{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "0b20329f-f095-4684-b404-cd77238e29bf", "code": "27214-90-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=27214-90-0", "code_system": "CAS", "references": [ "ac30eb0d-e4a3-4397-91d5-aeeeba60135d", "4539f707-6f7a-4d9e-8436-61dc57903053" ] }, { "uuid": "5927afbf-9545-4a7d-a786-6d6b08260487", "code": "248-333-2", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.043.925", "code_system": "ECHA (EC/EINECS)", "references": [ "ac30eb0d-e4a3-4397-91d5-aeeeba60135d" ] }, { "uuid": "4a97d39c-4a6f-4880-b55e-c7ee0b3b9d22", "code": "117949", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/117949", "code_system": "PUBCHEM", "references": [ "ac30eb0d-e4a3-4397-91d5-aeeeba60135d" ] }, { "uuid": "737c35be-8553-a186-30c1-d20c110ee5c3", "code": "DTXSID3067287", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3067287", "code_system": "EPA CompTox", "references": [ "01c314cd-5310-383a-2a7b-7e890906927e" ] }, { "uuid": "4aeae4fa-ecb6-4cc2-a8ef-ef7477eee2d5", "code": "ZD1TEK0P5Y", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "37b1407e-9f55-421b-8f80-94ea42286e9a", "name": "DECANEDIOIC ACID, 1,10-DIISOOCTYL ESTER", "stdName": "DECANEDIOIC ACID, 1,10-DIISOOCTYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2abd6751-c651-4090-a3b8-aa9f57aa1e40", "ac96e276-6969-4cc3-a173-6c74b2500f56" ], "display_name": false }, { "uuid": "1da3313f-ed62-4ec0-8be5-eb8ab03963e9", "name": "DIISOOCTYL SEBACATE", "stdName": "DIISOOCTYL SEBACATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "2416ca0c-267d-42c6-9c0a-fffd1f28a4b6", "3a2410e3-2428-42b8-a3c5-6e421812c89e", "1c651d1a-17cd-4df1-be39-2d684087c13c", "ac96e276-6969-4cc3-a173-6c74b2500f56" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "42110ed7-6f74-4992-a28e-2aee4603aa31", "name_org": "INCI" } ] }, { "uuid": "0c5002cf-c621-437c-9bd6-a9c463ab6268", "name": "HALLGREEN DCS", "stdName": "HALLGREEN DCS", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2416ca0c-267d-42c6-9c0a-fffd1f28a4b6", "ac96e276-6969-4cc3-a173-6c74b2500f56" ], "display_name": false }, { "uuid": "eaed1fe4-e0cd-4c7b-99ae-30e318907a3c", "name": "NIKKOL GS-DMHS", "stdName": "NIKKOL GS-DMHS", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2416ca0c-267d-42c6-9c0a-fffd1f28a4b6", "ac96e276-6969-4cc3-a173-6c74b2500f56" ], "display_name": false } ], "references": [ { "uuid": "1c651d1a-17cd-4df1-be39-2d684087c13c", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "2416ca0c-267d-42c6-9c0a-fffd1f28a4b6", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ac96e276-6969-4cc3-a173-6c74b2500f56", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2abd6751-c651-4090-a3b8-aa9f57aa1e40", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ac30eb0d-e4a3-4397-91d5-aeeeba60135d", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393357000, "tags": [ "NOMEN" ] }, { "uuid": "99acac23-d27a-42be-996a-7a904501bf9d", "citation": "SRS import [ZD1TEK0P5Y]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ZD1TEK0P5Y", "doc_type": "SRS", "public_domain": true, "document_date": 1493393357000, "tags": [ "NOMEN" ] }, { "uuid": "f4b67856-605a-4166-8581-c79d75eac5f4", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3a2410e3-2428-42b8-a3c5-6e421812c89e", "citation": "DIISOOCTYL SEBACATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "01c314cd-5310-383a-2a7b-7e890906927e", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=27214-90-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4539f707-6f7a-4d9e-8436-61dc57903053", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a689230e-f791-40c2-87f3-195fb64471a6", "id": "a689230e-f791-40c2-87f3-195fb64471a6", "molfile": "\n Marvin 01132108392D \n\n 30 29 0 0 0 0 999 V2000\n 1.6780 -2.8631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6780 -3.6926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9465 -4.0689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3876 -4.1368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3876 -4.9616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0751 -5.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0751 -6.2354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7581 -6.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7581 -7.5090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4456 -7.9531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4456 -8.7780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2038 -7.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2038 -6.7472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9619 -6.3665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9619 -5.5415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7202 -5.1606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7202 -4.3311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4783 -3.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4783 -3.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2099 -2.7445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2099 -1.9195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9194 -3.1885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6557 -2.8123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3652 -3.2564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0967 -2.8755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8063 -3.3197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5425 -2.9387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2520 -3.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9836 -3.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2520 -4.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 2 0 0 0 0\n 12 10 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 2 0 0 0 0\n 22 20 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 28 1 0 0 0 0\nM END", "smiles": "CC(C)CCCCCOC(=O)CCCCCCCCC(=O)OCCCCCC(C)C", "formula": "C26H50O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "24b4b7c6-fa74-4488-beab-0e76b0205191" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "426.6738", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "REPRESENTATIVE", "uuid": "7550a720-6d56-4ed5-b122-985f269de7f9", "version": "4", "structure": { "id": "cd1d39e8-8b16-4637-9944-a0f92ff16c47", "molfile": "\n Marvin 01132110362D \n\n 30 29 0 0 0 0 999 V2000\n 4.4456 -7.9531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4456 -8.7780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7581 -7.5090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7581 -6.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0751 -6.2354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0751 -5.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3876 -4.9616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3876 -4.1368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6780 -3.6926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6780 -2.8631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9465 -4.0689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2038 -7.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2038 -6.7472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9619 -6.3665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9619 -5.5415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7202 -5.1606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7202 -4.3311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4783 -3.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4783 -3.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2099 -2.7445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2099 -1.9195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9194 -3.1885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6557 -2.8123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3652 -3.2564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0967 -2.8755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8063 -3.3197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5425 -2.9387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2520 -3.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9836 -3.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2520 -4.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 1 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 9 1 0 0 0 0\n 12 1 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 2 0 0 0 0\n 22 20 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 28 1 0 0 0 0\nM END", "smiles": "CC(C)CCCCCOC(=O)CCCCCCCCC(=O)OCCCCCC(C)C", "formula": "C26H50O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "426.6738", "optical_activity": "NONE", "references": [ "f4b67856-605a-4166-8581-c79d75eac5f4", "99acac23-d27a-42be-996a-7a904501bf9d" ], "stereo_centers": 0 }, "unii": "ZD1TEK0P5Y" } ] }