{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d9e43f53-9ff3-45c8-8428-954aa77b396b", "code": "2385-85-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2385-85-5", "code_system": "CAS", "references": [ "cc6d81a4-806b-4aa3-a9d4-d1507fb124d7", "038a33c7-d29e-4db2-b0fb-48c8a83be507" ] }, { "uuid": "44bd3478-199f-49d2-b58f-c1d1942bf282", "code": "C44404", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C44404", "code_system": "NCI_THESAURUS", "references": [ "cc6d81a4-806b-4aa3-a9d4-d1507fb124d7" ] }, { "uuid": "4bbbfb78-8352-4963-9a3f-0ef598f33580", "code": "D008917", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68008917", "code_system": "MESH", "references": [ "cc6d81a4-806b-4aa3-a9d4-d1507fb124d7" ] }, { "uuid": "ba1e595a-5e19-4f9a-9b68-6c84f1ed7c10", "code": "MIREX", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Mirex", "code_system": "WIKIPEDIA", "references": [ "cc6d81a4-806b-4aa3-a9d4-d1507fb124d7" ] }, { "uuid": "4c11ec64-3698-45d3-a555-f471ab63de5e", "code": "39201", "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL", "type": "PRIMARY", "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:118", "code_system": "EPA PESTICIDE CODE", "references": [ "cc6d81a4-806b-4aa3-a9d4-d1507fb124d7" ] }, { "uuid": "5a27c79c-d93f-4b65-b6c1-fb649c377081", "code": "m7560", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m7560?q=authorize", "code_system": "MERCK INDEX", "references": [ "cc6d81a4-806b-4aa3-a9d4-d1507fb124d7" ] }, { "uuid": "cd00bea7-d689-4e70-9e96-3b57574d8c4d", "code": "219-196-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.452", "code_system": "ECHA (EC/EINECS)", "references": [ "cc6d81a4-806b-4aa3-a9d4-d1507fb124d7" ] }, { "uuid": "5c5a974b-35f6-4dd1-b676-c64032543928", "code": "16945", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16945", "code_system": "PUBCHEM", "references": [ "cc6d81a4-806b-4aa3-a9d4-d1507fb124d7" ] }, { "uuid": "78573078-8783-c613-ac4d-880685af6b1e", "code": "1659", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1659", "code_system": "HSDB", "references": [ "c461e4b1-f736-5935-1109-e7f4cd765d1d" ] }, { "uuid": "effaefe3-83bb-4ea3-a3b5-55aa7672c3cb", "code": "DTXSID7020895", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7020895", "code_system": "EPA CompTox", "references": [ "3a3e7fea-b86e-a2c8-29b3-ff73228f4c8f" ] }, { "uuid": "fa503e0b-79b6-42b2-3137-3a9783269586", "code": "C45410", "comments": "Chemical Modifier[C1932]|Carcinogen[C347]|Chemical Carcinogen[C1743]|Organic Carcinogen[C45175]|Organo-halide Carcinogen[C45183]|Halogenated Ring Carcinogen[C45186]|Chlorinated Ring Carcinogen", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45410", "code_system": "NCI_THESAURUS", "references": [ "0a5d1942-f3b9-d1ac-3de0-6daf73aaa76f" ] }, { "uuid": "c12d28aa-1118-4882-b144-360f9c08afe2", "code": "Z917AN264P", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "30944e91-b0e9-20cb-dd39-1463ba50af38", "code": "34852", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34852", "code_system": "CHEBI", "references": [ "0a5d1942-f3b9-d1ac-3de0-6daf73aaa76f" ] }, { "uuid": "1cb11fb2-f6f4-8376-3112-064785a5b85e", "code": "124102", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=124102", "code_system": "NSC", "references": [ "358d5ed2-ccb9-08cd-db28-028aad1008ab" ] }, { "uuid": "1a5be030-32ef-4892-3560-a9694038eade", "code": "26107", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=26107", "code_system": "NSC", "references": [ "358d5ed2-ccb9-08cd-db28-028aad1008ab" ] }, { "uuid": "0513496b-e0e1-599f-7428-b2e35c044e67", "code": "37656", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=37656", "code_system": "NSC", "references": [ "358d5ed2-ccb9-08cd-db28-028aad1008ab" ] }, { "uuid": "97e1f937-cd5d-0341-81db-5428a29a67f6", "code": "mirex", "type": "PRIMARY", "url": "https://pesticidecompendium.bcpc.org/mirex.html", "code_system": "ALANWOOD", "references": [ "b0d149e8-f5f3-f25a-a242-b76d853b79f2" ] } ], "substance_class": "chemical", "names": [ { "uuid": "b00fee81-df33-4cee-b08c-6e3658ce865f", "name": "1,1A,2,2,3,3A,4,5,5,5A,5B,6-DODECACHLOROOCTAHYDRO-1,3,4-METHENO-1H-CYCLOBUTA(CD)PENTALENE", "stdName": "1,1A,2,2,3,3A,4,5,5,5A,5B,6-DODECACHLOROOCTAHYDRO-1,3,4-METHENO-1H-CYCLOBUTA(CD)PENTALENE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "011b9c7d-d97b-4311-88e8-9ff123e4d85f", "2deff12f-5d00-4301-a584-d626f7c47744" ], "display_name": false }, { "uuid": "fe7de6e5-7c65-4a7c-972d-4734f7a297d5", "name": "DODECACHLOROPENTACYCLO(5.3.0.0(SUP 2,6).0(SUP 3,9).0(SUP 4,8))DECANE", "stdName": "DODECACHLOROPENTACYCLO(5.3.0.0(SUP 2,6).0(SUP 3,9).0(SUP 4,8))DECANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a03ae9a2-5bf2-4cb1-aace-5630068eaa27", "2deff12f-5d00-4301-a584-d626f7c47744" ], "display_name": false }, { "uuid": "28eb97cf-0431-4dba-bca8-146d468f73df", "name": "MIREX", "stdName": "MIREX", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "59ecf266-6f8d-481a-ae1a-6da5abe93e77", "6edf486b-79e1-44ad-8623-75caf6255f37", "dec2ce43-96ff-4bd5-8fed-5013d8e1867f", "bf043d3a-80e8-47e9-a33f-e9e532765bb7", "c62a2d16-a320-413d-a57b-11b412d23435" ], "display_name": true }, { "uuid": "27af9463-7429-4ceb-a896-3df9bba1f842", "name": "MIREX [HSDB]", "stdName": "MIREX [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "dec2ce43-96ff-4bd5-8fed-5013d8e1867f" ], "display_name": false }, { "uuid": "fb2c7814-a920-c87a-d831-295c7220f922", "name": "MIREX [IARC]", "stdName": "MIREX [IARC]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6e6ea210-bff2-1f7e-8f51-627a4408c535" ], "display_name": false }, { "uuid": "9dd415ce-ba81-43d8-acf3-048540cb733d", "name": "MIREX [MI]", "stdName": "MIREX [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6edf486b-79e1-44ad-8623-75caf6255f37" ], "display_name": false }, { "uuid": "c93649c0-4cec-481c-be65-00405e29b447", "name": "NSC-124102", "stdName": "NSC-124102", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "25fe6825-333e-462f-b4b0-f7d689d0105b" ], "display_name": false }, { "uuid": "5f9ee7c7-56c0-441d-9bac-3416b9ff795b", "name": "NSC-26107", "stdName": "NSC-26107", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "25fe6825-333e-462f-b4b0-f7d689d0105b" ], "display_name": false }, { "uuid": "42a7c718-e8d6-4605-a5a8-a9ce08448819", "name": "NSC-37656", "stdName": "NSC-37656", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "25fe6825-333e-462f-b4b0-f7d689d0105b" ], "display_name": false } ], "references": [ { "uuid": "c62a2d16-a320-413d-a57b-11b412d23435", "citation": "WIKIPEDIA", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "2deff12f-5d00-4301-a584-d626f7c47744", "citation": "ALANWOOD.NET", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a03ae9a2-5bf2-4cb1-aace-5630068eaa27", "citation": "ALANWOOD IUPAC", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "011b9c7d-d97b-4311-88e8-9ff123e4d85f", "citation": "ALANWOOD CAS", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6edf486b-79e1-44ad-8623-75caf6255f37", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dec2ce43-96ff-4bd5-8fed-5013d8e1867f", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "25fe6825-333e-462f-b4b0-f7d689d0105b", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "cc6d81a4-806b-4aa3-a9d4-d1507fb124d7", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389664000, "tags": [ "NOMEN" ] }, { "uuid": "26321625-9f55-4701-bab2-9a3adde129df", "citation": "SRS import [Z917AN264P]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Z917AN264P", "doc_type": "SRS", "public_domain": true, "document_date": 1493389664000, "tags": [ "NOMEN" ] }, { "uuid": "59ecf266-6f8d-481a-ae1a-6da5abe93e77", "citation": "MIREX [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "bf043d3a-80e8-47e9-a33f-e9e532765bb7", "citation": "MIREX [HSDB]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "c461e4b1-f736-5935-1109-e7f4cd765d1d", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+2385-85-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3a3e7fea-b86e-a2c8-29b3-ff73228f4c8f", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2385-85-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6e6ea210-bff2-1f7e-8f51-627a4408c535", "citation": "IARC", "doc_type": "IARC", "public_domain": true }, { "uuid": "0a5d1942-f3b9-d1ac-3de0-6daf73aaa76f", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "b0d149e8-f5f3-f25a-a242-b76d853b79f2", "citation": "AW", "doc_type": "ALANWOOD", "public_domain": true }, { "uuid": "038a33c7-d29e-4db2-b0fb-48c8a83be507", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "358d5ed2-ccb9-08cd-db28-028aad1008ab", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "149e9410-8386-474f-9d01-47bb8fc158b0", "id": "149e9410-8386-474f-9d01-47bb8fc158b0", "molfile": "\n Marvin 01132101162D \n\n 22 26 0 0 0 0 999 V2000\n 2.7719 -2.4528 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4249 -2.1224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9509 -1.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2147 -1.5884 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0055 -1.7686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6001 -1.4666 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0055 -0.8682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7009 -0.4632 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4301 -1.3015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6613 -1.0827 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4301 -2.1224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8286 -2.4785 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5744 -2.4721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.6518 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4332 -2.9542 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4249 -1.3015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7783 -1.1020 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6583 -0.4632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2630 -0.2852 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8577 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9573 -0.8618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6420 -0.4632 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 11 2 1 0 0 0 0\n 16 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 5 1 0 0 0 0\n 3 21 1 0 0 0 0\n 6 5 1 0 0 0 0\n 5 7 1 0 0 0 0\n 13 5 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 7 1 0 0 0 0\n 21 7 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 9 1 0 0 0 0\n 16 9 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 11 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 13 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 16 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 18 1 0 0 0 0\n 18 21 1 0 0 0 0\n 22 21 1 0 0 0 0\nM END", "smiles": "C12(C3(C4(C5(C(C1(C4(Cl)Cl)Cl)(C2(C(C35Cl)(Cl)Cl)Cl)Cl)Cl)Cl)Cl)Cl", "formula": "C10Cl12", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "4620d9d0-655a-4cd6-868c-e9a629079669" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "545.5426", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "INCOMPLETE", "uuid": "fb937d6b-eca9-46cd-bf66-aebb8203231e", "version": "14", "structure": { "id": "9b4859e0-7ee0-4ddd-8563-d158890fb3a3", "molfile": "\n Marvin 01132108042D \n\n 22 26 0 0 0 0 999 V2000\n 1.0056 -0.8683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9511 -1.7752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4302 -1.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4251 -2.1226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0056 -1.7688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4302 -2.1226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9575 -0.8619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4251 -1.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6586 -0.4632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5745 -2.4723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7722 -2.4530 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2149 -1.5886 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7010 -0.4632 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6615 -1.0828 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6002 -1.4667 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8288 -2.4787 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6422 -0.4632 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7786 -1.1021 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.6521 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4332 -2.9545 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2633 -0.2852 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8580 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2 7 1 0 0 0 0\n 3 1 1 0 0 0 0\n 4 2 1 0 0 0 0\n 5 1 1 0 0 0 0\n 6 3 1 0 0 0 0\n 7 1 1 0 0 0 0\n 8 3 1 0 0 0 0\n 9 7 1 0 0 0 0\n 10 5 1 0 0 0 0\n 11 4 1 0 0 0 0\n 12 2 1 0 0 0 0\n 13 1 1 0 0 0 0\n 14 3 1 0 0 0 0\n 15 5 1 0 0 0 0\n 16 6 1 0 0 0 0\n 17 7 1 0 0 0 0\n 18 8 1 0 0 0 0\n 19 10 1 0 0 0 0\n 20 10 1 0 0 0 0\n 21 9 1 0 0 0 0\n 22 9 1 0 0 0 0\n 2 5 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 6 1 0 0 0 0\n 8 4 1 0 0 0 0\n 6 4 1 0 0 0 0\nM END", "smiles": "C12(C3(C4(C5(C(C1(C4(Cl)Cl)Cl)(C2(C(C35Cl)(Cl)Cl)Cl)Cl)Cl)Cl)Cl)Cl", "formula": "C10Cl12", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "545.5426", "optical_activity": "NONE", "references": [ "c62a2d16-a320-413d-a57b-11b412d23435", "26321625-9f55-4701-bab2-9a3adde129df" ], "stereo_centers": 8 }, "unii": "Z917AN264P" } ] }