{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "9514c5a7-1c84-48f6-8650-987794475bbc", "code": "m5273", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m5273?q=authorize", "code_system": "MERCK INDEX", "references": [ "a0a147f1-857e-438f-8218-7e706704eac9" ] }, { "uuid": "c2429361-7a15-4fd3-9400-e98b0a456963", "code": "DB01482", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB01482", "code_system": "DRUG BANK", "references": [ "a0a147f1-857e-438f-8218-7e706704eac9" ] }, { "uuid": "e564e6ea-6bd9-4081-a7e4-f6a1f57f8e6d", "code": "SUB07560MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "a0a147f1-857e-438f-8218-7e706704eac9" ] }, { "uuid": "e927f14f-805e-404a-9fb7-c69548cd60b4", "code": "CHEMBL2111152", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2111152", "code_system": "ChEMBL", "references": [ "a0a147f1-857e-438f-8218-7e706704eac9" ] }, { "uuid": "e0250e09-390c-41c4-b1b5-2b1ce4c48f9f", "code": "19527", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/19527", "code_system": "PUBCHEM", "references": [ "a0a147f1-857e-438f-8218-7e706704eac9" ] }, { "uuid": "81e3b098-907c-4cfd-b505-b6a5e9a7d17f", "code": "N06BA10", "comments": "ATC|NERVOUS SYSTEM|PSYCHOANALEPTICS|PSYCHOSTIMULANTS, AGENTS USED FOR ADHD AND NOOTROPICS|Centrally acting sympathomimetics|fenetylline", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=N06BA10&showdescription=yes", "code_system": "WHO-ATC", "references": [ "a0a147f1-857e-438f-8218-7e706704eac9" ] }, { "uuid": "c5d1965e-76bb-4fd7-8dab-d7daadf7e30e", "code": "QN06BA10", "comments": "VATC|PSYCHOANALEPTICS|PSYCHOSTIMULANTS, AGENTS USED FOR ADHD AND NOOTROPICS|Centrally acting sympathomimetics|fenetylline", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN06BA10&showdescription=yes", "code_system": "WHO-VATC", "references": [ "a0a147f1-857e-438f-8218-7e706704eac9" ] }, { "uuid": "1d905345-0dcf-43c8-9c98-2887115493e1", "code": "3736-08-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=3736-08-1", "code_system": "CAS", "references": [ "a0a147f1-857e-438f-8218-7e706704eac9", "46c9e078-4dd0-4fa6-afa9-d1d3b62db7f9" ] }, { "uuid": "3695d2e1-fd09-475f-9fdf-d53a5c507c80", "code": "C004518", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67004518", "code_system": "MESH", "references": [ "a0a147f1-857e-438f-8218-7e706704eac9" ] }, { "uuid": "f280a13f-4b65-48ef-88bc-adc1d20aa02d", "code": "FENETHYLLINE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Fenethylline", "code_system": "WIKIPEDIA", "references": [ "a0a147f1-857e-438f-8218-7e706704eac9" ] }, { "uuid": "6a1d07b4-3499-4b44-85d4-02e9ce9222a9", "code": "1554", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1554", "code_system": "INN", "references": [ "a0a147f1-857e-438f-8218-7e706704eac9" ] }, { "uuid": "3c3e5bde-2af4-4555-a3f9-5d73dfa8fc3d", "code": "1503", "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I.|Stimulants", "type": "PRIMARY", "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111", "code_system": "DEA NO.", "references": [ "a0a147f1-857e-438f-8218-7e706704eac9" ] }, { "uuid": "a487476c-87c0-4057-b5a4-9fd5a2f1bc48", "code": "C81051", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81051", "code_system": "NCI_THESAURUS", "references": [ "a0a147f1-857e-438f-8218-7e706704eac9" ] }, { "uuid": "5a5ef648-80e9-4dc3-87bf-f29a932b8f23", "code": "24840", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/24840/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "a0a147f1-857e-438f-8218-7e706704eac9" ] }, { "uuid": "209a2b6e-4003-449d-f163-b9b9d8381501", "code": "8315", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/8315", "code_system": "HSDB", "references": [ "2a21387a-c63a-8128-f992-470457516fdb" ] }, { "uuid": "a83070c0-f92b-a6b2-0134-79de208b7254", "code": "C47795", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|CNS Stimulant", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47795", "code_system": "NCI_THESAURUS", "references": [ "cab1d8a0-2942-9178-fad6-f29a58548964" ] }, { "uuid": "5ce2844e-9b85-46af-a944-6abaea3a2c80", "code": "YZ0N7VL5R3", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "fcc8b920-9d47-e4af-7161-7374b8e1c846", "code": "1149", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/1149", "code_system": "DRUG CENTRAL", "references": [ "cab1d8a0-2942-9178-fad6-f29a58548964" ] }, { "uuid": "b013b581-2641-7594-e603-cdcbc0fff3e7", "code": "DTXSID50859686", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50859686", "code_system": "EPA CompTox", "references": [ "172a562c-60c2-0291-c79c-1571a3ddaa56" ] }, { "uuid": "eb174567-aa25-19f8-165c-48d10ac2264f", "code": "100000081273", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "3d45444a-dc6a-afaf-8b91-add20a07dab4" ] } ], "substance_class": "chemical", "references": [ { "uuid": "021f7a08-f996-4256-96fb-07bdc2d32ce5", "citation": "USP DICTIONARY 2008", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "f0961747-6712-4023-b838-10c544fa096e", "citation": "INN Proposed List 16", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL16.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "fea2a69d-7593-492e-bd98-f5bed2a34119", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5466d8c5-a8c6-4294-944d-4d9ec7551fd1", "citation": "KEGG 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dd04508e-ff40-4b4a-8e02-0a60a71634e1", "citation": "D07944", "doc_type": "KEGG", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "aca38255-b160-42f3-8bb6-bb6421a77e11", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bc2324aa-78f7-40b1-bdad-d20abdf07c4b", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a0a147f1-857e-438f-8218-7e706704eac9", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389672000, "tags": [ "NOMEN" ] }, { "uuid": "22b765ac-41d3-4a34-a2cb-a05a63da1304", "citation": "SRS import [YZ0N7VL5R3]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YZ0N7VL5R3", "doc_type": "SRS", "public_domain": true, "document_date": 1493389672000, "tags": [ "NOMEN" ] }, { "uuid": "dc2ea169-121c-4e1f-8024-d23557501a60", "citation": "FENETYLLINE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "87e41c27-3e22-469a-baff-17b6e1d8126a", "citation": "FENETHYLLINE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "460783a1-e282-467e-a241-7338bdb6764b", "citation": "FENETYLLINE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2a21387a-c63a-8128-f992-470457516fdb", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+3736-08-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "cab1d8a0-2942-9178-fad6-f29a58548964", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "46c9e078-4dd0-4fa6-afa9-d1d3b62db7f9", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "31c126cd-f87a-49ca-913c-568976cd057a", "citation": "Katselou, Maria, et al. \"Fenethylline (captagon) abuse–local problems from an old drug become universal.\" Basic & clinical pharmacology & toxicology 119.2 (2016): 133-140.", "url": "https://onlinelibrary.wiley.com/doi/full/10.1111/bcpt.12584", "doc_type": "JA", "public_domain": true }, { "uuid": "47d727b0-c1cd-a1d6-945a-282e41ec2862", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "172a562c-60c2-0291-c79c-1571a3ddaa56", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "3d45444a-dc6a-afaf-8b91-add20a07dab4", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "5952b2cb-38b6-4f1b-b0d0-9169aff23cb2", "citation": "Yoshimura, H., et al. \"Metabolic fate of fenetylline in rat and man.\" Xenobiotica 18.8 (1988): 929-940.", "url": "https://www.tandfonline.com/doi/pdf/10.3109/00498258809167516", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c28efe23-8919-43ac-9503-853e951f7cdf", "id": "c28efe23-8919-43ac-9503-853e951f7cdf", "molfile": "\n Marvin 01132110032D \n\n 25 27 0 0 0 0 999 V2000\n 2.3536 -11.3760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8039 -10.7695 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.0440 -9.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8646 -9.8120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4092 -10.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2195 -10.2611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4750 -9.4714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9202 -8.8494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1201 -9.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9936 -10.9475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7433 -11.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0465 -11.9024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3019 -12.6689 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1781 -13.3399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3019 -13.9928 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0968 -13.7502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8039 -14.1632 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8039 -14.9916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5343 -13.7502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2414 -14.1632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5343 -12.9167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2414 -12.5141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8039 -12.5141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8039 -11.7089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0968 -12.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 10 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 9 4 2 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 13 25 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 25 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 19 17 1 0 0 0 0\n 20 19 2 0 0 0 0\n 21 19 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 21 1 0 0 0 0\n 24 23 2 0 0 0 0\n 23 25 1 0 0 0 0\nM END", "smiles": "CC(Cc1ccccc1)NCCn2cnc3c2c(=O)n(C)c(=O)n3C", "formula": "C18H23N5O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "7d74b96c-d67f-437a-a641-6cbb8080bb1c" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "341.4082", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "49309316-7f59-4b34-9613-303bc808385b", "version": "18", "structure": { "id": "90656b9c-0c85-4066-abf5-f7fcdec23faf", "molfile": "\n Marvin 01132107292D \n\n 25 27 0 0 0 0 999 V2000\n -1.0968 -13.7502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0968 -12.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8039 -14.1632 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5343 -12.9167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5343 -13.7502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8039 -12.5141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3019 -13.9928 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3019 -12.6689 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1781 -13.3399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2414 -14.1632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8039 -11.7089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8039 -14.9916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2414 -12.5141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9936 -10.9475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0465 -11.9024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0440 -9.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8646 -9.8120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7433 -11.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8039 -10.7695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1201 -9.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4092 -10.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3536 -11.3760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2195 -10.2611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9202 -8.8494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4750 -9.4714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 1 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 3 1 0 0 0 0\n 6 2 1 0 0 0 0\n 7 1 1 0 0 0 0\n 8 2 1 0 0 0 0\n 9 7 2 0 0 0 0\n 10 5 2 0 0 0 0\n 11 6 2 0 0 0 0\n 12 3 1 0 0 0 0\n 13 4 1 0 0 0 0\n 14 18 1 0 0 0 0\n 15 8 1 0 0 0 0\n 16 19 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 15 1 0 0 0 0\n 19 14 1 0 0 0 0\n 20 17 2 0 0 0 0\n 21 17 1 0 0 0 0\n 19 22 1 0 0 0 0\n 23 21 2 0 0 0 0\n 24 20 1 0 0 0 0\n 25 23 1 0 0 0 0\n 9 8 1 0 0 0 0\n 6 4 1 0 0 0 0\n 25 24 2 0 0 0 0\nM END", "smiles": "CC(Cc1ccccc1)NCCn2cnc3c2c(=O)n(C)c(=O)n3C", "formula": "C18H23N5O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "341.4082", "optical_activity": "( + / - )", "references": [ "021f7a08-f996-4256-96fb-07bdc2d32ce5", "22b765ac-41d3-4a34-a2cb-a05a63da1304", "f0961747-6712-4023-b838-10c544fa096e" ], "stereo_centers": 1 }, "unii": "YZ0N7VL5R3", "relationships": [ { "uuid": "7ac9f623-a709-4043-a95b-7e696ad23d53", "amount": { "uuid": "4f4de158-63eb-4202-8fe4-6a72659d3dcc" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "5fbdd1cb-d030-4433-abb8-4059029ec935", "refuuid": "49309316-7f59-4b34-9613-303bc808385b", "name": "FENETHYLLINE", "unii": "YZ0N7VL5R3", "linking_id": "YZ0N7VL5R3", "ref_pname": "FENETHYLLINE", "substance_class": "reference" } }, { "uuid": "f6327359-6bbc-4790-af98-c42989878b70", "amount": { "uuid": "b4333269-2005-4e28-958b-7af85dcbaa44" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "eff5e2ce-9792-4877-8081-f9c24ffbcd29", "refuuid": "a9d2b39a-74f8-4b7c-af04-4bf44772d424", "name": "FENETHYLLINE HYDROCHLORIDE", "unii": "YA7K8ADZ2V", "linking_id": "YA7K8ADZ2V", "ref_pname": "FENETHYLLINE HYDROCHLORIDE", "substance_class": "reference" } }, { "uuid": "10326fe8-6b82-40eb-a49c-39078b263066", "amount": { "uuid": "fc93e48b-e0e4-4926-ae4b-a2f8ec902d4c", "type": "MOLE PERCENT OF AMOUNT ADMINISTERED", "high": 33.2, "low": 23 }, "qualification": "URINE", "type": "METABOLITE ACTIVE->PARENT", "interaction_type": "MAJOR", "references": [ "5952b2cb-38b6-4f1b-b0d0-9169aff23cb2" ], "related_substance": { "uuid": "35aa8dac-c11e-4b57-a1ef-e56602ced8a9", "refuuid": "d18472dd-4bc9-4255-ab23-0625d8640252", "name": "AMPHETAMINE", "unii": "CK833KGX7E", "linking_id": "CK833KGX7E", "ref_pname": "AMPHETAMINE", "substance_class": "reference" } }, { "uuid": "27e90f1e-8b2f-40e2-bc96-da8efb8b4d9b", "amount": { "uuid": "483f2cb0-222a-4c91-b998-fe5ecaaec553", "type": "MOLE PERCENT OF AMOUNT ADMINISTERED", "high": 11.6, "low": 8.3, "units": "%" }, "qualification": "URINE", "type": "METABOLITE->PARENT", "references": [ "5952b2cb-38b6-4f1b-b0d0-9169aff23cb2" ], "related_substance": { "uuid": "93c8d2e1-a28b-4289-a6ed-6f1d3d50b902", "refuuid": "e7aa9fb7-cac8-4ec6-a317-119a5b912762", "name": "7-(2-Aminoethyl)theophylline", "unii": "A8WQD8A7TZ", "linking_id": "A8WQD8A7TZ", "ref_pname": "7-(2-Aminoethyl)theophylline", "substance_class": "reference" } }, { "uuid": "a6558f39-79eb-4699-9204-7240f2203ced", "amount": { "uuid": "6de3382c-dc41-4899-897f-31eafa57ff28", "high": 3, "low": 2.7 }, "qualification": "URINE", "type": "METABOLITE->PARENT", "references": [ "5952b2cb-38b6-4f1b-b0d0-9169aff23cb2" ], "related_substance": { "uuid": "60512d7f-ece8-42fe-8960-53b1e1060fec", "refuuid": "fce39fdb-4a57-49b2-a561-e0a6a7142487", "name": "7-[2-(N-Acetylamino)ethyl]theophylline", "unii": "V96P8QW3XT", "linking_id": "V96P8QW3XT", "ref_pname": "7-[2-(N-Acetylamino)ethyl]theophylline", "substance_class": "reference" } }, { "uuid": "4f55416a-8d36-4ef2-8290-c40fbcb9a59a", "amount": { "uuid": "41ebb971-51f3-445b-8057-e774152f5033", "type": "MOLE PERCENT OF AMOUNT ADMINISTERED", "high": 2.1, "low": 1.2, "units": "%" }, "qualification": "URINE", "type": "METABOLITE ACTIVE->PARENT", "interaction_type": "MINOR", "related_substance": { "uuid": "d8104275-17df-45f1-b08f-8ca063ce428f", "refuuid": "400b8c40-bb1b-4d40-95bb-da9719267627", "name": "ETOFYLLINE", "unii": "L164909TBI", "linking_id": "L164909TBI", "ref_pname": "ETOFYLLINE", "substance_class": "reference" } } ], "names": [ { "uuid": "c443171e-7812-4b31-aaca-ab4b151e3f41", "name": "1,3-DIMETHYL-7-(2-(1-METHYL-2-PHENYLETHYLAMINO)ETHYL)XANTHINE", "stdName": "1,3-DIMETHYL-7-(2-(1-METHYL-2-PHENYLETHYLAMINO)ETHYL)XANTHINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bc2324aa-78f7-40b1-bdad-d20abdf07c4b" ], "display_name": false }, { "uuid": "0a313d19-caa5-43dc-bbd0-e9999df5514a", "name": "1H-PURINE-2,6-DIONE, 3,7-DIHYDRO-1,3-DIMETHYL-7-(2-((1-METHYL-2-PHENYLETHYL)AMINO)ETHYL)-", "stdName": "1H-PURINE-2,6-DIONE, 3,7-DIHYDRO-1,3-DIMETHYL-7-(2-((1-METHYL-2-PHENYLETHYL)AMINO)ETHYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "021f7a08-f996-4256-96fb-07bdc2d32ce5" ], "display_name": false }, { "uuid": "51b80b32-91df-49b1-b79a-83454255f85a", "name": "3,7-DIHYDRO-1,3-DIMETHYL-7-(2-((1-METHYL-2-PHENYLETHYL)AMINO)ETHYL)-1H-PURINE-2,6-DIONE", "stdName": "3,7-DIHYDRO-1,3-DIMETHYL-7-(2-((1-METHYL-2-PHENYLETHYL)AMINO)ETHYL)-1H-PURINE-2,6-DIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bc2324aa-78f7-40b1-bdad-d20abdf07c4b" ], "display_name": false }, { "uuid": "53cd98ff-8bad-4704-99eb-202919ba112a", "name": "7-(2-((.ALPHA.-METHYLPHENETHYL)AMINO)ETHYL)THEOPHYLLINE", "stdName": "7-(2-((.ALPHA.-METHYLPHENETHYL)AMINO)ETHYL)THEOPHYLLINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "021f7a08-f996-4256-96fb-07bdc2d32ce5" ], "display_name": false }, { "uuid": "7c476488-0708-4df1-a7d7-7073fba803af", "name": "AMFETYLINE", "stdName": "AMFETYLINE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "bc2324aa-78f7-40b1-bdad-d20abdf07c4b" ], "display_name": false }, { "uuid": "7606fc1e-dfed-4624-9ece-4ac458337147", "name": "AMPHETAMINOETHYLTHEOPHYLLINE", "stdName": "AMPHETAMINOETHYLTHEOPHYLLINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bc2324aa-78f7-40b1-bdad-d20abdf07c4b" ], "display_name": false }, { "uuid": "7103051e-4207-40da-8494-751116714d5a", "name": "BZT", "stdName": "BZT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bc2324aa-78f7-40b1-bdad-d20abdf07c4b" ], "display_name": false }, { "uuid": "d93dc7bd-64a0-4045-9cab-a47d3559d90d", "name": "Captagon", "stdName": "CAPTAGON", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "bc2324aa-78f7-40b1-bdad-d20abdf07c4b" ], "display_name": false }, { "uuid": "6b15d851-91d9-459c-ab8f-b26d0ad25a2e", "name": "FENETHYLLINE", "stdName": "FENETHYLLINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "021f7a08-f996-4256-96fb-07bdc2d32ce5", "fea2a69d-7593-492e-bd98-f5bed2a34119", "87e41c27-3e22-469a-baff-17b6e1d8126a" ], "display_name": true }, { "uuid": "521a89b7-49b1-487b-869e-fe1d12a6860a", "name": "FENETHYLLINE [MI]", "stdName": "FENETHYLLINE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fea2a69d-7593-492e-bd98-f5bed2a34119" ], "display_name": false }, { "uuid": "73e4cb84-e427-4369-85db-69f1b3987794", "name": "FENETYLLINE", "stdName": "FENETYLLINE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "460783a1-e282-467e-a241-7338bdb6764b", "021f7a08-f996-4256-96fb-07bdc2d32ce5", "dc2ea169-121c-4e1f-8024-d23557501a60", "f0961747-6712-4023-b838-10c544fa096e", "aca38255-b160-42f3-8bb6-bb6421a77e11" ], "display_name": false, "domains": [ "drug" ], "name_orgs": [ { "uuid": "d8386b8e-0e69-494d-984a-6ea9e2854685", "name_org": "INN" } ] }, { "uuid": "327053c9-2d63-442e-b40c-97d2f777ff67", "name": "FITTON", "stdName": "FITTON", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "5466d8c5-a8c6-4294-944d-4d9ec7551fd1", "dd04508e-ff40-4b4a-8e02-0a60a71634e1" ], "display_name": false }, { "uuid": "184497cf-301f-44dd-a9a3-c251f191edeb", "name": "Fenetylline [WHO-DD]", "stdName": "FENETYLLINE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "47d727b0-c1cd-a1d6-945a-282e41ec2862" ], "display_name": false }, { "uuid": "51149443-ceed-4f50-beb1-6a6662ad199e", "name": "HOMBURG-814", "stdName": "HOMBURG-814", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "bc2324aa-78f7-40b1-bdad-d20abdf07c4b" ], "display_name": false }, { "uuid": "e831c8c0-ba2c-488e-a8d5-5e0704512282", "name": "PHENETHYLLINE", "stdName": "PHENETHYLLINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bc2324aa-78f7-40b1-bdad-d20abdf07c4b" ], "display_name": false }, { "uuid": "af4c3dee-32d6-48cb-8ad8-6d7ff468fc7e", "name": "THEOPHYLLINE, 7-(2-((.ALPHA.-METHYLPHENETHYL)AMINO)ETHYL)-", "stdName": "THEOPHYLLINE, 7-(2-((.ALPHA.-METHYLPHENETHYL)AMINO)ETHYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bc2324aa-78f7-40b1-bdad-d20abdf07c4b" ], "display_name": false }, { "uuid": "21709d98-b74d-4b78-b2ee-b7ecdf8f0a0a", "name": "THEOPHYLLINEETHYLAMPHETAMINE", "stdName": "THEOPHYLLINEETHYLAMPHETAMINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bc2324aa-78f7-40b1-bdad-d20abdf07c4b" ], "display_name": false }, { "uuid": "b6d49f26-a1de-4c14-9f76-ecb685533b35", "name": "fenetylline [INN]", "stdName": "FENETYLLINE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f0961747-6712-4023-b838-10c544fa096e" ], "display_name": false } ], "modifications": { "uuid": "f08be1c1-1fca-41bc-a372-335a892feaf2" } } ] }