{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "45920c11-7537-4f6a-88f3-c1e0b8a541af",
          "code": "15111-97-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=15111-97-4",
          "code_system": "CAS",
          "references": [
            "43cc2bf1-b21a-4ca0-842c-a82ecfe8413e",
            "3aee11e1-412e-44dc-a4bb-8e0752a4aeb6"
          ]
        },
        {
          "uuid": "a2a41c3c-0311-44b4-baa2-13a2a84e1f3e",
          "code": "239-164-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.035.589",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "43cc2bf1-b21a-4ca0-842c-a82ecfe8413e"
          ]
        },
        {
          "uuid": "b090660f-138d-44f0-8df0-16017fb25c2a",
          "code": "61781",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/61781",
          "code_system": "PUBCHEM",
          "references": [
            "43cc2bf1-b21a-4ca0-842c-a82ecfe8413e"
          ]
        },
        {
          "uuid": "8d58ad52-8308-2939-3272-04c722f2b3c6",
          "code": "DTXSID50864558",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50864558",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "af6bbdee-5d26-478d-8006-62480b7bc2de",
          "code": "ZC37WVE9ED",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "f6f71cab-1113-4864-a4bb-f181da0723ff"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8ee903d5-b1f1-4f8e-9a40-9f9fd103f8a2",
          "amount": {
            "uuid": "16f5502e-c31c-47ad-87b7-ec61ee185dad"
          },
          "type": "ENANTIOMER->RACEMATE",
          "references": [
            "f6f71cab-1113-4864-a4bb-f181da0723ff"
          ],
          "related_substance": {
            "uuid": "33e7cc87-f771-485b-bdaa-7c39aac2912a",
            "refuuid": "78e048bd-65ad-4550-bd61-46c2bef4f401",
            "name": "2-[(1R)-4-methylcyclohex-3-en-1-yl]prop-2-enyl acetate",
            "unii": "M4J9E7532D",
            "linking_id": "M4J9E7532D",
            "ref_pname": "2-[(1R)-4-methylcyclohex-3-en-1-yl]prop-2-enyl acetate",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f176f903-6702-4dbe-94f2-e9f18c5a8eff",
          "amount": {
            "uuid": "31094805-5ad0-47d9-a6fc-29336aec0269"
          },
          "type": "ENANTIOMER->RACEMATE",
          "references": [
            "f6f71cab-1113-4864-a4bb-f181da0723ff"
          ],
          "related_substance": {
            "uuid": "22e241c6-bfc5-4978-83b0-a6690fc7fe48",
            "refuuid": "ce27adce-7e8e-48b0-bf89-feb83c6d9a70",
            "name": "2-[(1S)-4-methylcyclohex-3-en-1-yl]prop-2-enyl acetate",
            "unii": "J968WGR26H",
            "linking_id": "J968WGR26H",
            "ref_pname": "2-[(1S)-4-methylcyclohex-3-en-1-yl]prop-2-enyl acetate",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d98834e2-f955-4840-a9b3-f8c4ea07711f",
          "name": "1,8(10)-p-Menthadien-9-yl acetate",
          "stdName": "1,8(10)-P-MENTHADIEN-9-YL ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0058660-adef-41a7-bf10-56d3e5dfc2e4",
            "f6f71cab-1113-4864-a4bb-f181da0723ff"
          ],
          "display_name": false
        },
        {
          "uuid": "b1b916bd-1912-4b1f-afae-e0b4d76b0eea",
          "name": "2-(4-methylcyclohex-3-en-1-yl)prop-2-enyl acetate",
          "stdName": "2-(4-METHYLCYCLOHEX-3-EN-1-YL)PROP-2-ENYL ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6f71cab-1113-4864-a4bb-f181da0723ff"
          ],
          "display_name": true
        },
        {
          "uuid": "0d341d6b-61e4-45b5-ba60-e3baf6fdb35a",
          "name": "3-Cyclohexene-1-ethanol, 4-methyl-β-methylene-, 1-acetate",
          "stdName": "3-CYCLOHEXENE-1-ETHANOL, 4-METHYL-.BETA.-METHYLENE-, 1-ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0058660-adef-41a7-bf10-56d3e5dfc2e4",
            "f6f71cab-1113-4864-a4bb-f181da0723ff"
          ],
          "display_name": false
        },
        {
          "uuid": "ceaa1166-925e-4428-a51a-ff862074b6f2",
          "name": "4-Methyl-beta-methylenecyclohex-3-ene-1-ethyl acetate",
          "stdName": "4-METHYL-BETA-METHYLENECYCLOHEX-3-ENE-1-ETHYL ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6f71cab-1113-4864-a4bb-f181da0723ff",
            "39725945-b8d9-4d23-a4f8-5b18b6d5dcd6"
          ],
          "display_name": false
        },
        {
          "uuid": "cf316ee3-6962-4086-8f6e-66a2a88d5592",
          "name": "Limonen-10-yl acetate",
          "stdName": "LIMONEN-10-YL ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0058660-adef-41a7-bf10-56d3e5dfc2e4",
            "f6f71cab-1113-4864-a4bb-f181da0723ff"
          ],
          "display_name": false
        },
        {
          "uuid": "755c769c-d24a-4d58-b612-ea9df4ab6c13",
          "name": "p-Mentha-1,8(10)-dien-9-ol, acetate",
          "stdName": "P-MENTHA-1,8(10)-DIEN-9-OL, ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0058660-adef-41a7-bf10-56d3e5dfc2e4",
            "f6f71cab-1113-4864-a4bb-f181da0723ff"
          ],
          "display_name": false
        },
        {
          "uuid": "b2297586-019d-4c3d-ac6f-a30735b2128c",
          "name": "p-Mentha-1,8(10)-dien-9-yl acetate",
          "stdName": "P-MENTHA-1,8(10)-DIEN-9-YL ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0058660-adef-41a7-bf10-56d3e5dfc2e4",
            "f6f71cab-1113-4864-a4bb-f181da0723ff"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b0058660-adef-41a7-bf10-56d3e5dfc2e4",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6f71cab-1113-4864-a4bb-f181da0723ff",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "39725945-b8d9-4d23-a4f8-5b18b6d5dcd6",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43cc2bf1-b21a-4ca0-842c-a82ecfe8413e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392224000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3aee11e1-412e-44dc-a4bb-8e0752a4aeb6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "cabdc688-6fc7-4445-ae4a-30707fe05204",
          "id": "cabdc688-6fc7-4445-ae4a-30707fe05204",
          "molfile": "\n  Marvin  01132110282D          \n\n 14 14  0  0  0  0            999 V2000\n    2.8875   -0.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0625   -0.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6500   -1.4289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6500    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8250    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4125    0.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8250    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4125    0.7145    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -0.8250    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6500    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0625    0.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8875    0.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6500    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8250    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 14  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  2  0  0  0  0\n 14 13  1  0  0  0  0\nM  END",
          "smiles": "CC1=CCC(CC1)C(=C)COC(=O)C",
          "formula": "C12H18O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a4df6e55-26b2-4ba3-adc1-deba1bbf71c8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "194.2706",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e60a1052-c850-4da2-abd6-e3a963910566",
      "version": "5",
      "structure": {
        "id": "cac1311c-d981-4b66-8c6c-1b5d4d0b12b5",
        "molfile": "\n  Marvin  01132110282D          \n\n 14 14  0  0  0  0            999 V2000\n   -0.4125    0.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8250    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6500    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0625    0.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6500    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8250    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8250    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4125    0.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6500    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8250    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8875    0.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0625   -0.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8875   -0.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6500   -1.4289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  1  8  1  0  0  0  0\n  8 10  2  0  0  0  0\n  4 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\nM  END",
        "smiles": "CC1=CCC(CC1)C(=C)COC(=O)C",
        "formula": "C12H18O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "194.2706",
        "optical_activity": "( + / - )",
        "references": [
          "b0058660-adef-41a7-bf10-56d3e5dfc2e4",
          "f6f71cab-1113-4864-a4bb-f181da0723ff"
        ],
        "stereo_centers": 1
      },
      "unii": "ZC37WVE9ED"
    }
  ]
}