{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9556f41c-25ee-4b23-943b-6e4a7a8c6c62",
          "code": "21245-02-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=21245-02-3",
          "code_system": "CAS",
          "references": [
            "9f76605d-ff32-4b08-955d-516552df70db",
            "07a1bd30-8bc1-440b-a5d9-afc22fc35ee8"
          ]
        },
        {
          "uuid": "fb0d3087-8df6-4522-8d5a-7f5883e202e3",
          "code": "C041981",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67041981",
          "code_system": "MESH",
          "references": [
            "9f76605d-ff32-4b08-955d-516552df70db"
          ]
        },
        {
          "uuid": "6392f87d-e06f-45de-a44b-b34c408eb571",
          "code": "PADIMATE O",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Padimate_O",
          "code_system": "WIKIPEDIA",
          "references": [
            "9f76605d-ff32-4b08-955d-516552df70db"
          ]
        },
        {
          "uuid": "34907677-f148-44e0-b452-f829d2fb8d43",
          "code": "244-289-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.040.248",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9f76605d-ff32-4b08-955d-516552df70db"
          ]
        },
        {
          "uuid": "e19063a4-9964-4c06-b760-2cfeca54493f",
          "code": "C84038",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C84038",
          "code_system": "NCI_THESAURUS",
          "references": [
            "9f76605d-ff32-4b08-955d-516552df70db"
          ]
        },
        {
          "uuid": "fd832363-29cf-4cd8-a3d6-57d42526d2e9",
          "code": "32786",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/32786/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "9f76605d-ff32-4b08-955d-516552df70db"
          ]
        },
        {
          "uuid": "1e88fe3a-8130-49f0-9905-715fc07fad94",
          "code": "m4524",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4524?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "9f76605d-ff32-4b08-955d-516552df70db"
          ]
        },
        {
          "uuid": "4ac69ad4-897c-4ffc-aa05-50c7276305a6",
          "code": "SUB169711",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "9f76605d-ff32-4b08-955d-516552df70db"
          ]
        },
        {
          "uuid": "e4e5b0db-f099-4fb7-b581-a155c8cccc08",
          "code": "SUB14742MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "9f76605d-ff32-4b08-955d-516552df70db"
          ]
        },
        {
          "uuid": "3615ac10-b18a-45d5-9921-1ca25106a1f6",
          "code": "CHEMBL1323699",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1323699",
          "code_system": "ChEMBL",
          "references": [
            "9f76605d-ff32-4b08-955d-516552df70db"
          ]
        },
        {
          "uuid": "e0502b74-3a93-4a4d-930a-842ab0dc504c",
          "code": "30541",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/30541",
          "code_system": "PUBCHEM",
          "references": [
            "9f76605d-ff32-4b08-955d-516552df70db"
          ]
        },
        {
          "uuid": "1f0d1d3b-f5cc-d289-1002-33533db70333",
          "code": "7169",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7169",
          "code_system": "HSDB",
          "references": [
            "48400c7d-d7ac-7009-8bf4-6efe35197846"
          ]
        },
        {
          "uuid": "dd566d1c-d0f2-2853-182d-5d482dc450c2",
          "code": "DTXSID7029320",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7029320",
          "code_system": "EPA CompTox",
          "references": [
            "d0b8738d-3694-0ac9-8039-2c21242d9310"
          ]
        },
        {
          "uuid": "04b70977-d840-4385-6c30-5899a21624ba",
          "code": "C851",
          "comments": "Pharmacologic Substance[C1909]|Chemopreventive Agent[C1892]|Sunscreen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C851",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7804a9ad-9a2d-1f10-5deb-5ad1b8ee8d54"
          ]
        },
        {
          "uuid": "4d61fb4f-e458-1d79-c01d-2875f3b295e5",
          "code": "4270",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4270",
          "code_system": "DRUG CENTRAL",
          "references": [
            "7804a9ad-9a2d-1f10-5deb-5ad1b8ee8d54"
          ]
        },
        {
          "uuid": "daa04648-597c-3d10-4548-9b4d77e141ba",
          "code": "DB11570",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11570",
          "code_system": "DRUG BANK",
          "references": [
            "7804a9ad-9a2d-1f10-5deb-5ad1b8ee8d54"
          ]
        },
        {
          "uuid": "3f05fdb1-2f08-4596-8ef8-a0fa36e5b074",
          "code": "Z11006CMUZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "358eae87-977b-49fe-9630-4501868357f4",
          "code": "1491503",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1491503",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "7804a9ad-9a2d-1f10-5deb-5ad1b8ee8d54"
          ]
        },
        {
          "uuid": "61ee1b0c-71ad-8115-4a60-1aff8235a59a",
          "code": "Z11006CMUZ",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Z11006CMUZ",
          "code_system": "DAILYMED",
          "references": [
            "e1f96b4c-7933-93cc-9135-124c780f1962"
          ]
        },
        {
          "uuid": "9c7d01c3-f81a-4a98-8fc8-d353f8d6791a",
          "code": "100000159525",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "75afe0fc-b4a7-9a49-fcfb-e568ff2baeba"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "2a62ee0a-d45a-4cfc-89a7-8980ca7db311",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c1c10e4e-2a8f-423c-adef-c4a47a048f44",
            "refuuid": "57516865-7e3b-400e-9659-0e1725b27d40",
            "name": "PADIMATE O",
            "unii": "Z11006CMUZ",
            "linking_id": "Z11006CMUZ",
            "ref_pname": "PADIMATE O",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "cd97e360-f2aa-499a-8181-85aadefb5ee7",
          "amount": {
            "uuid": "921c177d-efde-40d7-844d-0390c370fd42"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "9072c457-6a13-41c1-a7b2-0e72715d1432"
          ],
          "related_substance": {
            "uuid": "a20268ab-9da9-4cf3-8e4e-bb04ab7049cb",
            "refuuid": "b86f30b7-c65d-4dba-a8ed-1e91ae16d0d4",
            "name": "N-nitroso-desmethyl-padimate o",
            "unii": "8D2UFM5DQQ",
            "linking_id": "8D2UFM5DQQ",
            "ref_pname": "N-nitroso-desmethyl-padimate o",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fcd7224a-1679-494a-b5cc-044f18aa69b3",
          "name": "(±)-PADIMATE O",
          "stdName": "(+/-)-PADIMATE O",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "071cad1d-516c-459e-b0c9-c568d4bcad68"
          ],
          "display_name": false
        },
        {
          "uuid": "29b8bd9a-fa28-4347-8fda-5548cdecf719",
          "name": "2-ETHYL-HEXYL 4-DIMETHYLAMINOBENZOATE",
          "stdName": "2-ETHYL-HEXYL 4-DIMETHYLAMINOBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd17c164-eefa-42fd-a68e-0112189e509c"
          ],
          "display_name": false
        },
        {
          "uuid": "1d21e1dd-f3ce-4204-80ff-b958541d8247",
          "name": "2-ETHYLHEXYL 4-(DIMETYLAMINO)BENZOATE",
          "stdName": "2-ETHYLHEXYL 4-(DIMETYLAMINO)BENZOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "686a1778-3781-4b7c-9c97-2331331bcc3e"
          ],
          "display_name": false
        },
        {
          "uuid": "81c10953-83be-4a31-97b1-78d486972770",
          "name": "2-ETHYLHEXYL N,N-DIMETHYL-P-AMINOBENZOATE",
          "stdName": "2-ETHYLHEXYL N,N-DIMETHYL-P-AMINOBENZOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60371439-0363-4208-abe0-ea5291c9e1b8"
          ],
          "display_name": false
        },
        {
          "uuid": "b9e7c8a8-f827-4699-bf69-aec6f2e28d58",
          "name": "2-ETHYLHEXYL P-(DIMETHYLAMINO)BENZOATE",
          "stdName": "2-ETHYLHEXYL P-(DIMETHYLAMINO)BENZOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08ea0d26-112d-44ed-97fa-34efae25b089"
          ],
          "display_name": false
        },
        {
          "uuid": "f30ee6f2-8f98-4829-a7fc-39b20587391e",
          "name": "2-Ethylhexyl 4-(dimethylamino)benzoate",
          "stdName": "2-ETHYLHEXYL 4-(DIMETHYLAMINO)BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85c15087-8663-4f06-9f29-035223b5d130"
          ],
          "display_name": false
        },
        {
          "uuid": "b9759863-51f6-4ac9-80af-74a8e764ac96",
          "name": "4-(DIMETHYLAMINO)BENZOIC ACID 2-ETHYLHEXYL ESTER",
          "stdName": "4-(DIMETHYLAMINO)BENZOIC ACID 2-ETHYLHEXYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c8c5dee-04d7-419a-b7d3-75b022b11ab8",
            "b178a5bd-70d2-40cc-836e-a4d2b76c4c54",
            "60371439-0363-4208-abe0-ea5291c9e1b8"
          ],
          "display_name": false
        },
        {
          "uuid": "7659ef4f-f2a2-49c5-870e-ad08e0a5b970",
          "name": "4-(DIMETHYLAMINO)BENZOIC ACID 2-ETHYLHEXYL ESTER [MI]",
          "stdName": "4-(DIMETHYLAMINO)BENZOIC ACID 2-ETHYLHEXYL ESTER [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b178a5bd-70d2-40cc-836e-a4d2b76c4c54"
          ],
          "display_name": false
        },
        {
          "uuid": "061f8f09-6720-4daa-9631-cad38a81276d",
          "name": "ARLATONE UVB",
          "stdName": "ARLATONE UVB",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08ea0d26-112d-44ed-97fa-34efae25b089"
          ],
          "display_name": false
        },
        {
          "uuid": "73218b3d-8f65-4ffa-9418-5d8b5267eeef",
          "name": "BENZOIC ACID, 4-(DIMETHYLAMINO)-, 2-ETHYLHEXYL ESTER",
          "stdName": "BENZOIC ACID, 4-(DIMETHYLAMINO)-, 2-ETHYLHEXYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08ea0d26-112d-44ed-97fa-34efae25b089"
          ],
          "display_name": false
        },
        {
          "uuid": "d9ef2e8d-0e1c-41a3-ba02-a1aaa6bafec7",
          "name": "ESCALOL 507",
          "stdName": "ESCALOL 507",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08ea0d26-112d-44ed-97fa-34efae25b089"
          ],
          "display_name": false
        },
        {
          "uuid": "d532db95-a8a6-4ef8-a20e-8e11cf75e95e",
          "name": "ETHYLHEXYL DIMETHYL PABA",
          "stdName": "ETHYLHEXYL DIMETHYL PABA",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "47a830e7-9699-4a19-95b6-92f71d659eff",
            "4cdc8abc-d8b8-482e-91b1-44c4efd0f312",
            "3ad6ce4b-049f-432d-b88e-a398b680f14d"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "289cceda-20b0-45d2-9ea1-eb54261ddb9b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "b062ab5d-2692-49a5-b2fa-bb48a5b976c9",
          "name": "EUSOLEX 6007",
          "stdName": "EUSOLEX 6007",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60371439-0363-4208-abe0-ea5291c9e1b8"
          ],
          "display_name": false
        },
        {
          "uuid": "66aee0aa-4e01-447f-9165-cbbb5fb1ab87",
          "name": "OCTYL DIMETHYL PABA",
          "stdName": "OCTYL DIMETHYL PABA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6ab4237-967a-474e-b00f-ce59dce35bb0",
            "d7a3fe02-7afe-498b-8ebd-12edda5a9b1a"
          ],
          "display_name": false
        },
        {
          "uuid": "26908ad2-120a-4071-8471-520781f215ab",
          "name": "OCTYL DIMETHYL PABA [VANDF]",
          "stdName": "OCTYL DIMETHYL PABA [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6ab4237-967a-474e-b00f-ce59dce35bb0"
          ],
          "display_name": false
        },
        {
          "uuid": "7c405383-2a70-407f-93c7-17b12a7e57ae",
          "name": "PADIMATE O",
          "stdName": "PADIMATE O",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e0092fc-8a79-4701-a6f6-2e8faad5044e",
            "649c4e7e-f16e-465c-b094-7e67df9739d3",
            "8b1b8241-ce56-4981-bc28-e39b6ee26a36",
            "1204d4c9-80df-4bfb-9976-6734986266b0",
            "37e42d1a-5b09-448e-8251-9220499eb710",
            "581891cd-f26b-4d54-89e8-e0c5de9bffec",
            "b506eabf-8b6c-4f7b-b30f-cfc80349b2a2",
            "42dd0dc7-2493-4137-843b-acaaafeedd51",
            "d6fa86e3-6145-4379-bdc3-0b83ab0c3d17",
            "b38d4f78-5c77-4ae6-9200-e219895d80ac",
            "85f53ddb-9454-4ec8-893d-6d2a27bf7916",
            "b4d0151a-533d-4c13-8963-ef41e95e7ed6",
            "f6ab4237-967a-474e-b00f-ce59dce35bb0",
            "13d28330-8124-4ea9-9909-170675f3a24e",
            "f26bad96-fbc7-40e5-b92e-27a5f60f3b38"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "e74c3552-6387-4d6a-bb4d-b80ea068920d",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "81372721-7881-46b7-b979-0d9f2f0ef566",
          "name": "PADIMATE O [HSDB]",
          "stdName": "PADIMATE O [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37e42d1a-5b09-448e-8251-9220499eb710"
          ],
          "display_name": false
        },
        {
          "uuid": "d98a6296-cdac-4cdd-a92d-14cf97c48da8",
          "name": "PADIMATE O [MART.]",
          "stdName": "PADIMATE O [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b38d4f78-5c77-4ae6-9200-e219895d80ac"
          ],
          "display_name": false
        },
        {
          "uuid": "4191457f-dbd9-44eb-bb45-a3b523eb5bb7",
          "name": "PADIMATE O [USAN]",
          "stdName": "PADIMATE O [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "13d28330-8124-4ea9-9909-170675f3a24e"
          ],
          "display_name": false
        },
        {
          "uuid": "74784afb-416f-8f60-36f3-b6120309b615",
          "name": "PADIMATE O [USP MONOGRAPH]",
          "stdName": "PADIMATE O [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7c24e5c-35ef-447d-4884-782786d77a09"
          ],
          "display_name": false
        },
        {
          "uuid": "e006e7c2-9f6d-4ebe-a1e6-7592efbdc77c",
          "name": "PADIMATE O [USP-RS]",
          "stdName": "PADIMATE O [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b1b8241-ce56-4981-bc28-e39b6ee26a36"
          ],
          "display_name": false
        },
        {
          "uuid": "0323eb88-b04a-4c26-ae8d-dcbefdba6c52",
          "name": "PADIMATE O [VANDF]",
          "stdName": "PADIMATE O [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6ab4237-967a-474e-b00f-ce59dce35bb0"
          ],
          "display_name": false
        },
        {
          "uuid": "750f6e3d-2475-49d0-96cb-0742e2102f01",
          "name": "PADIMATE O, (±)-",
          "stdName": "PADIMATE O, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "071cad1d-516c-459e-b0c9-c568d4bcad68"
          ],
          "display_name": false
        },
        {
          "uuid": "ad4967eb-fd23-4cb6-b59b-795d306a2094",
          "name": "PADIMATE-O",
          "stdName": "PADIMATE-O",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a92d579-48a6-4ed1-8e9f-c9b95f9b96d8",
            "f6ab4237-967a-474e-b00f-ce59dce35bb0",
            "18aa8971-0553-4720-8f46-69d08d3b6efb"
          ],
          "display_name": false
        },
        {
          "uuid": "b0c69b17-eeb2-46f5-a3f4-f54953d8bf59",
          "name": "PADIMATE-O [VANDF]",
          "stdName": "PADIMATE-O [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6ab4237-967a-474e-b00f-ce59dce35bb0"
          ],
          "display_name": false
        },
        {
          "uuid": "b4754d52-7760-4155-8c78-d8845f53582a",
          "name": "PAMIMATE O [VANDF]",
          "stdName": "PAMIMATE O [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6ab4237-967a-474e-b00f-ce59dce35bb0"
          ],
          "display_name": false
        },
        {
          "uuid": "433287d3-9de1-1f3c-a018-642e40826b83",
          "name": "Padimate o [WHO-DD]",
          "stdName": "PADIMATE O [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48b59df3-f0f1-1879-f91f-28c1a5a45970"
          ],
          "display_name": false
        },
        {
          "uuid": "739bde25-c691-4a49-aef8-94e9b61c74ba",
          "name": "UVASORB DMO",
          "stdName": "UVASORB DMO",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4cdc8abc-d8b8-482e-91b1-44c4efd0f312"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1204d4c9-80df-4bfb-9976-6734986266b0",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cd17c164-eefa-42fd-a68e-0112189e509c",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08ea0d26-112d-44ed-97fa-34efae25b089",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60371439-0363-4208-abe0-ea5291c9e1b8",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a92d579-48a6-4ed1-8e9f-c9b95f9b96d8",
          "citation": "WIKEPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6ab4237-967a-474e-b00f-ce59dce35bb0",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13d28330-8124-4ea9-9909-170675f3a24e",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4d0151a-533d-4c13-8963-ef41e95e7ed6",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b38d4f78-5c77-4ae6-9200-e219895d80ac",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4cdc8abc-d8b8-482e-91b1-44c4efd0f312",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "071cad1d-516c-459e-b0c9-c568d4bcad68",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37e42d1a-5b09-448e-8251-9220499eb710",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b1b8241-ce56-4981-bc28-e39b6ee26a36",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "649c4e7e-f16e-465c-b094-7e67df9739d3",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ad6ce4b-049f-432d-b88e-a398b680f14d",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b178a5bd-70d2-40cc-836e-a4d2b76c4c54",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "686a1778-3781-4b7c-9c97-2331331bcc3e",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85c15087-8663-4f06-9f29-035223b5d130",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f76605d-ff32-4b08-955d-516552df70db",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389672000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d42232a4-9b1a-4c80-8d99-0a0d247d8c69",
          "citation": "SRS import [Z11006CMUZ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Z11006CMUZ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389672000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25c9b507-a67a-45c7-b3d5-867132a36b62",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e0092fc-8a79-4701-a6f6-2e8faad5044e",
          "citation": "PADIMATE O [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f26bad96-fbc7-40e5-b92e-27a5f60f3b38",
          "citation": "PADIMATE O [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "85f53ddb-9454-4ec8-893d-6d2a27bf7916",
          "citation": "PADIMATE O [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "47a830e7-9699-4a19-95b6-92f71d659eff",
          "citation": "ETHYLHEXYL DIMETHYL PABA [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "581891cd-f26b-4d54-89e8-e0c5de9bffec",
          "citation": "PADIMATE O [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b506eabf-8b6c-4f7b-b30f-cfc80349b2a2",
          "citation": "PADIMATE O [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "42dd0dc7-2493-4137-843b-acaaafeedd51",
          "citation": "PADIMATE O [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d7a3fe02-7afe-498b-8ebd-12edda5a9b1a",
          "citation": "OCTYL DIMETHYL PABA [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d6fa86e3-6145-4379-bdc3-0b83ab0c3d17",
          "citation": "PADIMATE O [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "18aa8971-0553-4720-8f46-69d08d3b6efb",
          "citation": "PADIMATE-O [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8518a01f-fea0-4155-8bac-120c1c13361f",
          "citation": "PAMIMATE O [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5c8c5dee-04d7-419a-b7d3-75b022b11ab8",
          "citation": "4-(DIMETHYLAMINO)BENZOIC ACID 2-ETHYLHEXYL ESTER [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "48400c7d-d7ac-7009-8bf4-6efe35197846",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+21245-02-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d0b8738d-3694-0ac9-8039-2c21242d9310",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=21245-02-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7804a9ad-9a2d-1f10-5deb-5ad1b8ee8d54",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e7c24e5c-35ef-447d-4884-782786d77a09",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "07a1bd30-8bc1-440b-a5d9-afc22fc35ee8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e1f96b4c-7933-93cc-9135-124c780f1962",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "48b59df3-f0f1-1879-f91f-28c1a5a45970",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "75afe0fc-b4a7-9a49-fcfb-e568ff2baeba",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "fff70313-5a75-4684-901d-44038c20207a",
          "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs)",
          "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9072c457-6a13-41c1-a7b2-0e72715d1432",
          "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs)",
          "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b6599f49-23c8-4677-993f-24a561b3c653",
          "id": "b6599f49-23c8-4677-993f-24a561b3c653",
          "molfile": "\n  Marvin  01132109262D          \n\n 20 20  0  0  0  0            999 V2000\n   -1.7599   -3.8135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0539   -3.4090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3375   -3.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3607   -3.3703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0925   -3.7697    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.0899   -4.5943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3736   -5.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8011   -3.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5251   -3.7465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2415   -3.3317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2570   -2.7596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9501   -3.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6458   -3.3497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3338   -3.7568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3209   -4.6149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6638   -4.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9449   -4.5839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0913   -4.9756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8153   -4.5711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0990   -5.8156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  8  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 17 12  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 18 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 18  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COC(=O)c1ccc(cc1)N(C)C",
          "formula": "C17H27NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0378b0be-41b9-4087-9b58-3f3b32ffad2e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "277.4024",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "57516865-7e3b-400e-9659-0e1725b27d40",
      "version": "20",
      "structure": {
        "id": "2baec69f-7ab3-48a8-bf5d-5861c5434f91",
        "molfile": "\n  Marvin  01132102222D          \n\n 20 20  0  0  0  0            999 V2000\n    3.2415   -3.3317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9501   -3.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5251   -3.7465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3209   -4.6149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0913   -4.9756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2570   -2.7596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9449   -4.5839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6458   -3.3497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3338   -3.7568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6638   -4.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8011   -3.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8153   -4.5711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0990   -5.8156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0925   -3.7697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0899   -4.5943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3607   -3.3703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0539   -3.4090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3375   -3.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3736   -5.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7599   -3.8135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  9  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  1  2  0  0  0  0\n  7  2  2  0  0  0  0\n  8  2  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  7  1  0  0  0  0\n 11  3  1  0  0  0  0\n 12  5  1  0  0  0  0\n 13  5  1  0  0  0  0\n 14 11  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 16  1  0  0  0  0\n 19 15  1  0  0  0  0\n 20 17  1  0  0  0  0\n 10  4  2  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COC(=O)c1ccc(cc1)N(C)C",
        "formula": "C17H27NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "277.4024",
        "optical_activity": "( + / - )",
        "references": [
          "25c9b507-a67a-45c7-b3d5-867132a36b62",
          "d42232a4-9b1a-4c80-8d99-0a0d247d8c69"
        ],
        "stereo_centers": 1
      },
      "unii": "Z11006CMUZ"
    }
  ]
}