{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d97c3947-7120-49ba-9375-40d24951b249",
          "code": "17861-60-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=17861-60-8",
          "code_system": "CAS",
          "references": [
            "1b827cd0-ccc3-4ebc-96b9-e8b88b72f074",
            "5a583b76-e431-4438-bfd3-c96a9445f457"
          ]
        },
        {
          "uuid": "4db9a3f5-059f-4bf4-8855-6cfcfa1bc1f2",
          "code": "1607328",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1607328/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "1b827cd0-ccc3-4ebc-96b9-e8b88b72f074"
          ]
        },
        {
          "uuid": "742503db-88e8-49b1-8ce0-0cdefec13308",
          "code": "140291",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/140291",
          "code_system": "PUBCHEM",
          "references": [
            "1b827cd0-ccc3-4ebc-96b9-e8b88b72f074"
          ]
        },
        {
          "uuid": "e6838b6d-8381-0d4b-ae9b-82a4fc8f82fb",
          "code": "DTXSID80170518",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80170518",
          "code_system": "EPA CompTox",
          "references": [
            "00fb001e-11d7-72d6-5004-1bab969afa9e"
          ]
        },
        {
          "uuid": "2b3a6cbe-fdbd-4920-9c29-0e8cbc58b6e0",
          "code": "ZH1WJO5481",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0f3f0379-af98-a9b9-c349-48d08b44dc77",
          "code": "ZH1WJO5481",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=ZH1WJO5481",
          "code_system": "DAILYMED",
          "references": [
            "871b1339-b43d-d795-348b-30fdb235fd08"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "15ff6dfc-b550-43a6-8200-2ff548bbcf2f",
          "name": "3-ETHYL-1,1,1,3,5,5,5-HEPTAMETHYLTRISILOXANE",
          "stdName": "3-ETHYL-1,1,1,3,5,5,5-HEPTAMETHYLTRISILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41a918de-994a-416d-9fae-670aee75a7a4",
            "b3efa472-7989-4f71-9b57-0b895fd77d74"
          ],
          "display_name": false
        },
        {
          "uuid": "1f1143fe-8a8f-49ae-868a-f5d5f975f6e9",
          "name": "3-ETHYLHEPTAMETHYLTRISILOXANE",
          "stdName": "3-ETHYLHEPTAMETHYLTRISILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4099f93-39d1-4814-a7b0-233c7d319b1e",
            "b3efa472-7989-4f71-9b57-0b895fd77d74"
          ],
          "display_name": false
        },
        {
          "uuid": "c7cbb6b2-7829-4393-ba63-2630afa42e90",
          "name": "BOTANISIL VS-3",
          "stdName": "BOTANISIL VS-3",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4099f93-39d1-4814-a7b0-233c7d319b1e",
            "b3efa472-7989-4f71-9b57-0b895fd77d74"
          ],
          "display_name": false
        },
        {
          "uuid": "642fdc6d-b5e9-459b-a458-640077480bc9",
          "name": "ETHYL TRISILOXANE",
          "stdName": "ETHYL TRISILOXANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3b53da0-70f4-4fc8-bb05-061240be19ac",
            "b4099f93-39d1-4814-a7b0-233c7d319b1e",
            "b3efa472-7989-4f71-9b57-0b895fd77d74"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "bf170eff-9071-4087-bfa2-7d24865f2c9d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "af837b00-9380-4e64-a28d-4038213cc5c6",
          "name": "SILSOFT ETS",
          "stdName": "SILSOFT ETS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4099f93-39d1-4814-a7b0-233c7d319b1e",
            "b3efa472-7989-4f71-9b57-0b895fd77d74"
          ],
          "display_name": false
        },
        {
          "uuid": "8ba7a813-d501-4e5e-b1ef-00220bb6a026",
          "name": "TRISILOXANE, 3-ETHYL-1,1,1,3,5,5,5-HEPTAMETHYL-",
          "stdName": "TRISILOXANE, 3-ETHYL-1,1,1,3,5,5,5-HEPTAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41a918de-994a-416d-9fae-670aee75a7a4",
            "b3efa472-7989-4f71-9b57-0b895fd77d74"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b4099f93-39d1-4814-a7b0-233c7d319b1e",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b3efa472-7989-4f71-9b57-0b895fd77d74",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "41a918de-994a-416d-9fae-670aee75a7a4",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b827cd0-ccc3-4ebc-96b9-e8b88b72f074",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391523000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dfa1c35e-c538-4f2f-92d3-4ff0f942cc56",
          "citation": "SRS import [ZH1WJO5481]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ZH1WJO5481",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391523000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d3b53da0-70f4-4fc8-bb05-061240be19ac",
          "citation": "ETHYL TRISILOXANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "00fb001e-11d7-72d6-5004-1bab969afa9e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=17861-60-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5a583b76-e431-4438-bfd3-c96a9445f457",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "871b1339-b43d-d795-348b-30fdb235fd08",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4aa1f45c-012e-4f7d-8b61-d59135b46ad7",
          "id": "4aa1f45c-012e-4f7d-8b61-d59135b46ad7",
          "molfile": "\n  Marvin  01132103542D          \n\n 14 13  0  0  0  0            999 V2000\n    8.2703   -3.1674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8740   -3.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8740   -4.6862    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    7.8740   -5.5109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1712   -5.1182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4455   -4.7257    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    5.7427   -5.1577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4455   -3.9009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7198   -4.3330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5996   -5.0789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3025   -4.6467    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   10.0282   -5.0394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9533   -3.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8963   -3.9745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  1  0  0  0  0\n 10  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  6  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 11  1  0  0  0  0\nM  END",
          "smiles": "CC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C",
          "formula": "C9H26O2Si3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8ac68357-ca4c-47e3-a1e8-334979cc7ede"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "250.558",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e906c7f7-a7e1-4667-8c12-3d16577e33da",
      "version": "6",
      "structure": {
        "id": "318fbbed-4a08-473a-a73d-a407a1f61382",
        "molfile": "\n  Marvin  01132102392D          \n\n 14 13  0  0  0  0            999 V2000\n    7.8740   -4.6862    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    7.1712   -5.1182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4455   -4.7257    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    5.7427   -5.1577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4455   -3.9009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7198   -4.3330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5996   -5.0789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3025   -4.6467    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   10.0282   -5.0394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9533   -3.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8963   -3.9745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8740   -3.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2703   -3.1674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8740   -5.5109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11  8  1  0  0  0  0\n 12  1  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14  1  1  0  0  0  0\nM  END",
        "smiles": "CC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C",
        "formula": "C9H26O2Si3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "250.558",
        "optical_activity": "NONE",
        "references": [
          "dfa1c35e-c538-4f2f-92d3-4ff0f942cc56",
          "41a918de-994a-416d-9fae-670aee75a7a4"
        ],
        "stereo_centers": 0
      },
      "unii": "ZH1WJO5481"
    }
  ]
}