{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "35b40887-5419-41d7-b606-7ad50d7826e0",
          "code": "113715-27-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=113715-27-8",
          "code_system": "CAS",
          "references": [
            "64c9f2b9-910a-459d-9e77-57c98a2f9dc4",
            "860097ee-5a54-43a3-8486-fd84acb8302f"
          ]
        },
        {
          "uuid": "a436eef4-5318-421f-b738-f950d330756d",
          "code": "1737335",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1737335/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "64c9f2b9-910a-459d-9e77-57c98a2f9dc4"
          ]
        },
        {
          "uuid": "d093b1a5-2dcf-41f3-aa79-7f847d3f5e21",
          "code": "20027874",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/20027874",
          "code_system": "PUBCHEM",
          "references": [
            "64c9f2b9-910a-459d-9e77-57c98a2f9dc4"
          ]
        },
        {
          "uuid": "3b05c5b8-69f9-4a34-9986-6f6934b4eeb7",
          "code": "1737336",
          "type": "ALTERNATIVE",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1737336/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "3d9b8cbc-45c9-0d52-14e4-b4017aae7d64"
          ]
        },
        {
          "uuid": "d8ed08cd-9032-2295-1f32-d1f277dc2a7a",
          "code": "DTXSID90150543",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90150543",
          "code_system": "EPA CompTox",
          "references": [
            "a1393776-74ea-bd7f-e430-20fe762fb652"
          ]
        },
        {
          "uuid": "40d432fd-cd75-4c60-9b38-1aa9ca4269bc",
          "code": "Z28JS1XMY2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d25dd8b6-a2be-4eb9-e000-f3fb10ae64f0",
          "code": "Z28JS1XMY2",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Z28JS1XMY2",
          "code_system": "DAILYMED",
          "references": [
            "235c7f35-9ee7-5589-a2af-c9bdb34cbf8c"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "df70c8eb-f118-12a2-746b-e614f97ce059",
          "name": "2,4-DIAMINO-5-METHYLPHENOXYETHANOL",
          "stdName": "2,4-DIAMINO-5-METHYLPHENOXYETHANOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d9b8cbc-45c9-0d52-14e4-b4017aae7d64"
          ],
          "display_name": false
        },
        {
          "uuid": "bed03b9e-2f92-46e9-9c5b-d6c760d5925c",
          "name": "2,4-DIAMINO-5-METHYLPHENOXYETHANOL HCL",
          "stdName": "2,4-DIAMINO-5-METHYLPHENOXYETHANOL HCL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "78d46abf-8d75-44e6-b790-27ffa5655878",
            "0ce9e021-aa39-40da-a013-1c83cc62a237",
            "3c5e5e68-025e-486f-9ef0-8054bf6df87d"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "19faf04d-5032-4dcf-9ff3-d691012e44af",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f35be8f4-aa2b-4e67-9a46-5b67e8819803",
          "name": "2,4-DIAMINO-5-METHYLPHENOXYETHANOL HYDROCHLORIDE",
          "stdName": "2,4-DIAMINO-5-METHYLPHENOXYETHANOL HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c5e5e68-025e-486f-9ef0-8054bf6df87d",
            "c970cc9a-b375-478e-abf2-28c741ebddf4"
          ],
          "display_name": true
        },
        {
          "uuid": "e29fbbe0-cbc3-4923-af20-7facd7402d65",
          "name": "ETHANOL, 2-(2,4-DIAMINO-5-METHYLPHENOXY)-, DIHYDROCHLORIDE",
          "stdName": "ETHANOL, 2-(2,4-DIAMINO-5-METHYLPHENOXY)-, DIHYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "370ea30c-b9b5-4adc-84d4-492e8f651000",
            "3c5e5e68-025e-486f-9ef0-8054bf6df87d"
          ],
          "display_name": false
        },
        {
          "uuid": "1445a265-e24f-4410-851f-5441a7572783",
          "name": "ETHANOL, 2-(2,4-DIAMINO-5-METHYLPHENOXY)-, HYDROCHLORIDE (1:2)",
          "stdName": "ETHANOL, 2-(2,4-DIAMINO-5-METHYLPHENOXY)-, HYDROCHLORIDE (1:2)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "370ea30c-b9b5-4adc-84d4-492e8f651000",
            "3c5e5e68-025e-486f-9ef0-8054bf6df87d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "78d46abf-8d75-44e6-b790-27ffa5655878",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3c5e5e68-025e-486f-9ef0-8054bf6df87d",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c970cc9a-b375-478e-abf2-28c741ebddf4",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "370ea30c-b9b5-4adc-84d4-492e8f651000",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64c9f2b9-910a-459d-9e77-57c98a2f9dc4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391402000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22d67c63-1334-42ae-8092-1d4e86ebfd5b",
          "citation": "SRS import [Z28JS1XMY2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Z28JS1XMY2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391402000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ce9e021-aa39-40da-a013-1c83cc62a237",
          "citation": "2,4-DIAMINO-5-METHYLPHENOXYETHANOL HCL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3d9b8cbc-45c9-0d52-14e4-b4017aae7d64",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a1393776-74ea-bd7f-e430-20fe762fb652",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=113715-27-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "235c7f35-9ee7-5589-a2af-c9bdb34cbf8c",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "860097ee-5a54-43a3-8486-fd84acb8302f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6d765da3-4093-4094-861d-56014c3f803f",
          "id": "6d765da3-4093-4094-861d-56014c3f803f",
          "molfile": "\n  Marvin  01132105412D          \n\n  1  0  0  0  0  0            999 V2000\n   16.2345   -7.5472    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "636ed94b-6a74-4a59-96e2-81708b27d2d8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "da2eae95-e349-4b98-bf0f-70bade589e76",
          "id": "da2eae95-e349-4b98-bf0f-70bade589e76",
          "molfile": "\n  Marvin  01132111192D          \n\n 13 13  0  0  0  0            999 V2000\n   10.2025   -6.2725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6150   -6.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4400   -6.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8525   -7.7014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6775   -7.7014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0900   -6.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9151   -6.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3276   -6.2725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4400   -8.4159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8525   -9.1304    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6150   -8.4159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2025   -7.7014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3775   -7.7014    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 12  2  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(c(cc1N)N)OCCO",
          "formula": "C9H14N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a638e8d0-91e2-47fd-a6b7-9e1f10d8c443"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "182.22",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "16a81476-6198-43d5-8076-32f29a3c3bd3",
      "version": "7",
      "structure": {
        "id": "ecad5624-5542-4dba-bb59-00cdd7245ba3",
        "molfile": "\n  Marvin  01132112142D          \n\n 15 13  0  0  0  0            999 V2000\n   16.2345   -7.5472    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   10.2025   -7.7014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6150   -6.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4400   -6.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8525   -7.7014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4400   -8.4159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6150   -8.4159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8525   -9.1304    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6775   -7.7014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2025   -6.2725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3775   -7.7014    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0900   -6.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9151   -6.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3276   -6.2725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2345   -7.5472    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  2  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  5  9  1  0  0  0  0\n  3 10  1  0  0  0  0\n  2 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2   1  15\nM  SPA   1  1   1\nM  SDI   1  4   15.8145   -7.9672   15.8145   -7.1272\nM  SDI   1  4   16.6545   -7.1272   16.6545   -7.9672\nM  SMT   1 2\nM  END",
        "smiles": "Cc1cc(c(cc1N)N)OCCO.Cl.Cl",
        "formula": "C9H14N2O2.2ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "255.1418",
        "optical_activity": "NONE",
        "references": [
          "78d46abf-8d75-44e6-b790-27ffa5655878",
          "22d67c63-1334-42ae-8092-1d4e86ebfd5b"
        ],
        "stereo_centers": 0
      },
      "unii": "Z28JS1XMY2"
    }
  ]
}