{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "0d7bc1e3-6c6e-4eaf-87bc-73838357b495", "code": "C1518", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1518", "code_system": "NCI_THESAURUS", "references": [ "93184432-fae8-49d7-a4e8-58cd7b9fb067" ] }, { "uuid": "b8813928-048f-47b8-beef-8339e55b774e", "code": "NBK548475", "comments": "LiverTox|Endocrine|Osteoporosis|Selective Estrogen Receptor Modulators", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/NBK548475/", "code_system": "LIVERTOX", "references": [ "93184432-fae8-49d7-a4e8-58cd7b9fb067" ] }, { "uuid": "6daab754-cca6-4b3c-9bb7-31d1378ebe41", "code": "RALOXIFENE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Raloxifene", "code_system": "WIKIPEDIA", "references": [ "93184432-fae8-49d7-a4e8-58cd7b9fb067" ] }, { "uuid": "04679e4f-bffc-45e6-81d9-33c18e4a1d4f", "code": "D020849", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68020849", "code_system": "MESH", "references": [ "93184432-fae8-49d7-a4e8-58cd7b9fb067" ] }, { "uuid": "b640873f-624e-48e2-9376-76763af7d660", "code": "5388", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5388", "code_system": "INN", "references": [ "93184432-fae8-49d7-a4e8-58cd7b9fb067" ] }, { "uuid": "f2586ef1-a8f9-427d-bf71-77b798da9ac0", "code": "2820", "type": "PRIMARY", "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=2820", "code_system": "IUPHAR", "references": [ "93184432-fae8-49d7-a4e8-58cd7b9fb067" ] }, { "uuid": "6396f6a8-05d4-41a8-bc22-35885f394859", "code": "72143", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/72143/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "93184432-fae8-49d7-a4e8-58cd7b9fb067" ] }, { "uuid": "4cbf9be7-9946-4055-a0b4-b9d79b1d115f", "code": "m9485", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m9485?q=authorize", "code_system": "MERCK INDEX", "references": [ "93184432-fae8-49d7-a4e8-58cd7b9fb067" ] }, { "uuid": "ed6a64e1-2946-4bd6-b27f-2c95169f1e28", "code": "DB00481", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB00481", "code_system": "DRUG BANK", "references": [ "93184432-fae8-49d7-a4e8-58cd7b9fb067" ] }, { "uuid": "fadf88a2-9ab5-449a-abde-335d57d515e2", "code": "SUB10243MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "93184432-fae8-49d7-a4e8-58cd7b9fb067" ] }, { "uuid": "73afa70d-e2c5-4395-a993-754f87320162", "code": "CHEMBL81", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL81", "code_system": "ChEMBL", "references": [ "93184432-fae8-49d7-a4e8-58cd7b9fb067" ] }, { "uuid": "28aa826a-c9b3-4c40-bd80-540861699061", "code": "5035", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5035", "code_system": "PUBCHEM", "references": [ "93184432-fae8-49d7-a4e8-58cd7b9fb067" ] }, { "uuid": "3957009c-c662-4618-91ab-98e450e3d677", "code": "G03XC01", "comments": "ATC|GENITO URINARY SYSTEM AND SEX HORMONES|SEX HORMONES AND MODULATORS OF THE GENITAL SYSTEM|OTHER SEX HORMONES AND MODULATORS OF THE GENITAL SYSTEM|Selective estrogen receptor modulators|raloxifene", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=G03XC01&showdescription=yes", "code_system": "WHO-ATC", "references": [ "93184432-fae8-49d7-a4e8-58cd7b9fb067" ] }, { "uuid": "07a4e675-69c4-48e1-9222-c156646929bb", "code": "N0000175826", "comments": "Established Pharmacologic Class [EPC]|Estrogen Agonist/Antagonist [EPC]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175826", "code_system": "NDF-RT", "references": [ "93184432-fae8-49d7-a4e8-58cd7b9fb067" ] }, { "uuid": "586a94de-73e9-49d0-820b-1cee1f1da3e5", "code": "N0000000168", "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|Transcription Factor Activity [MoA]|Hormone Receptor Interactions [MoA]|Hormone Receptor Modulators [MoA]|Steroid Receptor Modulators [MoA]|Selective Estrogen Receptor Modulators [MoA]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000168", "code_system": "NDF-RT", "references": [ "93184432-fae8-49d7-a4e8-58cd7b9fb067" ] }, { "uuid": "a09fac91-503c-4520-a1b8-8698f2fa528c", "code": "QG03XC01", "comments": "VATC|SEX HORMONES AND MODULATORS OF THE GENITAL SYSTEM|OTHER SEX HORMONES AND MODULATORS OF THE GENITAL SYSTEM|Selective estrogen receptor modulators|raloxifene", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QG03XC01&showdescription=yes", "code_system": "WHO-VATC", "references": [ "93184432-fae8-49d7-a4e8-58cd7b9fb067" ] }, { "uuid": "0d2e6a6c-cf9d-4c57-9553-e49a26efede1", "code": "84449-90-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=84449-90-1", "code_system": "CAS", "references": [ "93184432-fae8-49d7-a4e8-58cd7b9fb067", "761e4fb3-9769-405c-87a7-559593fa3e66" ] }, { "uuid": "26c95d77-ebb6-07f8-8420-205119333371", "code": "DTXSID3023550", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3023550", "code_system": "EPA CompTox", "references": [ "8d274121-9bcb-d918-5dc3-c66fe5b964ce" ] }, { "uuid": "a7ed7ec1-7b8f-5300-4fdb-bc7903816d01", "code": "7460", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7460", "code_system": "HSDB", "references": [ "fd719ce3-aae8-369a-5fcc-a313f8d8d572" ] }, { "uuid": "94bfc2b9-cda6-f4ee-be40-cd6a1fb7784a", "code": "197504", "comments": "ORPHAN DRUG|Designated/Approved|Reduction of the risk of breast cancer in postmenopausal women", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=197504", "code_system": "FDA ORPHAN DRUG" }, { "uuid": "7ef85f59-e697-213c-1261-88871d39ccb3", "code": "C1821", "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Antineoplastic Hormonal/Endocrine Agent[C129818]|Antiestrogen[C481]|Selective Estrogen Receptor Modulator", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1821", "code_system": "NCI_THESAURUS", "references": [ "5fcf01b8-b1ed-7288-282d-a7fb2dabbf63" ] }, { "uuid": "64067736-14b5-47de-b7dc-f249fd30bfe9", "code": "YX9162EO3I", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "4e0927b9-b1b2-49e3-bfce-c28e048b5f34", "code": "NBK548475", "comments": "LiverTox|Antineoplastic Agents|Hormonal Agents|Antiestrogens|Selective Estrogen Receptor Modulators", "type": "ALTERNATIVE", "code_system": "LIVERTOX" }, { "uuid": "e82cc9aa-ca79-da60-78ab-2518fde1792c", "code": "2351", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/2351", "code_system": "DRUG CENTRAL", "references": [ "5fcf01b8-b1ed-7288-282d-a7fb2dabbf63" ] }, { "uuid": "2886a775-3976-1101-0faa-4feca5b34554", "code": "8772", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:8772", "code_system": "CHEBI", "references": [ "5fcf01b8-b1ed-7288-282d-a7fb2dabbf63" ] }, { "uuid": "b73a4b58-a8e0-318a-c09f-902dfd992b97", "code": "YX9162EO3I", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=YX9162EO3I", "code_system": "DAILYMED", "references": [ "cf4a4c72-2326-8dc4-1666-9c4b4f2ec36b" ] }, { "uuid": "0b21a865-1f30-d92b-2e3f-60805fc9667f", "code": "747974", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=747974", "code_system": "NSC", "references": [ "e4b63faa-d0e8-b6c6-2149-aad74a3112f1" ] }, { "uuid": "3e8e2146-2b4b-0826-2527-49c781c28ece", "code": "100000089181", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "4f9da3e8-bc39-8d58-f5aa-e4c77a461d49" ] } ], "substance_class": "chemical", "references": [ { "uuid": "586c8870-e27b-44b4-8eea-f2548e1d30e3", "citation": "USP Dictionary", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "9c0fdf8a-3e56-4380-b6f1-e67d9aba59ee", "citation": "ACD 9.0(USAN 2006)", "doc_type": "ACD", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "78b12388-ca9e-4907-9487-9a901f733d30", "citation": "INN Proposed List 54", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL54.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4ee35480-bdaf-4971-813a-8779231b4acb", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3290da6d-516e-43a6-9973-6a15dc5e1919", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "250203ab-b407-425c-97a6-954f97564582", "citation": "KEGG 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "56fdfbb4-abdc-46c6-bd82-2a55df4a0132", "citation": "D08465", "doc_type": "KEGG", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "70253698-a1dd-4382-bcfe-5c43e3ab79d3", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1a6407a5-42b3-493b-8753-158687570ac0", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ac682da3-fcca-47fa-abe8-691b3aa0710e", "citation": "NDF-RT", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f367bf13-0020-4422-84bf-a0f36a0d4c15", "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J22.982B", "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J22.982B", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f11fbf92-a5a4-4df0-816a-351fe0723bda", "citation": "http://archderm.jamanetwork.com/article.aspx?articleid=422021", "url": "http://archderm.jamanetwork.com/article.aspx?articleid=422021", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "93184432-fae8-49d7-a4e8-58cd7b9fb067", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390007000, "tags": [ "NOMEN" ] }, { "uuid": "df55d6a0-7542-43f7-b347-9ee47bf5ef4f", "citation": "EUROPEAN JOURNAL OF OBSTETRICS & GYNECOLOGY AND REPRODUCTIVE BIOLOGY, VOLUME 85, ISSUE 1, JULY 1999, PAGES 23?29", "doc_type": "JOURNAL ARTICLE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a81040ae-7661-4818-873f-2645f6821194", "citation": "SRS import [YX9162EO3I]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YX9162EO3I", "doc_type": "SRS", "public_domain": true, "document_date": 1493390007000, "tags": [ "NOMEN" ] }, { "uuid": "c787ba99-2af4-4085-bdc6-8b7a36b22512", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "46a8f22f-af4f-48c2-ae92-2e319b973f87", "citation": "RALOXIFENE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "15129675-9cc8-4fa3-8705-3cc4389ef331", "citation": "RALOXIFENE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "7c68d89e-853e-4c1e-a858-6e8570e0999c", "citation": "RALOXIFENE [HSDB]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "3037c95c-3e47-4bad-9811-658f18406b5a", "citation": "RALOXIFENE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "6a27877f-2302-4f2b-80b1-795f75a5ae14", "citation": "RALOXIFENE [VANDF]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "fd719ce3-aae8-369a-5fcc-a313f8d8d572", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+84449-90-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8d274121-9bcb-d918-5dc3-c66fe5b964ce", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=84449-90-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "5fc66ff3-f5f6-eb3d-1fdb-e6129ee0621b", "citation": "Obach, R. S., Huynh, P., Allen, M. C. and Beedham, C. (2004), Human Liver Aldehyde Oxidase: Inhibition by 239 Drugs. The Journal of Clinical Pharmacology, 44: 7–19. doi:10.1177/0091270003260336", "url": "http://onlinelibrary.wiley.com/doi/10.1177/0091270003260336/full", "doc_type": "JA", "public_domain": true }, { "uuid": "1b6fe808-0a90-a631-dc09-219cd8b19b53", "citation": "D. Hochner-Celnikier / European Journal of Obstetrics & Gynecology and Reproductive Biology 85 (1999) 23 –29", "url": "https://ac.els-cdn.com/S0301211598002784/1-s2.0-S0301211598002784-main.pdf?_tid=e758ef6a-1110-11e8-a510-00000aacb35f&acdnat=1518562673_03d321d51657bafa84cdaebcdf1c283a", "doc_type": "JA", "public_domain": true }, { "uuid": "c07be2be-43d0-7607-73ec-28f2e40c969d", "doc_type": "WIKI", "public_domain": true }, { "uuid": "28e704e8-bfe0-f57c-6294-de50771708ed", "citation": "Drug Information Handbook, 2016-2017 - 25th edition; Lexicomp Drug Reference Handbook; ISBN13: 9781591953531", "doc_type": "BOOK", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "5fcf01b8-b1ed-7288-282d-a7fb2dabbf63", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "005975a7-f448-44cf-906e-dbea642d4748", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "761e4fb3-9769-405c-87a7-559593fa3e66", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "56a465ed-3503-4112-93ab-28107e736d3c", "citation": "Du, Yin‐Xiao, and Xiao‐Ping Chen. \"Favipiravir: pharmacokinetics and concerns about clinical trials for 2019‐nCoV infection.\" Clinical Pharmacology & Therapeutics (2020).", "doc_type": "JA", "public_domain": true, "tags": [ "https://ascpt.onlinelibrary.wiley.com/doi/full/10.1002/cpt.1844" ] }, { "uuid": "44f5c342-191c-3412-cc2f-ccb2410c4206", "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2018/020815s034lbl.pdf", "doc_type": "FDA APPROVED DRUG LABEL", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8a180b08-571c-e88c-cfb7-59eb2ba94130", "citation": "Kemp, Daniel C., Peter W. Fan, and Jeffrey C. Stevens. \"Characterization of raloxifene glucuronidation in vitro: contribution of intestinal metabolism to presystemic clearance.\" Drug metabolism and disposition 30.6 (2002): 694-700.", "url": "https://dmd.aspetjournals.org/content/dmd/30/6/694.full.pdf", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e4b63faa-d0e8-b6c6-2149-aad74a3112f1", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "cf4a4c72-2326-8dc4-1666-9c4b4f2ec36b", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "ec8749b4-9d45-c5f2-1ce9-0f32333e4c8b", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "4f9da3e8-bc39-8d58-f5aa-e4c77a461d49", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a14c0774-0eb5-499e-81bd-69b499b742ce", "id": "a14c0774-0eb5-499e-81bd-69b499b742ce", "molfile": "\n Marvin 01132108232D \n\n 34 38 0 0 0 0 999 V2000\n 5.9166 -3.7565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1027 -3.7565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6764 -4.4697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8470 -4.4697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4491 -3.7565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8470 -3.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6764 -3.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6069 -3.7565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1186 -4.3999 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3280 -4.1571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6381 -4.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0749 -4.1571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7879 -4.5704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0749 -3.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6381 -2.9170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3280 -3.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1186 -3.0668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3717 -2.2891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1805 -2.1289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8396 -1.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0721 -0.9095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5424 -0.2816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7389 -0.4624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1809 0.1499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6329 -0.0206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1911 0.6071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9971 0.4289 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5397 1.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3380 0.8655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5964 0.0801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0358 -0.5244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2477 -0.3669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4831 -1.2531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0309 -1.8576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 7 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 2 0 0 0 0\n 5 8 1 0 0 0 0\n 7 6 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 17 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 10 16 2 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 2 0 0 0 0\n 20 18 1 0 0 0 0\n 21 20 1 0 0 0 0\n 34 20 2 0 0 0 0\n 22 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 33 23 2 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 32 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 33 34 1 0 0 0 0\nM END", "smiles": "C1CCN(CC1)CCOc2ccc(cc2)C(=O)c3c4ccc(cc4sc3-c5ccc(cc5)O)O", "formula": "C28H27NO4S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "6a4a27a6-8ae6-4a1a-8159-7b44a0205d4b" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "473.5854", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "6e075469-84e0-46ff-b809-92f68feca9f7", "version": "36", "structure": { "id": "affc96d2-8261-4d7a-a2a4-22068d46695e", "molfile": "\n Marvin 01132109072D \n\n 34 38 0 0 0 0 999 V2000\n 16.3307 -5.3990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8191 -6.0887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3307 -6.7321 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5401 -6.4893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5401 -5.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5839 -4.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6613 -6.0887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8501 -6.9026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8501 -5.2491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0517 -4.0114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2149 -1.9031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3927 -4.4610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0592 -6.8019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0592 -5.3499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2430 -4.1897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2842 -3.2416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1371 -6.4893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1371 -5.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.3150 -6.0887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9510 -2.7944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8887 -6.8019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8887 -5.3499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7545 -2.6136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6951 -3.5852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3930 -2.1821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0209 -1.7249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4241 -6.9026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.1289 -6.0887 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5791 -2.3526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9642 -2.6989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6722 -1.2959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8738 -1.4665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1761 -2.8564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6154 -2.2519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 2 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 1 1 0 0 0 0\n 6 1 1 0 0 0 0\n 7 2 1 0 0 0 0\n 8 4 1 0 0 0 0\n 9 5 1 0 0 0 0\n 10 6 1 0 0 0 0\n 11 26 1 0 0 0 0\n 12 6 2 0 0 0 0\n 13 7 2 0 0 0 0\n 14 7 1 0 0 0 0\n 15 10 2 0 0 0 0\n 16 10 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 9 2 0 0 0 0\n 19 22 1 0 0 0 0\n 20 23 1 0 0 0 0\n 21 13 1 0 0 0 0\n 22 14 2 0 0 0 0\n 23 16 2 0 0 0 0\n 24 15 1 0 0 0 0\n 25 20 1 0 0 0 0\n 26 29 1 0 0 0 0\n 27 17 1 0 0 0 0\n 28 19 1 0 0 0 0\n 29 25 1 0 0 0 0\n 30 11 1 0 0 0 0\n 31 11 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 30 1 0 0 0 0\n 34 33 1 0 0 0 0\n 4 3 1 0 0 0 0\n 24 20 2 0 0 0 0\n 17 8 2 0 0 0 0\n 21 19 2 0 0 0 0\n 32 34 1 0 0 0 0\nM END", "smiles": "C1CCN(CC1)CCOc2ccc(cc2)C(=O)c3c4ccc(cc4sc3-c5ccc(cc5)O)O", "formula": "C28H27NO4S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "473.5854", "optical_activity": "NONE", "references": [ "c787ba99-2af4-4085-bdc6-8b7a36b22512", "a81040ae-7661-4818-873f-2645f6821194", "78b12388-ca9e-4907-9487-9a901f733d30" ], "stereo_centers": 0 }, "unii": "YX9162EO3I", "relationships": [ { "uuid": "1a279177-9abb-4701-8fe6-66aec43cfb9b", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "1920d2e0-53f3-4e16-b6ff-fe44077b99b2", "refuuid": "6e075469-84e0-46ff-b809-92f68feca9f7", "name": "RALOXIFENE", "unii": "YX9162EO3I", "linking_id": "YX9162EO3I", "ref_pname": "RALOXIFENE", "substance_class": "reference" } }, { "uuid": "d5328146-d6a4-4672-b7d9-cbbffbfd7b83", "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "2797229c-6a99-4140-b22c-2e92e2178e33", "refuuid": "6ceda913-12a1-4052-8fd9-b15f72703a82", "name": "RALOXIFENE HYDROCHLORIDE", "unii": "4F86W47BR6", "linking_id": "4F86W47BR6", "ref_pname": "RALOXIFENE HYDROCHLORIDE", "substance_class": "reference" } }, { "uuid": "9aa3afa1-5df9-4145-8b63-fcf92c8aea2f", "qualification": "FECAL; PLASMA; URINE", "type": "METABOLITE->PARENT", "references": [ "df55d6a0-7542-43f7-b347-9ee47bf5ef4f" ], "related_substance": { "uuid": "ac13e523-ca39-4866-a156-69bcb7451e44", "refuuid": "0ffb0295-f684-4060-9251-343886bb4ea5", "name": "RALOXIFENE 6-GLUCURONIDE", "unii": "446O3AY2S7", "linking_id": "446O3AY2S7", "ref_pname": "RALOXIFENE 6-GLUCURONIDE", "substance_class": "reference" } }, { "uuid": "2e99d2ec-e92a-4457-9cb9-ac48e9f0f57f", "qualification": "FECAL; PLASMA; URINE", "type": "METABOLITE->PARENT", "references": [ "df55d6a0-7542-43f7-b347-9ee47bf5ef4f" ], "related_substance": { "uuid": "2c88e1c0-95fb-4524-b985-dfd99b8c03e1", "refuuid": "b18f2b3e-cbef-4196-84cf-972e052d35ff", "name": "RALOXIFENE-6, 4'-DIGLUCURONIDE", "unii": "JDB040T4BJ", "linking_id": "JDB040T4BJ", "ref_pname": "RALOXIFENE-6, 4'-DIGLUCURONIDE", "substance_class": "reference" } }, { "uuid": "050e52b2-1a4a-440d-8ca2-c361fa1ab1f0", "qualification": "FECAL; PLASMA; URINE", "type": "METABOLITE->PARENT", "interaction_type": "MAJOR", "references": [ "df55d6a0-7542-43f7-b347-9ee47bf5ef4f" ], "related_substance": { "uuid": "a408876a-e8a6-45b2-a81f-e43c7ea7b268", "refuuid": "884b8ae6-6a54-4889-8f88-676f7f40c3b9", "name": "RALOXIFENE 4'-GLUCURONIDE", "unii": "UZ95WFT3LZ", "linking_id": "UZ95WFT3LZ", "ref_pname": "RALOXIFENE 4'-GLUCURONIDE", "substance_class": "reference" } }, { "uuid": "cc39fb69-8f00-420d-bb86-57d70bd8364d", "amount": { "uuid": "81152535-ea4b-4082-91d1-7847614ac0e7" }, "type": "SALT/SOLVATE->PARENT", "references": [ "005975a7-f448-44cf-906e-dbea642d4748" ], "related_substance": { "uuid": "699a1ff7-6a0b-4ef3-b91f-7f6992a35426", "refuuid": "2f5d1b39-c154-4b31-b045-0ae1a4f21293", "name": "RALOXIFENE HYDROCHLORIDE MONOHYDRATE", "unii": "T67D4XMG4Q", "linking_id": "T67D4XMG4Q", "ref_pname": "RALOXIFENE HYDROCHLORIDE MONOHYDRATE", "substance_class": "reference" } }, { "uuid": "bf375990-a942-4d97-9620-e2b84a33c3e8", "type": "TARGET->AGONIST", "related_substance": { "uuid": "dd82e3ea-2c77-4218-b4c5-564f82580913", "refuuid": "4673cf81-dd46-4a8d-8696-823ccebce65d", "name": "ESTROGEN RECEPTOR", "unii": "SIDP85PFD6", "linking_id": "SIDP85PFD6", "ref_pname": "ESTROGEN RECEPTOR" } }, { "uuid": "fdcba8db-bab1-4b23-8a44-9a880694879c", "amount": { "uuid": "2b9cabda-39d6-45df-9290-07f3a3d22a1d", "low": 95, "units": "%" }, "comments": "Raloxifene and its two monoglucoronide conjugates are highly bound (.95%) to plasma proteins Raloxifene is primarily excreted in feces, and less than including bot.h albumin and a-1 acid glycoprotein", "type": "BINDER->LIGAND", "interaction_type": "BINDING", "references": [ "c07be2be-43d0-7607-73ec-28f2e40c969d", "1b6fe808-0a90-a631-dc09-219cd8b19b53" ], "related_substance": { "uuid": "24bc4a78-8f31-4ef4-9b2f-57a89095b7af", "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30", "name": "PLASMA PROTEIN FRACTION (HUMAN)", "unii": "6D53G0FD0Z", "linking_id": "6D53G0FD0Z", "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)", "substance_class": "reference" } }, { "uuid": "31a19654-d3be-4c89-b78a-24b277251715", "amount": { "uuid": "b75c3b3d-4539-44d5-98cf-860559fdfaf2", "average": 0.0029, "high": 0.0032, "low": 0.0026, "units": "MICROMOLAR" }, "qualification": "IC50", "type": "METABOLIC ENZYME->INHIBITOR", "references": [ "5fc66ff3-f5f6-eb3d-1fdb-e6129ee0621b" ], "related_substance": { "uuid": "06fe72c7-1ceb-4d4f-9bee-7a2afc1b8e6c", "refuuid": "393aa2e6-c500-402e-8f58-a069ed6e2771", "name": "ALDEHYDE OXIDASE", "unii": "LR0F81F33L", "linking_id": "LR0F81F33L", "ref_pname": "ALDEHYDE OXIDASE", "substance_class": "reference" } }, { "uuid": "509a42ed-4343-4b1a-b693-d3b76d93fe55", "amount": { "uuid": "4a03ae21-0924-4b6a-bdff-c8a2f1a30461", "average": 0.2, "units": "%" }, "qualification": "URINE", "type": "EXCRETED UNCHANGED", "references": [ "44f5c342-191c-3412-cc2f-ccb2410c4206" ], "related_substance": { "uuid": "d5c0b4e3-a393-4ccb-92bd-26c204a073cf", "refuuid": "6e075469-84e0-46ff-b809-92f68feca9f7", "name": "RALOXIFENE", "unii": "YX9162EO3I", "linking_id": "YX9162EO3I", "ref_pname": "RALOXIFENE", "substance_class": "reference" } }, { "uuid": "cac84ebe-448f-4114-8a4b-baa48006f08c", "type": "METABOLIC ENZYME->SUBSTRATE", "references": [ "8a180b08-571c-e88c-cfb7-59eb2ba94130" ], "related_substance": { "uuid": "e36568f6-4645-4416-ae0d-f0b62fc99b9d", "refuuid": "522659b1-be34-48f1-a9f4-06e4948bbdde", "name": "URIDINE DIPHOSPHATE GLUCURONOSYLTRANSFERASE 1A8", "unii": "S5EY2C8G0B", "linking_id": "S5EY2C8G0B", "ref_pname": "URIDINE DIPHOSPHATE GLUCURONOSYLTRANSFERASE 1A8", "substance_class": "reference" } }, { "uuid": "108f725d-b697-485f-9761-b41c349fefd4", "type": "METABOLIC ENZYME->SUBSTRATE", "references": [ "8a180b08-571c-e88c-cfb7-59eb2ba94130" ], "related_substance": { "uuid": "0e6682b1-9d44-4b0c-8623-92b08178d172", "refuuid": "72d20744-460f-4a4d-bb76-6c16f5a9145e", "name": "URIDINE DIPHOSPHATE GLUCURONOSYLTRANSFERASE 1A10", "unii": "S0025AG5ZT", "linking_id": "S0025AG5ZT", "ref_pname": "URIDINE DIPHOSPHATE GLUCURONOSYLTRANSFERASE 1A10", "substance_class": "reference" } }, { "uuid": "07c10ec6-835b-44d7-9ec2-e09d08e7c5cb", "type": "METABOLIC ENZYME->SUBSTRATE", "references": [ "8a180b08-571c-e88c-cfb7-59eb2ba94130" ], "related_substance": { "uuid": "fbdc22c2-d906-4574-b1f5-1d564cdd2c1b", "refuuid": "d8bbb7f1-afcc-4668-a9f9-829929c43304", "name": "URIDINE DIPHOSPHATE GLUCURONOSYLTRANSFERASE 1A1", "unii": "0RFO7VC96N", "linking_id": "0RFO7VC96N", "ref_pname": "URIDINE DIPHOSPHATE GLUCURONOSYLTRANSFERASE 1A1", "substance_class": "reference" } }, { "uuid": "23f32bdf-55a8-432e-83df-0d2c4829bd84", "comments": "Raloxifene is primarily excreted in feces, and less than 0.2% is excreted unchanged in urine.", "qualification": "FECAL", "type": "EXCRETED UNCHANGED", "interaction_type": "MAJOR", "references": [ "44f5c342-191c-3412-cc2f-ccb2410c4206" ], "related_substance": { "uuid": "f8b0ee14-97ce-49b3-b9e9-88c933a71d82", "refuuid": "6e075469-84e0-46ff-b809-92f68feca9f7", "name": "RALOXIFENE", "unii": "YX9162EO3I", "linking_id": "YX9162EO3I", "ref_pname": "RALOXIFENE", "substance_class": "reference" } } ], "names": [ { "uuid": "10525475-aefb-4312-b04c-9a308408d89b", "name": "EVIDEN", "stdName": "EVIDEN", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "56fdfbb4-abdc-46c6-bd82-2a55df4a0132", "250203ab-b407-425c-97a6-954f97564582" ], "display_name": false }, { "uuid": "c7d6f7a8-96cf-4c0a-bd64-5e0abcc03326", "name": "J22.982B", "stdName": "J22.982B", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "f367bf13-0020-4422-84bf-a0f36a0d4c15", "3290da6d-516e-43a6-9973-6a15dc5e1919" ], "display_name": false }, { "uuid": "eeaf7330-b449-46f7-a3bd-3a297b4494fc", "name": "KEOXIFENE", "stdName": "KEOXIFENE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f367bf13-0020-4422-84bf-a0f36a0d4c15", "3290da6d-516e-43a6-9973-6a15dc5e1919" ], "display_name": false }, { "uuid": "5c569bf5-1984-47d2-bb98-81f0cdb5a0b8", "name": "LY-139481", "stdName": "LY-139481", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "f367bf13-0020-4422-84bf-a0f36a0d4c15", "3290da6d-516e-43a6-9973-6a15dc5e1919" ], "display_name": false }, { "uuid": "44527aa1-0aab-0ce5-d0fb-c4f67e10e4b1", "name": "NSC-747974", "stdName": "NSC-747974", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "e4b63faa-d0e8-b6c6-2149-aad74a3112f1" ], "display_name": false }, { "uuid": "8bf0931d-d8a3-44e0-939d-ef21d15f1d0a", "name": "RALOXIFENE", "stdName": "RALOXIFENE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "586c8870-e27b-44b4-8eea-f2548e1d30e3", "70253698-a1dd-4382-bcfe-5c43e3ab79d3", "4ee35480-bdaf-4971-813a-8779231b4acb", "6a27877f-2302-4f2b-80b1-795f75a5ae14", "78b12388-ca9e-4907-9487-9a901f733d30", "15129675-9cc8-4fa3-8705-3cc4389ef331", "7c68d89e-853e-4c1e-a858-6e8570e0999c", "ac682da3-fcca-47fa-abe8-691b3aa0710e", "46a8f22f-af4f-48c2-ae92-2e319b973f87", "3290da6d-516e-43a6-9973-6a15dc5e1919", "3037c95c-3e47-4bad-9811-658f18406b5a", "1a6407a5-42b3-493b-8753-158687570ac0" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "089a88ac-3291-4ce0-aad3-5890a9099f64", "name_org": "INN" } ] }, { "uuid": "35b81827-5132-450b-b079-c9eb89afa816", "name": "RALOXIFENE [HSDB]", "stdName": "RALOXIFENE [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "70253698-a1dd-4382-bcfe-5c43e3ab79d3", "3290da6d-516e-43a6-9973-6a15dc5e1919" ], "display_name": false }, { "uuid": "b59201dd-2fd0-43b1-a40d-8b1ac68ca409", "name": "RALOXIFENE [MI]", "stdName": "RALOXIFENE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4ee35480-bdaf-4971-813a-8779231b4acb", "3290da6d-516e-43a6-9973-6a15dc5e1919" ], "display_name": false }, { "uuid": "a1675d47-d144-496d-9d03-69325d14ec79", "name": "RALOXIFENE [VANDF]", "stdName": "RALOXIFENE [VANDF]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3290da6d-516e-43a6-9973-6a15dc5e1919", "ac682da3-fcca-47fa-abe8-691b3aa0710e" ], "display_name": false }, { "uuid": "b794006d-4892-423f-8d5b-db4bd6736b43", "name": "RALOXIPHENE", "stdName": "RALOXIPHENE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f11fbf92-a5a4-4df0-816a-351fe0723bda", "3290da6d-516e-43a6-9973-6a15dc5e1919" ], "display_name": false }, { "uuid": "38d3be86-f498-4977-b0b2-e34a75e24b1a", "name": "RAXETO", "stdName": "RAXETO", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "56fdfbb4-abdc-46c6-bd82-2a55df4a0132", "250203ab-b407-425c-97a6-954f97564582" ], "display_name": false }, { "uuid": "3844fca3-dce1-81d6-a267-b00956142d11", "name": "Raloxifene [WHO-DD]", "stdName": "RALOXIFENE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ec8749b4-9d45-c5f2-1ce9-0f32333e4c8b" ], "display_name": false }, { "uuid": "bd0ff60b-66e7-4f69-9ab4-5c683a583334", "name": "raloxifene [INN]", "stdName": "RALOXIFENE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "78b12388-ca9e-4907-9487-9a901f733d30" ], "display_name": false } ], "properties": [ { "uuid": "6a48cda1-4018-4b4e-8c7e-dd120e716179", "name": "Biological Half-life", "value": { "uuid": "35d655a3-3fb3-4df8-b621-fa1f7b825763" }, "referencedSubstance": { "uuid": "59f26a0a-6925-4aa9-b3c1-ea374e596f57", "refPname": "RALOXIFENE", "refuuid": "6e075469-84e0-46ff-b809-92f68feca9f7", "substanceClass": "reference", "approvalID": "YX9162EO3I", "linkingID": "YX9162EO3I", "name": "RALOXIFENE", "references": [] }, "defining": false, "parameters": [ { "uuid": "84f48a7c-3fb7-454c-9c1f-b6554f03cd4b", "name": "Elimination", "type": "PHARMACOKINETIC", "value": { "uuid": "f3a1606b-5d22-462c-92e8-7d2030217e67", "high": 33, "low": 28, "units": "hours", "references": [] }, "references": [] } ], "property_type": "PHARMACOKINETIC", "references": [ "28e704e8-bfe0-f57c-6294-de50771708ed" ] }, { "uuid": "7257dee9-e360-4886-8edb-ce4327c934af", "name": "Volume of Distribution", "value": { "uuid": "39c137d3-3568-40f3-ae7c-6fde73f7545f", "average": 2348, "units": "Liters/Kilogram" }, "defining": false, "parameters": [ { "uuid": "208b7a37-b465-48c4-b3dc-cf83c69bbeaf", "name": "ORAL ADMINISTRATION", "references": [] }, { "uuid": "6fce6fd4-80ab-48a4-9b71-5951bc08821c", "name": "SINGLE DOSE", "references": [] } ], "property_type": "PHARMACOKINETIC", "references": [ "44f5c342-191c-3412-cc2f-ccb2410c4206" ] } ] } ] }