{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "7dab014a-1495-43d2-8488-a10fe50e9193", "code": "6607-41-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=6607-41-6", "code_system": "CAS", "references": [ "dedf91d6-ff05-4dd2-9cad-4ff7bad6e263", "84416656-d624-4121-9652-a9f3c50058b2" ] }, { "uuid": "2091d4bd-c270-4eb6-8f6b-897ede144717", "code": "2832097", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2832097", "code_system": "PUBCHEM", "references": [ "dedf91d6-ff05-4dd2-9cad-4ff7bad6e263" ] }, { "uuid": "f4da9b50-253e-66bf-14a2-98b0a17f8473", "code": "DTXSID701019794", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID701019794", "code_system": "EPA CompTox" }, { "uuid": "0b6435aa-58db-44e1-9a45-75bdc38aed1e", "code": "ZL3YBC3QFG", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "bd7f6592-31cb-4dbe-97d4-6559de3f0398", "name": "1H-Isoindol-1-one, 2,3-dihydro-3,3-bis(4-hydroxyphenyl)-2-phenyl-", "stdName": "1H-ISOINDOL-1-ONE, 2,3-DIHYDRO-3,3-BIS(4-HYDROXYPHENYL)-2-PHENYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "edef0cdd-c85e-4392-a15c-3915a0284f48", "8225251f-784c-4037-9a57-3ba0bda7d8cd" ], "display_name": false }, { "uuid": "f8e82303-3f27-449d-a0da-bcd514d552bc", "name": "2,3-Dihydro-3,3-bis(4-hydroxyphenyl)-2-phenyl-1H-isoindol-1-one", "stdName": "2,3-DIHYDRO-3,3-BIS(4-HYDROXYPHENYL)-2-PHENYL-1H-ISOINDOL-1-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "84416656-d624-4121-9652-a9f3c50058b2" ], "display_name": false }, { "uuid": "f3f0a595-10c3-4245-8ebc-2c4d5d49d63e", "name": "2-Phenyl-3,3-bis(4-hydroxyphenyl)phthalimidine", "stdName": "2-PHENYL-3,3-BIS(4-HYDROXYPHENYL)PHTHALIMIDINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "edef0cdd-c85e-4392-a15c-3915a0284f48", "8225251f-784c-4037-9a57-3ba0bda7d8cd" ], "display_name": false }, { "uuid": "056a1251-dac5-4afb-a182-86bf6c05d5bd", "name": "3,3-Bis(4-hydroxyphenyl)-2-phenyl-2,3-dihydroisoindol-1-one", "stdName": "3,3-BIS(4-HYDROXYPHENYL)-2-PHENYL-2,3-DIHYDROISOINDOL-1-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "edef0cdd-c85e-4392-a15c-3915a0284f48", "8225251f-784c-4037-9a57-3ba0bda7d8cd" ], "display_name": false }, { "uuid": "d487c6de-bd8e-45cc-be40-5ba5ea54ac08", "name": "N-Phenyl 3,3-bis(4-hydroxyphenyl)phthalimide", "stdName": "N-PHENYL 3,3-BIS(4-HYDROXYPHENYL)PHTHALIMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "edef0cdd-c85e-4392-a15c-3915a0284f48", "8225251f-784c-4037-9a57-3ba0bda7d8cd" ], "display_name": false }, { "uuid": "f69021cb-3ec1-44b3-95ad-df94b83e21c6", "name": "Phenolphthalein anilide", "stdName": "PHENOLPHTHALEIN ANILIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "edef0cdd-c85e-4392-a15c-3915a0284f48", "8225251f-784c-4037-9a57-3ba0bda7d8cd" ], "display_name": true }, { "uuid": "74056684-9216-4f78-9f21-15121a5a73cc", "name": "Phthalimidine, 3,3-bis(p-hydroxyphenyl)-2-phenyl-", "stdName": "PHTHALIMIDINE, 3,3-BIS(P-HYDROXYPHENYL)-2-PHENYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "edef0cdd-c85e-4392-a15c-3915a0284f48", "8225251f-784c-4037-9a57-3ba0bda7d8cd" ], "display_name": false } ], "references": [ { "uuid": "8225251f-784c-4037-9a57-3ba0bda7d8cd", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "edef0cdd-c85e-4392-a15c-3915a0284f48", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dedf91d6-ff05-4dd2-9cad-4ff7bad6e263", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392206000, "tags": [ "NOMEN" ] }, { "uuid": "84416656-d624-4121-9652-a9f3c50058b2", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "6b837e45-19aa-44ee-8ec1-fb5a22cf6ab3", "id": "6b837e45-19aa-44ee-8ec1-fb5a22cf6ab3", "molfile": "\n Marvin 01132105352D \n\n 30 34 0 0 0 0 999 V2000\n -2.0351 2.5896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7260 1.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2340 1.1746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9249 0.4096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1079 0.2948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6000 0.9449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9091 1.7099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7989 -0.4701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3140 -1.1375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7989 -1.8050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5439 -2.5896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5835 -1.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2980 -1.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0124 -1.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0124 -0.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2980 -0.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5835 -0.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3624 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7749 -0.4231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5999 -0.4231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0124 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5999 -1.8520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7749 -1.8520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0844 -0.0576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0844 0.7674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6301 1.1799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3445 0.7674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0590 1.1799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3445 -0.0576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6301 -0.4701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 7 2 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 8 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 17 1 0 0 0 0\n 8 24 1 0 0 0 0\n 10 9 1 0 0 0 0\n 9 18 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 17 12 2 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 23 2 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 30 2 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 2 0 0 0 0\n 29 30 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)N2C(=O)c3ccccc3C2(c4ccc(cc4)O)c5ccc(cc5)O", "formula": "C26H19NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "7001a537-8f75-4c85-97cf-987ee5d6eab8" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "393.4349", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "fa00f333-29d7-499b-a994-d1193715ad44", "version": "5", "structure": { "id": "d9067c67-c45d-49fc-8c32-c4f6a752db38", "molfile": "\n Marvin 01132111152D \n\n 30 34 0 0 0 0 999 V2000\n -0.7989 -1.8050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3140 -1.1375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7989 -0.4701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5835 -0.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2980 -0.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0124 -0.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0124 -1.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2980 -1.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5835 -1.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5439 -2.5896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3624 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7749 -0.4231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5999 -0.4231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0124 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5999 -1.8520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7749 -1.8520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1079 0.2948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9249 0.4096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2340 1.1746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7260 1.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9091 1.7099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6000 0.9449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0351 2.5896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0844 -0.0576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0844 0.7674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6301 1.1799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3445 0.7674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3445 -0.0576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6301 -0.4701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0590 1.1799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 1 9 1 0 0 0 0\n 4 9 2 0 0 0 0\n 1 10 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 11 16 2 0 0 0 0\n 2 11 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 17 22 2 0 0 0 0\n 20 23 1 0 0 0 0\n 3 17 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 24 29 2 0 0 0 0\n 27 30 1 0 0 0 0\n 3 24 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)N2C(=O)c3ccccc3C2(c4ccc(cc4)O)c5ccc(cc5)O", "formula": "C26H19NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "393.4349", "optical_activity": "NONE", "references": [ "8225251f-784c-4037-9a57-3ba0bda7d8cd" ], "stereo_centers": 0 }, "unii": "ZL3YBC3QFG" } ] }