{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8ae78707-9362-4c76-937d-80e2af94054b",
          "code": "58846-77-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=58846-77-8",
          "code_system": "CAS",
          "references": [
            "b60e2129-6e8c-4615-8d47-d9bce302098c",
            "cb928be6-6ece-497b-b953-a53dc9ea51d9"
          ]
        },
        {
          "uuid": "6fdf2fbb-8d98-4d5e-ae54-c83170c76b68",
          "code": "C504907",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67504907",
          "code_system": "MESH",
          "references": [
            "b60e2129-6e8c-4615-8d47-d9bce302098c"
          ]
        },
        {
          "uuid": "8bb9d47f-a97b-4c99-9d67-575dd9a7cf66",
          "code": "DECYL GLUCOSIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Decyl_glucoside",
          "code_system": "WIKIPEDIA",
          "references": [
            "b60e2129-6e8c-4615-8d47-d9bce302098c"
          ]
        },
        {
          "uuid": "f4cd93cf-6a23-4a7f-a2f8-6ad53a44995a",
          "code": "1311572",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1311572/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "b60e2129-6e8c-4615-8d47-d9bce302098c"
          ]
        },
        {
          "uuid": "4d84d3c5-0cd9-4020-895b-29b29f498355",
          "code": "SUB92409",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "b60e2129-6e8c-4615-8d47-d9bce302098c"
          ]
        },
        {
          "uuid": "a3b1e696-d0b0-43a3-9d6e-20d3f19243a5",
          "code": "261-469-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.055.863",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b60e2129-6e8c-4615-8d47-d9bce302098c"
          ]
        },
        {
          "uuid": "9586ca70-9111-48f9-95a5-8bdf66ed5dfe",
          "code": "62142",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/62142",
          "code_system": "PUBCHEM",
          "references": [
            "b60e2129-6e8c-4615-8d47-d9bce302098c"
          ]
        },
        {
          "uuid": "1915e770-6586-84c4-57f1-760c1a1082f8",
          "code": "DTXSID2041208",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2041208",
          "code_system": "EPA CompTox",
          "references": [
            "7c890eaf-4741-12ff-0b37-b924a925538e"
          ]
        },
        {
          "uuid": "6f3cd3fa-89b4-43d7-9b5d-68d39a773441",
          "code": "Z17H97EA6Y",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1337eaa5-1924-92a5-e7fe-20fb7d6e779d",
          "code": "Z17H97EA6Y",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Z17H97EA6Y",
          "code_system": "DAILYMED",
          "references": [
            "470eb1c2-b05c-a7d7-9f27-73f7639b124f"
          ]
        },
        {
          "uuid": "e13276e2-0fca-7d2b-de79-bfa28a760a40",
          "code": "100000141542",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "46f7008b-e5cf-8096-af00-3e676bd437c5"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "7cc6d9c1-e387-4080-b8bf-b906dd26ac2d",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6b2424b2-25ed-48e8-9f38-9ccc8a7390c9",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b87d593c-fb60-4e43-a92a-68fe99931e77",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd38bc32-6ae5-4c44-8251-dda55316e09e",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05684759-31ce-455e-a5e2-4601634e1742",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b60e2129-6e8c-4615-8d47-d9bce302098c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390985000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "acf14965-2a5f-4957-981d-b79ca745782c",
          "citation": "SRS import [Z17H97EA6Y]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Z17H97EA6Y",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390985000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30eb24cf-acb6-496f-a7e1-eda860c346fa",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea700c9a-ec7e-420b-9001-5e514911da12",
          "citation": "DECYL GLUCOSIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7c890eaf-4741-12ff-0b37-b924a925538e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=58846-77-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "470eb1c2-b05c-a7d7-9f27-73f7639b124f",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "cb928be6-6ece-497b-b953-a53dc9ea51d9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "46f7008b-e5cf-8096-af00-3e676bd437c5",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "943af5ae-31fa-4101-9359-0c4eca26d35a",
          "id": "943af5ae-31fa-4101-9359-0c4eca26d35a",
          "molfile": "\n  Marvin  12082112362D          \n\n 22 22  0  0  1  0            999 V2000\n   16.1712   -7.2621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4494   -6.8546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7389   -7.2739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0217   -6.8663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3068   -7.2857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5942   -6.8781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8791   -7.2975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1618   -6.8899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4515   -7.3093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7343   -6.9017    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.7275   -6.0793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0056   -5.6670    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.9988   -4.8445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7139   -4.4250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2953   -6.0911    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.5781   -5.6788    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3020   -6.9135    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.5918   -7.3328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0192   -7.3211    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.0260   -8.1434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9553   -6.8002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7469   -7.2491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1 21  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  1  0  0  0\n 11 10  1  0  0  0  0\n 10 19  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  1  0  0  0\n 15 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 16  1  6  0  0  0\n 17 15  1  0  0  0  0\n 17 18  1  1  0  0  0\n 19 17  1  0  0  0  0\n 19 20  1  6  0  0  0\n 21 22  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCCCCO[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O",
          "formula": "C16H32O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "99936cf2-80ed-4ee5-9470-fc621a4adcee"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "320.4223",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5f863c29-024b-42be-abbc-abd54f6c3ec9",
      "version": "8",
      "structure": {
        "id": "f8f5dd9c-b85f-482b-a2d8-19a933c8b86d",
        "molfile": "\n   JSDraw212082112362D\n\n 22 22  0  0  1  0              0 V2000\n   31.7845   -9.5401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.4233   -8.7716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.0835   -9.5623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.7311   -8.7937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.3830   -9.5846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.0392   -8.8159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.6907   -9.6068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.3381   -8.8382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.9986   -9.6291    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.6462   -8.8604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.6334   -7.3096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.2721   -6.5321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.2592   -4.9811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.6077   -4.1900    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9326   -7.3319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5802   -6.5544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9453   -8.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6060   -9.6734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.2977   -9.6513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3105  -11.2020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   33.2631   -8.6690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   34.7558   -9.5155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  1  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14 13  1  0  0  0  0\n 15 12  1  0  0  0  0\n 15 16  1  6  0  0  0\n 17 15  1  0  0  0  0\n 17 18  1  1  0  0  0\n 19 17  1  0  0  0  0\n 19 20  1  6  0  0  0\n 10 19  1  0  0  0  0\n  1 21  1  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCCCCO[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O",
        "formula": "C16H32O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "320.4223",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "30eb24cf-acb6-496f-a7e1-eda860c346fa",
          "acf14965-2a5f-4957-981d-b79ca745782c"
        ],
        "stereo_centers": 5
      },
      "unii": "Z17H97EA6Y",
      "relationships": [
        {
          "uuid": "ba5d3036-43d9-48b5-bd1e-ef88e79fcce5",
          "amount": {
            "uuid": "5f2df212-bcad-4b91-a8f1-897a933fdf7a"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "168974fb-7b52-412e-bf31-ae83dc071ddf",
            "refuuid": "5f863c29-024b-42be-abbc-abd54f6c3ec9",
            "name": "DECYL GLUCOSIDE",
            "unii": "Z17H97EA6Y",
            "linking_id": "Z17H97EA6Y",
            "ref_pname": "DECYL GLUCOSIDE",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "2fc87def-90a0-44eb-a085-c3556b41e3d2",
          "name": ".BETA.-D-GLUCOPYRANOSIDE, DECYL-",
          "stdName": ".BETA.-D-GLUCOPYRANOSIDE, DECYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b2424b2-25ed-48e8-9f38-9ccc8a7390c9",
            "b87d593c-fb60-4e43-a92a-68fe99931e77"
          ],
          "display_name": false
        },
        {
          "uuid": "d20d0205-4a50-48a4-a982-a9a09d0a3f73",
          "name": "1-O-DECYL-.BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "1-O-DECYL-.BETA.-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b2424b2-25ed-48e8-9f38-9ccc8a7390c9",
            "b87d593c-fb60-4e43-a92a-68fe99931e77"
          ],
          "display_name": false
        },
        {
          "uuid": "ee212537-bb9b-41b1-85c6-bc32898ed53d",
          "name": "AG 10 (GLUCOSIDE)",
          "stdName": "AG 10 (GLUCOSIDE)",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b2424b2-25ed-48e8-9f38-9ccc8a7390c9",
            "b87d593c-fb60-4e43-a92a-68fe99931e77"
          ],
          "display_name": false
        },
        {
          "uuid": "8f70797b-851b-495f-a337-b5b81cf34b68",
          "name": "AG-10LK",
          "stdName": "AG-10LK",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b2424b2-25ed-48e8-9f38-9ccc8a7390c9",
            "7cc6d9c1-e387-4080-b8bf-b906dd26ac2d"
          ],
          "display_name": false
        },
        {
          "uuid": "4e5b1adf-f5c5-4380-8938-c8ec8974d688",
          "name": "AVANEL DG 70",
          "stdName": "AVANEL DG 70",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b2424b2-25ed-48e8-9f38-9ccc8a7390c9",
            "7cc6d9c1-e387-4080-b8bf-b906dd26ac2d"
          ],
          "display_name": false
        },
        {
          "uuid": "e9fa8903-626f-41cb-abfa-1d2da1f2d592",
          "name": "CAPRYL GLUCOSIDE",
          "stdName": "CAPRYL GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd38bc32-6ae5-4c44-8251-dda55316e09e",
            "6b2424b2-25ed-48e8-9f38-9ccc8a7390c9"
          ],
          "display_name": false
        },
        {
          "uuid": "2283ee15-5abb-4c4d-b2f0-c24f382a27f8",
          "name": "DECYL .BETA.-D-GLUCOSIDE",
          "stdName": "DECYL .BETA.-D-GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b2424b2-25ed-48e8-9f38-9ccc8a7390c9",
            "b87d593c-fb60-4e43-a92a-68fe99931e77"
          ],
          "display_name": false
        },
        {
          "uuid": "a3c1b80d-4641-4001-b78b-2acbb09ed453",
          "name": "DECYL BETA-D-GLUCOPYRANOSIDE",
          "stdName": "DECYL BETA-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b2424b2-25ed-48e8-9f38-9ccc8a7390c9",
            "05684759-31ce-455e-a5e2-4601634e1742"
          ],
          "display_name": false
        },
        {
          "uuid": "660a2dc1-045e-4e08-b65c-ffe7e4a31ab5",
          "name": "DECYL GLUCOSIDE",
          "stdName": "DECYL GLUCOSIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b2424b2-25ed-48e8-9f38-9ccc8a7390c9",
            "7cc6d9c1-e387-4080-b8bf-b906dd26ac2d",
            "ea700c9a-ec7e-420b-9001-5e514911da12"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "34a4772f-10dc-4d78-85c4-983c573cc2d7",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "1c8ae276-a683-41b8-8d4c-a2ff3c78b19b",
          "name": "N-DECYL-.BETA.-GLUCOSIDE",
          "stdName": "N-DECYL-.BETA.-GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b2424b2-25ed-48e8-9f38-9ccc8a7390c9",
            "b87d593c-fb60-4e43-a92a-68fe99931e77"
          ],
          "display_name": false
        },
        {
          "uuid": "65421b54-c8fd-42d3-900d-a75968dd9d66",
          "name": "ORAMIX NS 10",
          "stdName": "ORAMIX NS 10",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b2424b2-25ed-48e8-9f38-9ccc8a7390c9",
            "b87d593c-fb60-4e43-a92a-68fe99931e77"
          ],
          "display_name": false
        },
        {
          "uuid": "6527b6ef-034c-4b9f-9d7e-0efc7276c853",
          "name": "PLANTACARE 2000 UP",
          "stdName": "PLANTACARE 2000 UP",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b2424b2-25ed-48e8-9f38-9ccc8a7390c9",
            "7cc6d9c1-e387-4080-b8bf-b906dd26ac2d"
          ],
          "display_name": false
        },
        {
          "uuid": "208220ac-efa5-49f4-8e74-231b5d0e1b7b",
          "name": "PLANTACARE 818",
          "stdName": "PLANTACARE 818",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b2424b2-25ed-48e8-9f38-9ccc8a7390c9",
            "b87d593c-fb60-4e43-a92a-68fe99931e77"
          ],
          "display_name": false
        },
        {
          "uuid": "98f35ada-9c50-4b60-834f-6f1ba532c3ef",
          "name": "PLANTAREN 2000 N UP",
          "stdName": "PLANTAREN 2000 N UP",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b2424b2-25ed-48e8-9f38-9ccc8a7390c9",
            "7cc6d9c1-e387-4080-b8bf-b906dd26ac2d"
          ],
          "display_name": false
        },
        {
          "uuid": "92c9852b-e92c-4d51-8289-d2f3c34cb6e5",
          "name": "PLANTAREN PS 100",
          "stdName": "PLANTAREN PS 100",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b2424b2-25ed-48e8-9f38-9ccc8a7390c9",
            "b87d593c-fb60-4e43-a92a-68fe99931e77"
          ],
          "display_name": false
        },
        {
          "uuid": "e4342d90-3f06-4ff2-abb9-24001f88d957",
          "name": "PLANTAREN W 2000",
          "stdName": "PLANTAREN W 2000",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b2424b2-25ed-48e8-9f38-9ccc8a7390c9",
            "b87d593c-fb60-4e43-a92a-68fe99931e77"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "b89d03b2-20c1-4a48-b8b0-c907c8a1718c"
      }
    }
  ]
}