{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0dc594d1-3f15-4688-b50a-963544e35e40",
          "code": "Isotonitazene",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Isotonitazene",
          "code_system": "WIKIPEDIA"
        },
        {
          "uuid": "66b0d4fb-1fc6-474c-8869-238e72f374ad",
          "code": "14188-81-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14188-81-9",
          "code_system": "CAS",
          "references": [
            "cb3326d7-847b-4560-9359-7b76539df43a"
          ]
        },
        {
          "uuid": "6ff09d17-70f9-4d41-8c5d-1ae9e4f0e589",
          "code": "9614",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I.|Opiates",
          "type": "PRIMARY",
          "url": "https://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "b7817eb5-1557-46ec-8d0c-86ca760cb503"
          ]
        },
        {
          "uuid": "2986fdee-e7ce-4cb6-9551-25c84f77c62a",
          "code": "ZFY1ZBQ8AV",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8ea6e3c3-e3f4-c4e1-856d-f9695db72d10",
          "code": "145721979",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/145721979",
          "code_system": "PUBCHEM",
          "references": [
            "03a648ed-d147-077a-7481-897351214e2d"
          ]
        },
        {
          "uuid": "040b1859-da56-b43b-fd1c-b9c9b2db8ae6",
          "code": "Designer-drugs-Isotonitazene",
          "comments": "Wikipedia|List of designer drugs|Sedatives|Opioids",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "fd6ef4a0-7dec-5dd4-c423-962f5bb08b87"
          ]
        },
        {
          "uuid": "dc3d3fa3-a057-da86-dfad-866d90cc100d",
          "code": "DTXSID201126188",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201126188",
          "code_system": "EPA CompTox",
          "references": [
            "74d6c30f-a99f-06f3-1b43-594d43ad2a54"
          ]
        },
        {
          "uuid": "41f452fc-ca18-4d4c-f813-1bfb5ff54719",
          "code": "300000039874",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "7c71f416-cf6f-7f60-0b20-422a0164a415"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "307fa10a-0510-2804-f4b0-e25d999b6d93",
          "citation": "https://en.wikipedia.org/wiki/Isotonitazene",
          "url": "https://en.wikipedia.org/wiki/Isotonitazene",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cb3326d7-847b-4560-9359-7b76539df43a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a1240a04-9b65-a1e2-49c4-8ad2cd40c56f",
          "citation": "Report on a novel emerging class of highly potent benzimidazole NPS opioids:\nPeter Blanckaert  Annelies Cannaert  Blanckaert, Peter; Cannaert, Annelies; Uytfanghe, Katleen Van; Hulpia, Fabian; Deconinck, Eric; Calenbergh, Serge Van; Stove, Christophe. \"Report on a novel emerging class of highly potent benzimidazole NPS opioids:\". Drug Testing and Analysis. n/a (n/a). doi:10.1002/dta.2738. ISSN 1942-7611",
          "url": "https://doi.org/10.1002/dta.2738",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "7d761806-6b76-406b-8e19-82af76fc7e33",
          "citation": "https://www.fox5dc.com/news/exclusive-new-drug-in-dc-is-as-strong-as-fentanyl-dea-says",
          "url": "https://www.fox5dc.com/news/exclusive-new-drug-in-dc-is-as-strong-as-fentanyl-dea-says",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "03a648ed-d147-077a-7481-897351214e2d",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "851471be-daf2-4f5e-9038-ffffb7cf6b31",
          "citation": "Vandeputte, Marthe M., et al. \"Synthesis, Chemical Characterization, and μ-Opioid Receptor Activity Assessment of the Emerging Group of “Nitazene” 2-Benzylbenzimidazole Synthetic Opioids.\" ACS Chemical Neuroscience 12.7 (2021): 1241-1251.",
          "url": "https://pubs.acs.org/doi/pdf/10.1021/acschemneuro.1c00064",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "83e4f0ed-c57b-447d-8cd6-c4a0337b9128",
          "citation": "Vandeputte, Marthe M., et al. \"Synthesis, Chemical Characterization, and μ-Opioid Receptor Activity Assessment of the Emerging Group of “Nitazene” 2-Benzylbenzimidazole Synthetic Opioids.\" ACS Chemical Neuroscience 12.7 (2021): 1241-1251.",
          "url": "https://pubs.acs.org/doi/pdf/10.1021/acschemneuro.1c00064",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4aa73c74-922a-47a9-8020-3f99ccb08b54",
          "citation": "Vandeputte, Marthe M., et al. \"Synthesis, Chemical Characterization, and μ-Opioid Receptor Activity Assessment of the Emerging Group of “Nitazene” 2-Benzylbenzimidazole Synthetic Opioids.\" ACS Chemical Neuroscience 12.7 (2021): 1241-1251.",
          "url": "https://pubs.acs.org/doi/pdf/10.1021/acschemneuro.1c00064",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "da0d0842-437d-42e1-8f9f-39d77aa8e310",
          "citation": "Vandeputte, Marthe M., et al. \"Synthesis, Chemical Characterization, and μ-Opioid Receptor Activity Assessment of the Emerging Group of “Nitazene” 2-Benzylbenzimidazole Synthetic Opioids.\" ACS Chemical Neuroscience 12.7 (2021): 1241-1251.",
          "url": "https://pubs.acs.org/doi/pdf/10.1021/acschemneuro.1c00064",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "1c64da35-42e7-4a23-8c38-155863acb10c",
          "citation": "Vandeputte, Marthe M., et al. \"Synthesis, Chemical Characterization, and μ-Opioid Receptor Activity Assessment of the Emerging Group of “Nitazene” 2-Benzylbenzimidazole Synthetic Opioids.\" ACS Chemical Neuroscience 12.7 (2021): 1241-1251.",
          "url": "https://pubs.acs.org/doi/pdf/10.1021/acschemneuro.1c00064",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b7817eb5-1557-46ec-8d0c-86ca760cb503",
          "citation": "Electronic Code of Federal Regulations",
          "url": "https://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fd6ef4a0-7dec-5dd4-c423-962f5bb08b87",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "74d6c30f-a99f-06f3-1b43-594d43ad2a54",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "7c71f416-cf6f-7f60-0b20-422a0164a415",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d4fb1105-d883-5478-9648-2c4da0fbc9cc",
          "id": "d4fb1105-d883-5478-9648-2c4da0fbc9cc",
          "molfile": "\n  Marvin  01132111022D          \n\n 30 32  0  0  0  0            999 V2000\n   17.4154   -7.4187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6704   -8.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9675   -6.8056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7125   -6.0210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9055   -5.8494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6506   -5.0648    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1355   -4.3974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6506   -3.7299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8660   -3.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8660   -4.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1515   -5.2224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4370   -4.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4370   -3.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1515   -3.5724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7226   -3.5724    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   13.7226   -2.7474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0081   -3.9849    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   17.9605   -4.3974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3730   -3.6829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1980   -3.6829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.6105   -2.9684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1980   -2.2540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3730   -2.2540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9605   -2.9684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.6105   -1.5395    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4355   -1.5395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8480   -2.2540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8480   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7744   -6.9771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.0294   -7.7617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 29  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 10  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7 18  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 14  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 19 24  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 22 25  1  0  0  0  0\n 23 24  2  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  1  0  0  0  0\n 29 30  1  0  0  0  0\nM  CHG  2  15   1  17  -1\nM  END",
          "smiles": "CCN(CC)CCn1c2ccc(cc2nc1Cc3ccc(cc3)OC(C)C)[N+](=O)[O-]",
          "formula": "C23H30N4O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9746e9d1-3bbc-4b9e-af74-9de64f75c302"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "410.5102",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ea5dbc79-3268-4632-91df-cce36aa2fbb2",
      "version": "18",
      "structure": {
        "id": "f27bde48-444c-dfe9-3c22-1ab3bdc4b154",
        "molfile": "\n  Marvin  01132112352D          \n\n 30 32  0  0  0  0            999 V2000\n   17.4154   -7.4187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6704   -8.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9675   -6.8056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7125   -6.0210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9055   -5.8494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6506   -5.0648    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1355   -4.3974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6506   -3.7299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8660   -3.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8660   -4.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1515   -5.2224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4370   -4.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4370   -3.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1515   -3.5724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7226   -3.5724    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   13.7226   -2.7474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0081   -3.9849    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   17.9605   -4.3974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3730   -3.6829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1980   -3.6829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.6105   -2.9684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1980   -2.2540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3730   -2.2540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9605   -2.9684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.6105   -1.5395    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4355   -1.5395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8480   -2.2540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8480   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7744   -6.9771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.0294   -7.7617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  6 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n  9 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n  7 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 19 24  1  0  0  0  0\n 22 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  1  0  0  0  0\n  3 29  1  0  0  0  0\n 29 30  1  0  0  0  0\nM  CHG  2  15   1  17  -1\nM  END",
        "smiles": "CCN(CC)CCn1c2ccc(cc2nc1Cc3ccc(cc3)OC(C)C)[N+](=O)[O-]",
        "formula": "C23H30N4O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "410.5102",
        "optical_activity": "NONE",
        "references": [
          "b7817eb5-1557-46ec-8d0c-86ca760cb503"
        ],
        "stereo_centers": 0
      },
      "unii": "ZFY1ZBQ8AV",
      "relationships": [
        {
          "uuid": "7cb75147-f39e-458e-a005-5d831a1b35d9",
          "amount": {
            "uuid": "35d37ef8-c623-4028-b50e-9784110c092a"
          },
          "type": "ACTIVE MOIETY",
          "references": [
            "a1240a04-9b65-a1e2-49c4-8ad2cd40c56f"
          ],
          "related_substance": {
            "uuid": "144419cb-7c37-4c59-9902-19b88cb077e5",
            "refuuid": "ea5dbc79-3268-4632-91df-cce36aa2fbb2",
            "name": "ISOTONITAZENE",
            "unii": "ZFY1ZBQ8AV",
            "linking_id": "ZFY1ZBQ8AV",
            "ref_pname": "ISOTONITAZENE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "bdf41ab9-6fcc-45e9-9274-d7999e2e1f93",
          "amount": {
            "uuid": "f4fac543-cd46-4a3f-b7d3-1a0b19301207",
            "average": 11.1,
            "units": "NANOMOLAR"
          },
          "comments": "Emax 180 of hydromorphone",
          "qualification": "EC50",
          "type": "TARGET->AGONIST",
          "interaction_type": "BIOASSAY (CELLULAR)",
          "references": [
            "a1240a04-9b65-a1e2-49c4-8ad2cd40c56f"
          ],
          "related_substance": {
            "uuid": "e5e21d4c-3735-4430-bfc0-0dc9915c0434",
            "refuuid": "39262e4f-d963-4b83-9b34-52fd55036f0e",
            "name": "MU-TYPE OPIOID RECEPTOR",
            "unii": "1PE72K8X46",
            "linking_id": "1PE72K8X46",
            "ref_pname": "MU-TYPE OPIOID RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0484d901-0e4b-467a-800a-0562534e06e4",
          "amount": {
            "uuid": "04990e89-6bec-40b1-aaa2-183969820c4f",
            "average": 1.63,
            "high": 2.28,
            "low": 1.17,
            "units": "NANOMOLAR"
          },
          "comments": "Emax = 140% of Fentanyl",
          "qualification": "EC50",
          "type": "TARGET->AGONIST",
          "references": [
            "4aa73c74-922a-47a9-8020-3f99ccb08b54"
          ],
          "related_substance": {
            "uuid": "3aa4777c-3295-4ba5-8579-e11142e96005",
            "refuuid": "39262e4f-d963-4b83-9b34-52fd55036f0e",
            "name": "MU-TYPE OPIOID RECEPTOR",
            "unii": "1PE72K8X46",
            "linking_id": "1PE72K8X46",
            "ref_pname": "MU-TYPE OPIOID RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c4bf83ef-c748-4a94-9565-f829145ba5e5",
          "amount": {
            "uuid": "f45aec0f-438a-45a2-98e9-ed030e10aafa"
          },
          "type": "METABOLITE LESS ACTIVE->PARENT",
          "references": [
            "1c64da35-42e7-4a23-8c38-155863acb10c"
          ],
          "related_substance": {
            "uuid": "7eac1c62-dd85-4f2e-9c78-4132c27d51e1",
            "refuuid": "ceb6dd21-6b67-4471-b504-d96b8474d40d",
            "name": "5-AMINOISOTONITAZENE",
            "unii": "RK98SSC5RK",
            "linking_id": "RK98SSC5RK",
            "ref_pname": "5-AMINOISOTONITAZENE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c69be0ba-d45e-4dde-b20d-c9cb92987803",
          "amount": {
            "uuid": "39d844a9-d18b-45bb-a5b9-39700b7ebd1c"
          },
          "type": "METABOLITE ACTIVE->PARENT",
          "references": [
            "83e4f0ed-c57b-447d-8cd6-c4a0337b9128"
          ],
          "related_substance": {
            "uuid": "19136194-f123-428e-bf29-8ba9e42b45f8",
            "refuuid": "eb440e49-640a-4672-be1e-9cd1930520c7",
            "name": "N-DESETHYLISOTONITAZENE",
            "unii": "T7LMM4S8UR",
            "linking_id": "T7LMM4S8UR",
            "ref_pname": "N-DESETHYLISOTONITAZENE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "72ce873b-61b9-4e05-ae7a-8e2b030d8133",
          "amount": {
            "uuid": "2ca17da4-316d-4037-8969-a31a4a6dc300"
          },
          "type": "METABOLITE LESS ACTIVE->PARENT",
          "references": [
            "da0d0842-437d-42e1-8f9f-39d77aa8e310"
          ],
          "related_substance": {
            "uuid": "e10f376b-523c-422c-9818-ac4f1cd21acf",
            "refuuid": "a6674726-a242-4f77-afb5-d010bdc93d28",
            "name": "4'-HYDROXYLNITAZENE",
            "unii": "SW434WNL25",
            "linking_id": "SW434WNL25",
            "ref_pname": "4'-HYDROXYLNITAZENE",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "a49592fd-c596-4c55-94a5-8e0a26839a2c",
          "name": "ISO (OPIOID RECEPTOR AGONIST)",
          "stdName": "ISO (OPIOID RECEPTOR AGONIST)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d761806-6b76-406b-8e19-82af76fc7e33"
          ],
          "display_name": false
        },
        {
          "uuid": "968261f4-dfd8-d0d6-f721-12514a33df1f",
          "name": "ISOTONITAZENE",
          "stdName": "ISOTONITAZENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "307fa10a-0510-2804-f4b0-e25d999b6d93"
          ],
          "display_name": true
        },
        {
          "uuid": "ec0e7181-ea5e-4093-a395-26e99951d195",
          "name": "N,N-DIETHYL-2-((4-(1-METHYLETHOXY)PHENYL)METHYL)-5-NITRO-1H-BENZIMIDAZOLE-1-ETHANAMINE",
          "stdName": "N,N-DIETHYL-2-((4-(1-METHYLETHOXY)PHENYL)METHYL)-5-NITRO-1H-BENZIMIDAZOLE-1-ETHANAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7817eb5-1557-46ec-8d0c-86ca760cb503"
          ],
          "display_name": false
        },
        {
          "uuid": "22f0b188-bd32-df11-4fb5-6cef5fbb6882",
          "name": "N,N-DIETHYL-2-(2-((4-ISOPROPOXYPHENYL)METHYL)-5-NITRO-BENZIMIDAZOL-1-YL)ETHANAMINE",
          "stdName": "N,N-DIETHYL-2-(2-((4-ISOPROPOXYPHENYL)METHYL)-5-NITRO-BENZIMIDAZOL-1-YL)ETHANAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "307fa10a-0510-2804-f4b0-e25d999b6d93"
          ],
          "display_name": false
        },
        {
          "uuid": "a5179de3-cc3f-47bd-8c0a-b1cf6dba97c3",
          "name": "N,N-DIETHYL-2-(2-(4 ISOPROPOXYBENZYL)-5-NITRO-1H-BENZIMIDAZOL-1-YL)ETHAN-1-AMINE",
          "stdName": "N,N-DIETHYL-2-(2-(4 ISOPROPOXYBENZYL)-5-NITRO-1H-BENZIMIDAZOL-1-YL)ETHAN-1-AMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7817eb5-1557-46ec-8d0c-86ca760cb503"
          ],
          "display_name": false
        },
        {
          "uuid": "a785bf1e-97b1-4fe8-b3d0-9620206c5cc8",
          "name": "TONI",
          "stdName": "TONI",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d761806-6b76-406b-8e19-82af76fc7e33"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "21273483-5444-4a62-afad-35c0d3108fde"
      }
    }
  ]
}