{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "98211809-7fa0-4da5-903a-c6c15c8f5e9c",
          "code": "57-87-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=57-87-4",
          "code_system": "CAS",
          "references": [
            "90f9ae5b-9ac4-4a16-89d3-45252393cc6c",
            "29ed0a9b-e6fa-4172-93b1-ecd24eb13d52"
          ]
        },
        {
          "uuid": "035bd3ae-4a5c-4e04-838b-adc15854f75b",
          "code": "C83810",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C83810",
          "code_system": "NCI_THESAURUS",
          "references": [
            "90f9ae5b-9ac4-4a16-89d3-45252393cc6c"
          ]
        },
        {
          "uuid": "5ac2b5d9-90f7-4b19-bbd5-904ceb7b9ca1",
          "code": "ERGOSTEROL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ergosterol",
          "code_system": "WIKIPEDIA",
          "references": [
            "90f9ae5b-9ac4-4a16-89d3-45252393cc6c"
          ]
        },
        {
          "uuid": "7cbfefce-66bd-43a3-973c-07af77b10ce7",
          "code": "200-352-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.320",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "90f9ae5b-9ac4-4a16-89d3-45252393cc6c"
          ]
        },
        {
          "uuid": "b88f7acc-6033-48d4-bea0-9b031183ee7f",
          "code": "m4986",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4986?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "90f9ae5b-9ac4-4a16-89d3-45252393cc6c"
          ]
        },
        {
          "uuid": "8d2fed74-d3c5-469c-991c-411d4501bff0",
          "code": "444679",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/444679",
          "code_system": "PUBCHEM",
          "references": [
            "90f9ae5b-9ac4-4a16-89d3-45252393cc6c"
          ]
        },
        {
          "uuid": "4cfc2f11-9433-f9b3-bd37-cf7be122ad10",
          "code": "395",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/395",
          "code_system": "HSDB",
          "references": [
            "308ba5d8-1200-7513-349c-009b0964266e"
          ]
        },
        {
          "uuid": "78d1e755-681f-5366-9348-87c829547915",
          "code": "C843",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Lipid[C616]|Steroid Compound",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C843",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6cbbcd50-a235-8991-b3b3-66b2a190f516"
          ]
        },
        {
          "uuid": "6ae8967a-ae52-63c1-6a2e-de01f662fb39",
          "code": "15411-2",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Ergosterol [Mass/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/15411-2/",
          "code_system": "LOINC",
          "references": [
            "6cbbcd50-a235-8991-b3b3-66b2a190f516"
          ]
        },
        {
          "uuid": "ae3121ea-976d-3082-d5df-90a240963efc",
          "code": "DB04038",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB04038",
          "code_system": "DRUG BANK",
          "references": [
            "6cbbcd50-a235-8991-b3b3-66b2a190f516"
          ]
        },
        {
          "uuid": "83d7c937-b802-4a91-a9fd-ea7cd4851f6b",
          "code": "Z30RAY509F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "112fcf3c-c9f0-19d5-35cf-902caa1c0a12",
          "code": "1241007",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1241007",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "6cbbcd50-a235-8991-b3b3-66b2a190f516"
          ]
        },
        {
          "uuid": "42573250-f3a3-dc31-18c9-c60ff03ec7e4",
          "code": "16933",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16933",
          "code_system": "CHEBI",
          "references": [
            "6cbbcd50-a235-8991-b3b3-66b2a190f516"
          ]
        },
        {
          "uuid": "c23830e5-2437-4335-2b23-8740d1332c58",
          "code": "DTXSID90878679",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90878679",
          "code_system": "EPA CompTox",
          "references": [
            "6cbbcd50-a235-8991-b3b3-66b2a190f516"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8f6b2424-9b99-4c54-ba66-ec14d977f32a",
          "amount": {
            "uuid": "4e8ea5a8-d950-47a4-9b32-60fbcb4c7dba",
            "units": "%",
            "high_limit": 0.1,
            "non_numeric_value": "peak value"
          },
          "type": "PARENT->IMPURITY",
          "references": [
            "cc338879-90c4-e2bf-c8df-909f418ce17b"
          ],
          "related_substance": {
            "uuid": "84a7af08-a58c-4fc6-bcec-1b1f09f7f488",
            "refuuid": "e97e860e-d9b8-4522-b9d9-7c7715a3a03b",
            "name": "Ergocalciferol",
            "unii": "VS041H42XC",
            "linking_id": "VS041H42XC",
            "ref_pname": "Ergocalciferol",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "db6b565f-1aac-4cba-940e-c98f9f6ee3df",
          "type": "INHIBITOR->TARGET",
          "references": [
            "7d362e08-316d-4c8b-a74e-e391879f3edd"
          ],
          "related_substance": {
            "uuid": "860e66c8-90c1-4a0d-8d96-5f4f14d1aa84",
            "refuuid": "4c0d15f6-2639-4201-9b5f-175a72c2dc4d",
            "name": "NETICONAZOLE",
            "unii": "KVL61ZF9UO",
            "linking_id": "KVL61ZF9UO",
            "ref_pname": "NETICONAZOLE"
          }
        },
        {
          "uuid": "db414c5a-a729-4a29-9198-6f1dbf3031c9",
          "type": "INHIBITOR->TARGET",
          "references": [
            "20a9e90a-2cc5-4e69-a47d-0ea1f279335f"
          ],
          "related_substance": {
            "uuid": "bc6a0f3e-4c97-4cd8-96c4-2fb2986f7a41",
            "refuuid": "65469b76-d070-4040-8cd9-7b57716f93df",
            "name": "EBERCONAZOLE",
            "unii": "V7O1U41C9B",
            "linking_id": "V7O1U41C9B",
            "ref_pname": "EBERCONAZOLE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ad6be296-4b1a-ac67-7ce1-e500515c3a33",
          "name": "(22E)-ERGOSTA-5,7,22-TRIEN-3.BETA.-OL",
          "stdName": "(22E)-ERGOSTA-5,7,22-TRIEN-3.BETA.-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc338879-90c4-e2bf-c8df-909f418ce17b"
          ],
          "display_name": false
        },
        {
          "uuid": "f7b17817-7ad7-42d3-9e43-ec498cd3b0fc",
          "name": "(3.BETA.,22E)-ERGOSTA-5,7,22-TRIEN-3-OL",
          "stdName": "(3.BETA.,22E)-ERGOSTA-5,7,22-TRIEN-3-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "743766a8-1e60-43f8-b0ba-c7287b16b760",
            "414be001-153c-4347-89b9-b0754146e81f"
          ],
          "display_name": false
        },
        {
          "uuid": "e31faff8-651a-545f-7952-924dac53aa45",
          "name": "ERGOCALCIFEROL IMPURITY B [EP IMPURITY]",
          "stdName": "ERGOCALCIFEROL IMPURITY B [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc338879-90c4-e2bf-c8df-909f418ce17b"
          ],
          "display_name": false
        },
        {
          "uuid": "12daf98b-e1d8-4cb2-9c0a-41e9531cbe5d",
          "name": "ERGOSTERIN",
          "stdName": "ERGOSTERIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "743766a8-1e60-43f8-b0ba-c7287b16b760",
            "414be001-153c-4347-89b9-b0754146e81f"
          ],
          "display_name": false
        },
        {
          "uuid": "96f40d89-acab-4513-a560-13e5134fa29b",
          "name": "ERGOSTEROL",
          "stdName": "ERGOSTEROL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f122da71-0473-473d-8145-5eaa5ef270ff",
            "48fd4d01-fc90-46e0-a99b-9cb7e25f4a72",
            "215045d6-1910-4ad8-be69-d0db56f1722f",
            "c025a64d-5efb-424c-8185-760fa97d0272",
            "75fb43f9-45a8-4272-ab1a-6a15db40c286",
            "5ffe06fa-b248-44e7-9a0c-1e31ebd1a12a",
            "49788f88-2384-4d60-9809-8d571bfa2938",
            "30ec5915-1be2-4b14-88e0-9f9a02559c13",
            "414be001-153c-4347-89b9-b0754146e81f",
            "c8c06983-aded-4e39-9a7c-342eb9153734"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3e502e66-fa2d-4907-a99a-fbf305ba9972",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "1121a2ea-2326-4d6f-84ad-7cd27d7045b1",
          "name": "ERGOSTEROL (CONSTITUENT OF GANODERMA LUCIDUM FRUITING BODY) [DSC]",
          "stdName": "ERGOSTEROL (CONSTITUENT OF GANODERMA LUCIDUM FRUITING BODY) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9ee136f6-fecf-438d-a1db-2c83add9ee2f",
            "414be001-153c-4347-89b9-b0754146e81f"
          ],
          "display_name": false
        },
        {
          "uuid": "a48d912a-585d-4a80-845b-6bd4132a6f2e",
          "name": "ERGOSTEROL [HSDB]",
          "stdName": "ERGOSTEROL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30ec5915-1be2-4b14-88e0-9f9a02559c13",
            "414be001-153c-4347-89b9-b0754146e81f"
          ],
          "display_name": false
        },
        {
          "uuid": "a207a789-3759-4dd0-804d-ddce3f9cf355",
          "name": "ERGOSTEROL [MI]",
          "stdName": "ERGOSTEROL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ffe06fa-b248-44e7-9a0c-1e31ebd1a12a",
            "414be001-153c-4347-89b9-b0754146e81f"
          ],
          "display_name": false
        },
        {
          "uuid": "ce572854-5f76-403d-a3e5-1e612bacdc71",
          "name": "ERGOSTEROL [USP-RS]",
          "stdName": "ERGOSTEROL [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f122da71-0473-473d-8145-5eaa5ef270ff",
            "414be001-153c-4347-89b9-b0754146e81f"
          ],
          "display_name": false
        },
        {
          "uuid": "a5bba6b9-3259-4aa9-bf60-78e610e2c09f",
          "name": "PROVITAMIN D2",
          "stdName": "PROVITAMIN D2",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49788f88-2384-4d60-9809-8d571bfa2938",
            "414be001-153c-4347-89b9-b0754146e81f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "743766a8-1e60-43f8-b0ba-c7287b16b760",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "414be001-153c-4347-89b9-b0754146e81f",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49788f88-2384-4d60-9809-8d571bfa2938",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ffe06fa-b248-44e7-9a0c-1e31ebd1a12a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "75fb43f9-45a8-4272-ab1a-6a15db40c286",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30ec5915-1be2-4b14-88e0-9f9a02559c13",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f122da71-0473-473d-8145-5eaa5ef270ff",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ee136f6-fecf-438d-a1db-2c83add9ee2f",
          "citation": "USP-DSC, VOL.2, 2015",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90f9ae5b-9ac4-4a16-89d3-45252393cc6c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389714000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc6a1064-8174-4ba8-b5ba-c737e3783850",
          "citation": "SRS import [Z30RAY509F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Z30RAY509F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389714000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48fd4d01-fc90-46e0-a99b-9cb7e25f4a72",
          "citation": "ERGOSTEROL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c025a64d-5efb-424c-8185-760fa97d0272",
          "citation": "ERGOSTEROL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c8c06983-aded-4e39-9a7c-342eb9153734",
          "citation": "ERGOSTEROL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "215045d6-1910-4ad8-be69-d0db56f1722f",
          "citation": "ERGOSTEROL [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7d362e08-316d-4c8b-a74e-e391879f3edd",
          "citation": "Tsuboi, Ryoji, et al. \"Hyperkeratotic chronic tinea pedis treated with neticonazole cream.\" International journal of dermatology 35.5 (1996): 371-373.",
          "url": "https://onlinelibrary.wiley.com/doi/pdf/10.1111/j.1365-4362.1996.tb03644.x#accessDenialLayout",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "308ba5d8-1200-7513-349c-009b0964266e",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+57-87-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cc338879-90c4-e2bf-c8df-909f418ce17b",
          "citation": "EP",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6cbbcd50-a235-8991-b3b3-66b2a190f516",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "29ed0a9b-e6fa-4172-93b1-ecd24eb13d52",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "20a9e90a-2cc5-4e69-a47d-0ea1f279335f",
          "citation": "Moodahadu-Bangera, Latha Subramanya, et al. \"Eberconazole-Pharmacological and clinical review.\" Indian Journal of Dermatology, Venereology, and Leprology 78.2 (2012): 217.",
          "url": "http://www.ijdvl.com/article.asp?issn=0378-6323;year=2012;volume=78;issue=2;spage=217;epage=222;aulast=Moodahadu",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "b4416079-9bf6-4a41-9f76-47304f2759df",
          "citation": "USP-DSC, VOL.2, 2015",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8efe6a77-d329-4f53-9222-ed070b7ffe2e",
          "id": "8efe6a77-d329-4f53-9222-ed070b7ffe2e",
          "molfile": "\n  Marvin  01132107252D          \n\n 29 32  0  0  1  0            999 V2000\n    7.1137   -0.5432    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.1163    0.3055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3302   -0.9193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6095   -0.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7320   -0.7599    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.1784   -0.1437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4813   -1.5303    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.9670   -2.1963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4813   -2.8544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6979   -2.6167    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.9954   -3.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9954   -3.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2746   -4.2619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5669   -3.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8566   -4.2619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1358   -3.8493    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   -0.5719   -4.2619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1358   -3.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8566   -2.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5669   -3.0241    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    1.5669   -2.1963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2746   -2.6167    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.2746   -1.7889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9954   -1.3789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6979   -1.7889    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.6927   -0.9741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8214   -0.9480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8188   -1.7575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5187   -0.5406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 27  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7 25  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  1  0  0  0\n 25 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 22 11  1  1  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 20 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  1  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  1  0  0  0\n 20 22  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  1  1  0  0  0\n 28 27  1  0  0  0  0\n 29 27  1  0  0  0  0\nM  END",
          "smiles": "CC(C)[C@@H](C)/C=C/[C@@H](C)[C@H]1CC[C@H]2C3=CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)O",
          "formula": "C28H44O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e7036b39-b6bc-4c28-9c59-77c20924776b"
          },
          "defined_stereo": 8,
          "ez_centers": 1,
          "molecular_weight": "396.6494",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 8
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d2e1221c-46a2-464e-b582-f9e6b925a540",
      "version": "22",
      "structure": {
        "id": "04dc6ac8-68bb-4b0d-b993-1e9d4769f9e0",
        "molfile": "\n  Marvin  01132100332D          \n\n 32 35  0  0  1  0            999 V2000\n    2.9954   -3.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6979   -1.7889    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.5669   -3.0241    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.6979   -2.6167    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.2746   -2.6167    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.5669   -3.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9954   -3.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4813   -1.5303    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.2746   -4.2619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9954   -1.3789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2746   -1.7889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4813   -2.8544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6095   -0.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3302   -0.9193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8566   -2.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9670   -2.1963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8566   -4.2619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7320   -0.7599    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.1137   -0.5432    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.6927   -0.9741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1358   -3.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1358   -3.8493    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.5669   -2.1963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8214   -0.9480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5719   -4.2619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1784   -0.1437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1163    0.3055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8188   -1.7575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5187   -0.5406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2746   -3.4341    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6927   -3.4419    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2752   -1.3162    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  9  2  0  0  0  0\n  7  1  2  0  0  0  0\n  8  2  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11  5  1  0  0  0  0\n 12  4  1  0  0  0  0\n 13 18  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15  3  1  0  0  0  0\n 16 12  1  0  0  0  0\n 17  6  1  0  0  0  0\n 18  8  1  0  0  0  0\n 19 14  1  0  0  0  0\n  2 20  1  1  0  0  0\n 21 15  1  0  0  0  0\n 22 17  1  0  0  0  0\n  3 23  1  1  0  0  0\n 24 19  1  0  0  0  0\n 22 25  1  1  0  0  0\n 18 26  1  6  0  0  0\n 19 27  1  6  0  0  0\n 28 24  1  0  0  0  0\n 29 24  1  0  0  0  0\n  5 30  1  6  0  0  0\n  4 31  1  6  0  0  0\n  8 32  1  6  0  0  0\n  3  6  1  0  0  0  0\n 10  2  1  0  0  0  0\n 16  8  1  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
        "smiles": "CC(C)[C@@H](C)/C=C/[C@@H](C)[C@@]1([H])CC[C@@]2([H])C3=CC=C4C[C@H](CC[C@]4(C)[C@@]3([H])CC[C@]12C)O",
        "formula": "C28H44O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 8,
        "ez_centers": 1,
        "molecular_weight": "396.6494",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "dc6a1064-8174-4ba8-b5ba-c737e3783850",
          "743766a8-1e60-43f8-b0ba-c7287b16b760"
        ],
        "stereo_centers": 8
      },
      "unii": "Z30RAY509F"
    }
  ]
}