{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "87cdc086-13c6-4c28-bcdc-85a3436a3aee",
          "code": "21 CFR 201.21",
          "comments": "PART 201 -- LABELING|Subpart A--General Labeling Provisions|Sec. 201.21 Declaration of presence of phenylalanine as a component of aspartame in over-the-counter and prescription drugs for human use.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=201.21",
          "code_system": "CFR",
          "references": [
            "5a98677d-b9fc-4b82-b90a-9c2bd99748d5"
          ]
        },
        {
          "uuid": "219792ff-5b01-41bb-8b4e-b2e20f56e3cf",
          "code": "21 CFR 201.66",
          "comments": "PART 201 -- LABELING|Subpart C--Labeling Requirements for Over-the-Counter Drugs|Sec. 201.66 Format and content requirements for over-the-counter (OTC) drug product labeling.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=201.66",
          "code_system": "CFR",
          "references": [
            "5a98677d-b9fc-4b82-b90a-9c2bd99748d5"
          ]
        },
        {
          "uuid": "1e0e776a-bbc8-46b0-ad81-53a802d7df1e",
          "code": "22839-47-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=22839-47-0",
          "code_system": "CAS",
          "references": [
            "5a98677d-b9fc-4b82-b90a-9c2bd99748d5",
            "92add5a1-a18a-4bf7-8303-1aaa40a53ba1"
          ]
        },
        {
          "uuid": "80a61e89-49ae-44bf-9e6e-9193b8ccb29b",
          "code": "C76513",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76513",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5a98677d-b9fc-4b82-b90a-9c2bd99748d5"
          ]
        },
        {
          "uuid": "6e7a15d4-b67f-4256-ad13-6ef70edd1cab",
          "code": "D001218",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68001218",
          "code_system": "MESH",
          "references": [
            "5a98677d-b9fc-4b82-b90a-9c2bd99748d5"
          ]
        },
        {
          "uuid": "865f9221-6033-4fe8-9624-fcc2c69354a0",
          "code": "21 CFR 172.804",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart I--Multipurpose Additives|Sec. 172.804 Aspartame.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=172.804",
          "code_system": "CFR",
          "references": [
            "5a98677d-b9fc-4b82-b90a-9c2bd99748d5"
          ]
        },
        {
          "uuid": "ffc45a96-61ce-47db-aec7-6d827820352c",
          "code": "ASPARTAME",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Aspartame",
          "code_system": "WIKIPEDIA",
          "references": [
            "5a98677d-b9fc-4b82-b90a-9c2bd99748d5"
          ]
        },
        {
          "uuid": "9daa2f63-01e2-4376-b84d-a6a23b1f4a57",
          "code": "INS-951",
          "comments": "JECFA|Food Additives|SWEETENER",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=951",
          "code_system": "JECFA EVALUATION",
          "references": [
            "5a98677d-b9fc-4b82-b90a-9c2bd99748d5"
          ]
        },
        {
          "uuid": "0ca9a32e-e7ca-490f-9132-e13689c5f1d6",
          "code": "E-951",
          "type": "PRIMARY",
          "url": "https://webgate.ec.europa.eu/sanco_foods/main/?event=substance.view&identifier=313",
          "code_system": "EU FOOD ADDITIVES",
          "references": [
            "5a98677d-b9fc-4b82-b90a-9c2bd99748d5"
          ]
        },
        {
          "uuid": "27df3adb-fbc3-41ea-b3dc-66139e64f051",
          "code": "3019",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3019",
          "code_system": "INN",
          "references": [
            "5a98677d-b9fc-4b82-b90a-9c2bd99748d5"
          ]
        },
        {
          "uuid": "2c789550-105d-4082-b557-6d93038c833b",
          "code": "245-261-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.041.132",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "5a98677d-b9fc-4b82-b90a-9c2bd99748d5"
          ]
        },
        {
          "uuid": "3e51d442-f081-4ded-ad32-a6b8efcbc8c8",
          "code": "m2099",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2099?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "5a98677d-b9fc-4b82-b90a-9c2bd99748d5"
          ]
        },
        {
          "uuid": "d74ad50b-4975-4b2d-8aa4-5cbd39873b22",
          "code": "1311524",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1311524/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "5a98677d-b9fc-4b82-b90a-9c2bd99748d5"
          ]
        },
        {
          "uuid": "22d77c6d-2eef-43fd-bc76-d4d23a487c85",
          "code": "DB00168",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00168",
          "code_system": "DRUG BANK",
          "references": [
            "5a98677d-b9fc-4b82-b90a-9c2bd99748d5"
          ]
        },
        {
          "uuid": "d8aaedbc-208c-4fc0-8e4c-fbd9c51ef289",
          "code": "SUB84574",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "5a98677d-b9fc-4b82-b90a-9c2bd99748d5"
          ]
        },
        {
          "uuid": "2f6b2356-95be-4a60-a66f-e5476e2be81e",
          "code": "CHEMBL171679",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL171679",
          "code_system": "ChEMBL",
          "references": [
            "5a98677d-b9fc-4b82-b90a-9c2bd99748d5"
          ]
        },
        {
          "uuid": "4c53085c-d06f-41ca-aa4e-bce057b2515c",
          "code": "INS-951",
          "comments": "CODEX ALIMENTARIUS|Flavour enhancer|Sweetener",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=90",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "5a98677d-b9fc-4b82-b90a-9c2bd99748d5"
          ]
        },
        {
          "uuid": "ef96cde8-7ace-8023-f594-2ab9e0fb6e71",
          "code": "3915",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3915",
          "code_system": "HSDB",
          "references": [
            "76b2f208-7f20-dbf5-2e59-75aeb0f8cad1"
          ]
        },
        {
          "uuid": "69561c95-99cb-6c9e-bfd0-372a96fce35b",
          "code": "DTXSID0020107",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0020107",
          "code_system": "EPA CompTox",
          "references": [
            "339427cd-0915-e7dc-de3d-0fe04bf4d438"
          ]
        },
        {
          "uuid": "222afc83-48cf-ffb0-af11-b12e735d0460",
          "code": "C283",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Artificial Sweetener",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C283",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a9dcd925-aa1a-9199-79a7-b398bbb4ec24"
          ]
        },
        {
          "uuid": "9de189d4-7786-4ac1-a8bd-8635ad416f7d",
          "code": "Z0H242BBR1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "21bc00de-8787-86e1-8583-a9ce1f629ec3",
          "code": "Aspartame",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM620/",
          "code_system": "LACTMED",
          "references": [
            "a9dcd925-aa1a-9199-79a7-b398bbb4ec24"
          ]
        },
        {
          "uuid": "1b0656dc-05cf-7053-ef2a-732b176a653a",
          "code": "134601",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/134601",
          "code_system": "PUBCHEM",
          "references": [
            "bf65a191-0e28-3a87-30c1-22ce01241462"
          ]
        },
        {
          "uuid": "9cf3b8f4-506c-6656-cf23-6568bd492957",
          "code": "1055 (Number of products:1)",
          "comments": "Dietary Supplement Label Database|Chemical|aspartame",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1055&item=aspartame",
          "code_system": "DSLD",
          "references": [
            "a9dcd925-aa1a-9199-79a7-b398bbb4ec24"
          ]
        },
        {
          "uuid": "09f03b9a-d5c1-d0d3-b395-0844305ecc01",
          "code": "1043706",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1043706",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "a9dcd925-aa1a-9199-79a7-b398bbb4ec24"
          ]
        },
        {
          "uuid": "bd136326-4039-01c9-f9c3-d997719dac1f",
          "code": "2877",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:2877",
          "code_system": "CHEBI",
          "references": [
            "a9dcd925-aa1a-9199-79a7-b398bbb4ec24"
          ]
        },
        {
          "uuid": "565a57ae-8733-791d-eb9b-5b303aee8bac",
          "code": "Z0H242BBR1",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Z0H242BBR1",
          "code_system": "DAILYMED",
          "references": [
            "5ca0fb13-7f64-3d80-2aa5-15622d38e55c"
          ]
        },
        {
          "uuid": "1c895278-768d-fa07-5aa5-8293cd18a0e1",
          "code": "758953",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=758953",
          "code_system": "NSC",
          "references": [
            "1fcfb525-9077-161a-1a84-dceea2b1cbf3"
          ]
        },
        {
          "uuid": "99578ca4-604b-8351-408e-201dc150e3dd",
          "code": "100000139218",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b9f4fdd7-8d66-f8d1-7194-ec175c7ec7c7"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "723aa8aa-29b1-4ed3-b5dc-d5200a933edf",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "2aed7ed3-e0a5-4272-8cb3-da39af8d7789",
            "refuuid": "649b1119-31f9-4d8b-8687-44e8a80b289f",
            "name": "ASPARTAME",
            "unii": "Z0H242BBR1",
            "linking_id": "Z0H242BBR1",
            "ref_pname": "ASPARTAME",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "88ac1e2d-92e3-426d-9460-b4c693891da9",
          "qualification": "PLASMA",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "cf8ed2c3-0e1e-4d87-bc7e-f5fd26d2e12b"
          ],
          "related_substance": {
            "uuid": "1b554dc7-87a4-4477-9a2b-624fc18c1d2d",
            "refuuid": "a8521c7c-75bd-4430-9468-dbd72574b575",
            "name": "ASPARTIC ACID",
            "unii": "30KYC7MIAI",
            "linking_id": "30KYC7MIAI",
            "ref_pname": "ASPARTIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e7e4c3ee-3064-490b-90f8-c911cfa85e56",
          "amount": {
            "uuid": "fa1242bb-f598-4b6a-b79a-28c608dc6c0f"
          },
          "qualification": "PLASMA",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "related_substance": {
            "uuid": "3266f307-f4a7-4101-aafd-df867aa317f3",
            "refuuid": "6a922272-bbed-4f3a-9987-8d0552c8828d",
            "name": "Phenylalanine",
            "unii": "47E5O17Y3R",
            "linking_id": "47E5O17Y3R",
            "ref_pname": "Phenylalanine",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d7727cb1-6e65-4cd1-a893-35577c4abe96",
          "amount": {
            "uuid": "e417817d-ead6-4a7e-a320-b45296317f0a",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 1.5
          },
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (GC)",
          "references": [
            "76fac785-3943-40d2-b8f3-4fb4ff68399a"
          ],
          "related_substance": {
            "uuid": "ead29226-cbf8-42f8-9384-90dd0990db05",
            "refuuid": "232d8701-bc19-46a3-9c81-1602941a760c",
            "name": "3,6-DIOXO-5-(PHENYLMETHYL)-2-PIPERAZINEACETIC ACID, (2S,5S)-",
            "unii": "ZM82VP15YJ",
            "linking_id": "ZM82VP15YJ",
            "ref_pname": "3,6-DIOXO-5-(PHENYLMETHYL)-2-PIPERAZINEACETIC ACID, (2S,5S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c4c075e7-5e0d-4c0a-bf7d-8ac2859b5937",
          "amount": {
            "uuid": "2b4cb975-db07-491d-9a09-81d04560b22c"
          },
          "type": "TARGET->AGONIST",
          "references": [
            "e7dfaddc-3f58-41f6-806b-86a863fe03f0"
          ],
          "related_substance": {
            "uuid": "f9c0c2de-28bf-468f-9256-21b3eae40d0d",
            "refuuid": "a5011326-e476-413d-a2bb-ba7e00e5e863",
            "name": "TASTE RECEPTOR TYPE 1 MEMBER 2",
            "unii": "5MI7P9AI4A",
            "linking_id": "5MI7P9AI4A",
            "ref_pname": "TASTE RECEPTOR TYPE 1 MEMBER 2",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "69fba674-0431-469d-a64a-69c78d0b70e2",
          "name": "3-Amino-N-(α-carboxyphenethyl)succinamic acid N-methyl ester",
          "stdName": "3-AMINO-N-(.ALPHA.-CARBOXYPHENETHYL)SUCCINAMIC ACID N-METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6de33ff2-e45c-45ef-b3c0-f14e69bfcc74"
          ],
          "display_name": false
        },
        {
          "uuid": "1de0d27b-acdd-4072-b258-bdbfc3bd240e",
          "name": "APM",
          "stdName": "APM",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "28cf39fe-004a-4f62-86a4-9621309a7152"
          ],
          "display_name": false
        },
        {
          "uuid": "666cb9f5-069d-4503-b20c-356f2d64b5a3",
          "name": "ASPARTAME",
          "stdName": "ASPARTAME",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "df682acd-276a-4009-8d6c-a93e20f082ac",
            "432b6f07-532a-4df8-912b-f458c2027c26",
            "a6c879f5-5808-4585-8901-c22f6f9436b7",
            "819e5f46-31cc-4b24-ad11-2542b15f3ca0",
            "74e31abb-9d13-4e0f-a6c5-f4d953d1196f",
            "c8415e15-cfd1-4b18-a741-1174037b0f12",
            "9ea74be1-4e4d-4423-9a68-bf045c0dc2d2",
            "819e7adf-9226-4c3e-b9b7-5cc10bfcac06",
            "1ff4ae33-2771-4095-828f-7bbd8bccc6b6",
            "3b640ef1-e9b7-4221-b50c-ac3fb01f7314",
            "cb251c85-f69f-46ea-9ad5-148795cc68f9",
            "85a84ad4-6375-4049-9454-e6b2afa1c64d",
            "ba0bac14-1d54-4fb9-82f4-4da415e2ae30",
            "339fd7fe-234a-49a7-b37b-e5c64b688a7a",
            "6da1d6da-d4ec-48e5-aea4-9937790e4d11",
            "9ba9d8d3-e984-4164-818b-dbd17febb526",
            "c142a8bc-1a9d-462d-981d-6815be972e0e",
            "a51cca34-b5c7-4331-aea3-a7e03fcdabbb",
            "ff534115-c92a-4090-a9e1-b7233716e6c3",
            "20b415d1-e265-4875-874b-e3f8ac731154",
            "3cf45221-a358-42a1-b6f2-5a867359a24d",
            "9b889f0d-35cf-47cf-b204-7c59cfc95940",
            "2ca55646-3f02-4e99-a20c-f60449d7a521",
            "70a3188a-f320-4391-8aad-dd07bc4fd26b",
            "807c07ca-18b5-4408-a76d-a1d437043d04",
            "6de33ff2-e45c-45ef-b3c0-f14e69bfcc74"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "0ef497f0-2e84-4d18-a598-600f72e89e7b",
              "name_org": "INN"
            },
            {
              "uuid": "54fa4daf-3f53-4a57-a9d6-ec765653f234",
              "name_org": "USAN"
            },
            {
              "uuid": "e76d133a-2af7-4398-9f71-de8896f15106",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "ba5c5be4-e55f-40f1-8147-4d13a0ebe001",
          "name": "ASPARTAME (E951)",
          "stdName": "ASPARTAME (E951)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c033084-4dd0-4e14-8c58-ca9ad6891575"
          ],
          "display_name": false
        },
        {
          "uuid": "4e0daffb-2f33-1744-7fa2-9209c3c1d10f",
          "name": "ASPARTAME [EP MONOGRAPH]",
          "stdName": "ASPARTAME [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3948558-e8d7-4f30-11d6-fc03531b4c73"
          ],
          "display_name": false
        },
        {
          "uuid": "e0b9afde-a1aa-4af2-9ed7-3b5eebe89458",
          "name": "ASPARTAME [FCC]",
          "stdName": "ASPARTAME [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "819e7adf-9226-4c3e-b9b7-5cc10bfcac06"
          ],
          "display_name": false
        },
        {
          "uuid": "cef4d511-4e04-4734-bcf6-66c91e11f63f",
          "name": "ASPARTAME [FHFI]",
          "stdName": "ASPARTAME [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8415e15-cfd1-4b18-a741-1174037b0f12"
          ],
          "display_name": false
        },
        {
          "uuid": "1c18680f-501a-44eb-a3f7-16041ba06dd3",
          "name": "ASPARTAME [HSDB]",
          "stdName": "ASPARTAME [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c142a8bc-1a9d-462d-981d-6815be972e0e"
          ],
          "display_name": false
        },
        {
          "uuid": "7b698b34-f542-4b40-be18-7854b585dec3",
          "name": "ASPARTAME [II]",
          "stdName": "ASPARTAME [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6de33ff2-e45c-45ef-b3c0-f14e69bfcc74"
          ],
          "display_name": false
        },
        {
          "uuid": "fcb77062-6dac-456f-a602-eae058741c18",
          "name": "ASPARTAME [MART.]",
          "stdName": "ASPARTAME [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ca55646-3f02-4e99-a20c-f60449d7a521"
          ],
          "display_name": false
        },
        {
          "uuid": "f5210ce2-84a5-4046-926e-01710933170a",
          "name": "ASPARTAME [MI]",
          "stdName": "ASPARTAME [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6c879f5-5808-4585-8901-c22f6f9436b7"
          ],
          "display_name": false
        },
        {
          "uuid": "5a117341-b3ba-4365-96bc-0cdc12ddaa37",
          "name": "ASPARTAME [USAN]",
          "stdName": "ASPARTAME [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "339fd7fe-234a-49a7-b37b-e5c64b688a7a"
          ],
          "display_name": false
        },
        {
          "uuid": "3dd9f395-74a5-45f3-b825-0c4eceab21be",
          "name": "ASPARTAME [USP-RS]",
          "stdName": "ASPARTAME [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85a84ad4-6375-4049-9454-e6b2afa1c64d"
          ],
          "display_name": false
        },
        {
          "uuid": "f6576c41-d05e-43f1-ac10-a439706f39cd",
          "name": "ASPARTAME [VANDF]",
          "stdName": "ASPARTAME [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74e31abb-9d13-4e0f-a6c5-f4d953d1196f"
          ],
          "display_name": false
        },
        {
          "uuid": "a894f4d2-1665-3ee4-ced6-bb46737923a5",
          "name": "Aspartame [WHO-DD]",
          "stdName": "ASPARTAME [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24122697-4e76-56cf-6f0c-bd8faaf6f729"
          ],
          "display_name": false
        },
        {
          "uuid": "2942f70f-9523-47f2-a90d-b2a088957f9f",
          "name": "E-951",
          "stdName": "E-951",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c033084-4dd0-4e14-8c58-ca9ad6891575"
          ],
          "display_name": false
        },
        {
          "uuid": "58080537-e623-40eb-80ba-d82d31c1039e",
          "name": "EQUAL",
          "stdName": "EQUAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7c70c7d-efcc-4690-a278-910ea3a781b4"
          ],
          "display_name": false
        },
        {
          "uuid": "c4e790f4-c710-4240-9121-011cbc71eac7",
          "name": "INS NO.951",
          "stdName": "INS NO.951",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c163b2f7-1b83-4500-b161-c5ddfb26a918"
          ],
          "display_name": false
        },
        {
          "uuid": "e3b1bbf2-49da-45d8-bd14-04dc4d3e36eb",
          "name": "INS-951",
          "stdName": "INS-951",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c163b2f7-1b83-4500-b161-c5ddfb26a918"
          ],
          "display_name": false
        },
        {
          "uuid": "210d55fb-ea89-4469-aad0-0216b01e533c",
          "name": "L-ASPARTYL-L-PHENYLALANYL METHYL ESTER",
          "stdName": "L-ASPARTYL-L-PHENYLALANYL METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d0fdb50-f16d-4f8e-905c-9541aedb9922"
          ],
          "display_name": false
        },
        {
          "uuid": "2d6b3612-024c-4380-9b36-b5d919e5aa46",
          "name": "L-PHENYLALANINE, N-L-.ALPHA.-ASPARTYL-, 1-METHYL ESTER",
          "stdName": "L-PHENYLALANINE, N-L-.ALPHA.-ASPARTYL-, 1-METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6de33ff2-e45c-45ef-b3c0-f14e69bfcc74"
          ],
          "display_name": false
        },
        {
          "uuid": "1606eeeb-d52d-448f-ba2b-2048e35c058b",
          "name": "METHYL ASPARTYLPHENYLALANATE",
          "stdName": "METHYL ASPARTYLPHENYLALANATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d0fdb50-f16d-4f8e-905c-9541aedb9922"
          ],
          "display_name": false
        },
        {
          "uuid": "b533d250-9524-115d-294a-536315ebe9be",
          "name": "NSC-758953",
          "stdName": "NSC-758953",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fcfb525-9077-161a-1a84-dceea2b1cbf3"
          ],
          "display_name": false
        },
        {
          "uuid": "8018d15a-4070-4c9c-83ab-ad950822a7fe",
          "name": "NUTRASWEET",
          "stdName": "NUTRASWEET",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74badcc3-3200-4d93-a4ff-f6fd3effe124"
          ],
          "display_name": false
        },
        {
          "uuid": "b0a02bbb-c220-413a-a400-ee99d97db9b5",
          "name": "PAL SWEET",
          "stdName": "PAL SWEET",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d0fdb50-f16d-4f8e-905c-9541aedb9922"
          ],
          "display_name": false
        },
        {
          "uuid": "dfca1f4b-f251-42bc-8483-6486ca579d36",
          "name": "SC-18862",
          "stdName": "SC-18862",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6de33ff2-e45c-45ef-b3c0-f14e69bfcc74"
          ],
          "display_name": false
        },
        {
          "uuid": "574f85b6-5419-4a8b-a837-d5b2c95abaeb",
          "name": "SLADEX",
          "stdName": "SLADEX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d0fdb50-f16d-4f8e-905c-9541aedb9922"
          ],
          "display_name": false
        },
        {
          "uuid": "e8792e8d-7bf7-4af9-bbf7-03ef07449373",
          "name": "ZERO-CAL",
          "stdName": "ZERO-CAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d0fdb50-f16d-4f8e-905c-9541aedb9922"
          ],
          "display_name": false
        },
        {
          "uuid": "afe6c7dd-6af9-44b7-8ec5-336f72fa3b67",
          "name": "aspartame [INN]",
          "stdName": "ASPARTAME [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "807c07ca-18b5-4408-a76d-a1d437043d04"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6de33ff2-e45c-45ef-b3c0-f14e69bfcc74",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "74badcc3-3200-4d93-a4ff-f6fd3effe124",
          "citation": "http://en.wikipedia.org/wiki/NutraSweet",
          "url": "http://en.wikipedia.org/wiki/NutraSweet",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7c70c7d-efcc-4690-a278-910ea3a781b4",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "807c07ca-18b5-4408-a76d-a1d437043d04",
          "citation": "INN Proposed List 25",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL25.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "339fd7fe-234a-49a7-b37b-e5c64b688a7a",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df682acd-276a-4009-8d6c-a93e20f082ac",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8415e15-cfd1-4b18-a741-1174037b0f12",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ca55646-3f02-4e99-a20c-f60449d7a521",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6c879f5-5808-4585-8901-c22f6f9436b7",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "819e7adf-9226-4c3e-b9b7-5cc10bfcac06",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6da1d6da-d4ec-48e5-aea4-9937790e4d11",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c142a8bc-1a9d-462d-981d-6815be972e0e",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85a84ad4-6375-4049-9454-e6b2afa1c64d",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20b415d1-e265-4875-874b-e3f8ac731154",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74e31abb-9d13-4e0f-a6c5-f4d953d1196f",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c033084-4dd0-4e14-8c58-ca9ad6891575",
          "citation": "evmpd",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d0fdb50-f16d-4f8e-905c-9541aedb9922",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c163b2f7-1b83-4500-b161-c5ddfb26a918",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "28cf39fe-004a-4f62-86a4-9621309a7152",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a98677d-b9fc-4b82-b90a-9c2bd99748d5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390722000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf8ed2c3-0e1e-4d87-bc7e-f5fd26d2e12b",
          "citation": "METABOLISM, VOL40, NO6(JUNE),1991: ~~612.618",
          "url": "http://ac.els-cdn.com/002604959190052X/1-s2.0-002604959190052X-main.pdf?_tid=fd108010-78ef-11e3-a24d-00000aab0f02&acdnat=1389245969_212bd8f96d5abb7d7454e39fb1408d72",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "76fac785-3943-40d2-b8f3-4fb4ff68399a",
          "citation": "JECFA MONOGRAPH",
          "url": "http://www.fao.org/ag/agn/jecfa-additives/specs/Monograph1/additive-046-m1.pdf",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d078242-6c0d-45f0-9c28-891957f53a76",
          "citation": "SRS import [Z0H242BBR1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Z0H242BBR1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390722000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3cf45221-a358-42a1-b6f2-5a867359a24d",
          "citation": "ASPARTAME [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9b889f0d-35cf-47cf-b204-7c59cfc95940",
          "citation": "ASPARTAME [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a51cca34-b5c7-4331-aea3-a7e03fcdabbb",
          "citation": "ASPARTAME [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9ea74be1-4e4d-4423-9a68-bf045c0dc2d2",
          "citation": "ASPARTAME [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9ba9d8d3-e984-4164-818b-dbd17febb526",
          "citation": "ASPARTAME [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ff534115-c92a-4090-a9e1-b7233716e6c3",
          "citation": "ASPARTAME [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "819e5f46-31cc-4b24-ad11-2542b15f3ca0",
          "citation": "ASPARTAME [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3b640ef1-e9b7-4221-b50c-ac3fb01f7314",
          "citation": "ASPARTAME [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cb251c85-f69f-46ea-9ad5-148795cc68f9",
          "citation": "ASPARTAME [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1ff4ae33-2771-4095-828f-7bbd8bccc6b6",
          "citation": "ASPARTAME [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "70a3188a-f320-4391-8aad-dd07bc4fd26b",
          "citation": "ASPARTAME [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "432b6f07-532a-4df8-912b-f458c2027c26",
          "citation": "ASPARTAME [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ba0bac14-1d54-4fb9-82f4-4da415e2ae30",
          "citation": "ASPARTAME [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "76b2f208-7f20-dbf5-2e59-75aeb0f8cad1",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+22839-47-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "339427cd-0915-e7dc-de3d-0fe04bf4d438",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=22839-47-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "efd33752-fb4c-9552-9ac8-f0efa4c8b79e",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+22839-47-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a9dcd925-aa1a-9199-79a7-b398bbb4ec24",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "bf65a191-0e28-3a87-30c1-22ce01241462",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "92add5a1-a18a-4bf7-8303-1aaa40a53ba1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1fcfb525-9077-161a-1a84-dceea2b1cbf3",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f3948558-e8d7-4f30-11d6-fc03531b4c73",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "5ca0fb13-7f64-3d80-2aa5-15622d38e55c",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "24122697-4e76-56cf-6f0c-bd8faaf6f729",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b9f4fdd7-8d66-f8d1-7194-ec175c7ec7c7",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "e7dfaddc-3f58-41f6-806b-86a863fe03f0",
          "citation": "Olfaction & Taste M. Max, W. Meyerhof, in The Senses: A Comprehensive Reference, 2008",
          "url": "https://www.sciencedirect.com/topics/neuroscience/neotame",
          "doc_type": "BOOK",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d5b0eda9-5394-4193-bf48-ecd2a985c7b1",
          "id": "d5b0eda9-5394-4193-bf48-ecd2a985c7b1",
          "molfile": "\n  Marvin  01132111042D          \n\n 21 21  0  0  1  0            999 V2000\n    3.9859    2.1457    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.9723    2.9503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7124    1.7450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4322    2.1695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1689    1.7722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4253    2.9774    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2695    1.7179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2762    1.1544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5430    2.1151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8232    1.7044    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    1.8402    0.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5633    0.4991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2865    0.9065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0096    0.5262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0300   -0.2954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3136   -0.7062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5837   -0.3124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1000    2.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0796    2.9096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3836    1.6806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3463    2.0642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1  7  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  1  0  0  0\n 10 11  1  0  0  0  0\n 18 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 17 12  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 18  1  0  0  0  0\n 21 20  1  0  0  0  0\nM  END",
          "smiles": "COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)N",
          "formula": "C14H18N2O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3a23dfd1-1b60-4bc2-b10d-4efdcc1f2000"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "294.3037",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "649b1119-31f9-4d8b-8687-44e8a80b289f",
      "version": "30",
      "structure": {
        "id": "0eb5d383-b877-44db-b5ce-731dddd39bb5",
        "molfile": "\n  Marvin  01132101002D          \n\n 21 21  0  0  1  0            999 V2000\n    3.2695    1.7179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5430    2.1151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7124    1.7450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8232    1.7044    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.1000    2.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9859    2.1457    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.4322    2.1695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2762    1.1544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8402    0.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0796    2.9096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1689    1.7722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9723    2.9503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3836    1.6806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4253    2.9774    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5633    0.4991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3463    2.0642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5837   -0.3124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2865    0.9065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0096    0.5262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3136   -0.7062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0300   -0.2954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  3  1  0  0  0  0\n  8  1  2  0  0  0  0\n  4  9  1  1  0  0  0\n 10  5  2  0  0  0  0\n 11  7  2  0  0  0  0\n  6 12  1  1  0  0  0\n 13  5  1  0  0  0  0\n 14  7  1  0  0  0  0\n 15  9  1  0  0  0  0\n 16 13  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18 15  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 17  1  0  0  0  0\n 21 19  1  0  0  0  0\n 21 20  2  0  0  0  0\nM  END",
        "smiles": "COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)N",
        "formula": "C14H18N2O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "294.3037",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "6de33ff2-e45c-45ef-b3c0-f14e69bfcc74",
          "2d078242-6c0d-45f0-9c28-891957f53a76",
          "807c07ca-18b5-4408-a76d-a1d437043d04"
        ],
        "stereo_centers": 2
      },
      "unii": "Z0H242BBR1"
    }
  ]
}