{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3cd8d016-5e67-424c-acfb-c08a786d90ea",
          "code": "120-54-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=120-54-7",
          "code_system": "CAS",
          "references": [
            "276fd719-9373-4323-859b-c84d2d6decb7",
            "4a56637d-f678-4b23-98cf-b592c9515592"
          ]
        },
        {
          "uuid": "0d38e5c8-b55a-4e95-ae15-4f1eab79c947",
          "code": "204-406-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.006",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "276fd719-9373-4323-859b-c84d2d6decb7"
          ]
        },
        {
          "uuid": "7ddffa15-7db3-4466-8352-5a84f87b1435",
          "code": "61049",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/61049",
          "code_system": "PUBCHEM",
          "references": [
            "276fd719-9373-4323-859b-c84d2d6decb7"
          ]
        },
        {
          "uuid": "d82513ef-08ca-8fbd-7489-05204721b259",
          "code": "DTXSID0044789",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0044789",
          "code_system": "EPA CompTox",
          "references": [
            "c29b7689-493d-365d-2571-3c1443a514f9"
          ]
        },
        {
          "uuid": "62960176-547d-48dd-ba90-17305701d870",
          "code": "YX3WH7S23F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a8203b91-6eab-99f6-02c7-0d3eaf20f3a0",
          "code": "4823",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=4823",
          "code_system": "NSC",
          "references": [
            "96eeab9a-c07b-3c6b-8428-8b9a93f0aaae"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "caadcc9e-a1cf-4cf3-bec6-5bc1937a3a61",
          "name": "BIS(PENTAMETHYLENE)THIURAM TETRASULFIDE",
          "stdName": "BIS(PENTAMETHYLENE)THIURAM TETRASULFIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de66fbfd-9b6c-4f74-a0c7-8527c5bf7ccb",
            "308d56ef-5515-4c7e-809f-b51f414b3504"
          ],
          "display_name": false
        },
        {
          "uuid": "c1dbadb7-f210-446e-a12a-45aaa7022c2e",
          "name": "BIS(PIPERIDINOTHIOCARBONYL) TETRASULFIDE",
          "stdName": "BIS(PIPERIDINOTHIOCARBONYL) TETRASULFIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de66fbfd-9b6c-4f74-a0c7-8527c5bf7ccb",
            "308d56ef-5515-4c7e-809f-b51f414b3504"
          ],
          "display_name": false
        },
        {
          "uuid": "f884373f-1999-4d4b-8899-79ebc5102823",
          "name": "DIPENTAMETHYLENETHIURAM TETRASULFIDE",
          "stdName": "DIPENTAMETHYLENETHIURAM TETRASULFIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d61833b7-8c53-44d4-b1ad-0a6f62df9611"
          ],
          "display_name": true
        },
        {
          "uuid": "fb230671-bd9a-4efc-aefe-f500213062cb",
          "name": "METHANETHIONE, 1,1'-TETRATHIOBIS(1-(1-PIPERIDINYL)-",
          "stdName": "METHANETHIONE, 1,1'-TETRATHIOBIS(1-(1-PIPERIDINYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de66fbfd-9b6c-4f74-a0c7-8527c5bf7ccb",
            "308d56ef-5515-4c7e-809f-b51f414b3504"
          ],
          "display_name": false
        },
        {
          "uuid": "89c4195c-f113-4b84-94a8-848ad16f5e08",
          "name": "NSC-4823",
          "stdName": "NSC-4823",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de66fbfd-9b6c-4f74-a0c7-8527c5bf7ccb",
            "308d56ef-5515-4c7e-809f-b51f414b3504"
          ],
          "display_name": false
        },
        {
          "uuid": "754008c6-b035-4274-b489-aad551e73cbc",
          "name": "PIPERIDINE, 1,1'-(TETRATHIODICARBONOTHIOYL)BIS-",
          "stdName": "PIPERIDINE, 1,1'-(TETRATHIODICARBONOTHIOYL)BIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de66fbfd-9b6c-4f74-a0c7-8527c5bf7ccb",
            "308d56ef-5515-4c7e-809f-b51f414b3504"
          ],
          "display_name": false
        },
        {
          "uuid": "c54f3c8a-aa75-4b8e-8cfc-ad87f4ccac84",
          "name": "SANCELER TRA",
          "stdName": "SANCELER TRA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de66fbfd-9b6c-4f74-a0c7-8527c5bf7ccb",
            "308d56ef-5515-4c7e-809f-b51f414b3504"
          ],
          "display_name": false
        },
        {
          "uuid": "5b93f593-1557-455a-adf7-4863d2ec60d6",
          "name": "TETRASULFIDE, BIS(PIPERIDINOTHIOCARBONYL)",
          "stdName": "TETRASULFIDE, BIS(PIPERIDINOTHIOCARBONYL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de66fbfd-9b6c-4f74-a0c7-8527c5bf7ccb",
            "308d56ef-5515-4c7e-809f-b51f414b3504"
          ],
          "display_name": false
        },
        {
          "uuid": "dac36d83-2cde-4443-bd2f-8739b1e296f8",
          "name": "TETRONE A",
          "stdName": "TETRONE A",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de66fbfd-9b6c-4f74-a0c7-8527c5bf7ccb",
            "308d56ef-5515-4c7e-809f-b51f414b3504"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "276fd719-9373-4323-859b-c84d2d6decb7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391083000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e965db30-22af-41ce-a61c-3c91a8b74dd8",
          "citation": "SRS import [YX3WH7S23F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YX3WH7S23F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391083000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f9554b6-f875-48e0-b168-b2f465d5dd96",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d61833b7-8c53-44d4-b1ad-0a6f62df9611",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "308d56ef-5515-4c7e-809f-b51f414b3504",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de66fbfd-9b6c-4f74-a0c7-8527c5bf7ccb",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c29b7689-493d-365d-2571-3c1443a514f9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=120-54-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4a56637d-f678-4b23-98cf-b592c9515592",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "96eeab9a-c07b-3c6b-8428-8b9a93f0aaae",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "76faed7d-097f-45d8-b3f3-216f7f44774e",
          "id": "76faed7d-097f-45d8-b3f3-216f7f44774e",
          "molfile": "\n  Marvin  01132106112D          \n\n 20 21  0  0  0  0            999 V2000\n    7.0351   -3.2674    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3210   -3.6802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3210   -4.5057    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0351   -4.9184    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0351   -5.7440    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7493   -6.1567    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7493   -6.9823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0351   -7.3951    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4634   -7.3951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1777   -6.9823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8964   -7.3951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8964   -8.2205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1777   -8.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4634   -8.2205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6068   -3.2674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8926   -3.6802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1783   -3.2674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1783   -2.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8926   -2.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6068   -2.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  2 15  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 14  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 20  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
          "smiles": "C1CCN(CC1)C(=S)SSSSC(=S)N2CCCCC2",
          "formula": "C12H20N2S6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b47c2464-6c2c-4070-8cdc-9a928651cfad"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "384.6976",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a9db2079-62ec-488b-9c5c-66b81470fdde",
      "version": "4",
      "structure": {
        "id": "138bd397-77cd-45e5-8630-497a6cdd0765",
        "molfile": "\n  Marvin  01132101132D          \n\n 20 21  0  0  0  0            999 V2000\n    8.4634   -7.3951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7493   -6.9823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7493   -6.1567    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0351   -5.7440    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0351   -4.9184    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3210   -4.5057    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3210   -3.6802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6068   -3.2674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8926   -3.6802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1783   -3.2674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1783   -2.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8926   -2.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6068   -2.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0351   -3.2674    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0351   -7.3951    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1777   -6.9823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8964   -7.3951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8964   -8.2205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1777   -8.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4634   -8.2205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n  8 13  1  0  0  0  0\n  7 14  2  0  0  0  0\n  2 15  2  0  0  0  0\n  1 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n  1 20  1  0  0  0  0\nM  END",
        "smiles": "C1CCN(CC1)C(=S)SSSSC(=S)N2CCCCC2",
        "formula": "C12H20N2S6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "384.6976",
        "optical_activity": "NONE",
        "references": [
          "2f9554b6-f875-48e0-b168-b2f465d5dd96",
          "e965db30-22af-41ce-a61c-3c91a8b74dd8"
        ],
        "stereo_centers": 0
      },
      "unii": "YX3WH7S23F"
    }
  ]
}