{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "382c8059-8a1d-4c2d-8e54-9ca6f8cc3d80",
          "code": "1234208-67-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1234208-67-3",
          "code_system": "CAS",
          "references": [
            "e8533bd3-1e7f-4b7f-b291-3e5ff0014510",
            "000b39d1-793c-4a38-a485-8c135bf2b509"
          ]
        },
        {
          "uuid": "b3eddf75-0183-458b-8008-3b6b220ce8d8",
          "code": "1307039",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1307039/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e8533bd3-1e7f-4b7f-b291-3e5ff0014510"
          ]
        },
        {
          "uuid": "b329d741-f82b-4bbf-bb45-e823b6e3e44a",
          "code": "56848967",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/56848967",
          "code_system": "PUBCHEM",
          "references": [
            "e8533bd3-1e7f-4b7f-b291-3e5ff0014510"
          ]
        },
        {
          "uuid": "ab4f9253-c887-bc6f-069d-c8c2929d9d3c",
          "code": "DTXSID40154011",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40154011",
          "code_system": "EPA CompTox",
          "references": [
            "74d45cfd-38f7-10e4-5b1d-680737e4cad0"
          ]
        },
        {
          "uuid": "2166d6ac-897c-4726-bba8-4c1b18339a48",
          "code": "Z9T72Z578T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "44379e81-cd36-4bec-b891-e338c15fa752",
          "code": "Z9T72Z578T",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Z9T72Z578T",
          "code_system": "DAILYMED",
          "references": [
            "09e81983-ae6c-cd52-04d7-88a753a29861"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "01a9af34-a4ff-4992-ae0e-bffb036826b7",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "e70e6e50-e2e0-4225-ad20-0d226539d56f",
            "refuuid": "84c8f287-623e-489f-8cc7-48d3ad74b00b",
            "name": "METHYLBENZYL METHYLBENZIMIDAZOLE PIPERIDINYLMETHANONE",
            "unii": "Z9T72Z578T",
            "linking_id": "Z9T72Z578T",
            "ref_pname": "METHYLBENZYL METHYLBENZIMIDAZOLE PIPERIDINYLMETHANONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3dfb640c-bc05-40ff-9750-6bfc4da049ca",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "bc3da2e4-24c3-4e2f-aef5-9fd42be58c21",
            "refuuid": "502c1d76-7361-4518-9b40-322cc00973d0",
            "name": "METHYLBENZYL METHYLBENZIMIDAZOLE PIPERIDINYLMETHANONE HYDROCHLORIDE",
            "unii": "MJ3AH4228F",
            "linking_id": "MJ3AH4228F",
            "ref_pname": "METHYLBENZYL METHYLBENZIMIDAZOLE PIPERIDINYLMETHANONE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3f737418-3405-4554-b47c-6518a8a5cd96",
          "name": "(2-METHYL-1-(3-METHYLBENZYL)-1H-BENZO(D)IMIDAZOL-5-YL)(PIPERIDIN-1-YL)METHANONE",
          "stdName": "(2-METHYL-1-(3-METHYLBENZYL)-1H-BENZO(D)IMIDAZOL-5-YL)(PIPERIDIN-1-YL)METHANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af8e06af-2f82-47a3-9e8e-c06e35260eaa",
            "67557b99-766f-4d15-bf44-cc7168a4871f"
          ],
          "display_name": false
        },
        {
          "uuid": "96081411-9e5b-4096-b844-c918750a1481",
          "name": "ADFENCE-P FREE BASE",
          "stdName": "ADFENCE-P FREE BASE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e83c7c12-9f45-4ffb-ab5e-e4b485738dad",
            "af8e06af-2f82-47a3-9e8e-c06e35260eaa"
          ],
          "display_name": false
        },
        {
          "uuid": "ef93901d-ef25-461d-9fb0-e79fb41cf5a9",
          "name": "METHANONE, (2-METHYL-1-((3-METHYLPHENYL)METHYL)-1H-BENZIMIDAZOL-5-YL)-1-PIPERIDINYL-",
          "stdName": "METHANONE, (2-METHYL-1-((3-METHYLPHENYL)METHYL)-1H-BENZIMIDAZOL-5-YL)-1-PIPERIDINYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af8e06af-2f82-47a3-9e8e-c06e35260eaa",
            "a77f599d-7871-4ad1-a2f9-2803a993ef59"
          ],
          "display_name": false
        },
        {
          "uuid": "dcae81da-f980-4100-8496-d63f387505ce",
          "name": "METHYLBENZYL METHYLBENZIMIDAZOLE PIPERIDINYLMETHANONE",
          "stdName": "METHYLBENZYL METHYLBENZIMIDAZOLE PIPERIDINYLMETHANONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76f5ae5b-55e0-4e6d-a719-eb9f35d3e6ee",
            "af8e06af-2f82-47a3-9e8e-c06e35260eaa",
            "6f3de1a2-07ad-4d5a-94cb-2d716e0c54c6"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "93121eaf-bf98-4a74-a7aa-771405205594",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "a77f599d-7871-4ad1-a2f9-2803a993ef59",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "af8e06af-2f82-47a3-9e8e-c06e35260eaa",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f3de1a2-07ad-4d5a-94cb-2d716e0c54c6",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e83c7c12-9f45-4ffb-ab5e-e4b485738dad",
          "citation": "NeoPharm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67557b99-766f-4d15-bf44-cc7168a4871f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8533bd3-1e7f-4b7f-b291-3e5ff0014510",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391078000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "03543bda-193a-4fb7-958f-bbaf813e52f2",
          "citation": "SRS import [Z9T72Z578T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Z9T72Z578T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391078000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "76f5ae5b-55e0-4e6d-a719-eb9f35d3e6ee",
          "citation": "METHYLBENZYL METHYLBENZIMIDAZOLE PIPERIDINYLMETHANONE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "74d45cfd-38f7-10e4-5b1d-680737e4cad0",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1234208-67-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "000b39d1-793c-4a38-a485-8c135bf2b509",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "09e81983-ae6c-cd52-04d7-88a753a29861",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "289af603-16af-4771-992d-7bb4ef3913b7",
          "id": "289af603-16af-4771-992d-7bb4ef3913b7",
          "molfile": "\n  Marvin  01132102132D          \n\n 26 29  0  0  0  0            999 V2000\n   14.7300   -9.2354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9050   -9.2354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4201   -9.9028    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6354   -9.6479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9210  -10.0604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2065   -9.6479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2065   -8.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9210   -8.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6354   -8.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4201   -8.5679    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6750   -7.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4820   -7.6118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7369   -6.8272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5439   -6.6556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0959   -7.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8410   -8.0534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3930   -8.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0340   -8.2249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4920  -10.0604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4920  -10.8854    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7776   -9.6479    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0631  -10.0604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3486   -9.6479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3486   -8.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0631   -8.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7776   -8.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2 10  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n 19  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 18  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 16  1  0  0  0  0\n 19 20  2  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 26  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\nM  END",
          "smiles": "Cc1cccc(c1)Cn2c(C)nc3cc(ccc32)C(=O)N4CCCCC4",
          "formula": "C22H25N3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ac8497c4-8828-41e5-9dac-f6844399a655"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "347.4542",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "84c8f287-623e-489f-8cc7-48d3ad74b00b",
      "version": "7",
      "structure": {
        "id": "361c3724-8ceb-43f7-b2a1-b6b9890f59df",
        "molfile": "\n  Marvin  01132102532D          \n\n 26 29  0  0  0  0            999 V2000\n   10.4920  -10.0604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4920  -10.8854    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7776   -9.6479    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0631  -10.0604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3486   -9.6479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3486   -8.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0631   -8.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7776   -8.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9050   -9.2354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4201   -8.5679    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6354   -8.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6354   -9.6479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4201   -9.9028    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9210  -10.0604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2065   -9.6479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2065   -8.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9210   -8.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6750   -7.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4820   -7.6118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0340   -8.2249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8410   -8.0534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0959   -7.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5439   -6.6556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7369   -6.8272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3930   -8.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7300   -9.2354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  3  8  1  0  0  0  0\n  1  3  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n  9 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 11 17  2  0  0  0  0\n 12 14  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 19 24  2  0  0  0  0\n 21 25  1  0  0  0  0\n 10 18  1  0  0  0  0\n  9 26  1  0  0  0  0\n  1 15  1  0  0  0  0\nM  END",
        "smiles": "Cc1cccc(c1)Cn2c(C)nc3cc(ccc32)C(=O)N4CCCCC4",
        "formula": "C22H25N3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "347.4542",
        "optical_activity": "NONE",
        "references": [
          "03543bda-193a-4fb7-958f-bbaf813e52f2",
          "a77f599d-7871-4ad1-a2f9-2803a993ef59"
        ],
        "stereo_centers": 0
      },
      "unii": "Z9T72Z578T"
    }
  ]
}