{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e2bbc1dc-77eb-40ae-9131-0c7f924663f0",
          "code": "N05BA21",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOLEPTICS|ANXIOLYTICS|Benzodiazepine derivatives|clotiazepam",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N05BA21&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "3e45d5ed-d248-4ef6-a460-a69fe49355e9"
          ]
        },
        {
          "uuid": "869496af-67a7-41b1-9e59-be396da96ca5",
          "code": "33671-46-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=33671-46-4",
          "code_system": "CAS",
          "references": [
            "3e45d5ed-d248-4ef6-a460-a69fe49355e9",
            "c95b4b88-bb12-488b-b3c5-7173876d12b1"
          ]
        },
        {
          "uuid": "2525761c-c6dc-4e4e-a919-c445ee8e6757",
          "code": "C80672",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80672",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3e45d5ed-d248-4ef6-a460-a69fe49355e9"
          ]
        },
        {
          "uuid": "09e5238d-5453-492d-b16f-c3ffacaeebe6",
          "code": "C084599",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67084599",
          "code_system": "MESH",
          "references": [
            "3e45d5ed-d248-4ef6-a460-a69fe49355e9"
          ]
        },
        {
          "uuid": "9b868655-085d-48da-bb4e-5977620f0bf6",
          "code": "CLOTIAZEPAM",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Clotiazepam",
          "code_system": "WIKIPEDIA",
          "references": [
            "3e45d5ed-d248-4ef6-a460-a69fe49355e9"
          ]
        },
        {
          "uuid": "d38b2af6-d9f6-4f93-81ea-eb2c2c917aac",
          "code": "QN05BA21",
          "comments": "VATC|PSYCHOLEPTICS|ANXIOLYTICS|Benzodiazepine derivatives|clotiazepam",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN05BA21&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "3e45d5ed-d248-4ef6-a460-a69fe49355e9"
          ]
        },
        {
          "uuid": "a76c7527-f054-48cd-b129-2d9ac1eee57d",
          "code": "3496",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3496",
          "code_system": "INN",
          "references": [
            "3e45d5ed-d248-4ef6-a460-a69fe49355e9"
          ]
        },
        {
          "uuid": "1950f66a-95eb-4d32-a2bf-95c1a7fbc4c5",
          "code": "251-627-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.046.920",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3e45d5ed-d248-4ef6-a460-a69fe49355e9"
          ]
        },
        {
          "uuid": "bf660874-d196-47d9-b7b1-7efdc0a00a02",
          "code": "2752",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule IV.|Depressants",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "3e45d5ed-d248-4ef6-a460-a69fe49355e9"
          ]
        },
        {
          "uuid": "c348a9d9-3cd0-4923-9ead-c7080b1fa083",
          "code": "m3670",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3670?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3e45d5ed-d248-4ef6-a460-a69fe49355e9"
          ]
        },
        {
          "uuid": "68b89a4f-ec36-436d-9968-87841dbbf5d7",
          "code": "2622",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2622/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "3e45d5ed-d248-4ef6-a460-a69fe49355e9"
          ]
        },
        {
          "uuid": "3b5f6824-496b-4914-a726-6d4c59bfdafd",
          "code": "DB01559",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01559",
          "code_system": "DRUG BANK",
          "references": [
            "3e45d5ed-d248-4ef6-a460-a69fe49355e9"
          ]
        },
        {
          "uuid": "07346686-86df-4077-a677-569e1857754d",
          "code": "SUB06773MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "3e45d5ed-d248-4ef6-a460-a69fe49355e9"
          ]
        },
        {
          "uuid": "d8a9f857-5635-45f8-a74d-88861184c822",
          "code": "CHEMBL1697737",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1697737",
          "code_system": "ChEMBL",
          "references": [
            "3e45d5ed-d248-4ef6-a460-a69fe49355e9"
          ]
        },
        {
          "uuid": "0b0a3291-1a67-499e-919c-6db25a5f8f97",
          "code": "2811",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2811",
          "code_system": "PUBCHEM",
          "references": [
            "3e45d5ed-d248-4ef6-a460-a69fe49355e9"
          ]
        },
        {
          "uuid": "d9e1eb85-633e-6eb0-8521-1f2e156aa862",
          "code": "DTXSID0022852",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0022852",
          "code_system": "EPA CompTox",
          "references": [
            "5f1146ab-1130-ea94-dc19-805f7a1c5182"
          ]
        },
        {
          "uuid": "4801cb2b-9466-31e3-0c61-4116e54937ae",
          "code": "C1012",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antianxiety Agent[C28197]|Benzodiazepine",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1012",
          "code_system": "NCI_THESAURUS",
          "references": [
            "dd4b69d5-650e-83ab-1641-941fe5dff853"
          ]
        },
        {
          "uuid": "56ee7da8-c90d-4859-8e31-29774138f692",
          "code": "ZCN055599V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e0fc98c3-373b-91de-cdd5-5611f104d163",
          "code": "718",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/718",
          "code_system": "DRUG CENTRAL",
          "references": [
            "dd4b69d5-650e-83ab-1641-941fe5dff853"
          ]
        },
        {
          "uuid": "0920ce76-490d-3fcb-3a58-03f335f0420a",
          "code": "100000092585",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "cd595700-26b9-5708-4872-ed1f95fb4190"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "15b51557-9082-4bc8-bebd-c47100c8d0fc",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "41f7716b-8aeb-4400-a8c7-7e0efcea8fcd",
            "refuuid": "a17638b3-1693-4147-8374-93f45d0bfba7",
            "name": "CLOTIAZEPAM",
            "unii": "ZCN055599V",
            "linking_id": "ZCN055599V",
            "ref_pname": "CLOTIAZEPAM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c69b53ce-2ae7-433d-9147-b60d99099449",
          "name": "5-(O-CHLOROPHENYL)-7-ETHYL-1,3-DIHYDRO-1-METHYL-2H-THIENO(2,3-E)-1,4-DIAZEPIN-2-ONE",
          "stdName": "5-(O-CHLOROPHENYL)-7-ETHYL-1,3-DIHYDRO-1-METHYL-2H-THIENO(2,3-E)-1,4-DIAZEPIN-2-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3a880f0-b9c3-4794-a9b7-e69a58c085e9"
          ],
          "display_name": false
        },
        {
          "uuid": "e5e0ceaf-00e8-47c2-a3c6-4489bd90ae85",
          "name": "CLOTIAZEPAM",
          "stdName": "CLOTIAZEPAM",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3720ab71-d00e-4dd5-9481-8f1c7afc8f2d",
            "7118d250-432e-4e81-99b6-cb88648b8b05",
            "ee97480a-95ff-4cd1-8b89-4e59fab65b9e",
            "ae13a9f5-a740-403d-8699-333b480c6c0c",
            "e8d99748-9bc9-4d2c-9258-33505863a455",
            "be2dfc33-e5c0-4805-85e4-5d81de766992",
            "a3a880f0-b9c3-4794-a9b7-e69a58c085e9",
            "705bc2d4-f0ce-4eaa-b031-fb9c6a83c2bb",
            "5ee5b5b0-a542-4ae7-b61a-33c5350ca871"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "31262cbf-4036-4df5-a083-62d46630b7a5",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "caae4e0f-d086-4a27-b507-ae918953128d",
          "name": "CLOTIAZEPAM [JAN]",
          "stdName": "CLOTIAZEPAM [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94713489-622e-0df4-6104-0b53dee79d72"
          ],
          "display_name": false
        },
        {
          "uuid": "49e464b0-75e5-4115-8a73-d9ec97a45e7f",
          "name": "CLOTIAZEPAM [MART.]",
          "stdName": "CLOTIAZEPAM [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee97480a-95ff-4cd1-8b89-4e59fab65b9e"
          ],
          "display_name": false
        },
        {
          "uuid": "2d0f2ec1-993f-4f06-a7d0-0337d859aa1d",
          "name": "CLOTIAZEPAM [MI]",
          "stdName": "CLOTIAZEPAM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3720ab71-d00e-4dd5-9481-8f1c7afc8f2d"
          ],
          "display_name": false
        },
        {
          "uuid": "58c3ad58-f3f0-8641-bb92-24b2f3f96921",
          "name": "Clotiazepam [WHO-DD]",
          "stdName": "CLOTIAZEPAM [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5bd38ecf-8c1b-fc9d-aca3-977c90f463a4"
          ],
          "display_name": false
        },
        {
          "uuid": "6b0fa3ac-065a-41b0-8918-ed5156875267",
          "name": "RIZE",
          "stdName": "RIZE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9526bb16-cc6f-41eb-b42d-8a93af83d48e",
            "e7cea696-a32b-475c-8281-6b4b318b2ea7"
          ],
          "display_name": false
        },
        {
          "uuid": "d5b8e56c-c24f-49c6-b9b6-87113a5cd0f7",
          "name": "clotiazepam [INN]",
          "stdName": "CLOTIAZEPAM [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "705bc2d4-f0ce-4eaa-b031-fb9c6a83c2bb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a3a880f0-b9c3-4794-a9b7-e69a58c085e9",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "705bc2d4-f0ce-4eaa-b031-fb9c6a83c2bb",
          "citation": "INN Proposed List 30",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL30.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ee97480a-95ff-4cd1-8b89-4e59fab65b9e",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3720ab71-d00e-4dd5-9481-8f1c7afc8f2d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9526bb16-cc6f-41eb-b42d-8a93af83d48e",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7cea696-a32b-475c-8281-6b4b318b2ea7",
          "citation": "D01328",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ee5b5b0-a542-4ae7-b61a-33c5350ca871",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e45d5ed-d248-4ef6-a460-a69fe49355e9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390169000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf30768d-a494-459c-bb32-192691057e1a",
          "citation": "SRS import [ZCN055599V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ZCN055599V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390169000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8d99748-9bc9-4d2c-9258-33505863a455",
          "citation": "CLOTIAZEPAM [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "be2dfc33-e5c0-4805-85e4-5d81de766992",
          "citation": "CLOTIAZEPAM [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ae13a9f5-a740-403d-8699-333b480c6c0c",
          "citation": "CLOTIAZEPAM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7118d250-432e-4e81-99b6-cb88648b8b05",
          "citation": "CLOTIAZEPAM [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "94713489-622e-0df4-6104-0b53dee79d72",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5f1146ab-1130-ea94-dc19-805f7a1c5182",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=33671-46-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dd4b69d5-650e-83ab-1641-941fe5dff853",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c95b4b88-bb12-488b-b3c5-7173876d12b1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5bd38ecf-8c1b-fc9d-aca3-977c90f463a4",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "cd595700-26b9-5708-4872-ed1f95fb4190",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e8299972-d239-4eb5-b917-eefc4e4f2b2d",
          "id": "e8299972-d239-4eb5-b917-eefc4e4f2b2d",
          "molfile": "\n  Marvin  01132112012D          \n\n 21 23  0  0  0  0            999 V2000\n    0.0000   -2.2774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4596   -1.6293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2885   -1.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7765   -2.3497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5097   -2.1560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5562   -1.3323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7894   -1.0251    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1863   -0.8056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0546    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0202   -1.0380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5728   -0.3951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3327   -1.7997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9221   -2.5123    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0984   -2.6130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8919   -3.4186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4961   -4.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2611   -4.8594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4788   -5.0686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8900   -4.4566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1147   -3.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5415   -3.0468    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  7  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n 14  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 20 15  2  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  1  0  0  0  0\nM  END",
          "smiles": "CCc1cc2C(=NCC(=O)N(C)c2s1)c3ccccc3Cl",
          "formula": "C16H15ClN2OS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e8cde261-d569-43ee-b503-4b42bdbfbda3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "318.8227",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a17638b3-1693-4147-8374-93f45d0bfba7",
      "version": "13",
      "structure": {
        "id": "90acf33b-2c3b-4288-b940-3b1328797d27",
        "molfile": "\n  Marvin  01132107302D          \n\n 21 23  0  0  0  0            999 V2000\n    2.5562   -1.3323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5097   -2.1560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1863   -0.8056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0984   -2.6130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9221   -2.5123    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7894   -1.0251    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7765   -2.3497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0202   -1.0380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8919   -3.4186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2885   -1.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3327   -1.7997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1147   -3.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5728   -0.3951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0546    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5415   -3.0468    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.4961   -4.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4596   -1.6293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8900   -4.4566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.2774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2611   -4.8594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4788   -5.0686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  1  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  3  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  6  1  0  0  0  0\n 11  8  1  0  0  0  0\n 12  9  2  0  0  0  0\n 13  8  2  0  0  0  0\n 14  3  1  0  0  0  0\n 15 12  1  0  0  0  0\n 16  9  1  0  0  0  0\n 17 10  1  0  0  0  0\n 18 12  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 16  2  0  0  0  0\n 21 20  1  0  0  0  0\n 10  7  2  0  0  0  0\n 11  5  1  0  0  0  0\n 21 18  2  0  0  0  0\nM  END",
        "smiles": "CCc1cc2C(=NCC(=O)N(C)c2s1)c3ccccc3Cl",
        "formula": "C16H15ClN2OS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "318.8227",
        "optical_activity": "NONE",
        "references": [
          "bf30768d-a494-459c-bb32-192691057e1a",
          "a3a880f0-b9c3-4794-a9b7-e69a58c085e9",
          "705bc2d4-f0ce-4eaa-b031-fb9c6a83c2bb"
        ],
        "stereo_centers": 0
      },
      "unii": "ZCN055599V"
    }
  ]
}