ]
        },
        {
          "uuid": "264265f5-49eb-46ce-b32d-7cef38839fd8",
          "code": "N0000175921",
          "comments": "Cellular or Molecular Interactions [MoA]|Enzyme Interactions [MoA]|Enzyme Inhibitors [MoA]|Steroid Synthesis Inhibitors [MoA]|Adrenal Steroid Synthesis Inhibitors [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175921",
          "code_system": "NDF-RT",
          "references": [
            "7d6a22f3-0112-435d-8a80-17b78c4b6da4"
          ]
        },
        {
          "uuid": "f73aa793-cd43-4d70-9f04-43008ac4c353",
          "code": "QV04CD01",
          "comments": "VATC|DIAGNOSTIC AGENTS|OTHER DIAGNOSTIC AGENTS|Tests for pituitary function|metyrapone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QV04CD01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "7d6a22f3-0112-435d-8a80-17b78c4b6da4"
          ]
        },
        {
          "uuid": "c2edf0a8-665b-4263-b816-3e879925925e",
          "code": "54-36-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=54-36-4",
          "code_system": "CAS",
          "references": [
            "7d6a22f3-0112-435d-8a80-17b78c4b6da4",
            "171d31b3-4c3e-4d69-8cf3-fc767f10c0ef"
          ]
        },
        {
          "uuid": "099ae1ff-3025-48a6-b77b-4697beda1c7e",
          "code": "C47619",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47619",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7d6a22f3-0112-435d-8a80-17b78c4b6da4"
          ]
        },
        {
          "uuid": "39ae8aa6-59d7-416f-bffa-e0e3a83d1655",
          "code": "D008797",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68008797",
          "code_system": "MESH",
          "references": [
            "7d6a22f3-0112-435d-8a80-17b78c4b6da4"
          ]
        },
        {
          "uuid": "232ba8e4-c2fa-42cf-9b56-e99be6cd9545",
          "code": "METYRAPONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Metyrapone",
          "code_system": "WIKIPEDIA",
          "references": [
            "7d6a22f3-0112-435d-8a80-17b78c4b6da4"
          ]
        },
        {
          "uuid": "2fc77840-7623-4e3f-9da2-13967382b561",
          "code": "V04CD01",
          "comments": "ATC|VARIOUS|DIAGNOSTIC AGENTS|OTHER DIAGNOSTIC AGENTS|Tests for pituitary function|metyrapone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=V04CD01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "7d6a22f3-0112-435d-8a80-17b78c4b6da4"
          ]
        },
        {
          "uuid": "3f581724-e6e1-4e19-b251-c40c0f0b3d9e",
          "code": "1404",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1404",
          "code_system": "INN",
          "references": [
            "7d6a22f3-0112-435d-8a80-17b78c4b6da4"
          ]
        },
        {
          "uuid": "07243e4a-034e-44f1-949f-2e1710701fcf",
          "code": "200-206-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.188",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7d6a22f3-0112-435d-8a80-17b78c4b6da4"
          ]
        },
        {
          "uuid": "8c266094-9566-4455-9d7e-f74955d9b084",
          "code": "5224",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=5224",
          "code_system": "IUPHAR",
          "references": [
            "7d6a22f3-0112-435d-8a80-17b78c4b6da4"
          ]
        },
        {
          "uuid": "ed11fff0-ccb3-4bb8-97cf-3f7a54f68560",
          "code": "6923",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6923/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7d6a22f3-0112-435d-8a80-17b78c4b6da4"
          ]
        },
        {
          "uuid": "d718d3fa-4a64-49d0-91bd-a1fb5b8cce94",
          "code": "m7508",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7508?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7d6a22f3-0112-435d-8a80-17b78c4b6da4"
          ]
        },
        {
          "uuid": "11f2b6ad-72d2-4f35-8977-61d285fa52d4",
          "code": "DB01011",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01011",
          "code_system": "DRUG BANK",
          "references": [
            "7d6a22f3-0112-435d-8a80-17b78c4b6da4"
          ]
        },
        {
          "uuid": "5661b9e9-1462-455a-83f5-6ad6a8a63dd4",
          "code": "SUB08925MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "7d6a22f3-0112-435d-8a80-17b78c4b6da4"
          ]
        },
        {
          "uuid": "3170f4f3-a8f4-45c4-85a3-f896649b3f63",
          "code": "CHEMBL934",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL934",
          "code_system": "ChEMBL",
          "references": [
            "7d6a22f3-0112-435d-8a80-17b78c4b6da4"
          ]
        },
        {
          "uuid": "0a6599bc-cd9f-45f4-a634-1db86ea78830",
          "code": "4174",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4174",
          "code_system": "PUBCHEM",
          "references": [
            "7d6a22f3-0112-435d-8a80-17b78c4b6da4"
          ]
        },
        {
          "uuid": "98186f5c-1483-423a-c25a-568229bc57ec",
          "code": "2500",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2500",
          "code_system": "HSDB",
          "references": [
            "0908b619-bf40-ea4a-6424-b35cf897966e"
          ]
        },
        {
          "uuid": "c39f0c2f-bdb2-7291-7528-5c3c299f82d9",
          "code": "DTXSID1023314",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1023314",
          "code_system": "EPA CompTox",
          "references": [
            "4924b7c3-12ed-dff0-3590-2c42b5d7d216"
          ]
        },
        {
          "uuid": "654717e3-5efe-b54f-45bb-f5d6e4ace3c4",
          "code": "377212",
          "comments": "ORPHAN DRUG|Designated|Treatment of Cushing's syndrome",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=377212",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "e3d38e4e-d747-ac27-9b57-a2b43022ad3f",
          "code": "C471",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C471",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e61dead0-df32-135b-a871-cb2bc29572f2"
          ]
        },
        {
          "uuid": "2b969f9c-9bf5-45c6-aa89-d96dbef7d952",
          "code": "ZS9KD92H6V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0e3b33d6-a812-2a52-06cc-125a97b14fb0",
          "code": "1443001",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1443001",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "e61dead0-df32-135b-a871-cb2bc29572f2"
          ]
        },
        {
          "uuid": "f1782d4e-5c0b-7b8f-672f-faecc72a0514",
          "code": "Metyrapone",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM798/",
          "code_system": "LACTMED",
          "references": [
            "e61dead0-df32-135b-a871-cb2bc29572f2"
          ]
        },
        {
          "uuid": "a95b7cf5-27ff-5670-442b-04732b6a62e0",
          "code": "1791",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1791",
          "code_system": "DRUG CENTRAL",
          "references": [
            "e61dead0-df32-135b-a871-cb2bc29572f2"
          ]
        },
        {
          "uuid": "38d5802c-d23d-6fc3-d243-a112a08fe2e9",
          "code": "44241",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:44241",
          "code_system": "CHEBI",
          "references": [
            "e61dead0-df32-135b-a871-cb2bc29572f2"
          ]
        },
        {
          "uuid": "2f714bbe-0669-7664-2713-6a74049a81af",
          "code": "25265",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=25265",
          "code_system": "NSC",
          "references": [
            "c2d7b5ab-3113-2610-7dc8-223ac6a21081"
          ]
        },
        {
          "uuid": "6b3a2e5d-3f01-7860-4f47-60e445e92c81",
          "code": "ZS9KD92H6V",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=ZS9KD92H6V",
          "code_system": "DAILYMED",
          "references": [
            "70ec71f1-3998-7b1b-368d-d86cb3858e25"
          ]
        },
        {
          "uuid": "4d1f8049-7162-c742-e43e-9996a78425b6",
          "code": "100000092415",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "def884b6-2f73-318e-503f-e243c3a6bcc7"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "e3bbba0e-142b-4f6e-b608-5edd219c40b1",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "9c9af2c5-2c81-4b86-8715-27aa7ae366e0",
            "refuuid": "8d33b4d4-f4ca-4a97-84ca-06d64c11e0ff",
            "name": "METYRAPONE",
            "unii": "ZS9KD92H6V",
            "linking_id": "ZS9KD92H6V",
            "ref_pname": "METYRAPONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "56c6709a-556c-4f0f-95ac-767eed3cd03c",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "b2fc0686-320f-4b9f-9566-81ac8d993b3e",
            "refuuid": "42c3b528-109c-4e48-8d79-e0737affa850",
            "name": "METYRAPONE TARTRATE",
            "unii": "B6DRB5ZI7P",
            "linking_id": "B6DRB5ZI7P",
            "ref_pname": "METYRAPONE TARTRATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b4684906-077f-40ea-81c1-4877c6995756",
          "name": "1-PROPANONE, 2-METHYL-1,2-DI-3-PYRIDINYL-",
          "stdName": "1-PROPANONE, 2-METHYL-1,2-DI-3-PYRIDINYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f72a0cd9-c107-4ed2-969b-12bc9ba3b494"
          ],
          "display_name": false
        },
        {
          "uuid": "33e44759-dcb3-4429-a2ab-6593dc8b39f9",
          "name": "2-Methyl-1,2-di-3-pyridyl-1-propanone",
          "stdName": "2-METHYL-1,2-DI-3-PYRIDYL-1-PROPANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f72a0cd9-c107-4ed2-969b-12bc9ba3b494"
          ],
          "display_name": false
        },
        {
          "uuid": "05e04fee-4d01-4657-9a38-1c7b7081cc97",
          "name": "METOPIRONE",
          "stdName": "METOPIRONE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f4d52ed-8b72-41a0-8384-f9e245584559"
          ],
          "display_name": false
        },
        {
          "uuid": "4ea2fc86-9b93-44ba-8ec0-b611965d6a32",
          "name": "METYRAPONE",
          "stdName": "METYRAPONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aeab2a8e-1b33-45b6-a4ab-7531d290724a",
            "f72a0cd9-c107-4ed2-969b-12bc9ba3b494",
            "b65eb852-4239-4df8-b453-1d05f3af58da",
            "1b216f39-1026-4514-8102-a8d4f6346bfa",
            "b0fab8dd-bf40-49f7-bc99-ab2247ed8bc7",
            "5a4765f4-dc71-464e-bafa-42438de5e643",
            "a554dcc5-e299-4bfe-9cc4-121e3a485246",
            "edf17c29-7c68-46bf-a0e2-1ab19875ea24",
            "25f8bf78-9228-41be-80a0-c4033bf51fd3",
            "4258961d-fc7b-4570-b31d-2fc80d53cf2f",
            "eae9c9bc-bd7b-49a7-962d-1f8fe6e59f75",
            "bb50e038-29ae-40c3-b75f-5644b3ae28f2",
            "cd27c475-93bc-4285-88f6-49e83833c224",
            "1642077c-9c32-405f-a2d5-787d913007f0",
            "b2b8923b-fd4c-471f-8602-5966132b4f6f",
            "0b1329b0-75f6-4c6b-b629-70b12b172dd4",
            "b7b5d985-5182-4d78-b5c9-782e344a12a2",
            "37a9955e-2013-4d3c-b397-2ef97aba88d5",
            "9c879ee8-79a1-43c3-bbf7-5d1adeba3b7a",
            "10706e10-3414-463a-af4c-0e2cd00b8e4e",
            "f082960a-da00-4235-b2e1-fc56365a432f"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "0f41def9-77e6-49bd-805a-c7d93fda33c3",
              "name_org": "INN"
            },
            {
              "uuid": "99bd93eb-9423-470c-82aa-b8fb1ec44a7a",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "279af0ab-556f-4739-a647-51f4f439c97c",
          "name": "METYRAPONE [HSDB]",
          "stdName": "METYRAPONE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4258961d-fc7b-4570-b31d-2fc80d53cf2f"
          ],
          "display_name": false
        },
        {
          "uuid": "bdcd0599-1b2c-45ca-a278-df582f6eed93",
          "name": "METYRAPONE [JAN]",
          "stdName": "METYRAPONE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51ba811d-d823-f7e4-e674-bfa310082d86"
          ],
          "display_name": false
        },
        {
          "uuid": "0d9ddcd9-e9e5-4db1-b40d-bcef2eee3cfa",
          "name": "METYRAPONE [MART.]",
          "stdName": "METYRAPONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0fab8dd-bf40-49f7-bc99-ab2247ed8bc7"
          ],
          "display_name": false
        },
        {
          "uuid": "eb53b805-ed13-4904-aa75-608df8643240",
          "name": "METYRAPONE [MI]",
          "stdName": "METYRAPONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37a9955e-2013-4d3c-b397-2ef97aba88d5"
          ],
          "display_name": false
        },
        {
          "uuid": "6fd62c80-64af-4406-98c9-be632fd1a40a",
          "name": "METYRAPONE [ORANGE BOOK]",
          "stdName": "METYRAPONE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2b8923b-fd4c-471f-8602-5966132b4f6f"
          ],
          "display_name": false
        },
        {
          "uuid": "c51568b4-1b26-4596-a0d3-f7f57de4fe1c",
          "name": "METYRAPONE [USAN]",
          "stdName": "METYRAPONE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b216f39-1026-4514-8102-a8d4f6346bfa"
          ],
          "display_name": false
        },
        {
          "uuid": "2aa793a1-25c2-1ac5-bed7-0c0b094d5386",
          "name": "METYRAPONE [USP MONOGRAPH]",
          "stdName": "METYRAPONE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04b8bd4e-ce6f-a64c-cae7-36b2bada12be"
          ],
          "display_name": false
        },
        {
          "uuid": "a66fba7d-b18f-406c-ba9c-8113ead7853c",
          "name": "METYRAPONE [USP-RS]",
          "stdName": "METYRAPONE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edf17c29-7c68-46bf-a0e2-1ab19875ea24"
          ],
          "display_name": false
        },
        {
          "uuid": "64eeac22-4452-4b2b-84f4-17d620b91f19",
          "name": "METYRAPONE [VANDF]",
          "stdName": "METYRAPONE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b1329b0-75f6-4c6b-b629-70b12b172dd4"
          ],
          "display_name": false
        },
        {
          "uuid": "5bf7b22f-3ad6-fc06-6481-a93f0819d285",
          "name": "Metyrapone [WHO-DD]",
          "stdName": "METYRAPONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b2fc75d-5f87-513a-616d-7a7257ee31d8"
          ],
          "display_name": false
        },
        {
          "uuid": "bdac84e8-e4a9-49e3-b555-6aadcc236a40",
          "name": "NSC-25265",
          "stdName": "NSC-25265",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "852638d6-41ef-4fa0-b8b1-f0a54e2c6ac3"
          ],
          "display_name": false
        },
        {
          "uuid": "6b7c05cc-6126-4a52-b619-a280b14384c2",
          "name": "metyrapone [INN]",
          "stdName": "METYRAPONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c879ee8-79a1-43c3-bbf7-5d1adeba3b7a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f72a0cd9-c107-4ed2-969b-12bc9ba3b494",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7f4d52ed-8b72-41a0-8384-f9e245584559",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c879ee8-79a1-43c3-bbf7-5d1adeba3b7a",
          "citation": "INN Proposed List 13",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1b216f39-1026-4514-8102-a8d4f6346bfa",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b65eb852-4239-4df8-b453-1d05f3af58da",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b2b8923b-fd4c-471f-8602-5966132b4f6f",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0fab8dd-bf40-49f7-bc99-ab2247ed8bc7",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37a9955e-2013-4d3c-b397-2ef97aba88d5",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4258961d-fc7b-4570-b31d-2fc80d53cf2f",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "edf17c29-7c68-46bf-a0e2-1ab19875ea24",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1642077c-9c32-405f-a2d5-787d913007f0",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b1329b0-75f6-4c6b-b629-70b12b172dd4",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "852638d6-41ef-4fa0-b8b1-f0a54e2c6ac3",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d6a22f3-0112-435d-8a80-17b78c4b6da4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390732000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48307e41-91a6-4e32-9e9f-b60ed9f12e61",
          "citation": "SRS import [ZS9KD92H6V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ZS9KD92H6V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390732000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10706e10-3414-463a-af4c-0e2cd00b8e4e",
          "citation": "METYRAPONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bb50e038-29ae-40c3-b75f-5644b3ae28f2",
          "citation": "METYRAPONE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cd27c475-93bc-4285-88f6-49e83833c224",
          "citation": "METYRAPONE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5a4765f4-dc71-464e-bafa-42438de5e643",
          "citation": "METYRAPONE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aeab2a8e-1b33-45b6-a4ab-7531d290724a",
          "citation": "METYRAPONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eae9c9bc-bd7b-49a7-962d-1f8fe6e59f75",
          "citation": "METYRAPONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b7b5d985-5182-4d78-b5c9-782e344a12a2",
          "citation": "METYRAPONE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a554dcc5-e299-4bfe-9cc4-121e3a485246",
          "citation": "METYRAPONE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f082960a-da00-4235-b2e1-fc56365a432f",
          "citation": "METYRAPONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "25f8bf78-9228-41be-80a0-c4033bf51fd3",
          "citation": "METYRAPONE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "51ba811d-d823-f7e4-e674-bfa310082d86",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0908b619-bf40-ea4a-6424-b35cf897966e",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+54-36-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4924b7c3-12ed-dff0-3590-2c42b5d7d216",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=54-36-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1a52746e-d85b-ceba-2e51-f948ffea39e8",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+54-36-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e61dead0-df32-135b-a871-cb2bc29572f2",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "171d31b3-4c3e-4d69-8cf3-fc767f10c0ef",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "04b8bd4e-ce6f-a64c-cae7-36b2bada12be",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "1b2fc75d-5f87-513a-616d-7a7257ee31d8",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c2d7b5ab-3113-2610-7dc8-223ac6a21081",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "70ec71f1-3998-7b1b-368d-d86cb3858e25",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "def884b6-2f73-318e-503f-e243c3a6bcc7",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6f84a52f-14d7-43b4-9982-32a8d7f094ba",
          "id": "6f84a52f-14d7-43b4-9982-32a8d7f094ba",
          "molfile": "\n  Marvin  01132105472D          \n\n 17 18  0  0  0  0            999 V2000\n    2.7730   -1.4345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3800   -1.8081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0337   -1.4579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1011   -2.2049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1167   -3.0298    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8171   -1.7899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8093   -0.9520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5123   -0.5370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2386   -0.9365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2516   -1.7614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5357   -2.1945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6641   -2.2049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9481   -1.7847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2244   -2.1894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2166   -3.0143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9326   -3.4397    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6563   -3.0376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n 12  2  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n 11  6  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 17 12  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(c1cccnc1)C(=O)c2cccnc2",
          "formula": "C14H14N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8632255a-5fea-4f95-a759-e0a2c760b851"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "226.2743",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8d33b4d4-f4ca-4a97-84ca-06d64c11e0ff",
      "version": "28",
      "structure": {
        "id": "f2755732-050b-442f-b8c2-005952ed5402",
        "molfile": "\n  Marvin  01132112342D          \n\n 17 18  0  0  0  0            999 V2000\n    4.1011   -2.2049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3800   -1.8081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8171   -1.7899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1167   -3.0298    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6641   -2.2049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2516   -1.7614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9326   -3.4397    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5357   -2.1945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7730   -1.4345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0337   -1.4579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6563   -3.0376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8093   -0.9520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2166   -3.0143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2386   -0.9365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9481   -1.7847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5123   -0.5370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2244   -2.1894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  8  1  0  0  0  0\n  7 11  2  0  0  0  0\n  8  3  2  0  0  0  0\n  9  2  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11  5  1  0  0  0  0\n 12  3  1  0  0  0  0\n 13 17  2  0  0  0  0\n 14 16  1  0  0  0  0\n 15  5  2  0  0  0  0\n 16 12  2  0  0  0  0\n 17 15  1  0  0  0  0\n 14  6  2  0  0  0  0\n  7 13  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(c1cccnc1)C(=O)c2cccnc2",
        "formula": "C14H14N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "226.2743",
        "optical_activity": "NONE",
        "references": [
          "48307e41-91a6-4e32-9e9f-b60ed9f12e61",
          "f72a0cd9-c107-4ed2-969b-12bc9ba3b494",
          "9c879ee8-79a1-43c3-bbf7-5d1adeba3b7a"
        ],
        "stereo_centers": 0
      },
      "unii": "ZS9KD92H6V"
    }
  ]
}