{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "46fe9046-0596-4bd2-b01d-c37e76dde2b8", "code": "100937-53-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=100937-53-9", "code_system": "CAS", "references": [ "1c27c3b4-837d-410f-b9be-d28a0b86da8b", "d1daba4f-d5f2-419f-8c93-54c003be4fe3" ] }, { "uuid": "52277b9f-70cf-409f-8cce-9d1d59c2258e", "code": "127716", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/127716", "code_system": "PUBCHEM", "references": [ "1c27c3b4-837d-410f-b9be-d28a0b86da8b" ] }, { "uuid": "e51a43af-ce69-429c-874d-1571f1774421", "code": "Z330X18GMD", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "0ac3f667-0854-e768-6dec-3533923d36d6", "code": "DB03411", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB03411", "code_system": "DRUG BANK", "references": [ "e4d46802-ddd8-1abd-564f-c3c23892f398" ] }, { "uuid": "3f334565-be96-bb15-15e7-fcbb223d5035", "code": "DTXSID10905855", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10905855", "code_system": "EPA CompTox", "references": [ "e4d46802-ddd8-1abd-564f-c3c23892f398" ] } ], "substance_class": "chemical", "names": [ { "uuid": "b2151749-abb4-bc5f-6501-872b0cbd7d51", "name": "(2S,3S,4S)-2-(HYDROXYMETHYL)PYRROLIDINE-3,4-DIOL", "stdName": "(2S,3S,4S)-2-(HYDROXYMETHYL)PYRROLIDINE-3,4-DIOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d1daba4f-d5f2-419f-8c93-54c003be4fe3" ], "display_name": true }, { "uuid": "3034eee0-d73c-d69c-92fa-64aa21a9ffdc", "name": "(2S,3S,4S)-3,4-DIHYDROXY-2-HYDROXYMETHYLPYRROLIDINE", "stdName": "(2S,3S,4S)-3,4-DIHYDROXY-2-HYDROXYMETHYLPYRROLIDINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d1daba4f-d5f2-419f-8c93-54c003be4fe3" ], "display_name": false }, { "uuid": "69b46c7e-3fb1-0132-dd8e-beffb45e2ce9", "name": "1,4-DIDEOXY-1,4-IMINO-L-ARABINITOL", "stdName": "1,4-DIDEOXY-1,4-IMINO-L-ARABINITOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d1daba4f-d5f2-419f-8c93-54c003be4fe3" ], "display_name": false }, { "uuid": "7a9291f0-2fea-4e35-9dbc-244bc68f1807", "name": "2-HYDROXYMETHYL-PYRROLIDINE-3,4-DIOL", "stdName": "2-HYDROXYMETHYL-PYRROLIDINE-3,4-DIOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f55f4cd2-0647-425c-9f84-62270c2a4d1e" ], "display_name": false }, { "uuid": "48bf9737-9600-9e98-27fc-759f2af4293e", "name": "2-HYDROXYMETHYLPYRROLIDINE-3,4-DIOL", "stdName": "2-HYDROXYMETHYLPYRROLIDINE-3,4-DIOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d1daba4f-d5f2-419f-8c93-54c003be4fe3" ], "display_name": false } ], "references": [ { "uuid": "f55f4cd2-0647-425c-9f84-62270c2a4d1e", "citation": "Drug Bank", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "1c27c3b4-837d-410f-b9be-d28a0b86da8b", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393545000, "tags": [ "NOMEN" ] }, { "uuid": "cae42269-73a5-4d00-9458-7b2490c8bec5", "citation": "Drug Bank DB03411", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e4d46802-ddd8-1abd-564f-c3c23892f398", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "d1daba4f-d5f2-419f-8c93-54c003be4fe3", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "be9157a4-fa95-41b3-867e-bd9e9caee2d9", "id": "be9157a4-fa95-41b3-867e-bd9e9caee2d9", "molfile": "\n Marvin 01132109512D \n\n 9 9 0 0 1 0 999 V2000\n -0.0997 0.6294 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n -0.8843 0.8843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1553 -0.1553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9803 -0.1553 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2352 0.6294 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 2.0198 0.8843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6329 0.3323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5678 1.1143 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 0.5678 1.9393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 8 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 6 0 0 0\n 8 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 9 1 1 0 0 0\nM END", "smiles": "C1[C@@H]([C@H]([C@H](CO)N1)O)O", "formula": "C5H11NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "6b0df40a-df79-4e1a-9f08-c51b7bff29f7" }, "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "133.1459", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "31fcb0c8-2c13-4f47-9e15-c3f4a19d17b8", "version": "7", "structure": { "id": "6f38ae97-76c2-4201-bd28-350264f78af2", "molfile": "\n Marvin 01132105462D \n\n 9 9 0 0 1 0 999 V2000\n 2.6329 0.3323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0198 0.8843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2352 0.6294 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 0.9803 -0.1553 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1553 -0.1553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0997 0.6294 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -0.8843 0.8843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5678 1.1143 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 0.5678 1.9393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 6 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 6 0 0 0\n 6 8 1 0 0 0 0\n 3 8 1 0 0 0 0\n 8 9 1 1 0 0 0\nM END", "smiles": "C1[C@@H]([C@H]([C@H](CO)N1)O)O", "formula": "C5H11NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "133.1459", "optical_activity": "UNSPECIFIED", "references": [ "cae42269-73a5-4d00-9458-7b2490c8bec5" ], "stereo_centers": 3 }, "unii": "Z330X18GMD" } ] }