{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "459454f2-e07b-49bb-904a-a06cc247709a", "code": "42774-15-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=42774-15-2", "code_system": "CAS", "references": [ "9165d886-5546-4401-a7f4-3d3d4cc477b1", "107cad39-398d-4343-a2ed-17d339b688ee" ] }, { "uuid": "a503da86-7c2e-4186-b9c5-87bd8a56b719", "code": "6451919", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6451919", "code_system": "PUBCHEM", "references": [ "9165d886-5546-4401-a7f4-3d3d4cc477b1" ] }, { "uuid": "9ad49ee6-5564-18e8-3188-cbb7c08ae87b", "code": "DTXSID3068417", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3068417", "code_system": "EPA CompTox", "references": [ "bc0ba8b0-c9d6-4817-2a6a-9f0565a41a02" ] }, { "uuid": "cc163640-3d2a-475d-b5c4-d3a9d61c726e", "code": "ZJD6FK539H", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "33ccd547-e060-4f84-a10d-268feb7baed5", "name": "1,3-BENZENEDICARBOXAMIDE, N1,N3-BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDINYL)-", "stdName": "1,3-BENZENEDICARBOXAMIDE, N1,N3-BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDINYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7cbaa22c-7cf2-4ccb-b84a-948910c4716e", "01150c98-5ebb-460f-a75a-10637b2c2595" ], "display_name": false }, { "uuid": "55498c1b-b97b-4034-865b-3cbd58a3113f", "name": "N,N'-BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDINYL)-1,3-BENZENEDICARBOXAMIDE", "stdName": "N,N'-BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDINYL)-1,3-BENZENEDICARBOXAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7cbaa22c-7cf2-4ccb-b84a-948910c4716e", "01150c98-5ebb-460f-a75a-10637b2c2595" ], "display_name": false }, { "uuid": "e2e606ae-4179-4ff9-aa0b-f11d8538ebb3", "name": "N,N'-BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDINYL)ISOPHTHALAMIDE", "stdName": "N,N'-BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDINYL)ISOPHTHALAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7cbaa22c-7cf2-4ccb-b84a-948910c4716e", "01150c98-5ebb-460f-a75a-10637b2c2595" ], "display_name": false }, { "uuid": "a920b1e3-4f26-4f27-a5b9-2600b96223ef", "name": "N,N'-BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDYL)ISOPHTHALAMIDE", "stdName": "N,N'-BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDYL)ISOPHTHALAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7cbaa22c-7cf2-4ccb-b84a-948910c4716e", "01150c98-5ebb-460f-a75a-10637b2c2595" ], "display_name": false }, { "uuid": "347d413b-a4a7-406d-b8c1-18e18877b4ee", "name": "N1,N3-BIS(2,2,6,6-TETRAMETHYLPIPERIDIN-4-YL)ISOPHTHALAMIDE", "stdName": "N1,N3-BIS(2,2,6,6-TETRAMETHYLPIPERIDIN-4-YL)ISOPHTHALAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "107cad39-398d-4343-a2ed-17d339b688ee" ], "display_name": true }, { "uuid": "66052465-0fe3-4969-b205-83a6dc0d288f", "name": "NYLOSTAB S-EED", "stdName": "NYLOSTAB S-EED", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "7cbaa22c-7cf2-4ccb-b84a-948910c4716e", "01150c98-5ebb-460f-a75a-10637b2c2595" ], "display_name": false } ], "references": [ { "uuid": "7cbaa22c-7cf2-4ccb-b84a-948910c4716e", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "01150c98-5ebb-460f-a75a-10637b2c2595", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9165d886-5546-4401-a7f4-3d3d4cc477b1", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393329000, "tags": [ "NOMEN" ] }, { "uuid": "bc0ba8b0-c9d6-4817-2a6a-9f0565a41a02", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=42774-15-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "107cad39-398d-4343-a2ed-17d339b688ee", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b8bb5ffa-6e31-4b39-aae7-b2a75765f8aa", "id": "b8bb5ffa-6e31-4b39-aae7-b2a75765f8aa", "molfile": "\n Marvin 01132109332D \n\n 32 34 0 0 0 0 999 V2000\n 15.9095 -4.3175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0971 -4.4608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3793 -5.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3826 -4.8733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6681 -4.4608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6681 -3.6358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3826 -3.2232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9128 -2.5912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8522 -2.5912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0971 -3.6358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9536 -4.8733 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9536 -5.6983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6681 -6.1108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2391 -6.1108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2391 -6.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5246 -7.3483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8101 -6.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8101 -6.1108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5246 -5.6983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0956 -5.6983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3811 -6.1108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0956 -4.8733 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3811 -4.4608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3811 -3.6358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6666 -3.2232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1969 -2.5912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1364 -2.5912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9522 -3.6358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9521 -4.4608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6699 -5.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1397 -4.3175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6666 -4.8733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 1 0 0 0 0\n 2 10 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 11 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 7 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 19 2 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 18 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 20 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 32 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 27 1 0 0 0 0\n 25 28 1 0 0 0 0\n 29 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 1 0 0 0 0\n 32 29 1 0 0 0 0\nM END", "smiles": "CC1(C)CC(CC(C)(C)N1)NC(=O)c2cccc(c2)C(=O)NC3CC(C)(C)NC(C)(C)C3", "formula": "C26H42N4O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "2d58150b-4273-45d8-8fc9-190469028730" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "442.6383", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "f2d92b0a-65e6-4b52-bad7-f0014dabb028", "version": "7", "structure": { "id": "a3e16130-ee22-4573-a4a0-6d4ec5693790", "molfile": "\n Marvin 01132108312D \n\n 32 34 0 0 0 0 999 V2000\n 12.9536 -4.8733 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6681 -4.4608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3826 -4.8733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0971 -4.4608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9095 -4.3175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3793 -5.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0971 -3.6358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3826 -3.2232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9128 -2.5912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8522 -2.5912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6681 -3.6358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9536 -5.6983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2391 -6.1108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2391 -6.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5246 -7.3483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8101 -6.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8101 -6.1108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0956 -5.6983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3811 -6.1108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0956 -4.8733 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3811 -4.4608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3811 -3.6358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6666 -3.2232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1969 -2.5912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1364 -2.5912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9522 -3.6358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9521 -4.4608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6699 -5.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1397 -4.3175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6666 -4.8733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5246 -5.6983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6681 -6.1108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 6 1 0 0 0 0\n 4 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 11 8 1 0 0 0 0\n 2 11 1 0 0 0 0\n 1 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 23 26 1 0 0 0 0\n 27 26 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 1 0 0 0 0\n 30 27 1 0 0 0 0\n 21 30 1 0 0 0 0\n 31 17 1 0 0 0 0\n 13 31 2 0 0 0 0\n 12 32 2 0 0 0 0\nM END", "smiles": "CC1(C)CC(CC(C)(C)N1)NC(=O)c2cccc(c2)C(=O)NC3CC(C)(C)NC(C)(C)C3", "formula": "C26H42N4O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "442.6383", "optical_activity": "NONE", "references": [ "7cbaa22c-7cf2-4ccb-b84a-948910c4716e" ], "stereo_centers": 0 }, "unii": "ZJD6FK539H" } ] }