{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "48945370-b227-4b88-8661-1f747cfe0746",
          "code": "1949-15-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1949-15-1",
          "code_system": "CAS",
          "references": [
            "bf6be69e-4405-41d9-8ee4-dfd6fd3da306",
            "6993f8cd-8a3b-4bf6-b70e-15c6a9871ff8"
          ]
        },
        {
          "uuid": "7125b1c2-0721-4a53-8b9e-1a085641a2a0",
          "code": "200392",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/200392",
          "code_system": "PUBCHEM",
          "references": [
            "bf6be69e-4405-41d9-8ee4-dfd6fd3da306"
          ]
        },
        {
          "uuid": "cfe672da-79d7-4396-bebe-0661651dbfdc",
          "code": "YZS2AGA4C7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c6f43b05-63af-08e0-d380-5c8a2092fbe3",
          "code": "DTXSID30904704",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30904704",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "b16ad0ec-7621-60e6-7837-b963f9bffe5b",
          "code": "300000037374",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "5367da82-c732-3bf0-6e61-d846ca8dea34"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a6fe745f-f84d-4228-aff9-f32748a0ef9d",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "552c78b1-6064-4e07-9551-5b4dae084402",
            "refuuid": "c8ff0e70-5817-4eae-9428-232340d19784",
            "name": "GLUTAMIC ACID, DL-",
            "unii": "61LJO5I15S",
            "linking_id": "61LJO5I15S",
            "ref_pname": "GLUTAMIC ACID, DL-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4ff5a232-567d-4750-9a5f-ae70ad58b511",
          "name": "GLUTAMIC ACID, ZINC SALT",
          "stdName": "GLUTAMIC ACID, ZINC SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7412a4cc-0048-4357-9581-b03bf0308cec",
            "83ee39f9-ef30-4d80-b923-fc0bb20bbd34"
          ],
          "display_name": false
        },
        {
          "uuid": "8eceb271-3486-4478-b436-b19c00bbb274",
          "name": "GLUTAMIC ACID, ZINC SALT, (±)-",
          "stdName": "GLUTAMIC ACID, ZINC SALT, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dad10812-5818-49af-8881-a68b093f9df7",
            "83ee39f9-ef30-4d80-b923-fc0bb20bbd34"
          ],
          "display_name": false
        },
        {
          "uuid": "4c364647-b480-417d-9980-dbfa6211a907",
          "name": "GLUTAMIC ACID, ZINC SALT, DL-",
          "stdName": "GLUTAMIC ACID, ZINC SALT, DL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dad10812-5818-49af-8881-a68b093f9df7",
            "83ee39f9-ef30-4d80-b923-fc0bb20bbd34"
          ],
          "display_name": false
        },
        {
          "uuid": "53b5121b-ea11-4872-8937-4d0ba42f938f",
          "name": "ZINC DL-GLUTAMATE (1:1)",
          "stdName": "ZINC DL-GLUTAMATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5cdc064b-0d88-490a-9253-d7df4dfa7997",
            "83ee39f9-ef30-4d80-b923-fc0bb20bbd34"
          ],
          "display_name": false
        },
        {
          "uuid": "b4873d91-9872-4212-8e0b-995aa6d788a8",
          "name": "ZINC GLUTAMATE",
          "stdName": "ZINC GLUTAMATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7412a4cc-0048-4357-9581-b03bf0308cec",
            "101ba875-5b86-4d78-a7bb-2a97809d96b9",
            "83ee39f9-ef30-4d80-b923-fc0bb20bbd34"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f4bc613b-a2cf-4d27-8612-91e261470073",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "cfb19e92-6d5c-4f22-816a-814021a52d71",
          "name": "ZINC, (GLUTAMATO(2-)-N,O1)-",
          "stdName": "ZINC, (GLUTAMATO(2-)-N,O1)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8691f2da-5b9f-4989-a4d3-81b82ae5ced7",
            "83ee39f9-ef30-4d80-b923-fc0bb20bbd34"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7412a4cc-0048-4357-9581-b03bf0308cec",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "83ee39f9-ef30-4d80-b923-fc0bb20bbd34",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dad10812-5818-49af-8881-a68b093f9df7",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5cdc064b-0d88-490a-9253-d7df4dfa7997",
          "citation": "ChemSpider",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8691f2da-5b9f-4989-a4d3-81b82ae5ced7",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf6be69e-4405-41d9-8ee4-dfd6fd3da306",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390919000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a920990d-b1bd-43d0-9e20-cf49e0467e75",
          "citation": "SRS import [YZS2AGA4C7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YZS2AGA4C7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390919000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "101ba875-5b86-4d78-a7bb-2a97809d96b9",
          "citation": "ZINC GLUTAMATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6993f8cd-8a3b-4bf6-b70e-15c6a9871ff8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5367da82-c732-3bf0-6e61-d846ca8dea34",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0361cad9-eed6-4ecf-9c2e-f3f2c79ef8f3",
          "id": "0361cad9-eed6-4ecf-9c2e-f3f2c79ef8f3",
          "molfile": "\n  Marvin  01132100292D          \n\n  1  0  0  0  0  0            999 V2000\n    9.8338   -5.7002    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "dfda75d1-dc95-4b2d-a044-4c788e275af5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "427fc972-ce01-4195-bbd2-771a19bcc0ae",
          "id": "427fc972-ce01-4195-bbd2-771a19bcc0ae",
          "molfile": "\n  Marvin  01132103302D          \n\n 10  9  0  0  0  0            999 V2000\n    5.3008   -4.9874    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7128   -5.7022    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.5368   -5.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9533   -4.9874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7776   -4.9874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1894   -5.7022    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.1894   -4.2720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3008   -6.4176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7128   -7.1283    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.4772   -6.4176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  8  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  2  0  0  0  0\nM  CHG  2   6  -1   9  -1\nM  END",
          "smiles": "C(CC(=O)[O-])C(C(=O)[O-])N",
          "formula": "C5H7NO4",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f2cf9461-bca3-4a90-a81b-683a742a62c7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "145.1136",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "33e54dc3-26ad-48ea-b157-cc311b8882b7",
      "version": "7",
      "structure": {
        "id": "f8292ac5-c208-4b7d-a7d9-13fd094e4696",
        "molfile": "\n  Marvin  01132112522D          \n\n 11  9  0  0  0  0            999 V2000\n    9.8370   -5.7018    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n    5.7124   -7.1277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3004   -6.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7124   -5.7018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5363   -5.7018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9528   -4.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7770   -4.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1888   -5.7018    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1888   -4.2717    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.3004   -4.9870    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4768   -6.4171    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  3  2  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  4 10  1  0  0  0  0\n 11  3  1  0  0  0  0\nM  CHG  3   1   2   9  -1  11  -1\nM  END",
        "smiles": "C(CC(=O)[O-])C(C(=O)[O-])N.[Zn+2]",
        "formula": "C5H7NO4.Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "210.5092",
        "optical_activity": "( + / - )",
        "references": [
          "a920990d-b1bd-43d0-9e20-cf49e0467e75",
          "8691f2da-5b9f-4989-a4d3-81b82ae5ced7"
        ],
        "stereo_centers": 1
      },
      "unii": "YZS2AGA4C7"
    }
  ]
}