{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "930173e5-98ec-4712-981a-f7ccc393195f", "code": "135861-56-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=135861-56-2", "code_system": "CAS", "references": [ "60316a07-76e8-4fe4-9fab-8ad5ba65a188", "9f01705b-3d15-4ba2-b1a0-246faf6ecf7b" ] }, { "uuid": "7498fcd3-2535-436c-9630-ffc0de787d88", "code": "18666587", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18666587", "code_system": "PUBCHEM", "references": [ "60316a07-76e8-4fe4-9fab-8ad5ba65a188" ] }, { "uuid": "5f0882e6-b7e0-4272-9ae3-eb1dd6b585ad", "code": "DTXSID4051297", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4051297", "code_system": "EPA CompTox", "references": [ "08626cbf-83e9-5e08-0b30-977669b7f309" ] }, { "uuid": "2b8db31c-9bc3-4dc8-ba67-5723627b177a", "code": "ZR857KD5X9", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "bbbea10b-f192-485b-b75a-f0b3366e7bfc", "name": "1,3:2,4-BIS(3,4-DIMETHYLBENZYLIDENE)SORBITOL", "stdName": "1,3:2,4-BIS(3,4-DIMETHYLBENZYLIDENE)SORBITOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "45d7ad0c-f73f-4479-aa7a-5ac4212130ce", "aeb086b3-e2a8-4f50-bf2c-781933a31323" ], "display_name": false }, { "uuid": "8215505f-7a5d-4ef4-84b6-b83c53743f48", "name": "BIS(3,4-DIMETHYLBENZYLIDENE) SORBITOL", "stdName": "BIS(3,4-DIMETHYLBENZYLIDENE) SORBITOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "45d7ad0c-f73f-4479-aa7a-5ac4212130ce", "aeb086b3-e2a8-4f50-bf2c-781933a31323" ], "display_name": false }, { "uuid": "25b98044-66a3-41f8-a079-dc15e0f86990", "name": "D-GLUCITOL, 1,3:2,4-BIS-O-((3,4-DIMETHYLPHENYL)METHYLENE)-", "stdName": "D-GLUCITOL, 1,3:2,4-BIS-O-((3,4-DIMETHYLPHENYL)METHYLENE)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "45d7ad0c-f73f-4479-aa7a-5ac4212130ce", "aeb086b3-e2a8-4f50-bf2c-781933a31323" ], "display_name": false }, { "uuid": "4394d1b2-7101-4ced-91a4-9c84fe3a3aff", "name": "DIMETHYLDIBENZYLIDENE SORBITOL", "stdName": "DIMETHYLDIBENZYLIDENE SORBITOL", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "0507e73c-c751-4746-b446-b9d7333823bd", "45d7ad0c-f73f-4479-aa7a-5ac4212130ce", "d2f91450-f0a2-4ef6-849a-b500d65841c9" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "862ba3d1-6a0f-4657-9a28-59ed18082eb4", "name_org": "INCI" } ] }, { "uuid": "a6bc1b1f-34be-49e9-80b7-894769baf648", "name": "MILLAD 3988", "stdName": "MILLAD 3988", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "45d7ad0c-f73f-4479-aa7a-5ac4212130ce", "d2f91450-f0a2-4ef6-849a-b500d65841c9" ], "display_name": false } ], "references": [ { "uuid": "d2f91450-f0a2-4ef6-849a-b500d65841c9", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "45d7ad0c-f73f-4479-aa7a-5ac4212130ce", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "aeb086b3-e2a8-4f50-bf2c-781933a31323", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "60316a07-76e8-4fe4-9fab-8ad5ba65a188", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391524000, "tags": [ "NOMEN" ] }, { "uuid": "c14c84a9-a6ba-4942-8798-7a47e7f7d5c7", "citation": "SRS import [ZR857KD5X9]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ZR857KD5X9", "doc_type": "SRS", "public_domain": true, "document_date": 1493391524000, "tags": [ "NOMEN" ] }, { "uuid": "0507e73c-c751-4746-b446-b9d7333823bd", "citation": "DIMETHYLDIBENZYLIDENE SORBITOL [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "08626cbf-83e9-5e08-0b30-977669b7f309", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=135861-56-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "9f01705b-3d15-4ba2-b1a0-246faf6ecf7b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d723b3a8-5269-4da2-850c-f56dbcc73143", "id": "d723b3a8-5269-4da2-850c-f56dbcc73143", "molfile": "\n Marvin 01132111092D \n\n 30 33 0 0 1 0 999 V2000\n 8.1963 -6.4013 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.3663 -6.5502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7071 -7.0504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5371 -6.9121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4730 -5.6351 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 9.1966 -5.2307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1966 -4.4007 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 8.4730 -3.9857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7600 -4.4007 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 7.0470 -3.9857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3234 -4.4007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3234 -5.2307 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 7.0470 -5.6351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7600 -5.2307 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 5.6211 -5.6351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6211 -6.4651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9082 -6.8801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1739 -6.4758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4716 -6.8908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1739 -5.6351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4716 -5.2201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9082 -5.2307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8989 -3.9857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8989 -3.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6119 -2.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3462 -3.1450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0485 -2.7407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3462 -3.9857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0485 -4.4007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6119 -4.3901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 3 1 0 0 0 0\n 5 1 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 6 1 6 0 0 0\n 14 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 23 7 1 0 0 0 0\n 9 8 1 6 0 0 0\n 9 10 1 0 0 0 0\n 14 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 15 12 1 0 0 0 0\n 14 13 1 6 0 0 0\n 16 15 1 0 0 0 0\n 22 15 2 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 18 20 2 0 0 0 0\n 21 20 1 0 0 0 0\n 20 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 30 23 2 0 0 0 0\n 25 24 2 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 26 28 2 0 0 0 0\n 29 28 1 0 0 0 0\n 28 30 1 0 0 0 0\nM END", "smiles": "Cc1ccc(cc1C)C2OC[C@H]3[C@H]([C@@H]([C@@H](CO)O)OC(c4ccc(C)c(C)c4)O3)O2", "formula": "C24H30O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "1f61da87-6299-41aa-aa7d-feb897efa0da" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "414.4923", "optical_activity": "UNSPECIFIED", "stereo_centers": 6 } ], "definition_level": "COMPLETE", "uuid": "e02cb06d-fdfe-412d-bff5-3a89fa742240", "version": "5", "structure": { "id": "eb1fb848-9eb9-42fb-ac0f-382ea912a26f", "molfile": "\n Marvin 01132112102D \n\n 33 36 0 0 1 0 999 V2000\n 7.4514 -5.9756 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4408 -3.6345 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8242 -6.3800 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0485 -2.7407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4716 -6.8908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0485 -4.4007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4716 -5.2201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7071 -7.0504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5371 -6.9121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3663 -6.5502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9082 -6.8801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6119 -2.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6211 -6.4651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8989 -3.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3462 -3.1450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1739 -6.4758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1963 -6.4013 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.0470 -3.9857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3462 -3.9857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1739 -5.6351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9082 -5.2307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6119 -4.3901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6211 -5.6351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8989 -3.9857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3234 -4.4007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3234 -5.2307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4730 -3.9857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7600 -4.4007 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.1966 -4.4007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0470 -5.6351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1966 -5.2307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4730 -5.6351 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.7600 -5.2307 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 15 19 2 0 0 0 0\n 16 11 2 0 0 0 0\n 29 31 1 0 0 0 0\n 25 26 1 0 0 0 0\n 33 1 1 1 0 0 0\n 28 2 1 1 0 0 0\n 32 3 1 1 0 0 0\n 4 15 1 0 0 0 0\n 5 16 1 0 0 0 0\n 6 19 1 0 0 0 0\n 7 20 1 0 0 0 0\n 8 17 1 0 0 0 0\n 9 8 1 0 0 0 0\n 17 10 1 1 0 0 0\n 11 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 13 23 2 0 0 0 0\n 14 24 1 0 0 0 0\n 15 12 1 0 0 0 0\n 16 20 1 0 0 0 0\n 17 32 1 0 0 0 0\n 18 28 1 0 0 0 0\n 19 22 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 23 1 0 0 0 0\n 22 24 2 0 0 0 0\n 23 26 1 0 0 0 0\n 24 29 1 0 0 0 0\n 25 18 1 0 0 0 0\n 26 30 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 33 1 0 0 0 0\n 29 27 1 0 0 0 0\n 30 33 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\nM END", "smiles": "Cc1ccc(cc1C)C2OC[C@@]3([H])[C@]([H])([C@@]([H])([C@@H](CO)O)OC(c4ccc(C)c(C)c4)O3)O2", "formula": "C24H30O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "414.4923", "optical_activity": "UNSPECIFIED", "references": [ "c14c84a9-a6ba-4942-8798-7a47e7f7d5c7", "aeb086b3-e2a8-4f50-bf2c-781933a31323" ], "stereo_centers": 6 }, "unii": "ZR857KD5X9" } ] }