{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "050bc1a6-af6a-4ac6-b03f-0ce4c0c32f8a", "code": "68155-67-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=68155-67-9", "code_system": "CAS", "references": [ "af226c9e-f978-4e07-9ac4-2aba24d2a528", "45d1b07e-8f3b-4dc0-8b5f-62f03da48818" ] }, { "uuid": "731ea010-c834-4ee7-98f7-8c909cd003b7", "code": "268-979-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.062.690", "code_system": "ECHA (EC/EINECS)", "references": [ "af226c9e-f978-4e07-9ac4-2aba24d2a528" ] }, { "uuid": "7914d124-7de7-4857-ae77-5d2640449813", "code": "109194", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/109194", "code_system": "PUBCHEM", "references": [ "af226c9e-f978-4e07-9ac4-2aba24d2a528" ] }, { "uuid": "25bbf30b-271d-bf60-0643-0b999ef0e19b", "code": "DTXSID6041923", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6041923", "code_system": "EPA CompTox", "references": [ "24bf2912-511d-5ab7-c9f2-359441613954" ] }, { "uuid": "2b78c9f8-7785-4fe2-9961-b3ca44875e4e", "code": "Z578SE5DGN", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "9d0b57fa-354d-4b1f-9b6a-7970cb116ad4", "name": "1-(2,3,8,8-TETRAMETHYL-1,2,3,4,6,7,8,8A-OCTAHYDRONAPHTHALEN-2-YL)ETHANONE", "stdName": "1-(2,3,8,8-TETRAMETHYL-1,2,3,4,6,7,8,8A-OCTAHYDRONAPHTHALEN-2-YL)ETHANONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "33857955-ec23-40d8-8c16-9658c530c8fb" ], "display_name": true }, { "uuid": "96a64f65-23fd-4663-94bc-aabb03b96398", "name": "2,3,8,8-TETRAMETHYL-2- ACETYL-1,2,3,4,6,7,8,8A-OCTAHYDRONAPHTHALENES", "stdName": "2,3,8,8-TETRAMETHYL-2- ACETYL-1,2,3,4,6,7,8,8A-OCTAHYDRONAPHTHALENES", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "28f1ef2e-c34d-4237-8d85-37cdafa67bbc" ], "display_name": false }, { "uuid": "5cb1c566-07fc-42bd-b8d2-84edc8709259", "name": "ETHANONE, 1-(1,2,3,4,6,7,8,8A-OCTAHYDRO-2,3,8,8-TETRAMETHYL-2-NAPHTHALENYL)-", "stdName": "ETHANONE, 1-(1,2,3,4,6,7,8,8A-OCTAHYDRO-2,3,8,8-TETRAMETHYL-2-NAPHTHALENYL)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "14a893fb-8b7a-4374-abe1-8456ca1099d8" ], "display_name": false } ], "references": [ { "uuid": "33857955-ec23-40d8-8c16-9658c530c8fb", "citation": "CHEMBIODRAW", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "28f1ef2e-c34d-4237-8d85-37cdafa67bbc", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "14a893fb-8b7a-4374-abe1-8456ca1099d8", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "af226c9e-f978-4e07-9ac4-2aba24d2a528", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391466000, "tags": [ "NOMEN" ] }, { "uuid": "a9e069d2-2a23-4ac9-9452-121df403abb8", "citation": "SRS import [Z578SE5DGN]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Z578SE5DGN", "doc_type": "SRS", "public_domain": true, "document_date": 1493391466000, "tags": [ "NOMEN" ] }, { "uuid": "24bf2912-511d-5ab7-c9f2-359441613954", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=68155-67-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "45d1b07e-8f3b-4dc0-8b5f-62f03da48818", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "5a9dcbc2-153e-4ef5-ad48-b91281acddf4", "id": "5a9dcbc2-153e-4ef5-ad48-b91281acddf4", "molfile": "\n Marvin 01132104422D \n\n 17 18 0 0 0 0 999 V2000\n 16.6530 -10.4866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9385 -10.0741 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 15.2241 -10.4866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5095 -10.0741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7951 -10.4866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0806 -10.0741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0806 -9.2491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7951 -8.8366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3254 -8.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2648 -8.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5095 -9.2491 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 15.2241 -8.8366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9385 -9.2491 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 16.2207 -8.4739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7509 -9.3924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2813 -8.7604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0332 -10.1676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 13 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 2 0 0 0 0\n 4 11 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 11 8 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 2 0 0 0 0\nM END", "smiles": "CC1CC2=CCCC(C)(C)C2CC1(C)C(=O)C", "formula": "C16H26O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "413ee623-dc03-4c05-abc1-6a07db9acc6a" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "234.3776", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "e03dbdf8-3c3d-4daf-b403-8f403b5e2d19", "version": "3", "structure": { "id": "3af103c8-11e1-4c49-b72f-2012b9632c8a", "molfile": "\n Marvin 01132103082D \n\n 17 18 0 0 0 0 999 V2000\n 13.0806 -9.2491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0806 -10.0741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7951 -10.4866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5095 -10.0741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2241 -10.4866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9385 -10.0741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6530 -10.4866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9385 -9.2491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7509 -9.3924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0332 -10.1676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2813 -8.7604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2207 -8.4739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2241 -8.8366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5095 -9.2491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7951 -8.8366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3254 -8.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2648 -8.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 8 12 1 0 0 0 0\n 8 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 4 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 1 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 1 0 0 0 0\nM END", "smiles": "CC1CC2=CCCC(C)(C)C2CC1(C)C(=O)C", "formula": "C16H26O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "234.3776", "optical_activity": "UNSPECIFIED", "references": [ "a9e069d2-2a23-4ac9-9452-121df403abb8", "14a893fb-8b7a-4374-abe1-8456ca1099d8" ], "stereo_centers": 3 }, "unii": "Z578SE5DGN" } ] }