{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "81f55563-bde2-4bf5-9f42-393ce83d09e9",
          "code": "QP53AF03",
          "comments": "VATC|ECTOPARACITICIDES,  INSECTICIDES AND REPELLENTS|ECTOPARASITICIDES FOR TOPICAL USE, INCL. INSECTICIDES|Organophosphorous compounds|dimpylate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP53AF03&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "f7bee741-7cb8-4118-93ee-97f31f1ccf50"
          ]
        },
        {
          "uuid": "92db00ef-8da4-42b3-80be-b45a67e3831c",
          "code": "333-41-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=333-41-5",
          "code_system": "CAS",
          "references": [
            "f7bee741-7cb8-4118-93ee-97f31f1ccf50",
            "e35bcc6f-2225-4588-a545-ef1aa4f12f49"
          ]
        },
        {
          "uuid": "1e6ca1d6-a017-4acc-86cf-35379a963e88",
          "code": "D003976",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68003976",
          "code_system": "MESH",
          "references": [
            "f7bee741-7cb8-4118-93ee-97f31f1ccf50"
          ]
        },
        {
          "uuid": "4277da4e-4803-443d-865b-b24245bb6897",
          "code": "DIAZINON",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Diazinon",
          "code_system": "WIKIPEDIA",
          "references": [
            "f7bee741-7cb8-4118-93ee-97f31f1ccf50"
          ]
        },
        {
          "uuid": "9e11e033-09ea-4459-a8af-d618ff1d3e6f",
          "code": "57801",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2086",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "f7bee741-7cb8-4118-93ee-97f31f1ccf50"
          ]
        },
        {
          "uuid": "05a76c83-166b-4f04-b50f-2b6842cbef08",
          "code": "2045",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2045",
          "code_system": "INN",
          "references": [
            "f7bee741-7cb8-4118-93ee-97f31f1ccf50"
          ]
        },
        {
          "uuid": "a38cb57a-dab7-4bce-8d39-dfce3760e067",
          "code": "206-373-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.795",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f7bee741-7cb8-4118-93ee-97f31f1ccf50"
          ]
        },
        {
          "uuid": "d0e46421-b089-4676-a00d-caefa3834339",
          "code": "m4268",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4268?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f7bee741-7cb8-4118-93ee-97f31f1ccf50"
          ]
        },
        {
          "uuid": "9c9ab267-9888-46af-9fad-79fb93cc383f",
          "code": "SUB07189MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "f7bee741-7cb8-4118-93ee-97f31f1ccf50"
          ]
        },
        {
          "uuid": "cd1ad477-3d6c-49cc-b2d9-73aa7aa9b6ca",
          "code": "CHEMBL388560",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL388560",
          "code_system": "ChEMBL",
          "references": [
            "f7bee741-7cb8-4118-93ee-97f31f1ccf50"
          ]
        },
        {
          "uuid": "448faf26-7af4-4657-ba59-25be3cc87df9",
          "code": "3017",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3017",
          "code_system": "PUBCHEM",
          "references": [
            "f7bee741-7cb8-4118-93ee-97f31f1ccf50"
          ]
        },
        {
          "uuid": "59354b61-9971-1781-9384-e93ec1f34d12",
          "code": "303",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/303",
          "code_system": "HSDB",
          "references": [
            "6b89958f-ec1c-9391-2ad4-a03fab20641d"
          ]
        },
        {
          "uuid": "25a961ea-b6a3-6d56-c290-e827d998b990",
          "code": "DTXSID9020407",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9020407",
          "code_system": "EPA CompTox",
          "references": [
            "16d8694f-b26e-9a27-7728-52166a83e05f"
          ]
        },
        {
          "uuid": "ba1ec129-c20e-4798-b416-496a8e790459",
          "code": "YUS1M1Q929",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a72670eb-4d4a-bd0b-b3bf-a597a7315941",
          "code": "C169912",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C169912",
          "code_system": "NCI_THESAURUS",
          "references": [
            "45b01b50-9667-84d7-5533-a855eec2caec"
          ]
        },
        {
          "uuid": "384e3636-9919-3f3e-be7e-3d70acdc8630",
          "code": "34682",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34682",
          "code_system": "CHEBI",
          "references": [
            "45b01b50-9667-84d7-5533-a855eec2caec"
          ]
        },
        {
          "uuid": "697b49d4-306b-33e6-e31b-9b0faab1fd9d",
          "code": "8938",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=8938",
          "code_system": "NSC",
          "references": [
            "4c78764f-2185-be54-8dd2-b7c467dd1022"
          ]
        },
        {
          "uuid": "ca8f6cfd-10d1-6c9c-6b2a-5c5b71cb531d",
          "code": "YUS1M1Q929",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=YUS1M1Q929",
          "code_system": "DAILYMED",
          "references": [
            "b98458d7-f762-dd8e-b9f0-99775e9d74b9"
          ]
        },
        {
          "uuid": "3d04a429-9afe-9928-e511-cd085177fe8c",
          "code": "diazinon",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/diazinon.html",
          "code_system": "ALANWOOD",
          "references": [
            "ea0ec4c4-7b3a-8364-1664-39e8ce2d1ed7"
          ]
        },
        {
          "uuid": "a6040dec-ed6a-68a3-bfbd-d4b4d2b780ce",
          "code": "100000082650",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f72e187b-2154-a15e-17a1-2a92186c0d80"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ed1b8add-84b3-4fd4-bb75-99abcae3bbd4",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "4b97ff3c-ad90-4ed2-bb79-07c5bcb77a09",
            "refuuid": "05ec51ea-ceae-43ab-9f37-8d109f060f74",
            "name": "DIMPYLATE",
            "unii": "YUS1M1Q929",
            "linking_id": "YUS1M1Q929",
            "ref_pname": "DIMPYLATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "cfb60db4-96d4-4bfd-9c98-2e10c24251cb",
          "amount": {
            "uuid": "528bb680-0369-4cd2-b5b7-638c2b398c4c"
          },
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "76607cfe-9243-4a40-821d-da01941825f6"
          ],
          "related_substance": {
            "uuid": "f1ceedd5-e1ae-4793-9b4c-63c2832f7a5b",
            "refuuid": "af140fab-1943-47e6-b0eb-bc830d08e98a",
            "name": "CYTOCHROME P450 1A1",
            "unii": "9DX651UO0D",
            "linking_id": "9DX651UO0D",
            "ref_pname": "CYTOCHROME P450 1A1",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "cd97ed7a-ba1c-46e2-af26-d65d8ade146a",
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "9e7042d8-3960-d960-804c-44b288ebd1e6"
          ],
          "related_substance": {
            "uuid": "1863d254-44aa-4375-b02d-b65c0e0f998e",
            "refuuid": "4f746c19-0e0a-447a-beda-d28b91d6f23e",
            "name": "CYTOCHROME P450 2C19",
            "unii": "081I12ZA58",
            "linking_id": "081I12ZA58",
            "ref_pname": "CYTOCHROME P450 2C19",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "51152592-749f-44ab-9e15-5f5cbcf86ff4",
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "9e7042d8-3960-d960-804c-44b288ebd1e6"
          ],
          "related_substance": {
            "uuid": "b05421ad-e94f-4926-85d8-1146e99a8015",
            "refuuid": "83e3f07e-be5b-48ac-be08-0c68c20e8bf0",
            "name": "CYTOCHROME P450 2B6",
            "unii": "0UY97CSG1T",
            "linking_id": "0UY97CSG1T",
            "ref_pname": "CYTOCHROME P450 2B6",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "85f6b92e-757c-4bfc-ac68-e79bf8a83e56",
          "amount": {
            "uuid": "0f9c6d84-63ca-4464-80e7-00f529f5767e"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "18bf0a68-7086-4be7-af51-b1859840d554"
          ],
          "related_substance": {
            "uuid": "85046316-28e8-4fe6-af3c-101c5e03b5eb",
            "refuuid": "067a8ec1-fe78-4d20-ae7f-680d78ecd9bf",
            "name": "2-ISOPROPYL-6-METHYL-4-PYRIMIDONE",
            "unii": "0JET159MZQ",
            "linking_id": "0JET159MZQ",
            "ref_pname": "2-ISOPROPYL-6-METHYL-4-PYRIMIDONE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "893eada2-d11c-466e-9523-c9b5345d4c4e",
          "name": "DIAZINON",
          "stdName": "DIAZINON",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa377d6c-48e1-4529-94b0-51fc673315a9",
            "162e36a3-0ba5-42ee-ac78-65da7c50d929",
            "b534f687-508f-45bb-be7e-cba617681e7b",
            "61a3c079-f9c6-4c41-9027-4e3d7addd467",
            "0f45af29-387f-4941-b4dd-cd66c082359b",
            "3b00c549-307f-4ba7-b2a8-5976ad1102e9"
          ],
          "display_name": false
        },
        {
          "uuid": "517de347-1dd9-4f64-a35d-911f27b5a1d2",
          "name": "DIAZINON [HSDB]",
          "stdName": "DIAZINON [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa377d6c-48e1-4529-94b0-51fc673315a9"
          ],
          "display_name": false
        },
        {
          "uuid": "ecfd8c87-cf5e-94fe-7cc7-591fffd54314",
          "name": "DIAZINON [IARC]",
          "stdName": "DIAZINON [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d59763a1-2eca-11cc-6b45-321d5f065c32"
          ],
          "display_name": false
        },
        {
          "uuid": "1d5cdbef-3a22-4c65-a748-8ca39cef2e4b",
          "name": "DIAZINON [ISO]",
          "stdName": "DIAZINON [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f45af29-387f-4941-b4dd-cd66c082359b"
          ],
          "display_name": false
        },
        {
          "uuid": "72516a94-fd64-4a2e-a269-c354ec5b737a",
          "name": "DIAZINON [MI]",
          "stdName": "DIAZINON [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61a3c079-f9c6-4c41-9027-4e3d7addd467"
          ],
          "display_name": false
        },
        {
          "uuid": "124a61e9-1773-44d7-9667-b6ae79c609bc",
          "name": "DIETHYL 2-ISOPROPYL-4-METHYL-6-PYRIMIDYL THIONOPHOSPHATE",
          "stdName": "DIETHYL 2-ISOPROPYL-4-METHYL-6-PYRIMIDYL THIONOPHOSPHATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61a3c079-f9c6-4c41-9027-4e3d7addd467"
          ],
          "display_name": false
        },
        {
          "uuid": "e16e6dde-d5f5-46f3-a802-0ec1f1705802",
          "name": "DIMPYLATE",
          "stdName": "DIMPYLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "879b67a2-0dba-452f-973d-5a8c17db9028",
            "3db5b228-923a-45f4-8d6a-98393eaaa686",
            "907e9eb4-fb94-4106-b98b-909271695432",
            "e697430a-809d-4d0d-b441-2d9bc11ebb78",
            "bf54814f-88e3-44ea-b2ee-9b554fa1c543",
            "a1ac6723-a14a-4d48-bcf3-6f54f2ac1bbf",
            "bd4fb1bd-ca70-4d6f-9565-d79a4f80368b"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "8387431e-66e4-48f0-bf94-acaa49442b46",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "79d7062d-ae9c-453d-8ad9-8da55a7dd318",
          "name": "DIMPYLATE [MART.]",
          "stdName": "DIMPYLATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3db5b228-923a-45f4-8d6a-98393eaaa686"
          ],
          "display_name": false
        },
        {
          "uuid": "4931ab99-8e5f-5b7a-9885-ac3af5574f3c",
          "name": "Dimpylate [WHO-DD]",
          "stdName": "DIMPYLATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f4faaaa-a35b-5f83-10f4-8e5ab92746a9"
          ],
          "display_name": false
        },
        {
          "uuid": "f012fc6e-1d7a-416b-9e34-376099e60205",
          "name": "G-24480",
          "stdName": "G-24480",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97fa2f9b-0bc6-45f6-a5a6-cd2cd2625ee2"
          ],
          "display_name": false
        },
        {
          "uuid": "ded6d443-3ab1-4fbb-82ac-0d63ac0550cc",
          "name": "NEW Z DIAZINON",
          "stdName": "NEW Z DIAZINON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "52d58567-9e3d-4775-ab4d-a8b95d60d272"
          ],
          "display_name": false
        },
        {
          "uuid": "c9320b11-fd9a-4932-9285-292484077d5c",
          "name": "NSC-8938",
          "stdName": "NSC-8938",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "282d3656-5c8a-490e-9b3f-1bdddb68ffe7"
          ],
          "display_name": false
        },
        {
          "uuid": "390c7e66-9f2f-42e9-8446-ae2e0ae3d7ea",
          "name": "O,O-DIETHYL 2-ISOPROPYL-6-METHYL-4-PYRIMIDINYLPHOSPHOROTHIOATE",
          "stdName": "O,O-DIETHYL 2-ISOPROPYL-6-METHYL-4-PYRIMIDINYLPHOSPHOROTHIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97fa2f9b-0bc6-45f6-a5a6-cd2cd2625ee2"
          ],
          "display_name": false
        },
        {
          "uuid": "67ae3038-6b22-4c74-b97b-a80e9d27fb33",
          "name": "O,O-DIETHYL O-(6-METHYL-2-(1-METHYLETHYL)-4-PYRIMIDINYL) PHOSPHOROTHIOATE",
          "stdName": "O,O-DIETHYL O-(6-METHYL-2-(1-METHYLETHYL)-4-PYRIMIDINYL) PHOSPHOROTHIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61a3c079-f9c6-4c41-9027-4e3d7addd467"
          ],
          "display_name": false
        },
        {
          "uuid": "45bdafcd-51f3-4ec8-869b-9117824b175a",
          "name": "OPTIMIZER INSECTICIDE",
          "stdName": "OPTIMIZER INSECTICIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "52d58567-9e3d-4775-ab4d-a8b95d60d272"
          ],
          "display_name": false
        },
        {
          "uuid": "a4bca094-c98d-47d1-96fa-acaf0670fe2d",
          "name": "PHOSPHOROTHIOIC ACID O,O-DIETHYL O-(6-METHYL-2-(1-METHYLETHYL)-4-PYRIMIDINYL) ESTER",
          "stdName": "PHOSPHOROTHIOIC ACID O,O-DIETHYL O-(6-METHYL-2-(1-METHYLETHYL)-4-PYRIMIDINYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61a3c079-f9c6-4c41-9027-4e3d7addd467"
          ],
          "display_name": false
        },
        {
          "uuid": "4fffc168-5445-4e22-a536-38e4eb3e2fc0",
          "name": "dimpylate [INN]",
          "stdName": "DIMPYLATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "907e9eb4-fb94-4106-b98b-909271695432",
            "226e36ec-c1f8-4e8e-bcb2-f782ac52791f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d3eff7dd-5f17-4216-9363-2138bc986da0",
          "citation": "SRS import [YUS1M1Q929]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YUS1M1Q929",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389687000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1ac6723-a14a-4d48-bcf3-6f54f2ac1bbf",
          "citation": "DIMPYLATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "162e36a3-0ba5-42ee-ac78-65da7c50d929",
          "citation": "DIAZINON [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3b00c549-307f-4ba7-b2a8-5976ad1102e9",
          "citation": "DIAZINON [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bd4fb1bd-ca70-4d6f-9565-d79a4f80368b",
          "citation": "DIMPYLATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e697430a-809d-4d0d-b441-2d9bc11ebb78",
          "citation": "DIMPYLATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b534f687-508f-45bb-be7e-cba617681e7b",
          "citation": "DIAZINON [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "879b67a2-0dba-452f-973d-5a8c17db9028",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bf54814f-88e3-44ea-b2ee-9b554fa1c543",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61a3c079-f9c6-4c41-9027-4e3d7addd467",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa377d6c-48e1-4529-94b0-51fc673315a9",
          "citation": "NLM",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "907e9eb4-fb94-4106-b98b-909271695432",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "97fa2f9b-0bc6-45f6-a5a6-cd2cd2625ee2",
          "citation": "usp dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52d58567-9e3d-4775-ab4d-a8b95d60d272",
          "citation": "KEGG",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3db5b228-923a-45f4-8d6a-98393eaaa686",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f45af29-387f-4941-b4dd-cd66c082359b",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "282d3656-5c8a-490e-9b3f-1bdddb68ffe7",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7bee741-7cb8-4118-93ee-97f31f1ccf50",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389687000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b89958f-ec1c-9391-2ad4-a03fab20641d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+333-41-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "16d8694f-b26e-9a27-7728-52166a83e05f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=333-41-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d59763a1-2eca-11cc-6b45-321d5f065c32",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "45b01b50-9667-84d7-5533-a855eec2caec",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e35bcc6f-2225-4588-a545-ef1aa4f12f49",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9e7042d8-3960-d960-804c-44b288ebd1e6",
          "citation": "Ellison, Corie A., et al. \"Human hepatic cytochrome P450-specific metabolism of the organophosphorus pesticides methyl parathion and diazinon.\" Drug Metabolism and Disposition 40.1 (2012): 1-5.",
          "url": "https://dmd.aspetjournals.org/content/dmd/40/1/1.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "226e36ec-c1f8-4e8e-bcb2-f782ac52791f",
          "citation": "INN Proposed List 16",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL16.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ea0ec4c4-7b3a-8364-1664-39e8ce2d1ed7",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "18bf0a68-7086-4be7-af51-b1859840d554",
          "citation": "J Chromatography 103(2):341;1975",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4c78764f-2185-be54-8dd2-b7c467dd1022",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b98458d7-f762-dd8e-b9f0-99775e9d74b9",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "5f4faaaa-a35b-5f83-10f4-8e5ab92746a9",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "76607cfe-9243-4a40-821d-da01941825f6",
          "citation": "Ellison, Corie A., et al. \"Human hepatic cytochrome P450-specific metabolism of the organophosphorus pesticides methyl parathion and diazinon.\" Drug Metabolism and Disposition 40.1 (2012): 1-5.",
          "url": "https://dmd.aspetjournals.org/content/dmd/40/1/1.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f72e187b-2154-a15e-17a1-2a92186c0d80",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "df18da80-9a9b-4d60-94b7-b5c6ed2c53c5",
          "id": "df18da80-9a9b-4d60-94b7-b5c6ed2c53c5",
          "molfile": "\n  Marvin  01132111342D          \n\n 19 19  0  0  0  0            999 V2000\n    6.2559   -0.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6818   -0.8534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8827   -0.6466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2930   -1.2207    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1456   -2.0327    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8827   -1.8103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6895   -1.5931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2766   -2.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5766   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8732   -1.2284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8732   -2.0586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1646   -2.4672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1646   -3.2922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4405   -2.0637    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4353   -1.2284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1517   -0.8250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7138   -0.8328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7138    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  4  9  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 16  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  1  0  0  0  0\nM  END",
          "smiles": "CCOP(=S)(OCC)Oc1cc(C)nc(C(C)C)n1",
          "formula": "C12H21N2O3PS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1780cb2a-2663-4bde-9f77-6f69a653e07e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "304.3471",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "05ec51ea-ceae-43ab-9f37-8d109f060f74",
      "version": "19",
      "structure": {
        "id": "a4ba7e57-45f5-4bac-872a-338fbe229b42",
        "molfile": "\n  Marvin  01132108332D          \n\n 19 19  0  0  0  0            999 V2000\n    2.1517   -0.8250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2930   -1.2207    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4353   -1.2284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8732   -1.2284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5766   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4405   -2.0637    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8732   -2.0586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1456   -2.0327    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1646   -2.4672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7138   -0.8328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8827   -0.6466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8827   -1.8103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1646   -3.2922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6818   -0.8534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6895   -1.5931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7138    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2559   -0.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2766   -2.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  5  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  4  2  0  0  0  0\n  8  2  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11  2  1  0  0  0  0\n 12  2  1  0  0  0  0\n 13  9  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 12  1  0  0  0  0\n 16 10  1  0  0  0  0\n 17 10  1  0  0  0  0\n 18 14  1  0  0  0  0\n 19 15  1  0  0  0  0\n  6  9  2  0  0  0  0\nM  END",
        "smiles": "CCOP(=S)(OCC)Oc1cc(C)nc(C(C)C)n1",
        "formula": "C12H21N2O3PS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "304.3471",
        "optical_activity": "NONE",
        "references": [
          "879b67a2-0dba-452f-973d-5a8c17db9028",
          "d3eff7dd-5f17-4216-9363-2138bc986da0",
          "226e36ec-c1f8-4e8e-bcb2-f782ac52791f"
        ],
        "stereo_centers": 0
      },
      "unii": "YUS1M1Q929"
    }
  ]
}