{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cd9e977e-91d4-45f7-9ef1-d40d80904119",
          "code": "20256-56-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=20256-56-8",
          "code_system": "CAS",
          "references": [
            "42f4b18a-be1c-4830-aaba-a441e94f323d",
            "26776b90-9c91-4336-885d-a97c5bcc199a"
          ]
        },
        {
          "uuid": "8a3e3f1a-f672-4fa8-9f9b-fcda055511fe",
          "code": "C027118",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67027118",
          "code_system": "MESH",
          "references": [
            "42f4b18a-be1c-4830-aaba-a441e94f323d"
          ]
        },
        {
          "uuid": "c8353f83-38ce-48cf-86b9-e1488d206ba5",
          "code": "1425983",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1425983/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "42f4b18a-be1c-4830-aaba-a441e94f323d"
          ]
        },
        {
          "uuid": "cd515bf0-489f-43f1-ba87-b1fa97f5113f",
          "code": "D08AJ06",
          "comments": "ATC|DERMATOLOGICALS|ANTISEPTICS AND DISINFECTANTS|ANTISEPTICS AND DISINFECTANTS|Quaternary ammonium compounds|didecyldimethylammonium chloride",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=D08AJ06&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "42f4b18a-be1c-4830-aaba-a441e94f323d"
          ]
        },
        {
          "uuid": "2883d3c7-b813-449e-a927-f3976c5c7e53",
          "code": "16958",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16958",
          "code_system": "PUBCHEM",
          "references": [
            "42f4b18a-be1c-4830-aaba-a441e94f323d"
          ]
        },
        {
          "uuid": "c64792ea-972f-5d85-e3cf-93ab037e2573",
          "code": "Didecyldimethylammonium",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Didecyldimethylammonium",
          "code_system": "WIKIPEDIA",
          "references": [
            "70b40738-6e5f-5099-9518-6eb176887568"
          ]
        },
        {
          "uuid": "42927693-e757-fbcd-a52e-194e957ed378",
          "code": "DTXSID0048004",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0048004",
          "code_system": "EPA CompTox",
          "references": [
            "9b762d13-0cd8-c045-db43-4dfbfa737add"
          ]
        },
        {
          "uuid": "4fbef99f-8e6a-0e0e-4438-3b021b131ff4",
          "code": "DB04221",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB04221",
          "code_system": "DRUG BANK",
          "references": [
            "d2a39342-5a98-1d2f-1ee5-87e99022cfd3"
          ]
        },
        {
          "uuid": "8949a1cd-a8ad-4046-b6f3-3d1bd34e4462",
          "code": "Z7F472XQPA",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "cb4f50a9-6c12-3c21-c336-0ba175bcd244",
          "code": "Z7F472XQPA",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Z7F472XQPA",
          "code_system": "DAILYMED",
          "references": [
            "a3963bc9-fb3d-2a1d-3d30-92fe71123a60"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "025dc13e-215e-457b-a530-5dbb6c019c80",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "21c3e470-b37c-447f-a318-07d766e27dc7",
            "refuuid": "59f912a3-7430-42a9-9f60-65b56d197dc0",
            "name": "DIDECYLDIMONIUM CHLORIDE",
            "unii": "JXN40O9Y9B",
            "linking_id": "JXN40O9Y9B",
            "ref_pname": "DIDECYLDIMONIUM CHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fac9d49d-93dc-4c61-98e9-e45545d7d474",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "415518e1-bfa4-4969-a909-22adaafe92ab",
            "refuuid": "4bd038aa-3e59-4612-9d09-6bcbb733d6ca",
            "name": "DIDECYLDIMONIUM",
            "unii": "Z7F472XQPA",
            "linking_id": "Z7F472XQPA",
            "ref_pname": "DIDECYLDIMONIUM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a0188ad1-12bb-400f-b344-ab3d105e0120",
          "name": "1-DECANAMINIUM, N-DECYL-N,N-DIMETHYL-",
          "stdName": "1-DECANAMINIUM, N-DECYL-N,N-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feedbb58-919d-4386-8869-cc7f59feb1ee",
            "6b46a14b-f478-491b-8a93-2c71d375e992"
          ],
          "display_name": false
        },
        {
          "uuid": "b7dd8d3d-e577-4263-9b20-17ebcd31c09c",
          "name": "AMMONIUM, DIDECYLDIMETHYL-",
          "stdName": "AMMONIUM, DIDECYLDIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feedbb58-919d-4386-8869-cc7f59feb1ee",
            "6b46a14b-f478-491b-8a93-2c71d375e992"
          ],
          "display_name": false
        },
        {
          "uuid": "0dd254e7-3152-4d69-8b92-ce72229d7ce6",
          "name": "DIDECYLDIMETHYLAMMONIUM",
          "stdName": "DIDECYLDIMETHYLAMMONIUM",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feedbb58-919d-4386-8869-cc7f59feb1ee",
            "6b46a14b-f478-491b-8a93-2c71d375e992",
            "9275d876-41df-48fe-b9a0-c0d4739a7f6e",
            "b237d748-5885-443a-971d-abf094c1f2fc"
          ],
          "display_name": false
        },
        {
          "uuid": "a38866ce-958f-44f0-b0d3-d86e97dcbabb",
          "name": "DIDECYLDIMETHYLAMMONIUM CATION",
          "stdName": "DIDECYLDIMETHYLAMMONIUM CATION",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feedbb58-919d-4386-8869-cc7f59feb1ee",
            "7db72980-d9f3-43c9-9ed9-c770a0145af3"
          ],
          "display_name": false
        },
        {
          "uuid": "c27b813c-8cbe-4c77-843d-68e87992d9fc",
          "name": "DIDECYLDIMETHYLAMMONIUM ION",
          "stdName": "DIDECYLDIMETHYLAMMONIUM ION",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feedbb58-919d-4386-8869-cc7f59feb1ee",
            "7db72980-d9f3-43c9-9ed9-c770a0145af3"
          ],
          "display_name": false
        },
        {
          "uuid": "62081905-81e0-42eb-8093-2cc6d2963851",
          "name": "DIDECYLDIMONIUM",
          "stdName": "DIDECYLDIMONIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feedbb58-919d-4386-8869-cc7f59feb1ee",
            "7db72980-d9f3-43c9-9ed9-c770a0145af3"
          ],
          "display_name": true
        },
        {
          "uuid": "6f38ba4c-a36c-474e-96b9-ceab41e3f121",
          "name": "DIDECYLDIMONIUM CATION",
          "stdName": "DIDECYLDIMONIUM CATION",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feedbb58-919d-4386-8869-cc7f59feb1ee",
            "7db72980-d9f3-43c9-9ed9-c770a0145af3"
          ],
          "display_name": false
        },
        {
          "uuid": "7f7eed6e-3d13-493f-9aa4-12986069c9e8",
          "name": "DIDECYLDIMONIUM ION",
          "stdName": "DIDECYLDIMONIUM ION",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feedbb58-919d-4386-8869-cc7f59feb1ee",
            "7db72980-d9f3-43c9-9ed9-c770a0145af3"
          ],
          "display_name": false
        },
        {
          "uuid": "162a9999-ef4b-5910-9d27-40e699d30b76",
          "name": "Didecyldimethylammonium [WHO-DD]",
          "stdName": "DIDECYLDIMETHYLAMMONIUM [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79d58d9c-2bce-a88f-a35b-a602c63d8da4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6b46a14b-f478-491b-8a93-2c71d375e992",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "feedbb58-919d-4386-8869-cc7f59feb1ee",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7db72980-d9f3-43c9-9ed9-c770a0145af3",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b237d748-5885-443a-971d-abf094c1f2fc",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42f4b18a-be1c-4830-aaba-a441e94f323d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390962000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "688a418c-e4f0-4ab4-bef8-d381fb2317fb",
          "citation": "SRS import [Z7F472XQPA]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Z7F472XQPA",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390962000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9275d876-41df-48fe-b9a0-c0d4739a7f6e",
          "citation": "DIDECYLDIMETHYLAMMONIUM [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "70b40738-6e5f-5099-9518-6eb176887568",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Didecyldimethylammonium",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9b762d13-0cd8-c045-db43-4dfbfa737add",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=20256-56-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "26776b90-9c91-4336-885d-a97c5bcc199a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d2a39342-5a98-1d2f-1ee5-87e99022cfd3",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a3963bc9-fb3d-2a1d-3d30-92fe71123a60",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "79d58d9c-2bce-a88f-a35b-a602c63d8da4",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "394da5ec-b176-4e8f-892c-99b072e17436",
          "id": "394da5ec-b176-4e8f-892c-99b072e17436",
          "molfile": "\n  Marvin  01132103022D          \n\n 23 22  0  0  0  0            999 V2000\n    5.2854   -6.8702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4990   -6.0733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2959   -5.8643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5095   -5.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3062   -4.8538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5200   -4.0571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3167   -3.8388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5303   -3.0419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3272   -2.8330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5408   -2.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3376   -1.8178    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n   10.9547   -2.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9206   -1.2348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6210   -1.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9090   -1.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1970   -1.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4804   -1.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7684   -1.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0518   -1.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3352   -1.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6232   -1.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9066   -1.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1900   -1.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\nM  CHG  1  11   1\nM  END",
          "smiles": "CCCCCCCCCC[N+](C)(C)CCCCCCCCCC",
          "formula": "C22H48N",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9ca1b3df-33e4-4d30-87e3-c0415ebeb640"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "326.624",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4bd038aa-3e59-4612-9d09-6bcbb733d6ca",
      "version": "8",
      "structure": {
        "id": "197ab8db-f79d-4d2f-8679-3b67ddbd5ea9",
        "molfile": "\n  Marvin  01132101302D          \n\n 23 22  0  0  0  0            999 V2000\n    5.2854   -6.8702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4990   -6.0733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2959   -5.8643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5095   -5.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3062   -4.8538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5200   -4.0571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3167   -3.8388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5303   -3.0419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3272   -2.8330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5408   -2.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3376   -1.8178    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   10.9547   -2.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9206   -1.2348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6210   -1.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9090   -1.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1970   -1.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4804   -1.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7684   -1.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0518   -1.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3352   -1.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6232   -1.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9066   -1.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1900   -1.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\nM  CHG  1  11   1\nM  END",
        "smiles": "CCCCCCCCCC[N+](C)(C)CCCCCCCCCC",
        "formula": "C22H48N",
        "atropisomerism": "No",
        "charge": 1,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "326.624",
        "optical_activity": "NONE",
        "references": [
          "6b46a14b-f478-491b-8a93-2c71d375e992",
          "688a418c-e4f0-4ab4-bef8-d381fb2317fb"
        ],
        "stereo_centers": 0
      },
      "unii": "Z7F472XQPA"
    }
  ]
}