{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a23bd499-a2f8-4f9a-b14e-536a3350a62f",
          "code": "1190428-65-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1190428-65-9",
          "code_system": "CAS",
          "references": [
            "33a1f01e-576e-4058-adbf-14ea091db66b",
            "803e17a3-7935-4e47-a78d-c8a2a59c43e5"
          ]
        },
        {
          "uuid": "159f7a09-a3cd-0c2b-a384-3a61fc538c20",
          "code": "91936869",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91936869",
          "code_system": "PUBCHEM",
          "references": [
            "a8874cd7-0b7b-7b49-5d22-ad353e4b0314"
          ]
        },
        {
          "uuid": "c56ad801-5562-4b0a-ad6a-29b520ebed34",
          "code": "Z75Y5P356H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8750d469-eaf0-4434-bc25-c52daf61a882",
          "name": "IMIDAZOLYLPHENYLETHYL NAPHTHYLSULFONYL ASPARAGINE",
          "stdName": "IMIDAZOLYLPHENYLETHYL NAPHTHYLSULFONYL ASPARAGINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2510d3e1-5b83-4cfb-80ff-2c363c52f060",
            "5d8da1b9-253e-4e5c-803f-0a7eaa76e923",
            "d9969613-9262-4dfc-89e8-0686f1e0d12a"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "8b714091-8126-4c7e-87bd-66144a2253ce",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "3616c0d0-63a0-4bac-bc4d-b7a4c3e41c2c",
          "name": "L-ASPARAGINE, N-(2-(4-(4,5-DIHYDRO-1H-IMIDAZOL-2-YL)PHENYL)ETHYL)-N2-(2-NAPHTHALENYLSULFONYL)-",
          "stdName": "L-ASPARAGINE, N-(2-(4-(4,5-DIHYDRO-1H-IMIDAZOL-2-YL)PHENYL)ETHYL)-N2-(2-NAPHTHALENYLSULFONYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5d8da1b9-253e-4e5c-803f-0a7eaa76e923",
            "d19e053f-bbb2-4a8b-a22b-818f2ecea359"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2510d3e1-5b83-4cfb-80ff-2c363c52f060",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5d8da1b9-253e-4e5c-803f-0a7eaa76e923",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d19e053f-bbb2-4a8b-a22b-818f2ecea359",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33a1f01e-576e-4058-adbf-14ea091db66b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391951000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21d00a21-2ace-4119-b328-e6c7fb8dbc88",
          "citation": "SRS import [Z75Y5P356H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Z75Y5P356H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391951000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9969613-9262-4dfc-89e8-0686f1e0d12a",
          "citation": "IMIDAZOLYLPHENYLETHYL NAPHTHYLSULFONYL ASPARAGINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a8874cd7-0b7b-7b49-5d22-ad353e4b0314",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "803e17a3-7935-4e47-a78d-c8a2a59c43e5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7bf910e8-ac0a-4a88-b802-507f5e30650e",
          "id": "7bf910e8-ac0a-4a88-b802-507f5e30650e",
          "molfile": "\n  Marvin  01132106262D          \n\n 35 38  0  0  1  0            999 V2000\n   12.2888   -8.3669    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   12.7013   -9.0814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5263   -9.0814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9389   -9.7958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9389   -8.3669    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7639   -8.3669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1764   -7.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0014   -7.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4139   -8.3669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2390   -8.3668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6514   -7.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2390   -6.9379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4139   -6.9379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4765   -7.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.9615   -8.3198    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7460   -8.0649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7460   -7.2399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.9615   -6.9849    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4638   -8.3669    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0512   -7.6524    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6388   -6.9379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7657   -7.2399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3367   -8.0649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3367   -8.8900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6222   -9.3024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9077   -8.8900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1933   -9.3024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4788   -8.8900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4788   -8.0650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1933   -7.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9077   -8.0650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6222   -7.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7013   -7.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2888   -6.9379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5263   -7.6524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 19  1  6  0  0  0\n  1 33  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 13  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 14  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 18  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  2  0  0  0  0\n 20 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 32  2  0  0  0  0\n 24 25  2  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 31 26  2  0  0  0  0\n 27 28  2  0  0  0  0\n 29 28  1  0  0  0  0\n 30 29  2  0  0  0  0\n 31 30  1  0  0  0  0\n 32 31  1  0  0  0  0\n 33 34  1  0  0  0  0\n 33 35  2  0  0  0  0\nM  END",
          "smiles": "c1ccc2cc(ccc2c1)S(=O)(=O)N[C@@H](CC(=O)NCCc3ccc(cc3)C4=NCCN4)C(=O)O",
          "formula": "C25H26N4O5S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "61454c66-0186-4845-9893-55e45f538536"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "494.5648",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9147cf7f-fd39-46ff-8b00-7f226b639c45",
      "version": "5",
      "structure": {
        "id": "198d102d-8e6c-4d7a-be9b-f4c7408a9029",
        "molfile": "\n  Marvin  01132101312D          \n\n 35 38  0  0  1  0            999 V2000\n   11.0512   -7.6524    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3367   -8.0649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3367   -8.8900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6222   -9.3024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9077   -8.8900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1933   -9.3024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4788   -8.8900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4788   -8.0650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1933   -7.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9077   -8.0650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6222   -7.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6388   -6.9379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7657   -7.2399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4638   -8.3669    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2888   -8.3669    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.7013   -7.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2888   -6.9379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5263   -7.6524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7013   -9.0814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5263   -9.0814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9389   -9.7958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9389   -8.3669    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7639   -8.3669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1764   -7.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0014   -7.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4139   -8.3669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2390   -8.3668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6514   -7.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4765   -7.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.9615   -6.9849    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7460   -7.2399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7460   -8.0649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.9615   -8.3198    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2390   -6.9379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4139   -6.9379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10  5  2  0  0  0  0\n 11 10  1  0  0  0  0\n  2 11  2  0  0  0  0\n  1 12  2  0  0  0  0\n  1 13  2  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  6  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 15 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  2  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  2  0  0  0  0\n 30 31  1  0  0  0  0\n 32 31  1  0  0  0  0\n 33 32  1  0  0  0  0\n 29 33  1  0  0  0  0\n 34 28  2  0  0  0  0\n 35 34  1  0  0  0  0\n 25 35  2  0  0  0  0\nM  END",
        "smiles": "c1ccc2cc(ccc2c1)S(=O)(=O)N[C@@H](CC(=O)NCCc3ccc(cc3)C4=NCCN4)C(=O)O",
        "formula": "C25H26N4O5S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "494.5648",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d19e053f-bbb2-4a8b-a22b-818f2ecea359",
          "21d00a21-2ace-4119-b328-e6c7fb8dbc88"
        ],
        "stereo_centers": 1
      },
      "unii": "Z75Y5P356H"
    }
  ]
}