{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f8db0400-8651-4922-9578-b285df2c46c1",
          "code": "N07XX06",
          "comments": "ATC|NERVOUS SYSTEM|OTHER NERVOUS SYSTEM DRUGS|OTHER NERVOUS SYSTEM DRUGS|Other nervous system drugs|tetrabenazine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N07XX06&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "e730d321-0d5f-489d-803d-d495c96e0b3d"
          ]
        },
        {
          "uuid": "3614209a-7708-4627-aae7-9ad967312513",
          "code": "58-46-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=58-46-8",
          "code_system": "CAS",
          "references": [
            "e730d321-0d5f-489d-803d-d495c96e0b3d",
            "b2f407e8-dbc8-4be4-8e44-cfb92c3e9afa"
          ]
        },
        {
          "uuid": "491abcad-dcd3-4794-b19d-4a4304023548",
          "code": "C81095",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81095",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e730d321-0d5f-489d-803d-d495c96e0b3d"
          ]
        },
        {
          "uuid": "83cdaaf3-6e80-4435-960f-2df120ecb4d2",
          "code": "NBK548187",
          "comments": "LiverTox|CNS|Chorea|Dopaminergic",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548187/",
          "code_system": "LIVERTOX",
          "references": [
            "24d6afc1-b9ab-0ae0-544b-2d1e26d5b200"
          ]
        },
        {
          "uuid": "0e17143f-0b60-4cfd-b2d2-3d2c662370dd",
          "code": "D013747",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68013747",
          "code_system": "MESH",
          "references": [
            "e730d321-0d5f-489d-803d-d495c96e0b3d"
          ]
        },
        {
          "uuid": "bc1ae2a7-9943-43d3-96f2-e92b310f01e5",
          "code": "TETRABENAZINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Tetrabenazine",
          "code_system": "WIKIPEDIA",
          "references": [
            "e730d321-0d5f-489d-803d-d495c96e0b3d"
          ]
        },
        {
          "uuid": "6f6f8dc4-a3da-41ea-a595-b4b604fd69de",
          "code": "QN07XX06",
          "comments": "VATC|OTHER NERVOUS SYSTEM DRUGS|OTHER NERVOUS SYSTEM DRUGS|Other nervous system drugs|tetrabenazine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN07XX06&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "e730d321-0d5f-489d-803d-d495c96e0b3d"
          ]
        },
        {
          "uuid": "db8e1548-3dd4-46ab-9ac5-1a28a9be697a",
          "code": "1056",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1056",
          "code_system": "INN",
          "references": [
            "e730d321-0d5f-489d-803d-d495c96e0b3d"
          ]
        },
        {
          "uuid": "a7673062-fdf9-4f26-987b-5cd41009c706",
          "code": "200-383-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.348",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e730d321-0d5f-489d-803d-d495c96e0b3d"
          ]
        },
        {
          "uuid": "77cc46f3-4038-449a-a17b-6a1e89e1f729",
          "code": "4834",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=4834",
          "code_system": "IUPHAR",
          "references": [
            "e730d321-0d5f-489d-803d-d495c96e0b3d"
          ]
        },
        {
          "uuid": "3bca2db4-be80-4269-9fa3-09a4769caceb",
          "code": "10390",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/10390/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e730d321-0d5f-489d-803d-d495c96e0b3d"
          ]
        },
        {
          "uuid": "196baff1-e077-4ad7-a356-ec1938eea257",
          "code": "m10596",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10596?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e730d321-0d5f-489d-803d-d495c96e0b3d"
          ]
        },
        {
          "uuid": "52ac7e95-50e7-4fe5-a487-ca0f97a8f2ed",
          "code": "DB04844",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB04844",
          "code_system": "DRUG BANK",
          "references": [
            "e730d321-0d5f-489d-803d-d495c96e0b3d"
          ]
        },
        {
          "uuid": "9a0a3779-ba3e-44d0-b7eb-667fb8a97a24",
          "code": "SUB10939MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e730d321-0d5f-489d-803d-d495c96e0b3d"
          ]
        },
        {
          "uuid": "b25b4647-8f0f-408c-87fe-a4f30ec05ba0",
          "code": "CHEMBL117785",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL117785",
          "code_system": "ChEMBL",
          "references": [
            "e730d321-0d5f-489d-803d-d495c96e0b3d"
          ]
        },
        {
          "uuid": "8ef37f31-e1e1-4b03-860d-9f7c1789d432",
          "code": "N0000190856",
          "comments": "Established Pharmacologic Class [EPC]|Vesicular Monoamine Transporter 2 Inhibitor [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000190856",
          "code_system": "NDF-RT",
          "references": [
            "e730d321-0d5f-489d-803d-d495c96e0b3d"
          ]
        },
        {
          "uuid": "f1922966-d3ce-4a5f-8b31-74ad12c34618",
          "code": "N0000190855",
          "comments": "Vesicular Monoamine Transporter 2 Inhibitors [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000190855",
          "code_system": "NDF-RT",
          "references": [
            "e730d321-0d5f-489d-803d-d495c96e0b3d"
          ]
        },
        {
          "uuid": "d07e1de3-9d6f-4130-1734-7b5885c36475",
          "code": "DTXSID0042614",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0042614",
          "code_system": "EPA CompTox",
          "references": [
            "edf3fb3c-b46f-b833-dba6-3a7160b9d449"
          ]
        },
        {
          "uuid": "06ad349a-186d-0182-e296-4d945ee8c269",
          "code": "108897",
          "comments": "ORPHAN DRUG|Designated/Approved|Treatment of Huntington's disease",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=108897",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "6f268fe3-8ed7-0524-ef84-596853fdfbde",
          "code": "109797",
          "comments": "ORPHAN DRUG|Designated|Treatment of moderate/severe tardive dyskinesia.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=109797",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "dc5babd9-79fc-0dc8-643b-3c519dccb406",
          "code": "278109",
          "comments": "ORPHAN DRUG|Designated|Treatment of Tourette's Syndrome in school-age children, ages 5-16",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=278109",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "9eddae14-da44-6aeb-a0cc-ba29f9efcd45",
          "code": "C471",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C471",
          "code_system": "NCI_THESAURUS",
          "references": [
            "24d6afc1-b9ab-0ae0-544b-2d1e26d5b200"
          ]
        },
        {
          "uuid": "ff4a32c1-dbbb-49b4-bad0-8817981fd9d1",
          "code": "Z9O08YRN8O",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "38bc5a12-f0d2-ae98-74fc-ceb8efb68c0b",
          "code": "2609",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2609",
          "code_system": "DRUG CENTRAL",
          "references": [
            "24d6afc1-b9ab-0ae0-544b-2d1e26d5b200"
          ]
        },
        {
          "uuid": "955482e2-7d93-392b-5bc9-48fbf8666487",
          "code": "9467",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9467",
          "code_system": "CHEBI",
          "references": [
            "24d6afc1-b9ab-0ae0-544b-2d1e26d5b200"
          ]
        },
        {
          "uuid": "ce83ef65-b40d-9261-587c-e808dc34fe92",
          "code": "1649801",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1649801",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "24d6afc1-b9ab-0ae0-544b-2d1e26d5b200"
          ]
        },
        {
          "uuid": "95243130-ec29-59bd-e4e7-bcd86e22aca3",
          "code": "Z9O08YRN8O",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Z9O08YRN8O",
          "code_system": "DAILYMED",
          "references": [
            "813a0c0e-522d-15ff-3b39-cb2e77efecd6"
          ]
        },
        {
          "uuid": "478e3860-14b2-4e64-be07-cc24b19037e6",
          "code": "169886",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=169886",
          "code_system": "NSC",
          "references": [
            "ce19eeea-25ae-14f1-43fe-30f9f3bc52a7"
          ]
        },
        {
          "uuid": "6267854a-5be9-7f0c-2273-e688a91e31e8",
          "code": "100000092314",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "052ed19e-8c24-4529-ed61-44fd41b39008"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "6a7abae3-59eb-4a87-bbf1-6f60c23da044",
          "amount": {
            "uuid": "6774a3b4-f946-44c2-9c79-75a76f907360"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "3b559913-5546-4305-a2ac-a40d6c96408f",
            "refuuid": "cb5d7dfc-9205-410e-a765-f37f63b5201a",
            "name": "TETRABENAZINE",
            "unii": "Z9O08YRN8O",
            "linking_id": "Z9O08YRN8O",
            "ref_pname": "TETRABENAZINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a6e39b0d-ad5f-4689-9c3d-471cac40798b",
          "amount": {
            "uuid": "45138e41-cb0f-452e-b86c-5eb11787a628"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "f2b92d43-3857-4e5e-9ea8-eef685bd2430",
            "refuuid": "b929fedc-7712-40fb-a3fe-46c04cb76612",
            "name": "TETRABENAZINE METHANESULFONATE",
            "unii": "5X57I1N37U",
            "linking_id": "5X57I1N37U",
            "ref_pname": "TETRABENAZINE METHANESULFONATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "282eb1dd-d5ea-4aa1-8022-c22fce634095",
          "amount": {
            "uuid": "4e6c2ba2-ce6b-4676-acd2-e019396539a6"
          },
          "type": "METABOLITE ACTIVE->PARENT",
          "references": [
            "7539427c-71ac-45e3-a115-6d321bbf1b05"
          ],
          "related_substance": {
            "uuid": "3197e8cf-98f5-4d97-a260-ee1338519e76",
            "refuuid": "15f9b124-b7ee-40ad-92b1-8364056bff24",
            "name": "α-Dihydrotetrabenazine",
            "unii": "OHZ3DQX6Q3",
            "linking_id": "OHZ3DQX6Q3",
            "ref_pname": "α-Dihydrotetrabenazine"
          }
        },
        {
          "uuid": "5ae8ddc2-5ea4-4d37-a4fb-be14c29c8ed4",
          "amount": {
            "uuid": "c6e92c2e-0032-4adb-afbc-d4665745e947"
          },
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "8921ac87-19f6-41df-beb6-47c8b288d1e0",
            "refuuid": "189ab807-b3b3-4ddb-8b51-8935fdf0f51c",
            "name": "9-O-DESMETHYL-.ALPHA.-DIHYDROTETRABENAZINE",
            "unii": "P3M4TU3OJF",
            "linking_id": "P3M4TU3OJF",
            "ref_pname": "9-O-DESMETHYL-.ALPHA.-DIHYDROTETRABENAZINE"
          }
        },
        {
          "uuid": "3a14ac2f-7e85-4cdd-a880-bb0fd7766bd6",
          "amount": {
            "uuid": "70e49071-26bc-431b-8c26-9ab5533b3629"
          },
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "c0271d22-fe7a-48b1-b6d9-4b38a77644f6",
            "refuuid": "addcaddd-34b5-4f7b-9794-9c78381815b1",
            "name": "MONOHYDROXY TETRABENAZINE",
            "unii": "Q013AUA6S6",
            "linking_id": "Q013AUA6S6",
            "ref_pname": "MONOHYDROXY TETRABENAZINE"
          }
        },
        {
          "uuid": "54fd3b02-48d1-438d-8bf1-8b3ae44a82f5",
          "amount": {
            "uuid": "01d46cae-c875-42b6-a940-7063d6e9b4f8"
          },
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "ed0ba518-6827-499f-a838-19e1f289c2c1",
            "refuuid": "709f84a9-d449-46a8-ab66-30a5171e37a9",
            "name": "9-O-DESMETHYL-.BETA.-DIHYDROTETRABENAZINE",
            "unii": "G60MWH9TPC",
            "linking_id": "G60MWH9TPC",
            "ref_pname": "9-O-DESMETHYL-.BETA.-DIHYDROTETRABENAZINE"
          }
        },
        {
          "uuid": "e679a57c-de57-4dc0-9182-e9530f0eeb7a",
          "amount": {
            "uuid": "1e767927-65cf-471f-bc7d-d24cfb17a9a0"
          },
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "74b64f90-e65b-4c23-aeff-6ceb3b28eb40",
            "refuuid": "7bb53c1e-2584-4e2e-9ff0-442a8ad85457",
            "name": "10-O-DESMETHYL-.ALPHA.-DIHYDROTETRABENAZINE",
            "unii": "DK3H75E8YD",
            "linking_id": "DK3H75E8YD",
            "ref_pname": "10-O-DESMETHYL-.ALPHA.-DIHYDROTETRABENAZINE"
          }
        },
        {
          "uuid": "3a3ebc4f-33ab-46bf-98a1-30f8ba620110",
          "amount": {
            "uuid": "21dd8486-b4c4-4f83-bd7a-3dff5e94e3b8"
          },
          "type": "METABOLITE ACTIVE->PARENT",
          "related_substance": {
            "uuid": "c854d806-ccc4-46d4-a2ff-0b345bfe2d48",
            "refuuid": "756831d9-a0d4-4a23-816d-6977f287994f",
            "name": ".BETA.-DIHYDROTETRABENAZINE",
            "unii": "R2FU181UOU",
            "linking_id": "R2FU181UOU",
            "ref_pname": ".BETA.-DIHYDROTETRABENAZINE"
          }
        },
        {
          "uuid": "dfa5b3de-2cc9-47ca-a4e3-366c78d19472",
          "amount": {
            "uuid": "c7df5366-68a5-4d8c-ae3b-0d8f604919de"
          },
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "139bb476-4fe9-48aa-b4f4-1fb99afc16f2",
            "refuuid": "0d2f0395-4f84-41dd-bc0c-900f9e10d97a",
            "name": "10-O-DESMETHYL-.BETA.-DIHYDROTETRABENAZINE",
            "unii": "M77O1AV6SS",
            "linking_id": "M77O1AV6SS",
            "ref_pname": "10-O-DESMETHYL-.BETA.-DIHYDROTETRABENAZINE"
          }
        },
        {
          "uuid": "f574f727-27ad-4929-83b2-60cd00d1d809",
          "amount": {
            "uuid": "33178f64-e918-4b8d-a539-1564f9999565"
          },
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "8ecc1746-020e-4343-9ebe-91b9e6cae8e9",
            "refuuid": "2ebf5aa1-d599-480b-9c1a-d587941224bf",
            "name": "SD-1027",
            "unii": "3G7675CL5A",
            "linking_id": "3G7675CL5A",
            "ref_pname": "SD-1027"
          }
        },
        {
          "uuid": "5ed56b31-aa9d-42f2-a4d2-6c7e47b7529b",
          "amount": {
            "uuid": "012c7d4e-f76d-470c-b63b-9b72557de15b",
            "average": 97,
            "high": 99,
            "low": 95,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "references": [
            "91a30679-0ecb-f67c-427c-a3eb45965594",
            "44823830-c9b5-4383-9bf6-e2676fd8a93f"
          ],
          "related_substance": {
            "uuid": "0a217a99-2d93-4e90-8516-d442b38bd7eb",
            "refuuid": "b10187f3-c698-4d55-8df7-8ab80b507ef1",
            "name": "SYNAPTIC VESICULAR AMINE TRANSPORTER",
            "unii": "BPFII2BY4U",
            "linking_id": "BPFII2BY4U",
            "ref_pname": "SYNAPTIC VESICULAR AMINE TRANSPORTER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7fcd1f6c-19f0-4188-8161-b13b1e87f9d6",
          "amount": {
            "uuid": "bf3b6484-36a6-4b5c-8230-681424212fc2",
            "average": 0,
            "units": "%"
          },
          "comments": "Unchanged tetrabenazine has not been found in human urine.",
          "qualification": "URINE",
          "type": "EXCRETED UNCHANGED",
          "references": [
            "cf315230-d7db-c722-41e6-a7ab5b1a95bb"
          ],
          "related_substance": {
            "uuid": "712603b9-37c0-4106-bd74-80ee5a36aafc",
            "refuuid": "cb5d7dfc-9205-410e-a765-f37f63b5201a",
            "name": "TETRABENAZINE",
            "unii": "Z9O08YRN8O",
            "linking_id": "Z9O08YRN8O",
            "ref_pname": "TETRABENAZINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e58aefef-ff13-4f7c-a7d3-ba3ea3baab99",
          "amount": {
            "uuid": "df812faa-aedf-4a27-a77e-be143dd3e115",
            "high": 85,
            "low": 82,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "interaction_type": "BINDING",
          "references": [
            "cf315230-d7db-c722-41e6-a7ab5b1a95bb"
          ],
          "related_substance": {
            "uuid": "da8a2403-82b1-48f8-9286-d45d0cd49226",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ed219ec7-c06e-4a87-ab7f-e05a777c7c2c",
          "amount": {
            "uuid": "729619f6-b514-46f9-bd28-6a5968c01de4"
          },
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "interaction_type": "MINOR",
          "references": [
            "cf315230-d7db-c722-41e6-a7ab5b1a95bb"
          ],
          "related_substance": {
            "uuid": "90bce94b-d657-4a90-a398-64773bd0d180",
            "refuuid": "2964cc53-40a9-4b2b-b19c-d61342fadb5a",
            "name": "CYTOCHROME P450 1A2",
            "unii": "VK4SQL11C0",
            "linking_id": "VK4SQL11C0",
            "ref_pname": "CYTOCHROME P450 1A2",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0f1a219c-97ff-4a28-97c3-a88167df5654",
          "amount": {
            "uuid": "1e446c35-8d7a-471a-98e6-5f27c1524151"
          },
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "interaction_type": "MAJOR",
          "references": [
            "cf315230-d7db-c722-41e6-a7ab5b1a95bb"
          ],
          "related_substance": {
            "uuid": "66c4f08e-31c1-4791-9b53-879aaee58f69",
            "refuuid": "cc92795c-ba54-4e71-a72b-1af36b57df6b",
            "name": "CYTOCHROME P450 2D6",
            "unii": "8E4LAA4357",
            "linking_id": "8E4LAA4357",
            "ref_pname": "CYTOCHROME P450 2D6",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ba4f96f6-56ba-4c98-a204-cf6bb2f2bbca",
          "amount": {
            "uuid": "4114ed5a-70b8-42a3-a7d0-136e35e00e7d",
            "low": 20,
            "units": "MICROMOLAR"
          },
          "qualification": "IC50",
          "type": "OFF TARGET->NON-INHIBITOR",
          "references": [
            "44823830-c9b5-4383-9bf6-e2676fd8a93f"
          ],
          "related_substance": {
            "uuid": "57fda187-a868-415d-a006-426b494a6816",
            "refuuid": "f9fe89bd-1392-4773-87c1-d7a117b1a22c",
            "name": "Chromaffin granule amine transporter",
            "unii": "5PW6T9YK9P",
            "linking_id": "5PW6T9YK9P",
            "ref_pname": "Chromaffin granule amine transporter",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "56e22408-cbc6-4383-93ce-03a5461e25f0",
          "name": "1,3,4,6,7,11B-HEXAHYDRO-3-ISOBUTYL-9,10-DIMETHOXY-2H-BENZO(A)QUINOLIZIN-2-ONE",
          "stdName": "1,3,4,6,7,11B-HEXAHYDRO-3-ISOBUTYL-9,10-DIMETHOXY-2H-BENZO(A)QUINOLIZIN-2-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5857d2a2-91a6-4728-8f33-caae030deffc",
            "35182470-0fbc-4cbd-a7d3-561d7aa98a69"
          ],
          "display_name": false
        },
        {
          "uuid": "1b2ac90e-7b07-4a25-96ae-9a9f5f1cf80e",
          "name": "2H-BENZO(A)QUINOLIZIN-2-ONE, 1,3,4,6,7,11B-HEXAHYDRO-9,10-DIMETHOXY-3-(2-METHYLPROPYL)-, (3R,11BR)-REL-",
          "stdName": "2H-BENZO(A)QUINOLIZIN-2-ONE, 1,3,4,6,7,11B-HEXAHYDRO-9,10-DIMETHOXY-3-(2-METHYLPROPYL)-, (3R,11BR)-REL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35182470-0fbc-4cbd-a7d3-561d7aa98a69",
            "a77a2c1e-79fa-4b06-9f43-6ec7a0fbf435"
          ],
          "display_name": false
        },
        {
          "uuid": "8e41ee0a-0d7f-4a67-84ef-f0747855b9d1",
          "name": "NITOMAN",
          "stdName": "NITOMAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59ba7180-8cd6-4d54-9263-c1c3159c026b",
            "4567cf0c-441b-4b88-9e9f-3868e58c8318"
          ],
          "display_name": false
        },
        {
          "uuid": "f5b78fdb-031b-4640-b024-065c71961ffe",
          "name": "NSC-169886",
          "stdName": "NSC-169886",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42d50b49-206e-4657-ba9e-933e43ced325",
            "35182470-0fbc-4cbd-a7d3-561d7aa98a69"
          ],
          "display_name": false
        },
        {
          "uuid": "dc1236ac-0116-47a5-8df9-331513cfc4c8",
          "name": "RO 1-9569",
          "stdName": "RO 1-9569",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5857d2a2-91a6-4728-8f33-caae030deffc",
            "35182470-0fbc-4cbd-a7d3-561d7aa98a69"
          ],
          "display_name": false
        },
        {
          "uuid": "22bf91c2-ad68-4d25-9531-960431ca9544",
          "name": "RO-1-9569",
          "stdName": "RO-1-9569",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac9b60ff-f045-4741-a488-4618b3af21ad",
            "35182470-0fbc-4cbd-a7d3-561d7aa98a69"
          ],
          "display_name": false
        },
        {
          "uuid": "4a130baf-4434-471e-b910-ba8c9f4b789b",
          "name": "RO-19569",
          "stdName": "RO-19569",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "401ff513-9749-4059-bf66-3db801242673",
            "35182470-0fbc-4cbd-a7d3-561d7aa98a69"
          ],
          "display_name": false
        },
        {
          "uuid": "470ef296-f5ed-4fa8-8a9d-d2b1e47a6bf9",
          "name": "TETRABENAZINE",
          "stdName": "TETRABENAZINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e139cefd-d7c7-4470-a281-41030c415f66",
            "bc95aea7-50dc-43a1-94da-322c23656124",
            "612c61a1-8017-4975-8e38-918ace0e09d1",
            "2612b105-3493-4cea-8639-8c881ae6aea3",
            "e60a33b0-9828-4dc7-94c6-8b3342d8cb2e",
            "5857d2a2-91a6-4728-8f33-caae030deffc",
            "90ef4526-cc59-4396-b5ae-0354605f6475",
            "1cce8cb4-5163-4d9e-80d7-968e2fa7e4d7",
            "e58a26a8-93dc-4145-8056-f1b588fffaf9",
            "64f80542-96af-4e85-8bbc-1d2c40950cd5",
            "d04f249e-735d-4fa0-8fa4-2280586bd9de",
            "cdb18daf-d1fc-46bc-89bc-da0a27fd5fc0",
            "224236f9-d599-47d7-ac4f-432cb42ffbb2",
            "35182470-0fbc-4cbd-a7d3-561d7aa98a69",
            "3b707479-2791-4e1b-9ea5-f3c29b52c627"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "60dec648-ff00-4234-b573-c1dcbcaeaa06",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "2ef890af-b43c-846d-16d4-80162c5bd2a6",
          "name": "TETRABENAZINE [JAN]",
          "stdName": "TETRABENAZINE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3983b7a5-afb4-96a4-5195-047c3e6254fa"
          ],
          "display_name": false
        },
        {
          "uuid": "e23cf020-c630-4f54-b9ec-3bcb2e132c0a",
          "name": "TETRABENAZINE [MART.]",
          "stdName": "TETRABENAZINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc95aea7-50dc-43a1-94da-322c23656124"
          ],
          "display_name": false
        },
        {
          "uuid": "9e63c4a9-434c-473a-9d64-dc1648536ff7",
          "name": "TETRABENAZINE [MI]",
          "stdName": "TETRABENAZINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35182470-0fbc-4cbd-a7d3-561d7aa98a69",
            "3b707479-2791-4e1b-9ea5-f3c29b52c627"
          ],
          "display_name": false
        },
        {
          "uuid": "7c40a8d1-70e7-4c2e-9d15-07f4166053b3",
          "name": "TETRABENAZINE [ORANGE BOOK]",
          "stdName": "TETRABENAZINE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e60a33b0-9828-4dc7-94c6-8b3342d8cb2e"
          ],
          "display_name": false
        },
        {
          "uuid": "e312c50e-4417-cbcc-8527-bcb6d9a278c0",
          "name": "TETRABENAZINE [USP-RS]",
          "stdName": "TETRABENAZINE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ef76db7-83a4-3908-4a35-6740f877a162"
          ],
          "display_name": false
        },
        {
          "uuid": "8268a581-4c9c-4243-8c29-8ff618e5e243",
          "name": "TETRABENAZINE [VANDF]",
          "stdName": "TETRABENAZINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "612c61a1-8017-4975-8e38-918ace0e09d1",
            "35182470-0fbc-4cbd-a7d3-561d7aa98a69"
          ],
          "display_name": false
        },
        {
          "uuid": "7a0a98ff-cb27-fabc-3ec3-5c46f70f8b39",
          "name": "Tetrabenazine [WHO-DD]",
          "stdName": "TETRABENAZINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62dd38dc-00c9-f8d4-da78-02ff8fa1fecd"
          ],
          "display_name": false
        },
        {
          "uuid": "5c17e997-b083-473a-9c32-9ef04cf31639",
          "name": "XENAZINE",
          "stdName": "XENAZINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59ba7180-8cd6-4d54-9263-c1c3159c026b",
            "4567cf0c-441b-4b88-9e9f-3868e58c8318"
          ],
          "display_name": false
        },
        {
          "uuid": "6cf05ae8-e3e9-4f55-9efe-e8bc23093f04",
          "name": "tetrabenazine [INN]",
          "stdName": "TETRABENAZINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "224236f9-d599-47d7-ac4f-432cb42ffbb2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a77a2c1e-79fa-4b06-9f43-6ec7a0fbf435",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "35182470-0fbc-4cbd-a7d3-561d7aa98a69",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac9b60ff-f045-4741-a488-4618b3af21ad",
          "citation": "Merck Index 14th Edition",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5857d2a2-91a6-4728-8f33-caae030deffc",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "224236f9-d599-47d7-ac4f-432cb42ffbb2",
          "citation": "INN Proposed List 11",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL11.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e60a33b0-9828-4dc7-94c6-8b3342d8cb2e",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc95aea7-50dc-43a1-94da-322c23656124",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b707479-2791-4e1b-9ea5-f3c29b52c627",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59ba7180-8cd6-4d54-9263-c1c3159c026b",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4567cf0c-441b-4b88-9e9f-3868e58c8318",
          "citation": "D08575",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1cce8cb4-5163-4d9e-80d7-968e2fa7e4d7",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "612c61a1-8017-4975-8e38-918ace0e09d1",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42d50b49-206e-4657-ba9e-933e43ced325",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "401ff513-9749-4059-bf66-3db801242673",
          "citation": "CHEMBL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e730d321-0d5f-489d-803d-d495c96e0b3d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390773000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8f08ad2-2326-4213-b4df-80fbc06e7d9e",
          "citation": "SRS import [Z9O08YRN8O]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Z9O08YRN8O",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390773000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00052326-3588-4fa1-b0a0-c6c05986ebb7",
          "citation": "STN; USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64f80542-96af-4e85-8bbc-1d2c40950cd5",
          "citation": "TETRABENAZINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e139cefd-d7c7-4470-a281-41030c415f66",
          "citation": "TETRABENAZINE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cdb18daf-d1fc-46bc-89bc-da0a27fd5fc0",
          "citation": "TETRABENAZINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "90ef4526-cc59-4396-b5ae-0354605f6475",
          "citation": "TETRABENAZINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d04f249e-735d-4fa0-8fa4-2280586bd9de",
          "citation": "TETRABENAZINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e58a26a8-93dc-4145-8056-f1b588fffaf9",
          "citation": "TETRABENAZINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2612b105-3493-4cea-8639-8c881ae6aea3",
          "citation": "TETRABENAZINE [DASH]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "edf3fb3c-b46f-b833-dba6-3a7160b9d449",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=58-46-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "91a30679-0ecb-f67c-427c-a3eb45965594",
          "citation": "https://en.wikipedia.org/wiki/Tetrabenazine",
          "url": "https://en.wikipedia.org/wiki/Tetrabenazine",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "b2f407e8-dbc8-4be4-8e44-cfb92c3e9afa",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "24d6afc1-b9ab-0ae0-544b-2d1e26d5b200",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3983b7a5-afb4-96a4-5195-047c3e6254fa",
          "citation": "JAN",
          "doc_type": "JAN",
          "public_domain": true
        },
        {
          "uuid": "cf315230-d7db-c722-41e6-a7ab5b1a95bb",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2008/021894lbl.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4ef76db7-83a4-3908-4a35-6740f877a162",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "7539427c-71ac-45e3-a115-6d321bbf1b05",
          "citation": "208082Orig1s000 CLINICAL PHARMACOLOGY AND BIOPHARMACEUTICS REVIEW(S)",
          "url": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2017/208082Orig1s000ClinPharmR.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "CLIN"
          ]
        },
        {
          "uuid": "ce19eeea-25ae-14f1-43fe-30f9f3bc52a7",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "62dd38dc-00c9-f8d4-da78-02ff8fa1fecd",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "813a0c0e-522d-15ff-3b39-cb2e77efecd6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "052ed19e-8c24-4529-ed61-44fd41b39008",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "44823830-c9b5-4383-9bf6-e2676fd8a93f",
          "citation": "Erickson, Jeffrey D., et al. \"Distinct pharmacological properties and distribution in neurons and endocrine cells of two isoforms of the human vesicular monoamine transporter.\" Proceedings of the National Academy of Sciences 93.10 (1996): 5166-5171.",
          "url": "https://www.pnas.org/doi/pdf/10.1073/pnas.93.10.5166",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "da627026-73f6-ea73-8c93-75626c076048",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9ae63646-aa81-419f-b5dc-33b0b6d67aa8",
          "id": "9ae63646-aa81-419f-b5dc-33b0b6d67aa8",
          "molfile": "\n  Marvin  01132108032D          \n\n 23 25  0  0  0  0            999 V2000\n    1.6540   -1.4368    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.4367   -0.9704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1632   -1.4207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0666   -0.8980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1632   -2.3671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6674   -2.2410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9114   -2.6860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9142   -3.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2842   -3.8870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4504   -3.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1634   -3.9057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8925   -3.5197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6592   -3.9138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3642   -3.6538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8899   -2.7262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6190   -2.4475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3026   -2.8094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1526   -2.2920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4557   -2.6753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1984   -2.2920    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    0.2225   -1.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9356   -1.0642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9329   -0.3566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  6  1  0  0  0  0\n 22  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n 20  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 19 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 15 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 18  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  6  0  0  0\n 21 22  1  0  0  0  0\n 23 22  2  0  0  0  0\nM  END",
          "smiles": "CC(C)C[C@H]1CN2CCc3cc(c(cc3[C@@H]2CC1=O)OC)OC",
          "formula": "C19H27NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "42453cf8-6282-4212-9417-d0003103382d"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "317.4233",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cb5d7dfc-9205-410e-a765-f37f63b5201a",
      "version": "43",
      "structure": {
        "id": "141d2cfd-187e-48ee-99e1-2675cf0e1c07",
        "molfile": "\n  Marvin  01132101152D          \n\n 24 26  0  0  0  0            999 V2000\n    0.9114   -2.6860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1984   -2.2920    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -0.4557   -2.6753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2225   -1.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9356   -1.0642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6540   -1.4368    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -0.4504   -3.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1526   -2.2920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6674   -2.2410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8899   -2.7262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1634   -3.9057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8925   -3.5197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9142   -3.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4367   -0.9704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2842   -3.8870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9329   -0.3566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6190   -2.4475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6592   -3.9138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1632   -1.4207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3642   -3.6538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3026   -2.8094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0666   -0.8980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1632   -2.3671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1904   -3.0104    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  9  1  0  0  0  0\n  7 15  1  0  0  0  0\n  8  3  2  0  0  0  0\n  9  1  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11  7  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13  1  1  0  0  0  0\n  6 14  1  1  0  0  0\n 15 13  1  0  0  0  0\n 16  5  2  0  0  0  0\n 17 10  1  0  0  0  0\n 18 12  1  0  0  0  0\n 19 14  1  0  0  0  0\n 20 18  1  0  0  0  0\n 21 17  1  0  0  0  0\n 22 19  1  0  0  0  0\n 23 19  1  0  0  0  0\n  2 24  1  1  0  0  0\n  3  7  1  0  0  0  0\n  4  5  1  0  0  0  0\n 10 12  2  0  0  0  0\nM  END",
        "smiles": "CC(C)C[C@H]1CN2CCc3cc(c(cc3[C@]2([H])CC1=O)OC)OC",
        "formula": "C19H27NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "317.4233",
        "optical_activity": "( + / - )",
        "references": [
          "e8f08ad2-2326-4213-b4df-80fbc06e7d9e",
          "00052326-3588-4fa1-b0a0-c6c05986ebb7",
          "224236f9-d599-47d7-ac4f-432cb42ffbb2"
        ],
        "stereo_centers": 2
      },
      "unii": "Z9O08YRN8O"
    }
  ]
}