{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "31086049-4ffa-4bce-b87f-afb0c7ab33d1",
          "code": "126-49-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=126-49-8",
          "code_system": "CAS",
          "references": [
            "f8c0e175-2380-4a09-a45b-48693b830736",
            "b5e0017e-9f28-4d8f-b635-f71ab4fdf42b"
          ]
        },
        {
          "uuid": "d9eb6f47-982f-45ae-a660-b53d0d8e0e56",
          "code": "PREPHENIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Prephenic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "f8c0e175-2380-4a09-a45b-48693b830736"
          ]
        },
        {
          "uuid": "6e9e693d-30fc-4983-a3c5-3b44bd65d461",
          "code": "87664-40-2",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=87664-40-2",
          "code_system": "CAS",
          "references": [
            "f8c0e175-2380-4a09-a45b-48693b830736",
            "78ca0068-e788-4496-82f9-94ff15753c76"
          ]
        },
        {
          "uuid": "d73d1148-7643-4586-b6e4-69a4bab8dde4",
          "code": "m9126",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9126?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f8c0e175-2380-4a09-a45b-48693b830736"
          ]
        },
        {
          "uuid": "fea92e43-d543-400b-9a75-bfd146e8a94a",
          "code": "1028",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1028",
          "code_system": "PUBCHEM",
          "references": [
            "f8c0e175-2380-4a09-a45b-48693b830736"
          ]
        },
        {
          "uuid": "8656dd74-de08-e3bb-3403-c22f91efd16b",
          "code": "DB08427",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB08427",
          "code_system": "DRUG BANK",
          "references": [
            "55078394-fa3a-d1eb-120a-ecb6705e5ebf"
          ]
        },
        {
          "uuid": "230ccde3-540a-4349-a47b-9c2686f409a7",
          "code": "Z66B98Z97I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "020b0e3f-35fb-6b05-fb97-a40cc777f66d",
          "code": "16666",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16666",
          "code_system": "CHEBI",
          "references": [
            "55078394-fa3a-d1eb-120a-ecb6705e5ebf"
          ]
        },
        {
          "uuid": "ee871970-cd45-7664-8daf-0acd2cf8b213",
          "code": "84387",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:84387",
          "code_system": "CHEBI",
          "references": [
            "55078394-fa3a-d1eb-120a-ecb6705e5ebf"
          ]
        },
        {
          "uuid": "48bfd9ff-b1cf-ec1d-17c4-55d051748d43",
          "code": "DTXSID60894109",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60894109",
          "code_system": "EPA CompTox",
          "references": [
            "55078394-fa3a-d1eb-120a-ecb6705e5ebf"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "05905e4d-1ee0-4c9d-8c4f-a7e381402556",
          "name": "CIS-1-CARBOXY-4-HYDROXY-.ALPHA.-OXO-2,5-CYCLOHEXADIENE-1-PROPANOIC ACID",
          "stdName": "CIS-1-CARBOXY-4-HYDROXY-.ALPHA.-OXO-2,5-CYCLOHEXADIENE-1-PROPANOIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c08ac996-1379-44fa-b1f0-4c56b036be61",
            "9a1eee69-a8f9-4073-84df-0eacbacc385c"
          ],
          "display_name": false
        },
        {
          "uuid": "a7c780c8-62f8-4f2d-be29-cfb7b8f471f2",
          "name": "PREPHENIC ACID",
          "stdName": "PREPHENIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d947988-2186-4704-9896-6a7d5a85ebbd",
            "c08ac996-1379-44fa-b1f0-4c56b036be61",
            "8b4ba3b4-25dc-497e-8b63-dbb09b949f0e"
          ],
          "display_name": true
        },
        {
          "uuid": "619fdc14-5a9a-42dc-ad6e-a913ada13a3f",
          "name": "PREPHENIC ACID [MI]",
          "stdName": "PREPHENIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c08ac996-1379-44fa-b1f0-4c56b036be61",
            "8b4ba3b4-25dc-497e-8b63-dbb09b949f0e"
          ],
          "display_name": false
        },
        {
          "uuid": "98390788-7d3c-4b9f-9cbe-1f715f39ba59",
          "name": "PREPHENIC ACID, CIS",
          "stdName": "PREPHENIC ACID, CIS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c08ac996-1379-44fa-b1f0-4c56b036be61",
            "9a1eee69-a8f9-4073-84df-0eacbacc385c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8b4ba3b4-25dc-497e-8b63-dbb09b949f0e",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c08ac996-1379-44fa-b1f0-4c56b036be61",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a1eee69-a8f9-4073-84df-0eacbacc385c",
          "citation": "http://en.wikipedia.org/wiki/Prephenic_acid",
          "url": "http://en.wikipedia.org/wiki/Prephenic_acid",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8c0e175-2380-4a09-a45b-48693b830736",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391704000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4be37664-757f-4fae-9cfe-900edde3c607",
          "citation": "SRS import [Z66B98Z97I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Z66B98Z97I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391704000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96cbafcf-c882-4d83-8d91-e379457410de",
          "citation": "CHEMID RECORD 126-49-8",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d947988-2186-4704-9896-6a7d5a85ebbd",
          "citation": "PREPHENIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "55078394-fa3a-d1eb-120a-ecb6705e5ebf",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "78ca0068-e788-4496-82f9-94ff15753c76",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b5e0017e-9f28-4d8f-b635-f71ab4fdf42b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fff3076d-74a7-4b56-b480-3520ec24f613",
          "id": "fff3076d-74a7-4b56-b480-3520ec24f613",
          "molfile": "\n  Marvin  01132113152D          \n\n 16 16  0  0  1  0            999 V2000\n    2.7633   -3.9642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4777   -3.5518    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.4777   -2.7267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1922   -2.3142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9066   -2.7267    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.1889   -1.9515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5569   -1.4212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7816   -1.7034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7001   -0.6088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0681   -0.0784    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4754   -0.3266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9066   -3.5518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1922   -3.9642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7191   -2.8700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2494   -2.2380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0013   -3.6453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n 13  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5 12  1  0  0  0  0\n  5 14  1  1  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\nM  END",
          "smiles": "C1=C[C@@](C=C[C@H]1O)(CC(=O)C(=O)O)C(=O)O",
          "formula": "C10H10O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "90ed7109-6e0a-4115-a0b9-270da8af0493"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "226.1832",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "INCOMPLETE",
      "uuid": "64950a5f-5701-463a-84b3-d385d31f3267",
      "version": "10",
      "structure": {
        "id": "ca1059c8-f391-4eee-89a5-c7b0c43c60e6",
        "molfile": "\n  Marvin  01132110262D          \n\n 16 16  0  0  1  0            999 V2000\n    4.9066   -2.7267    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.9066   -3.5518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1922   -3.9642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4777   -3.5518    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.4777   -2.7267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1922   -2.3142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7633   -3.9642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1889   -1.9515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5569   -1.4212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7001   -0.6088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0681   -0.0784    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4754   -0.3266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7816   -1.7034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7191   -2.8700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2494   -2.2380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0013   -3.6453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  1  6  1  0  0  0  0\n  4  7  1  1  0  0  0\n  1  8  1  6  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n  9 13  2  0  0  0  0\n  1 14  1  1  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
        "smiles": "C1=C[C@@](C=C[C@H]1O)(CC(=O)C(=O)O)C(=O)O",
        "formula": "C10H10O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "226.1832",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "4be37664-757f-4fae-9cfe-900edde3c607",
          "96cbafcf-c882-4d83-8d91-e379457410de"
        ],
        "stereo_centers": 2
      },
      "unii": "Z66B98Z97I"
    }
  ]
}