{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ba387e79-0a81-4c0c-aa74-1a6c6c11d6d0",
          "code": "63316-43-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=63316-43-8",
          "code_system": "CAS",
          "references": [
            "aa9d1ff7-6337-46a6-9069-eb63290138a3",
            "9e534cf1-2fd6-4c8b-ba39-75b807b2155d"
          ]
        },
        {
          "uuid": "601e4698-0f11-4a29-916b-d99e05356ad5",
          "code": "264-097-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.058.252",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "aa9d1ff7-6337-46a6-9069-eb63290138a3"
          ]
        },
        {
          "uuid": "9524739d-d761-4f70-8c20-3c1022df0fbb",
          "code": "23686562",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23686562",
          "code_system": "PUBCHEM",
          "references": [
            "aa9d1ff7-6337-46a6-9069-eb63290138a3"
          ]
        },
        {
          "uuid": "c19cb911-2782-8a1d-3a6a-84aa0141429e",
          "code": "DTXSID30872797",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30872797",
          "code_system": "EPA CompTox",
          "references": [
            "4afc4d4e-80cd-b33a-db95-bf4d2917f0b0"
          ]
        },
        {
          "uuid": "083dc105-bc52-47f3-9a75-1b158b8fabf5",
          "code": "YW52U3T4UP",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "9e534cf1-2fd6-4c8b-ba39-75b807b2155d"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "82329af3-f242-47f1-96ae-a671f472be75",
          "amount": {
            "uuid": "f7aa250e-2ded-4675-a4fa-c553e1ed08d7"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "a7c5bb4b-e534-4ca4-98af-e4423eb174e1",
            "refuuid": "5af41403-b354-40ba-9f49-00e183a1bfbc",
            "name": "3-PHENYLSULFONYLBENZENESULFONIC ACID",
            "unii": "F72EAJ8RSM",
            "linking_id": "F72EAJ8RSM",
            "ref_pname": "3-PHENYLSULFONYLBENZENESULFONIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fe52c11b-bef5-4bd3-9ec5-045185c2ede2",
          "name": "Benzenesulfonic acid, 3-(phenylsulfonyl)-, potassium salt",
          "stdName": "BENZENESULFONIC ACID, 3-(PHENYLSULFONYL)-, POTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e534cf1-2fd6-4c8b-ba39-75b807b2155d"
          ],
          "display_name": false
        },
        {
          "uuid": "5a4cc83f-38e3-4842-9381-22231145f5e3",
          "name": "Benzenesulfonic acid, 3-(phenylsulfonyl)-, potassium salt (1:1)",
          "stdName": "BENZENESULFONIC ACID, 3-(PHENYLSULFONYL)-, POTASSIUM SALT (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e534cf1-2fd6-4c8b-ba39-75b807b2155d"
          ],
          "display_name": false
        },
        {
          "uuid": "1b4ef923-1697-4977-b678-d5b63ca8f2e4",
          "name": "Potassium 3-(phenylsulfonyl)benzenesulfonate",
          "stdName": "POTASSIUM 3-(PHENYLSULFONYL)BENZENESULFONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1791350d-f8d6-472b-8f95-cb99c46df831",
            "5be0dfec-7876-477e-a2d5-3260ebe8c5ef"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "5be0dfec-7876-477e-a2d5-3260ebe8c5ef",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1791350d-f8d6-472b-8f95-cb99c46df831",
          "citation": "EPA",
          "doc_type": "EPA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa9d1ff7-6337-46a6-9069-eb63290138a3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393972000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4afc4d4e-80cd-b33a-db95-bf4d2917f0b0",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=63316-43-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9e534cf1-2fd6-4c8b-ba39-75b807b2155d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b54891d3-587a-4ab4-bb3a-2c90d5e64722",
          "id": "b54891d3-587a-4ab4-bb3a-2c90d5e64722",
          "molfile": "\n  CDK     11272313402D\n\n  1  0  0  0  0  0  0  0  0  0999 V2000\n   26.7904   -9.8957    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "900adce6-52f9-449c-b32a-c7d9b8073c0c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "be669bb9-7603-47fd-b216-ff99a6b97e49",
          "id": "be669bb9-7603-47fd-b216-ff99a6b97e49",
          "molfile": "\n  CDK     11272313402D\n\n 19 20  0  0  0  0  0  0  0  0999 V2000\n   19.4884   -5.1739    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8396   -5.9537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1913   -5.1733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5436   -5.9529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5441   -7.5129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1923   -8.2933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8401   -7.5137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1928   -9.8533    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6328   -9.8537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1934  -11.4133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7528   -9.8528    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   18.1374   -4.3939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7086   -6.5250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.2682   -3.8228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7864   -5.1739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4354   -4.3939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1374   -2.8339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7864   -2.0539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4354   -2.8339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  2  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  2  0  0  0  0\n  8 11  1  0  0  0  0\n  1 12  1  0  0  0  0\n  1 13  2  0  0  0  0\n  1 14  2  0  0  0  0\n 12 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 12 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 16  2  0  0  0  0\nM  CHG  1  11  -1\nM  END",
          "smiles": "c1ccc(cc1)S(=O)(=O)c2cccc(c2)S(=O)(=O)[O-]",
          "formula": "C12H9O5S2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "04533f37-d4ef-4a65-8c20-b021d92c0862"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "297.3295",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ff5bd178-31ea-4a30-9692-6575ec8b27cf",
      "version": "8",
      "structure": {
        "id": "feee86fc-8b18-4565-ae44-cd9e7f2386c1",
        "molfile": "\n   JSDraw211272313402D\n\n 20 20  0  0  0  0              0 V2000\n   19.4884   -5.1739    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8396   -5.9537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1913   -5.1733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5436   -5.9529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5441   -7.5129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1923   -8.2933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8401   -7.5137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1928   -9.8533    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6328   -9.8537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1934  -11.4133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7528   -9.8528    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   26.7904   -9.8957    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n   18.1374   -4.3939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7086   -6.5250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.2682   -3.8228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7864   -5.1739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4354   -4.3939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1374   -2.8339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7864   -2.0539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4354   -2.8339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  2  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  2  0  0  0  0\n  8 11  1  0  0  0  0\n  1 13  1  0  0  0  0\n  1 14  2  0  0  0  0\n  1 15  2  0  0  0  0\n 13 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 13 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 17  2  0  0  0  0\nM  CHG  2  11  -1  12   1\nM  END",
        "smiles": "c1ccc(cc1)S(=O)(=O)c2cccc(c2)S(=O)(=O)[O-].[K+]",
        "formula": "C12H9O5S2.K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "336.4278",
        "optical_activity": "NONE",
        "references": [
          "5be0dfec-7876-477e-a2d5-3260ebe8c5ef"
        ],
        "stereo_centers": 0
      },
      "unii": "YW52U3T4UP"
    }
  ]
}