{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "e6c903b5-3163-4438-800f-23cf03bbfb54", "code": "7147-34-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=7147-34-4", "code_system": "CAS", "references": [ "41963623-eaca-4ae8-afef-c02f0675e444", "58aa5cd8-1c36-41d7-89e0-6613d0924e87" ] }, { "uuid": "4c7fedb7-9029-4dec-8c77-efa9df6ef0ab", "code": "230-457-3", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.027.689", "code_system": "ECHA (EC/EINECS)", "references": [ "41963623-eaca-4ae8-afef-c02f0675e444" ] }, { "uuid": "683e7dd2-143d-4027-a9fb-c96239690234", "code": "95243", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/95243", "code_system": "PUBCHEM", "references": [ "41963623-eaca-4ae8-afef-c02f0675e444" ] }, { "uuid": "3f1c842c-4eab-ba78-86f1-35949e1fed4e", "code": "DTXSID10991894", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10991894", "code_system": "EPA CompTox" }, { "uuid": "45714a8c-3b6f-4c31-81ae-2d61cb3e3d5e", "code": "ZS6ME39S45", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "b04910bc-2919-b99f-a1ba-72bb84f165da", "code": "25386", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=25386", "code_system": "NSC", "references": [ "707d19fc-a87a-94c3-7601-603d58f4098b" ] } ], "substance_class": "chemical", "names": [ { "uuid": "f090a0bd-4081-4cd6-a5cf-1ede56a84cbd", "name": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, 1,2,3-TRIS(2-ETHYLHEXYL) ESTER", "stdName": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, 1,2,3-TRIS(2-ETHYLHEXYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bda98a9e-53cd-48a0-bc58-2acbb6e80312", "03ae4f9b-2f06-446c-95fa-1a5e0ef9b488" ], "display_name": false }, { "uuid": "652047d9-8cee-4155-8a91-2b0dbdff08f4", "name": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, TRIS(2-ETHYLHEXYL) ESTER", "stdName": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, TRIS(2-ETHYLHEXYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bda98a9e-53cd-48a0-bc58-2acbb6e80312", "03ae4f9b-2f06-446c-95fa-1a5e0ef9b488" ], "display_name": false }, { "uuid": "5af60c5a-3a80-4759-a222-d535f286f3c5", "name": "BERNEL ESTER TOC", "stdName": "BERNEL ESTER TOC", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "bda98a9e-53cd-48a0-bc58-2acbb6e80312", "03ae4f9b-2f06-446c-95fa-1a5e0ef9b488" ], "display_name": false }, { "uuid": "999bf37a-587f-4c1e-af92-53e112575d49", "name": "CITRIC ACID, TRIS(2-ETHYLHEXYL) ESTER", "stdName": "CITRIC ACID, TRIS(2-ETHYLHEXYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bda98a9e-53cd-48a0-bc58-2acbb6e80312", "03ae4f9b-2f06-446c-95fa-1a5e0ef9b488" ], "display_name": false }, { "uuid": "9e3b2c3d-75e2-421a-94a1-bbb43a916457", "name": "NIKKOL STO", "stdName": "NIKKOL STO", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "bda98a9e-53cd-48a0-bc58-2acbb6e80312", "03ae4f9b-2f06-446c-95fa-1a5e0ef9b488" ], "display_name": false }, { "uuid": "59188fa5-288d-4fed-8089-7216fc01720d", "name": "NSC-25386", "stdName": "NSC-25386", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "bda98a9e-53cd-48a0-bc58-2acbb6e80312", "03ae4f9b-2f06-446c-95fa-1a5e0ef9b488" ], "display_name": false }, { "uuid": "e840822c-2c2c-45e4-afca-c3284cc2992f", "name": "TOC", "stdName": "TOC", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bda98a9e-53cd-48a0-bc58-2acbb6e80312", "03ae4f9b-2f06-446c-95fa-1a5e0ef9b488" ], "display_name": false }, { "uuid": "231f36fd-118c-488e-96e0-f0f23b9fa677", "name": "TRIETHYLHEXYL CITRATE", "stdName": "TRIETHYLHEXYL CITRATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "bda98a9e-53cd-48a0-bc58-2acbb6e80312", "27eefb5d-8bc5-44fe-ba9d-6b62f583c078", "827be386-19b6-422a-8ec0-a5419debe886" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "3d1d746f-0528-49de-8c66-88c7a552b0b5", "name_org": "INCI" } ] }, { "uuid": "1f955cd4-d5ec-4790-a681-4ebec613c022", "name": "TRIS(2-ETHYLHEXYL) CITRATE", "stdName": "TRIS(2-ETHYLHEXYL) CITRATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bda98a9e-53cd-48a0-bc58-2acbb6e80312", "00bfad6b-9a16-4caf-9ffd-bab525361d22" ], "display_name": false } ], "references": [ { "uuid": "03ae4f9b-2f06-446c-95fa-1a5e0ef9b488", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "bda98a9e-53cd-48a0-bc58-2acbb6e80312", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "00bfad6b-9a16-4caf-9ffd-bab525361d22", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "27eefb5d-8bc5-44fe-ba9d-6b62f583c078", "citation": "pcpc", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "41963623-eaca-4ae8-afef-c02f0675e444", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391989000, "tags": [ "NOMEN" ] }, { "uuid": "0b6d3cad-ef7a-42f3-a8e1-37507f328bd0", "citation": "SRS import [ZS6ME39S45]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ZS6ME39S45", "doc_type": "SRS", "public_domain": true, "document_date": 1493391989000, "tags": [ "NOMEN" ] }, { "uuid": "827be386-19b6-422a-8ec0-a5419debe886", "citation": "TRIETHYLHEXYL CITRATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "58aa5cd8-1c36-41d7-89e0-6613d0924e87", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "707d19fc-a87a-94c3-7601-603d58f4098b", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "12947ca9-bb40-4aa9-bf93-39ccd860e3ee", "id": "12947ca9-bb40-4aa9-bf93-39ccd860e3ee", "molfile": "\n Marvin 01132101112D \n\n 37 36 0 0 0 0 999 V2000\n 0.0000 -7.8402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7169 -8.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4247 -7.8402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1415 -8.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8584 -7.8402 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 3.5753 -8.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5753 -9.0743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8584 -7.0144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5753 -6.5970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5753 -5.7713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8584 -5.3629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2831 -5.3629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2831 -4.5372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4573 -4.5372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2831 -3.7114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5753 -3.3030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8584 -3.7114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5753 -2.4773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8584 -2.0599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8584 -1.2341 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 3.5753 -0.8258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5753 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1415 -0.8258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4247 -1.2341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7169 -0.8258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.2341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1088 -4.5372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5262 -5.2540 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5262 -3.8203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3520 -3.8203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7603 -3.1125 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 7.5861 -3.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9944 -2.3956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3520 -2.3956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5262 -2.3956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1088 -1.6788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2831 -1.6788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 8 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 12 10 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 13 27 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 23 1 0 0 0 0\n 21 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 27 28 2 0 0 0 0\n 27 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 34 1 0 0 0 0\n 32 33 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\nM END", "smiles": "CCCCC(CC)COC(=O)CC(CC(=O)OCC(CC)CCCC)(C(=O)OCC(CC)CCCC)O", "formula": "C30H56O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "83d836c8-2460-46bd-b84a-4cfbd35f9db4" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "528.7626", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "2863c237-619b-4cf9-8ac9-9038de5896de", "version": "6", "structure": { "id": "6121b963-c44e-409b-bf7d-3ca1ecd23f5c", "molfile": "\n Marvin 01132105022D \n\n 37 36 0 0 0 0 999 V2000\n 4.2831 -4.5372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1088 -4.5372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2831 -5.3629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2831 -3.7114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4573 -4.5372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5262 -3.8203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5262 -5.2540 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5753 -5.7713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5753 -3.3030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3520 -3.8203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5753 -6.5970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8584 -5.3629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5753 -2.4773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8584 -3.7114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7603 -3.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8584 -7.0144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8584 -2.0599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3520 -2.3956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5861 -3.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8584 -7.8402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8584 -1.2341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5262 -2.3956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9944 -2.3956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1415 -8.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5753 -8.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1415 -0.8258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5753 -0.8258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1088 -1.6788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4247 -7.8402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5753 -9.0743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4247 -1.2341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5753 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2831 -1.6788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7169 -8.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7169 -0.8258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -7.8402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.2341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 0 0 0 0\n 1 5 1 0 0 0 0\n 2 6 1 0 0 0 0\n 2 7 2 0 0 0 0\n 3 8 1 0 0 0 0\n 4 9 1 0 0 0 0\n 6 10 1 0 0 0 0\n 8 11 1 0 0 0 0\n 8 12 2 0 0 0 0\n 9 13 1 0 0 0 0\n 9 14 2 0 0 0 0\n 10 15 1 0 0 0 0\n 11 16 1 0 0 0 0\n 13 17 1 0 0 0 0\n 15 18 1 0 0 0 0\n 15 19 1 0 0 0 0\n 16 20 1 0 0 0 0\n 17 21 1 0 0 0 0\n 18 22 1 0 0 0 0\n 19 23 1 0 0 0 0\n 20 24 1 0 0 0 0\n 20 25 1 0 0 0 0\n 21 26 1 0 0 0 0\n 21 27 1 0 0 0 0\n 22 28 1 0 0 0 0\n 24 29 1 0 0 0 0\n 25 30 1 0 0 0 0\n 26 31 1 0 0 0 0\n 27 32 1 0 0 0 0\n 28 33 1 0 0 0 0\n 29 34 1 0 0 0 0\n 31 35 1 0 0 0 0\n 34 36 1 0 0 0 0\n 35 37 1 0 0 0 0\nM END", "smiles": "CCCCC(CC)COC(=O)CC(CC(=O)OCC(CC)CCCC)(C(=O)OCC(CC)CCCC)O", "formula": "C30H56O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "528.7626", "optical_activity": "UNSPECIFIED", "references": [ "0b6d3cad-ef7a-42f3-a8e1-37507f328bd0", "00bfad6b-9a16-4caf-9ffd-bab525361d22" ], "stereo_centers": 3 }, "unii": "ZS6ME39S45" } ] }