{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6196cb57-4b0b-4353-9fe0-05b80acd3248",
          "code": "M01AB15",
          "comments": "ATC|MUSCULO-SKELETAL SYSTEM|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS, NON-STEROIDS|Acetic acid derivatives and related substances|ketorolac",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=M01AB15&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "e8cd1547-6726-4856-82da-724fb6b4f3c6"
          ]
        },
        {
          "uuid": "464691ae-8cd9-4604-bb9b-d21a688634cd",
          "code": "S01BC05",
          "comments": "ATC|SENSORY ORGANS|OPHTHALMOLOGICALS|ANTIINFLAMMATORY AGENTS|Antiinflammatory agents, non-steroids|ketorolac",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=S01BC05&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "e8cd1547-6726-4856-82da-724fb6b4f3c6"
          ]
        },
        {
          "uuid": "7b814634-c803-499e-97dd-10e18fff8422",
          "code": "N0000175722",
          "comments": "Established Pharmacologic Class [EPC]|Nonsteroidal Anti-inflammatory Drug [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175722",
          "code_system": "NDF-RT",
          "references": [
            "e8cd1547-6726-4856-82da-724fb6b4f3c6"
          ]
        },
        {
          "uuid": "31869274-7374-4389-9f7f-5a8da5d150b0",
          "code": "N0000175721",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Chemical Classes for Pharmacologic Classification [Chemical/Ingredient]|Nonsteroidal Anti-inflammatory Compounds [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175721",
          "code_system": "NDF-RT",
          "references": [
            "e8cd1547-6726-4856-82da-724fb6b4f3c6"
          ]
        },
        {
          "uuid": "1d52e37c-c247-49d5-b749-506529c453c5",
          "code": "N0000000160",
          "comments": "Cellular or Molecular Interactions [MoA]|Enzyme Interactions [MoA]|Enzyme Inhibitors [MoA]|Cyclooxygenase Inhibitors [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000160",
          "code_system": "NDF-RT",
          "references": [
            "e8cd1547-6726-4856-82da-724fb6b4f3c6"
          ]
        },
        {
          "uuid": "75c3548d-7bd8-4bc9-b739-8f1d70a56f9a",
          "code": "QM01AB15",
          "comments": "VATC|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS, NON-STEROIDS|Acetic acid derivatives and related substances|ketorolac",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QM01AB15&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "e8cd1547-6726-4856-82da-724fb6b4f3c6"
          ]
        },
        {
          "uuid": "857453c2-526d-4bcf-8ad3-e1f2fe5d9195",
          "code": "QS01BC05",
          "comments": "VATC|OPHTHALMOLOGICALS|ANTIINFLAMMATORY AGENTS|Antiinflammatory agents, non-steroids|ketorolac",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QS01BC05&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "e8cd1547-6726-4856-82da-724fb6b4f3c6"
          ]
        },
        {
          "uuid": "0a3a41e5-c80c-4301-aa64-de5c5f288b6a",
          "code": "74103-06-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=74103-06-3",
          "code_system": "CAS",
          "references": [
            "e8cd1547-6726-4856-82da-724fb6b4f3c6",
            "e50f16ac-db2b-44ca-8b85-33f69c55f0f5"
          ]
        },
        {
          "uuid": "25222c77-1aca-44a9-9b72-6a508914cfc9",
          "code": "C1219",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1219",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e8cd1547-6726-4856-82da-724fb6b4f3c6"
          ]
        },
        {
          "uuid": "902cdd65-ff7d-4872-b1ab-3e4ff52ed217",
          "code": "D020910",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68020910",
          "code_system": "MESH",
          "references": [
            "e8cd1547-6726-4856-82da-724fb6b4f3c6"
          ]
        },
        {
          "uuid": "b82cab68-bda8-45c0-9c9e-f2e6c99834ae",
          "code": "NBK548459",
          "comments": "LiverTox|Analgesic|Mild-Moderate Pain|NSAID",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548459/",
          "code_system": "LIVERTOX",
          "references": [
            "183b8f61-83d7-dadd-24de-991f703c038c"
          ]
        },
        {
          "uuid": "c7be648e-3be9-459e-8e3f-93efa46fa734",
          "code": "KETOROLAC",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ketorolac",
          "code_system": "WIKIPEDIA",
          "references": [
            "e8cd1547-6726-4856-82da-724fb6b4f3c6"
          ]
        },
        {
          "uuid": "c8de8319-4e6b-4034-a2d7-b8d8fd905bb5",
          "code": "5558",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5558",
          "code_system": "INN",
          "references": [
            "e8cd1547-6726-4856-82da-724fb6b4f3c6"
          ]
        },
        {
          "uuid": "477fcbaf-639a-4494-a831-20d19faa79e9",
          "code": "6661",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=6661",
          "code_system": "IUPHAR",
          "references": [
            "e8cd1547-6726-4856-82da-724fb6b4f3c6"
          ]
        },
        {
          "uuid": "309e3de0-9d6d-4adc-acd0-6e9f74627bdd",
          "code": "35827",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/35827/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e8cd1547-6726-4856-82da-724fb6b4f3c6"
          ]
        },
        {
          "uuid": "fdb14dd6-7b19-4060-ac5c-03e26acc0fe8",
          "code": "m6623",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6623?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e8cd1547-6726-4856-82da-724fb6b4f3c6"
          ]
        },
        {
          "uuid": "acd7d940-008d-4342-87b0-170ac598fd91",
          "code": "SUB08376MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e8cd1547-6726-4856-82da-724fb6b4f3c6"
          ]
        },
        {
          "uuid": "d2b7456d-7a37-4b7c-a53a-4592453784d5",
          "code": "CHEMBL469",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL469",
          "code_system": "ChEMBL",
          "references": [
            "e8cd1547-6726-4856-82da-724fb6b4f3c6"
          ]
        },
        {
          "uuid": "de655294-6b54-4b82-bf91-0aba6d803975",
          "code": "N0000175939",
          "comments": "Established Pharmacologic Class [EPC]|Cyclooxygenase Inhibitor [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175939",
          "code_system": "NDF-RT",
          "references": [
            "e8cd1547-6726-4856-82da-724fb6b4f3c6"
          ]
        },
        {
          "uuid": "af5087dd-0c6a-4893-beb7-389223c3183c",
          "code": "3826",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3826",
          "code_system": "PUBCHEM",
          "references": [
            "e8cd1547-6726-4856-82da-724fb6b4f3c6"
          ]
        },
        {
          "uuid": "70e1335d-f9f8-2ffd-2356-bd418975b6a5",
          "code": "DTXSID8023189",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8023189",
          "code_system": "EPA CompTox",
          "references": [
            "c0a2b670-e9e4-776e-c78b-27f6a25d7d6b"
          ]
        },
        {
          "uuid": "2ed77c49-a559-7d2f-8021-86c24c9407f5",
          "code": "S01FB51",
          "comments": "ATC|SENSORY ORGANS|OPHTHALMOLOGICALS|MYDRIATICS AND CYCLOPLEGICS|Sympathomimetics excl. antiglaucoma preparations|phenylephrine and ketorolac",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=S01FB51&showdescription=yes",
          "code_system": "WHO-ATC"
        },
        {
          "uuid": "06dc8962-7dee-7be8-1f54-3e0bf51f4066",
          "code": "C1323",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Nonnarcotic Analgesic[C2198]|Analgesic and Antipyretic[C2356]|Nonsteroidal Antiinflammatory Drug[C257]|Cyclooxygenase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1323",
          "code_system": "NCI_THESAURUS",
          "references": [
            "183b8f61-83d7-dadd-24de-991f703c038c"
          ]
        },
        {
          "uuid": "ac650321-0952-4a24-8e0b-bc7cd8fa6949",
          "code": "YZI5105V0L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e563ddca-54c1-0e97-1128-bcf9d520d5bc",
          "code": "Ketorolac",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM153/",
          "code_system": "LACTMED",
          "references": [
            "183b8f61-83d7-dadd-24de-991f703c038c"
          ]
        },
        {
          "uuid": "c7b8729c-88e3-c4c2-9944-a2960cdd73d6",
          "code": "1529",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1529",
          "code_system": "DRUG CENTRAL",
          "references": [
            "183b8f61-83d7-dadd-24de-991f703c038c"
          ]
        },
        {
          "uuid": "41eebaf7-d829-d0d6-b133-47f70174808e",
          "code": "DB00465",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB00465",
          "code_system": "DRUG BANK",
          "references": [
            "183b8f61-83d7-dadd-24de-991f703c038c"
          ]
        },
        {
          "uuid": "cd663c7c-8472-7e40-11fc-941bb35fed9d",
          "code": "6129",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:6129",
          "code_system": "CHEBI",
          "references": [
            "183b8f61-83d7-dadd-24de-991f703c038c"
          ]
        },
        {
          "uuid": "ee2e5be4-614e-41ed-23cc-cefbab4a4d1e",
          "code": "YZI5105V0L",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=YZI5105V0L",
          "code_system": "DAILYMED",
          "references": [
            "d8a97ec0-74af-2d4d-b877-78e15147a9eb"
          ]
        },
        {
          "uuid": "bbdcab2a-de88-49ea-c9d1-ba48774967ba",
          "code": "100000083097",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "33f9f924-724a-7e5a-6854-71587cc6ac1e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "0a5cf2f1-6c91-4bc7-b24b-b1d47f2de0ad",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ed16b38f-6ba3-4bbb-a224-f6af5366f6b5",
            "refuuid": "19e15722-eee4-4b20-b063-90232eb00eb1",
            "name": "KETOROLAC",
            "unii": "YZI5105V0L",
            "linking_id": "YZI5105V0L",
            "ref_pname": "KETOROLAC",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6b2c8d1a-4282-4a2e-800a-d0a7b9195cb1",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "2df4148f-ba53-488f-a35d-6e4c3e84d7ca",
            "refuuid": "1c09c07d-863b-44a4-a985-1b9dd877a9f7",
            "name": "KETOROLAC CALCIUM",
            "unii": "52541KD36N",
            "linking_id": "52541KD36N",
            "ref_pname": "KETOROLAC CALCIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d011325d-e34a-478a-8fb2-f046ff52dc3e",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "7e712fa9-3894-44fc-baeb-9f5213f54a3a",
            "refuuid": "9e1b65e7-8ffe-4337-a45e-601eac1efe8c",
            "name": "KETOROLAC TROMETHAMINE",
            "unii": "4EVE5946BQ",
            "linking_id": "4EVE5946BQ",
            "ref_pname": "KETOROLAC TROMETHAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "74483a0f-c830-4ffd-86a0-3f9ff3fdb8ca",
          "type": "METABOLITE INACTIVE->PARENT",
          "references": [
            "a9cbab92-9df5-4281-a0a3-d4882fd42137"
          ],
          "related_substance": {
            "uuid": "e35c0e12-6150-4b0e-af58-f45d8a700fd9",
            "refuuid": "27f16c0c-e036-4981-9c1f-86582657da88",
            "name": "P-HYDROXYKETOROLAC",
            "unii": "6T186586WT",
            "linking_id": "6T186586WT",
            "ref_pname": "P-HYDROXYKETOROLAC",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c4cd8ce2-1840-4632-b307-ae626e1dae1b",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "139d220b-96ac-4f53-bb31-8c4b2eae9752",
            "refuuid": "eff3ac65-9f00-45e8-85cd-1c31211ec577",
            "name": "KETOROLAC, (R)-",
            "unii": "10A5O25ILE",
            "linking_id": "10A5O25ILE",
            "ref_pname": "KETOROLAC, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fddd2d45-54b3-4c0b-b201-35370d0eb643",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "f0cd7487-b058-47a5-822a-bf5bcd3328ef",
            "refuuid": "1e979610-28f7-45c9-a4e2-3384ef69070d",
            "name": "KETOROLAC, (S)-",
            "unii": "5H3TJ0A81K",
            "linking_id": "5H3TJ0A81K",
            "ref_pname": "KETOROLAC, (S)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8c563173-5146-4269-aa50-32ddeaa381ce",
          "name": "(±)-5-BENZOYL-2,3-DIHYDRO-1H-PYRROLIZINE-1-CARBOXYLIC ACID",
          "stdName": "(+/-)-5-BENZOYL-2,3-DIHYDRO-1H-PYRROLIZINE-1-CARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9de7dee0-4981-403c-a633-8d705520895c"
          ],
          "display_name": false
        },
        {
          "uuid": "9d797444-7fb9-41a7-8bb4-20900f958ff4",
          "name": "1H-PYRROLIZINE-1-CARBOXYLIC ACID, 5-BENZOYL-2,3-DIHYDRO, (±)-",
          "stdName": "1H-PYRROLIZINE-1-CARBOXYLIC ACID, 5-BENZOYL-2,3-DIHYDRO, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9de7dee0-4981-403c-a633-8d705520895c"
          ],
          "display_name": false
        },
        {
          "uuid": "a3a36546-85f6-40a0-84d8-54228f5255e3",
          "name": "KETOROLAC",
          "stdName": "KETOROLAC",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b071542-485e-4a80-ae9f-35cd86eecb9e",
            "20543076-55a9-42ab-bd20-c3d96c21cde2",
            "ae873fd0-69ec-42e4-a7a7-2ffe3732dabd",
            "027cafa2-a21c-4aa7-b367-1195f902519b",
            "6171f45f-c75c-49ca-a866-cf040f764d56",
            "8bf8a972-a765-414b-b337-7e8843f0d35d",
            "4d948928-9278-4f43-b2bd-af4692a097ed",
            "8415fc92-ea8a-4172-8e9a-e85c9a48bd5f",
            "4c22b8da-149d-48ef-b40d-85e64718517a"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "f77daa35-8e02-4f75-89b7-4d2ab4a9e6f8",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "c92d30d3-104b-49d0-aa6b-e08fc34ab0cc",
          "name": "KETOROLAC [MI]",
          "stdName": "KETOROLAC [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "027cafa2-a21c-4aa7-b367-1195f902519b"
          ],
          "display_name": false
        },
        {
          "uuid": "6234c398-0942-4385-8d08-fbf4a7b90f8a",
          "name": "KETOROLAC [VANDF]",
          "stdName": "KETOROLAC [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20543076-55a9-42ab-bd20-c3d96c21cde2"
          ],
          "display_name": false
        },
        {
          "uuid": "b7afc3af-c04d-d71c-fbda-a1bc5d0d9eda",
          "name": "Ketorolac [WHO-DD]",
          "stdName": "KETOROLAC [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b9c633f-78b7-1aef-872f-46c42bd49ea3"
          ],
          "display_name": false
        },
        {
          "uuid": "b4413a87-a99d-431d-b43a-a83a2ad6d6ce",
          "name": "ketorolac [INN]",
          "stdName": "KETOROLAC [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae873fd0-69ec-42e4-a7a7-2ffe3732dabd",
            "9d4cc81e-da53-437a-90ce-7478cf79ebe6"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3b071542-485e-4a80-ae9f-35cd86eecb9e",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9de7dee0-4981-403c-a633-8d705520895c",
          "citation": "USAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae873fd0-69ec-42e4-a7a7-2ffe3732dabd",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "027cafa2-a21c-4aa7-b367-1195f902519b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8bf8a972-a765-414b-b337-7e8843f0d35d",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20543076-55a9-42ab-bd20-c3d96c21cde2",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8cd1547-6726-4856-82da-724fb6b4f3c6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389728000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cef82a79-f137-4ee2-a255-4b022029c87b",
          "citation": "JOURNAL OF CHROMATOGRAPHY B: BIOMEDICAL SCIENCES AND APPLICATIONS, VOLUME 534, 1990, PAGES 241?246",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e04b527b-1aec-4b40-baa2-d1efd85c7711",
          "citation": "SRS import [YZI5105V0L]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YZI5105V0L",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389728000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6171f45f-c75c-49ca-a866-cf040f764d56",
          "citation": "KETOROLAC [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4d948928-9278-4f43-b2bd-af4692a097ed",
          "citation": "KETOROLAC [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4c22b8da-149d-48ef-b40d-85e64718517a",
          "citation": "KETOROLAC [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8415fc92-ea8a-4172-8e9a-e85c9a48bd5f",
          "citation": "KETOROLAC [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c0a2b670-e9e4-776e-c78b-27f6a25d7d6b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=74103-06-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3eac191e-09f5-e87b-b73a-7dd6c4ec1021",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+74103-06-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "183b8f61-83d7-dadd-24de-991f703c038c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e50f16ac-db2b-44ca-8b85-33f69c55f0f5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9d4cc81e-da53-437a-90ce-7478cf79ebe6",
          "citation": "INN Proposed List 51",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL51.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a9cbab92-9df5-4281-a0a3-d4882fd42137",
          "citation": "Pharm Res 1989;6(1):62",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1b9c633f-78b7-1aef-872f-46c42bd49ea3",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d8a97ec0-74af-2d4d-b877-78e15147a9eb",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "33f9f924-724a-7e5a-6854-71587cc6ac1e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0927bc75-ac9c-46ec-82c1-12731c7191cf",
          "id": "0927bc75-ac9c-46ec-82c1-12731c7191cf",
          "molfile": "\n  Marvin  01132100442D          \n\n 19 21  0  0  0  0            999 V2000\n    1.3279   -2.4708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5913   -2.8736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5913   -3.7008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1306   -2.4708    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -0.2177   -1.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0341   -1.4731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4477   -2.1987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8926   -2.7793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3062   -3.5158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0899   -3.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1770   -2.5144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8990   -2.1153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8990   -1.2881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6246   -2.5144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6246   -3.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3430   -3.7589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0505   -3.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0505   -2.5289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3430   -2.1262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  8  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n 11  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 19 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C(=O)c2ccc3C(CCn32)C(=O)O",
          "formula": "C15H13NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cb276b14-a337-4708-a8b9-106545b7d39b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "255.2692",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "19e15722-eee4-4b20-b063-90232eb00eb1",
      "version": "24",
      "structure": {
        "id": "7724975c-d235-414b-ab13-c927a55064db",
        "molfile": "\n  Marvin  01132106112D          \n\n 19 21  0  0  0  0            999 V2000\n   -1.4477   -2.1987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8926   -2.7793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1770   -2.5144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1306   -2.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3062   -3.5158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0899   -3.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8990   -2.1153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5913   -2.8736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0341   -1.4731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2177   -1.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8990   -1.2881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6246   -2.5144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3279   -2.4708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5913   -3.7008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3430   -2.1262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6246   -3.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3430   -3.7589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0505   -2.5289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0505   -3.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  2  2  0  0  0  0\n  6  3  2  0  0  0  0\n  7  3  1  0  0  0  0\n  4  8  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  7  2  0  0  0  0\n 12  7  1  0  0  0  0\n 13  8  2  0  0  0  0\n 14  8  1  0  0  0  0\n 15 12  2  0  0  0  0\n 16 12  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 15  1  0  0  0  0\n 19 17  1  0  0  0  0\n 10  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n 19 18  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)C(=O)c2ccc3C(CCn32)C(=O)O",
        "formula": "C15H13NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "255.2692",
        "optical_activity": "( + / - )",
        "references": [
          "e04b527b-1aec-4b40-baa2-d1efd85c7711",
          "3b071542-485e-4a80-ae9f-35cd86eecb9e",
          "9d4cc81e-da53-437a-90ce-7478cf79ebe6"
        ],
        "stereo_centers": 1
      },
      "unii": "YZI5105V0L"
    }
  ]
}