{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "11412d03-2da2-4c27-ab9d-32506f67bec1",
          "code": "7559-04-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7559-04-8",
          "code_system": "CAS",
          "references": [
            "364d5736-a234-443b-b56f-b3319ddb1435",
            "82f254ba-8d01-40b1-b2d9-d3f7c7285c97"
          ]
        },
        {
          "uuid": "48ba523a-06e3-489e-85e5-98013455eb59",
          "code": "231-450-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.028.592",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "364d5736-a234-443b-b56f-b3319ddb1435"
          ]
        },
        {
          "uuid": "cf3e8f4e-9f70-4031-81ca-be6505a476b6",
          "code": "1376149",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1376149/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "364d5736-a234-443b-b56f-b3319ddb1435"
          ]
        },
        {
          "uuid": "c7472855-ca29-4973-9c0f-3eba9c964efd",
          "code": "2734086",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2734086",
          "code_system": "PUBCHEM",
          "references": [
            "364d5736-a234-443b-b56f-b3319ddb1435"
          ]
        },
        {
          "uuid": "cfcf5b13-330d-0f4d-0931-b4359def98dc",
          "code": "C942",
          "comments": "Pharmacologic Substance[C1909]|Protective Agent[C26170]|Antioxidant[C275]|Vitamin E Compound",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C275",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d29e757f-2d2c-bc68-1729-c99cc1f488ca"
          ]
        },
        {
          "uuid": "86f07151-8784-4487-bcbc-14ffb41dd825",
          "code": "SUB193910",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "3c99ac54-bfed-e55b-34d5-83bcb9876048"
          ]
        },
        {
          "uuid": "c03d9dfa-12af-fb47-4f1b-3eac7ecb83df",
          "code": "DB14094",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB14094",
          "code_system": "DRUG BANK",
          "references": [
            "d29e757f-2d2c-bc68-1729-c99cc1f488ca"
          ]
        },
        {
          "uuid": "e432a9fb-b00b-4a6b-9607-45ec8ad0077f",
          "code": "ZO763K43XR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9e25aa5e-cd9c-405b-c216-6ca737d9cc7d",
          "code": "C126913",
          "comments": "NCIT",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C126913",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5a32ac15-c711-7d6e-e45d-dcfed16afe9e"
          ]
        },
        {
          "uuid": "a173fd3b-b9ac-4d16-100e-e28d3bba9f4c",
          "code": "DTXSID501009892",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID501009892",
          "code_system": "EPA CompTox",
          "references": [
            "d29e757f-2d2c-bc68-1729-c99cc1f488ca"
          ]
        },
        {
          "uuid": "4952852a-97e1-d559-5e2e-ff5762ee0edb",
          "code": "ZO763K43XR",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=ZO763K43XR",
          "code_system": "DAILYMED",
          "references": [
            "4e3206ed-4cd4-db7e-1670-052a07294e91"
          ]
        },
        {
          "uuid": "7fd7036c-58c0-3034-6dc5-081e1329b89b",
          "code": "100000178273",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a5017f96-9227-4811-7280-d74650d5b590"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "b587ed7c-83be-4ff7-bbcb-17c5a80df273",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "e7e0cd0d-750d-4086-9da3-ec1db6bd8919",
            "refuuid": "87339952-8c66-4891-b0bb-ca28419b6442",
            "name": "TOCOQUINONE",
            "unii": "ZO763K43XR",
            "linking_id": "ZO763K43XR",
            "ref_pname": "TOCOQUINONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ec5ba920-37b7-4ef5-b662-ff2bc1147e67",
          "name": ".ALPHA.-TOCOPHERYLQUINONE",
          "stdName": ".ALPHA.-TOCOPHERYLQUINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a04c15ae-cd4c-4549-bbb4-59fc7aac164d",
            "b98118d7-d509-41dc-84fb-53e32cce1f54"
          ],
          "display_name": false
        },
        {
          "uuid": "8fb79e23-6bb1-435e-8e53-da8b919f651c",
          "name": "2,5-CYCLOHEXADIENE-1,4-DIONE, 2-((3R,7R,11R)-3-HYDROXY-3,7,11,15-TETRAMETHYLHEXADECYL)-3,5,6-TRIMETHYL-",
          "stdName": "2,5-CYCLOHEXADIENE-1,4-DIONE, 2-((3R,7R,11R)-3-HYDROXY-3,7,11,15-TETRAMETHYLHEXADECYL)-3,5,6-TRIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a04c15ae-cd4c-4549-bbb4-59fc7aac164d",
            "b98118d7-d509-41dc-84fb-53e32cce1f54"
          ],
          "display_name": false
        },
        {
          "uuid": "0e1005b7-daf3-4a25-afc2-840cc82a57b1",
          "name": "A-0001",
          "stdName": "A-0001",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a04c15ae-cd4c-4549-bbb4-59fc7aac164d",
            "c0aedc5d-2a38-4b78-b2f9-9a2addaf046d"
          ],
          "display_name": false
        },
        {
          "uuid": "2f99e802-727a-426a-80c2-a04b5bfe3aba",
          "name": "A0001",
          "stdName": "A0001",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a04c15ae-cd4c-4549-bbb4-59fc7aac164d",
            "8652f7a4-355a-4ece-a277-9d080c875083"
          ],
          "display_name": false
        },
        {
          "uuid": "d3f0b7ea-6d85-4a58-949f-96802ee858a8",
          "name": "ALPHA-TOCOPHEROLQUINONE",
          "stdName": "ALPHA-TOCOPHEROLQUINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a04c15ae-cd4c-4549-bbb4-59fc7aac164d",
            "8652f7a4-355a-4ece-a277-9d080c875083"
          ],
          "display_name": false
        },
        {
          "uuid": "cdce22ca-8ed5-4390-b01d-e9260b89446a",
          "name": "ALPHA-TOCOPHERYLQUINONE",
          "stdName": "ALPHA-TOCOPHERYLQUINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6596d090-72e8-477c-bc73-395683390106"
          ],
          "display_name": false
        },
        {
          "uuid": "6b96e9d9-39e4-4b0c-b13a-8dd1423e042b",
          "name": "ALPHA-TOCOPHERYLQUINONE S",
          "stdName": "ALPHA-TOCOPHERYLQUINONE S",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a04c15ae-cd4c-4549-bbb4-59fc7aac164d",
            "370fdec5-4ed3-49d8-9eac-6e4332767c25"
          ],
          "display_name": false
        },
        {
          "uuid": "8a55ee6a-70be-4e24-b67b-84a550a2061b",
          "name": "D-.ALPHA.-TOCOPHEROL QUINONE",
          "stdName": "D-.ALPHA.-TOCOPHEROL QUINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a04c15ae-cd4c-4549-bbb4-59fc7aac164d",
            "b98118d7-d509-41dc-84fb-53e32cce1f54"
          ],
          "display_name": false
        },
        {
          "uuid": "64e687c7-660b-43da-8235-d135df51d679",
          "name": "EPIA-0001",
          "stdName": "EPIA-0001",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a04c15ae-cd4c-4549-bbb4-59fc7aac164d",
            "c0aedc5d-2a38-4b78-b2f9-9a2addaf046d"
          ],
          "display_name": false
        },
        {
          "uuid": "41a187f5-1c15-4bb7-8454-1c5f08aa76a7",
          "name": "METARENE",
          "stdName": "METARENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a04c15ae-cd4c-4549-bbb4-59fc7aac164d",
            "b98118d7-d509-41dc-84fb-53e32cce1f54"
          ],
          "display_name": false
        },
        {
          "uuid": "38979e9a-126d-4a65-8205-6670f8b18eda",
          "name": "TOCOPHERYLQUINONE",
          "stdName": "TOCOPHERYLQUINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93630aa3-6b86-410c-9ecb-0c9ef38e73d9",
            "a04c15ae-cd4c-4549-bbb4-59fc7aac164d",
            "62ca10c0-5f59-4c5e-abd8-487e59df15aa"
          ],
          "display_name": false
        },
        {
          "uuid": "46ed2b97-670e-41ef-9a56-8ad29ab5e239",
          "name": "TOCOQUINONE",
          "stdName": "TOCOQUINONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a04c15ae-cd4c-4549-bbb4-59fc7aac164d",
            "01bf9b43-1beb-4b26-804f-91416c156f0b",
            "370fdec5-4ed3-49d8-9eac-6e4332767c25"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ce100b9a-2e26-4246-9d75-e0ef1842cb62",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "208577a8-9e66-32f3-49b8-7734e76e7e9d",
          "name": "Tocopherylquinone [WHO-DD]",
          "stdName": "TOCOPHERYLQUINONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35c1d908-2620-b536-2d27-18015563af8c"
          ],
          "display_name": false
        },
        {
          "uuid": "6ddff70f-2b56-4edb-8d3d-0d290c8ddc1e",
          "name": "VITAMIN E QUINONE",
          "stdName": "VITAMIN E QUINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a04c15ae-cd4c-4549-bbb4-59fc7aac164d",
            "b98118d7-d509-41dc-84fb-53e32cce1f54"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6596d090-72e8-477c-bc73-395683390106",
          "citation": "FAERS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b98118d7-d509-41dc-84fb-53e32cce1f54",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a04c15ae-cd4c-4549-bbb4-59fc7aac164d",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93630aa3-6b86-410c-9ecb-0c9ef38e73d9",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "370fdec5-4ed3-49d8-9eac-6e4332767c25",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c0aedc5d-2a38-4b78-b2f9-9a2addaf046d",
          "citation": "http://adisinsight.springer.com/drugs/800028591",
          "url": "http://adisinsight.springer.com/drugs/800028591",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8652f7a4-355a-4ece-a277-9d080c875083",
          "citation": "https://clinicaltrials.gov/ct2/show/NCT01035671?term=A0001&rank=1",
          "url": "https://clinicaltrials.gov/ct2/show/NCT01035671?term=A0001&rank=1",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "364d5736-a234-443b-b56f-b3319ddb1435",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389734000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7b3d210-64f1-4a26-a578-eed5f1b83cc7",
          "citation": "SRS import [ZO763K43XR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ZO763K43XR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389734000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01bf9b43-1beb-4b26-804f-91416c156f0b",
          "citation": "TOCOQUINONE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "62ca10c0-5f59-4c5e-abd8-487e59df15aa",
          "citation": "TOCOPHERYLQUINONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d29e757f-2d2c-bc68-1729-c99cc1f488ca",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3c99ac54-bfed-e55b-34d5-83bcb9876048",
          "citation": "EVMPD",
          "doc_type": "EVMPD",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "82f254ba-8d01-40b1-b2d9-d3f7c7285c97",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5a32ac15-c711-7d6e-e45d-dcfed16afe9e",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "4e3206ed-4cd4-db7e-1670-052a07294e91",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "35c1d908-2620-b536-2d27-18015563af8c",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a5017f96-9227-4811-7280-d74650d5b590",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d4afbe3c-c8cc-4637-8c4f-e8bcff859665",
          "id": "d4afbe3c-c8cc-4637-8c4f-e8bcff859665",
          "molfile": "\n  Marvin  01132111012D          \n\n 32 32  0  0  1  0            999 V2000\n   10.2673   -7.0040    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.2673   -7.8350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9735   -6.5978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7075   -7.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3999   -6.5978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1338   -7.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1338   -7.8396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8401   -6.5978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5472   -6.5978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8410   -7.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1208   -6.5978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4146   -7.0040    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.4146   -7.8165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6945   -6.5978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9883   -7.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2682   -6.5978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5620   -7.0040    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.9636   -7.7103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1512   -7.7103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8326   -6.5839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0987   -6.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4063   -6.5839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4063   -5.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0987   -5.3376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6724   -5.3376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6724   -4.5068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9660   -5.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2507   -5.3376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9660   -6.5839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2507   -6.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6724   -6.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6724   -7.8073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1  9  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  1  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  6  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  2  0  0  0  0\n 31 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 23  1  0  0  0  0\n 26 25  2  0  0  0  0\n 25 27  1  0  0  0  0\n 28 27  1  0  0  0  0\n 27 29  2  0  0  0  0\n 30 29  1  0  0  0  0\n 29 31  1  0  0  0  0\n 32 31  2  0  0  0  0\nM  END",
          "smiles": "CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@](C)(CCC1=C(C)C(=O)C(=C(C)C1=O)C)O",
          "formula": "C29H50O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "351bb156-32ad-472f-aa98-ac7887bba994"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "446.7066",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "87339952-8c66-4891-b0bb-ca28419b6442",
      "version": "13",
      "structure": {
        "id": "83accffa-b848-4a8c-9b87-3cee3542a7ab",
        "molfile": "\n  Marvin  01132106502D          \n\n 32 32  0  0  1  0            999 V2000\n    2.4063   -6.5839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4063   -5.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6724   -5.3376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6724   -4.5068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9660   -5.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9660   -6.5839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6724   -6.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6724   -7.8073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2507   -6.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2507   -5.3376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0987   -5.3376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0987   -6.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8326   -6.5839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5620   -7.0040    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.1512   -7.7103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2682   -6.5978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9883   -7.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6945   -6.5978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4146   -7.0040    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.1208   -6.5978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8410   -7.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5472   -6.5978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2673   -7.0040    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.9735   -6.5978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7075   -7.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3999   -6.5978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1338   -7.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1338   -7.8396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8401   -6.5978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2673   -7.8350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4146   -7.8165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9636   -7.7103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  6  1  0  0  0  0\n 10  5  1  0  0  0  0\n 11  2  1  0  0  0  0\n 12  1  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  1  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 27  1  0  0  0  0\n 23 30  1  1  0  0  0\n 19 31  1  1  0  0  0\n 14 32  1  6  0  0  0\nM  END",
        "smiles": "CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@](C)(CCC1=C(C)C(=O)C(=C(C)C1=O)C)O",
        "formula": "C29H50O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "446.7066",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b7b3d210-64f1-4a26-a578-eed5f1b83cc7",
          "b98118d7-d509-41dc-84fb-53e32cce1f54"
        ],
        "stereo_centers": 3
      },
      "unii": "ZO763K43XR"
    }
  ]
}