{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5ad97eac-8bb1-4b24-88c8-f314e4a5c6e1",
          "code": "93804-64-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=93804-64-9",
          "code_system": "CAS",
          "references": [
            "5190b627-8c44-4e91-be29-655f73747e58",
            "3d4d68ea-6660-4c62-b5a4-03e40cd7252c"
          ]
        },
        {
          "uuid": "aa36491a-6643-4d10-99fb-6f17b2a953a9",
          "code": "298-441-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.089.450",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "5190b627-8c44-4e91-be29-655f73747e58"
          ]
        },
        {
          "uuid": "e65b3853-e1c2-4fc3-8e7e-18f3d4a9e5d9",
          "code": "2839751",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2839751",
          "code_system": "PUBCHEM",
          "references": [
            "5190b627-8c44-4e91-be29-655f73747e58"
          ]
        },
        {
          "uuid": "4e6ac722-81b8-45ba-9f8a-c09a0e3dc687",
          "code": "YVA11ARE3N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "dbadf293-d174-2529-8c92-c500a5ef2b05",
          "code": "DTXSID10917832",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10917832",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "a8c0dbe1-51de-5eca-5000-c386f6b0f53a",
          "code": "1953",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1953/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "f9f5523c-ea0c-1e27-d8bd-25501b95a498"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1fbd6ef3-9b3c-486b-a7b4-8b083569d60c",
          "name": "(±)-HYDROXYCITRONELLAL PROPYLENEGLYCOL ACETAL",
          "stdName": "(+/-)-HYDROXYCITRONELLAL PROPYLENEGLYCOL ACETAL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59bf139d-4bde-4ca2-979c-2c1a35667f20",
            "2ad70466-81d9-4f3c-97d7-1d5cdf130ee3"
          ],
          "display_name": false
        },
        {
          "uuid": "d68ce440-90da-4863-bff9-35d4e8e6e1b4",
          "name": "1,3-DIOXOLANE-2-HEXANOL, .ALPHA.,.ALPHA.,.EPSILON.,4-TETRAMETHYL-",
          "stdName": "1,3-DIOXOLANE-2-HEXANOL, .ALPHA.,.ALPHA.,.EPSILON.,4-TETRAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59bf139d-4bde-4ca2-979c-2c1a35667f20",
            "eddb5d13-662b-4a84-986a-6a25b5d47b78"
          ],
          "display_name": false
        },
        {
          "uuid": "7e75b141-6348-494c-b9e6-9c530d4832a4",
          "name": "FEMA NO. 4485",
          "stdName": "FEMA NO. 4485",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59bf139d-4bde-4ca2-979c-2c1a35667f20",
            "eddb5d13-662b-4a84-986a-6a25b5d47b78"
          ],
          "display_name": false
        },
        {
          "uuid": "36c1c253-d5f8-4caf-8f20-412daed91fc0",
          "name": "HYDROXYCITRONELLAL PROPYLENE GLYCOL ACETAL",
          "stdName": "HYDROXYCITRONELLAL PROPYLENE GLYCOL ACETAL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f56617b2-3fca-43e0-a41f-ec048ca50939",
            "59bf139d-4bde-4ca2-979c-2c1a35667f20"
          ],
          "display_name": false
        },
        {
          "uuid": "2a3758f6-627c-448d-a530-525b1989ed41",
          "name": "HYDROXYCITRONELLAL PROPYLENEGLYCOL ACETAL",
          "stdName": "HYDROXYCITRONELLAL PROPYLENEGLYCOL ACETAL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59bf139d-4bde-4ca2-979c-2c1a35667f20",
            "eddb5d13-662b-4a84-986a-6a25b5d47b78"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "eddb5d13-662b-4a84-986a-6a25b5d47b78",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "59bf139d-4bde-4ca2-979c-2c1a35667f20",
          "citation": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "doc_type": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ad70466-81d9-4f3c-97d7-1d5cdf130ee3",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f56617b2-3fca-43e0-a41f-ec048ca50939",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5190b627-8c44-4e91-be29-655f73747e58",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391404000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0386f91-4579-4ba0-81e9-8e3ed9b7e956",
          "citation": "SRS import [YVA11ARE3N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YVA11ARE3N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391404000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81930ceb-0422-44b4-94d2-348cb8624f1b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d4d68ea-6660-4c62-b5a4-03e40cd7252c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f9f5523c-ea0c-1e27-d8bd-25501b95a498",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "36c9bf3a-710e-4752-a381-d97a55d3610a",
          "id": "36c9bf3a-710e-4752-a381-d97a55d3610a",
          "molfile": "\n  Marvin  01132102552D          \n\n 16 16  0  0  0  0            999 V2000\n    8.0311   -6.6779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0997   -5.8558    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.8460   -5.5041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5237   -5.9745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2700   -5.6228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9477   -6.0933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4182   -5.4156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4773   -6.7710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6255   -6.5638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4220   -5.3852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6757   -5.7369    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.9526   -5.3399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3514   -5.9050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7031   -6.6513    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.2906   -7.3658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5216   -6.5474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 10  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  6  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 16 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  1  0  0  0  0\nM  END",
          "smiles": "CC(CCCC(C)(C)O)CC1OCC(C)O1",
          "formula": "C13H26O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "754e4239-2b1d-49c5-9bfe-162d6e2b2e41"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "230.3442",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "63ad9462-3a2f-4075-be2b-cd2464a8790a",
      "version": "4",
      "structure": {
        "id": "970ad843-487d-4559-9548-3341641345bd",
        "molfile": "\n  Marvin  01132107512D          \n\n 16 16  0  0  0  0            999 V2000\n    6.6757   -5.7369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4220   -5.3852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0997   -5.8558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8460   -5.5041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5237   -5.9745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2700   -5.6228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9477   -6.0933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6255   -6.5638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4182   -5.4156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4773   -6.7710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0311   -6.6779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5216   -6.5474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7031   -6.6513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3514   -5.9050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9526   -5.3399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2906   -7.3658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  7  1  0  0  0  0\n 11  3  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 12  1  1  0  0  0  0\n 15  1  1  0  0  0  0\n 13 16  1  0  0  0  0\nM  END",
        "smiles": "CC(CCCC(C)(C)O)CC1OCC(C)O1",
        "formula": "C13H26O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "230.3442",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "81930ceb-0422-44b4-94d2-348cb8624f1b",
          "b0386f91-4579-4ba0-81e9-8e3ed9b7e956"
        ],
        "stereo_centers": 3
      },
      "unii": "YVA11ARE3N"
    }
  ]
}