{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5925e70c-ad27-4e4a-9f55-b935e51e5502",
          "code": "1046-56-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1046-56-6",
          "code_system": "CAS",
          "references": [
            "fc0496c4-70e0-407a-80f4-3bac84e06d77",
            "4d1a41f1-fecf-4330-8ed4-98813db2c294"
          ]
        },
        {
          "uuid": "03c48ebb-884a-450f-b163-758463e34268",
          "code": "213-878-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.617",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "fc0496c4-70e0-407a-80f4-3bac84e06d77"
          ]
        },
        {
          "uuid": "d8c9d053-b905-4460-bd98-cad9e9b43728",
          "code": "70588",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/70588",
          "code_system": "PUBCHEM",
          "references": [
            "fc0496c4-70e0-407a-80f4-3bac84e06d77"
          ]
        },
        {
          "uuid": "c7df68bf-a513-ee70-3b39-258e5df112c4",
          "code": "DTXSID8061428",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8061428",
          "code_system": "EPA CompTox",
          "references": [
            "fb2a235b-ab35-4de2-7d8f-24624fdfde5f"
          ]
        },
        {
          "uuid": "eda372fc-eb61-49e0-b12d-f739025c93b9",
          "code": "Z9WP0M1OQU",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "cec0be3f-61ea-c883-68a1-4ddce238e90c",
          "code": "242686",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=242686",
          "code_system": "NSC",
          "references": [
            "dae13cf7-7f05-5d8d-f853-3cc3760aee86"
          ]
        },
        {
          "uuid": "a9fc65e7-c8b1-5b23-c0ff-6000b80a4d30",
          "code": "300000009283",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "0867546a-3450-d4e5-7558-5f2fddc964a5"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b02052f2-57b3-4c29-8e54-02c8b7856213",
          "name": "1,2,4-TRIAZINE, 5,6-DIPHENYL-3-(2-PYRIDINYL)-",
          "stdName": "1,2,4-TRIAZINE, 5,6-DIPHENYL-3-(2-PYRIDINYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93e8f432-bf4a-4a47-abef-4de756439ff9",
            "db3b3536-7bd4-470a-afcd-9d87d3695309"
          ],
          "display_name": false
        },
        {
          "uuid": "ca11f5d0-c9ff-89ca-fac1-a368d27f1289",
          "name": "3-(2-PYRIDYL)-5,6-DIPHENYL-1,2,4-TRIAZINE",
          "stdName": "3-(2-PYRIDYL)-5,6-DIPHENYL-1,2,4-TRIAZINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a903cc5-9cb1-166f-a3a4-9d887f420619"
          ],
          "display_name": false
        },
        {
          "uuid": "d7ba6ced-c7b6-b2db-78fb-a5d747d8f42d",
          "name": "3-(PYRIDIN-2-YL)-5,6-DIPHENYL-1,2,4-TRIAZINE",
          "stdName": "3-(PYRIDIN-2-YL)-5,6-DIPHENYL-1,2,4-TRIAZINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a903cc5-9cb1-166f-a3a4-9d887f420619"
          ],
          "display_name": false
        },
        {
          "uuid": "07d07115-7e09-08ab-70ca-e65f0eb01089",
          "name": "5,6-DIPHENYL-3-(2-PYRIDINYL)-1,2,4-TRIAZINE",
          "stdName": "5,6-DIPHENYL-3-(2-PYRIDINYL)-1,2,4-TRIAZINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a903cc5-9cb1-166f-a3a4-9d887f420619"
          ],
          "display_name": false
        },
        {
          "uuid": "35b7e7ce-0983-15f0-a287-4b0b944ae711",
          "name": "5,6-DIPHENYL-3-(2-PYRIDYL)-1,2,4-TRIAZINE",
          "stdName": "5,6-DIPHENYL-3-(2-PYRIDYL)-1,2,4-TRIAZINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a903cc5-9cb1-166f-a3a4-9d887f420619"
          ],
          "display_name": false
        },
        {
          "uuid": "f6fab09f-adf3-ebf0-55e9-15cdba8157ca",
          "name": "5,6-DIPHENYL-3-(PYRIDIN-2-YL)-AS-TRIAZINE",
          "stdName": "5,6-DIPHENYL-3-(PYRIDIN-2-YL)-AS-TRIAZINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a903cc5-9cb1-166f-a3a4-9d887f420619"
          ],
          "display_name": false
        },
        {
          "uuid": "00e0832f-cb80-fa34-3c14-981aa163e756",
          "name": "AS-TRIAZINE, 5,6-DIPHENYL-3-(2-PYRIDYL)-",
          "stdName": "AS-TRIAZINE, 5,6-DIPHENYL-3-(2-PYRIDYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a903cc5-9cb1-166f-a3a4-9d887f420619"
          ],
          "display_name": false
        },
        {
          "uuid": "0374f4b9-3a89-69c8-423c-1acbcb5f822a",
          "name": "FERROPRINT",
          "stdName": "FERROPRINT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a903cc5-9cb1-166f-a3a4-9d887f420619"
          ],
          "display_name": false
        },
        {
          "uuid": "35f8481a-f205-c9bd-5251-e0c221b95e9e",
          "name": "FERROTRACE",
          "stdName": "FERROTRACE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a903cc5-9cb1-166f-a3a4-9d887f420619"
          ],
          "display_name": true
        },
        {
          "uuid": "7012a3ff-d1ac-4aeb-8281-0c04e96a528e",
          "name": "NSC-242686",
          "stdName": "NSC-242686",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93e8f432-bf4a-4a47-abef-4de756439ff9",
            "db3b3536-7bd4-470a-afcd-9d87d3695309"
          ],
          "display_name": false
        },
        {
          "uuid": "d18e077d-8251-b538-507c-8c12b1faf9a6",
          "name": "PDT",
          "stdName": "PDT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a903cc5-9cb1-166f-a3a4-9d887f420619"
          ],
          "display_name": false
        },
        {
          "uuid": "fe3ca397-64ce-7644-9df0-5cce5df2fc96",
          "name": "PDT (LIGAND)",
          "stdName": "PDT (LIGAND)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a903cc5-9cb1-166f-a3a4-9d887f420619"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "db3b3536-7bd4-470a-afcd-9d87d3695309",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93e8f432-bf4a-4a47-abef-4de756439ff9",
          "citation": "EPA",
          "doc_type": "EPA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc0496c4-70e0-407a-80f4-3bac84e06d77",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393834000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb2a235b-ab35-4de2-7d8f-24624fdfde5f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1046-56-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2a903cc5-9cb1-166f-a3a4-9d887f420619",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4d1a41f1-fecf-4330-8ed4-98813db2c294",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "dae13cf7-7f05-5d8d-f853-3cc3760aee86",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "0867546a-3450-d4e5-7558-5f2fddc964a5",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9bf0119b-65f3-4a06-8a1e-5d4a0fa8a690",
          "id": "9bf0119b-65f3-4a06-8a1e-5d4a0fa8a690",
          "molfile": "\n  Marvin  01132108062D          \n\n 24 27  0  0  0  0            999 V2000\n    0.0000    1.0275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0021    0.2025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7126   -0.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4293    0.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4272    1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7084    1.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2874   -0.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2874   -1.1127    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9969   -1.5252    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7146   -1.1127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7146   -0.2877    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9969    0.1248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9944    1.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7099    1.5312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7062    2.3519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9911    2.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2797    2.3540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2793    1.5262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4288   -1.5259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1440   -1.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8593   -1.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8552   -2.3522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1399   -2.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4288   -2.3537    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1  6  2  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  7  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n 12  7  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 19  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 18 13  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 24  2  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)-c2c(-c3ccccc3)nnc(-c4ccccn4)n2",
          "formula": "C20H14N4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "19e9280c-f4de-41ae-8683-e62f155d9301"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "310.3527",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "249f8972-25d8-4321-94c6-d61b93ee9491",
      "version": "8",
      "structure": {
        "id": "c6235754-be14-4a67-b555-641a39656907",
        "molfile": "\n  Marvin  01132110152D          \n\n 24 27  0  0  0  0            999 V2000\n    3.7146   -0.2877    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9969    0.1248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9944    1.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7099    1.5312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7062    2.3519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9911    2.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2797    2.3540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2793    1.5262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2874   -0.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2874   -1.1127    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9969   -1.5252    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7146   -1.1127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4288   -1.5259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4288   -2.3537    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1399   -2.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8552   -2.3522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8593   -1.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1440   -1.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4293    0.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7126   -0.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0021    0.2025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    1.0275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7084    1.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4272    1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  3  2  0  0  0  0\n  2  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12  1  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 13  2  0  0  0  0\n  9 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 19  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)-c2c(-c3ccccc3)nnc(-c4ccccn4)n2",
        "formula": "C20H14N4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "310.3527",
        "optical_activity": "NONE",
        "references": [
          "2a903cc5-9cb1-166f-a3a4-9d887f420619",
          "db3b3536-7bd4-470a-afcd-9d87d3695309"
        ],
        "stereo_centers": 0
      },
      "unii": "Z9WP0M1OQU"
    }
  ]
}