{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "34fef73f-4520-4edd-bb0f-1992047b5906", "code": "N05BA12", "comments": "ATC|NERVOUS SYSTEM|PSYCHOLEPTICS|ANXIOLYTICS|Benzodiazepine derivatives|alprazolam", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=N05BA12&showdescription=yes", "code_system": "WHO-ATC", "references": [ "fc58d57d-23d1-4013-8f0d-57b198455c1c" ] }, { "uuid": "e9b9879a-db9f-4650-8d17-d8bd261134ca", "code": "N0000175694", "comments": "Established Pharmacologic Class [EPC]|Benzodiazepine [EPC]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175694", "code_system": "NDF-RT", "references": [ "fc58d57d-23d1-4013-8f0d-57b198455c1c" ] }, { "uuid": "440ace05-6ccf-401f-b053-3afaf1305d37", "code": "N0000007542", "comments": "Chemical Ingredients [Chemical/Ingredient]|Heterocyclic Compounds [Chemical/Ingredient]|Heterocyclic Compounds, 2-Ring [Chemical/Ingredient]|Benzazepines [Chemical/Ingredient]|Benzodiazepines [Chemical/Ingredient]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000007542", "code_system": "NDF-RT", "references": [ "fc58d57d-23d1-4013-8f0d-57b198455c1c" ] }, { "uuid": "8ec48ab6-ee2c-4de3-a4a3-30354c022cfa", "code": "28981-97-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=28981-97-7", "code_system": "CAS", "references": [ "fc58d57d-23d1-4013-8f0d-57b198455c1c", "5ec1fc2f-6384-4573-99c3-8fa9f6ade300" ] }, { "uuid": "29f3a195-c9fa-4925-ade8-23b7a0b5f7e9", "code": "C227", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C227", "code_system": "NCI_THESAURUS", "references": [ "fc58d57d-23d1-4013-8f0d-57b198455c1c" ] }, { "uuid": "087f9401-d166-43d0-9c68-0894c1f9e7a5", "code": "NBK548178", "comments": "LiverTox|CNS|Sedative/Hypnotic|Benzodiazepine", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/NBK548178/", "code_system": "LIVERTOX", "references": [ "10ccaf86-ea8d-7ece-5271-32826c408f64" ] }, { "uuid": "d22c46d9-db12-4435-bbe9-802c9070ec56", "code": "D000525", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68000525", "code_system": "MESH", "references": [ "fc58d57d-23d1-4013-8f0d-57b198455c1c" ] }, { "uuid": "30c8f3f5-139f-4caf-9c10-fc18e3470231", "code": "ALPRAZOLAM", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Alprazolam", "code_system": "WIKIPEDIA", "references": [ "fc58d57d-23d1-4013-8f0d-57b198455c1c" ] }, { "uuid": "d162afaf-4cf4-4bd0-bf39-d447c59d6606", "code": "QN05BA12", "comments": "VATC|PSYCHOLEPTICS|ANXIOLYTICS|Benzodiazepine derivatives|alprazolam", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN05BA12&showdescription=yes", "code_system": "WHO-VATC", "references": [ "fc58d57d-23d1-4013-8f0d-57b198455c1c" ] }, { "uuid": "71620f70-3bff-4c70-8e08-bfc583888e80", "code": "3426", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3426", "code_system": "INN", "references": [ "fc58d57d-23d1-4013-8f0d-57b198455c1c" ] }, { "uuid": "fce231a4-64fe-415b-8cec-cda8e642edca", "code": "249-349-2", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.044.849", "code_system": "ECHA (EC/EINECS)", "references": [ "fc58d57d-23d1-4013-8f0d-57b198455c1c" ] }, { "uuid": "16b8f5ea-95e0-4e04-b47d-05a1bbabff39", "code": "2882", "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule IV.|Depressants", "type": "PRIMARY", "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111", "code_system": "DEA NO.", "references": [ "fc58d57d-23d1-4013-8f0d-57b198455c1c" ] }, { "uuid": "00bbbf30-62fe-48be-a4b5-8dd22f94f3d5", "code": "7111", "type": "PRIMARY", "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7111", "code_system": "IUPHAR", "references": [ "fc58d57d-23d1-4013-8f0d-57b198455c1c" ] }, { "uuid": "f9ebfa6c-de20-4dd2-9731-29ba59e6a8d2", "code": "m1578", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m1578?q=authorize", "code_system": "MERCK INDEX", "references": [ "fc58d57d-23d1-4013-8f0d-57b198455c1c" ] }, { "uuid": "83f1ace6-1c30-4fe9-ab46-db13ca61d1d2", "code": "596", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/596/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "fc58d57d-23d1-4013-8f0d-57b198455c1c" ] }, { "uuid": "2e7f27d0-8c95-4582-90b1-ee1537b32d50", "code": "DB00404", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB00404", "code_system": "DRUG BANK", "references": [ "fc58d57d-23d1-4013-8f0d-57b198455c1c" ] }, { "uuid": "89d8a24a-d191-40fe-aa5e-d553c104c320", "code": "SUB05370MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "fc58d57d-23d1-4013-8f0d-57b198455c1c" ] }, { "uuid": "cc25e2b9-590a-4621-a0ea-7fc8b8612f51", "code": "CHEMBL661", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL661", "code_system": "ChEMBL", "references": [ "fc58d57d-23d1-4013-8f0d-57b198455c1c" ] }, { "uuid": "76a0f9e0-68e3-4ca1-b0fc-49f0e5ad0531", "code": "2118", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2118", "code_system": "PUBCHEM", "references": [ "fc58d57d-23d1-4013-8f0d-57b198455c1c" ] }, { "uuid": "08c57288-d150-8bbc-27d3-07111ca70559", "code": "7207", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7207", "code_system": "HSDB", "references": [ "8590460d-ad0a-61ea-25c6-bf799dbfc76f" ] }, { "uuid": "b9387e63-ed44-7b13-551f-2a7fc9257d0e", "code": "DTXSID4022577", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4022577", "code_system": "EPA CompTox", "references": [ "62127aa0-2486-0c0f-d41b-58117df6255a" ] }, { "uuid": "e4c0dc9c-c8dd-b29a-5e4a-228308a56420", "code": "Alprazolam", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM335/", "code_system": "LACTMED", "references": [ "10ccaf86-ea8d-7ece-5271-32826c408f64" ] }, { "uuid": "ea2de63a-7141-45c4-c996-6b6c921ce30a", "code": "C1012", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antianxiety Agent[C28197]|Benzodiazepine", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1012", "code_system": "NCI_THESAURUS", "references": [ "10ccaf86-ea8d-7ece-5271-32826c408f64" ] }, { "uuid": "40df7884-514f-48a7-a18f-343559588a7a", "code": "YU55MQ3IZY", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "bc3fc734-dd25-e014-64bf-77013e0230f1", "code": "136", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/136", "code_system": "DRUG CENTRAL", "references": [ "10ccaf86-ea8d-7ece-5271-32826c408f64" ] }, { "uuid": "a88960fb-0c1a-5717-8e38-ae9c5d3b473c", "code": "2611", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:2611", "code_system": "CHEBI", "references": [ "10ccaf86-ea8d-7ece-5271-32826c408f64" ] }, { "uuid": "c60387a4-4b44-e62b-279c-ea0311e9a8c2", "code": "1015008", "type": "PRIMARY", "url": "https://store.usp.org/product/1015008", "code_system": "RS_ITEM_NUM", "references": [ "10ccaf86-ea8d-7ece-5271-32826c408f64" ] }, { "uuid": "c1fad9aa-1426-c5b9-fe88-9ff9b4860bb5", "code": "YU55MQ3IZY", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=YU55MQ3IZY", "code_system": "DAILYMED", "references": [ "72bf980f-94b4-d2d7-d946-810d81e82473" ] }, { "uuid": "77516229-6e93-f7c0-80e2-7c7a0a90477f", "code": "760140", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=760140", "code_system": "NSC", "references": [ "30b5d3df-0fa3-059a-515b-7ba366d6e718" ] }, { "uuid": "16984ee7-7f10-c337-ac4b-113e360b0a53", "code": "100000091908", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "29db339d-b390-de73-c8e7-95770f1c332d" ] } ], "substance_class": "chemical", "references": [ { "uuid": "68dea82d-da1c-4a00-bc98-b8ba26b2d4a1", "citation": "USP Dictionary 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "6b803cd6-1493-4de6-aa38-f6cbd094f04f", "citation": "USP DICTIONARY 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a2b682f3-7907-474e-8a37-9f4360c92295", "citation": "FDA_SRS 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e0d542ca-4912-4ccc-8528-94e4cff0742f", "citation": "INN Proposed List 30", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL30.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ef6bb150-fecf-4e05-afb5-eced1fb8b59d", "citation": "USP DICTIONARY 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c870d417-6b2b-4d4a-80ca-6acc9102853c", "citation": "EP 7.2", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ec7c44fe-7cfc-4ea4-930d-770558901038", "citation": "USP 33", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "47797be0-f353-48da-ac61-c8dbe3d993ef", "citation": "ORANGE BOOK 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5c878e4d-fe97-449e-9ecb-e1ceed38e01b", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6dc0da16-b870-4672-89e0-dab103da8ff1", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ccd77eaa-c4d8-4b95-9258-939c7e8464f7", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "449e5de8-f911-4621-99ad-590f3ec368f0", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ed05e8e0-2ffc-44cd-8f70-f789335e65a7", "citation": "NDF-RT", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "85370cc9-5d23-4c2e-ae51-9dcad3990b0b", "citation": "USP-RS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fc58d57d-23d1-4013-8f0d-57b198455c1c", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389723000, "tags": [ "NOMEN" ] }, { "uuid": "70aaaa2b-5b15-4c67-801d-cd5ade3abe41", "citation": "EP 7.8 ALPRAZOLAM MONOGRAPH", "doc_type": "EUROPEAN PHARMACOPEIA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fdf7e54a-fcde-4041-beb8-6f11be5d9b64", "citation": "EP 7.5 ALPRAZOLAM MONOGRAPH", "doc_type": "EUROPEAN PHARMACOPEIA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "48734865-5034-402e-8839-6753cbb4b7c1", "citation": "USP 35 ALPRAZOLAM MONOGRAPH", "doc_type": "USP", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4ed5f06c-9bf2-43ea-b4b1-d4200ba2594a", "citation": "USP 36 ALPRAZOLAM MONOGRAPH", "doc_type": "USP", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "99fe68d1-566e-4117-af0a-3b70e16c9536", "citation": "AGARWAL V, KOMMADDI RP, VALLI K, RYDER D, HYDE TM, ET AL. (2008) DRUG METABOLISM IN HUMAN BRAIN: HIGH LEVELS OF CYTOCHROME P4503A43 IN BRAIN AND METABOLISM OF ANTI-ANXIETY DRUG ALPRAZOLAM TO ITS ACTIVE METABOLITE", "url": "http://www.plosone.org/article/info%3Adoi%2F10.1371%2Fjournal.pone.0002337", "doc_type": "JOURNAL ARTICLE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "007a1404-9b4f-4992-90b2-671f09f278db", "citation": "BIOPHARMACEUTICS & DRUG DISPOSITIONVOLUME 22, ISSUE 2, ARTICLE FIRST PUBLISHED ONLINE: 8 NOV 2001", "url": "http://onlinelibrary.wiley.com/doi/10.1002/bdd.261/pdf", "doc_type": "JOURNAL ARTICLE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9c3ec479-9b11-461d-87c8-49af8e35a13f", "citation": "AGARWAL V, KOMMADDI RP, VALLI K, RYDER D, HYDE TM, ET AL. (2008) DRUG METABOLISM IN HUMAN BRAIN: HIGH LEVELS OF CYTOCHROME P4503A43 IN BRAIN AND METABOLISM OF ANTI-ANXIETY DRUG ALPRAZOLAM TO ITS ACTIVE METABOLITE.", "url": "http://www.plosone.org/article/info%3Adoi%2F10.1371%2Fjournal.pone.0002337", "doc_type": "JOURNAL ARTICLE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "adcbbc21-5850-46f5-910e-d2266f48de68", "citation": "SRS import [YU55MQ3IZY]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YU55MQ3IZY", "doc_type": "SRS", "public_domain": true, "document_date": 1493389723000, "tags": [ "NOMEN" ] }, { "uuid": "ee8fd479-b3f7-431b-ba72-4615839bbbf8", "citation": "USP Dictionary 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "182d1343-ee51-47ba-8caf-14ec2c1abbb5", "citation": "ALPRAZOLAM [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "5443ad1f-6505-43c0-9b68-204168767d1b", "citation": "ALPRAZOLAM [USAN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "daddb647-47ad-4f06-a5c0-a813cdc39bac", "citation": "ALPRAZOLAM [EP]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "f7bb6c3d-68d3-44d4-9f9b-ac77ca68e27a", "citation": "ALPRAZOLAM [USP]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "ba697409-cf50-4c3f-9e1d-f198322a951b", "citation": "ALPRAZOLAM [ORANGE BOOK]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "858a5843-c8d2-4dd3-bee3-e2ce7250c40a", "citation": "ALPRAZOLAM [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "bf8d9f11-638a-4205-99fd-103c43c25395", "citation": "ALPRAZOLAM [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "f2120f0b-c789-4f11-9470-3c85507d07be", "citation": "ALPRAZOLAM [HSDB]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "d91d8983-a164-43d9-9126-073b2d02b353", "citation": "ALPRAZOLAM [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "56f8a8d3-8454-4b3e-a8d0-d8e303df2efc", "citation": "ALPRAZOLAM [VANDF]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "05ba0315-9ac7-439c-aca2-242e835c531e", "citation": "ALPRAZOLAM CIV [USP-RS]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "060b1adc-9146-1c79-aec3-0c9ccb2e93a7", "citation": "JAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8590460d-ad0a-61ea-25c6-bf799dbfc76f", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+28981-97-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "0ee1d0ff-a2a4-5140-900a-ad30db2e6fad", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+28981-97-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "62127aa0-2486-0c0f-d41b-58117df6255a", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=28981-97-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f57aaba2-8b53-9f37-ab00-e9ecaff7c68f", "citation": "http://fco.factsandcomparisons.com/lco/action/doc/retrieve/docid/fc_dfc/5549277#f_pharmacokinetics", "doc_type": "LEPINDEX", "public_domain": true }, { "uuid": "80e6a5d0-9658-4a74-a251-267c5f9595ef", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "9fa6f29d-a8a3-3261-d823-b8fca776cc9b", "citation": "ALPRAZOLAM", "doc_type": "MICROMEDEX", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "10ccaf86-ea8d-7ece-5271-32826c408f64", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "5ec1fc2f-6384-4573-99c3-8fa9f6ade300", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "93ee75bc-6f97-40fb-9ab8-3d6651158db8", "citation": "Bromazolam", "url": "https://en.wikipedia.org/wiki/Bromazolam", "doc_type": "WIKI", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "cf2bb88f-38f0-45f1-a07f-a9b84079246e", "citation": "Igaku Kenkyu 1980;50(7):495", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "357cb819-cef8-4121-9b65-077cd17f1bc1", "citation": "Igaku Kenkyu 1980;50(7):495", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "107af420-dabe-46ef-a836-de1af649d903", "citation": "Igaku Kenkyu 1980;50(7):495", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "fc85f5e6-0375-d326-6e70-cb06d2385e66", "citation": "USP 10/2020", "doc_type": "USPNF", "public_domain": true }, { "uuid": "9f60cd53-e1ab-498d-ac5a-907835a25523", "citation": "Eur J Clin Pharmacol 2005 Apr;61(2):113-8", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "30b5d3df-0fa3-059a-515b-7ba366d6e718", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "87db9dce-a7a2-f896-e894-76ed822ab19f", "citation": "EP 10.5", "doc_type": "EP", "public_domain": true }, { "uuid": "72bf980f-94b4-d2d7-d946-810d81e82473", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "be4b49ac-6edf-48ae-785c-33a3db16a946", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "29db339d-b390-de73-c8e7-95770f1c332d", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "302e0520-483e-4732-8790-ed530479e0a4", "id": "302e0520-483e-4732-8790-ed530479e0a4", "molfile": "\n Marvin 01132102352D \n\n 22 25 0 0 0 0 999 V2000\n 1.3778 -0.1972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1664 -0.4669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8724 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5443 -0.4929 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2459 -1.3026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7388 -1.9485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5365 -2.7272 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7661 -3.0618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7505 -3.8866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4016 -4.3151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4016 -5.1633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6545 -5.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9719 -5.1400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9848 -4.2892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0419 -2.7194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4661 -3.2096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6796 -2.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.5287 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5006 -2.1742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1392 -1.6502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8941 -1.9174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3977 -1.2923 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 2 0 0 0 0\n 2 22 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 2 0 0 0 0\n 6 5 1 0 0 0 0\n 5 22 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 8 15 1 0 0 0 0\n 10 9 1 0 0 0 0\n 14 9 2 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 2 0 0 0 0\n 13 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 15 21 2 0 0 0 0\n 16 17 2 0 0 0 0\n 18 17 1 0 0 0 0\n 17 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\nM END", "smiles": "Cc1nnc2CN=C(c3ccccc3)c4cc(ccc4-n12)Cl", "formula": "C17H13ClN4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "1fea6063-0acd-4b25-9fa8-e3439728f198" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "308.7655", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "4d0b4f64-c90a-42f1-b239-03361fc04d25", "version": "52", "structure": { "id": "a0e99302-2e06-4662-9998-81a7b8efa7fd", "molfile": "\n Marvin 01132108212D \n\n 22 25 0 0 0 0 999 V2000\n 2.3975 -1.2922 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8940 -1.9173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0418 -2.7192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2457 -1.3025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5441 -0.4929 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7659 -3.0616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5363 -2.7270 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8722 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1663 -0.4669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7386 -1.9484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1391 -1.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4660 -3.2094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7503 -3.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6796 -2.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5006 -2.1741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.5285 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3777 -0.1972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9847 -4.2889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4014 -4.3148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4014 -5.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9718 -5.1397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6543 -5.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 2 0 0 0 0\n 4 1 1 0 0 0 0\n 5 4 2 0 0 0 0\n 6 3 1 0 0 0 0\n 7 10 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 1 1 0 0 0 0\n 10 4 1 0 0 0 0\n 11 2 1 0 0 0 0\n 12 3 1 0 0 0 0\n 13 6 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 11 2 0 0 0 0\n 16 14 1 0 0 0 0\n 17 9 1 0 0 0 0\n 18 13 2 0 0 0 0\n 19 13 1 0 0 0 0\n 20 19 2 0 0 0 0\n 21 18 1 0 0 0 0\n 22 20 1 0 0 0 0\n 5 8 1 0 0 0 0\n 6 7 2 0 0 0 0\n 12 14 2 0 0 0 0\n 21 22 2 0 0 0 0\nM END", "smiles": "Cc1nnc2CN=C(c3ccccc3)c4cc(ccc4-n12)Cl", "formula": "C17H13ClN4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "308.7655", "optical_activity": "NONE", "references": [ "adcbbc21-5850-46f5-910e-d2266f48de68", "ee8fd479-b3f7-431b-ba72-4615839bbbf8", "e0d542ca-4912-4ccc-8528-94e4cff0742f" ], "stereo_centers": 0 }, "unii": "YU55MQ3IZY", "relationships": [ { "uuid": "69807f4c-dea2-48c3-8401-29056074599f", "amount": { "uuid": "b5a17346-b67e-4fde-9539-aa581eef1891" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "6b3e7657-0c40-4f97-99aa-6bb1ee8e32b6", "refuuid": "4d0b4f64-c90a-42f1-b239-03361fc04d25", "name": "ALPRAZOLAM", "unii": "YU55MQ3IZY", "linking_id": "YU55MQ3IZY", "ref_pname": "ALPRAZOLAM", "substance_class": "reference" } }, { "uuid": "d11ce3fe-0c16-4297-8249-babfea12bc4e", "amount": { "uuid": "3341bcf4-89ae-4787-9d3b-c09cce893bdb" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "1254a621-fb73-4fc9-ba57-6908f0ad4704", "refuuid": "5f53234a-2344-4f89-89a5-f7b2b5c8776c", "name": "ALPRAZOLAM DIHYDRATE", "unii": "2I8KVA57TM", "linking_id": "2I8KVA57TM", "ref_pname": "ALPRAZOLAM DIHYDRATE", "substance_class": "reference" } }, { "uuid": "f6d9dc12-d660-4fe1-9c8a-fcb3ae722c90", "amount": { "uuid": "24e4f795-da16-4fcf-98e3-f2f8e0767586" }, "comments": "UNSPECIFIED", "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "70aaaa2b-5b15-4c67-801d-cd5ade3abe41" ], "related_substance": { "uuid": "ee617bad-f4f4-4716-be10-a2e8b5db9f7d", "refuuid": "e93ccd51-0b48-4a3b-b8d3-3bcde6ecfe99", "name": "(5-CHLORO-2-(3-(((6RS)-8-CHLORO-6-HYDROXY-1-METHYL-6-PHENYL-4H-(1,2,4)TRIAZOLO(4,3-A)(1,4)BENZODIAZEPIN-5(6H)-YL)METHYL)-5-METHYL-4H-1,2,4-TRIAZOL-4-YL)PHENYL)PHENYLMETHANONE", "unii": "68I61IKM90", "linking_id": "68I61IKM90", "ref_pname": "(5-CHLORO-2-(3-(((6RS)-8-CHLORO-6-HYDROXY-1-METHYL-6-PHENYL-4H-(1,2,4)TRIAZOLO(4,3-A)(1,4)BENZODIAZEPIN-5(6H)-YL)METHYL)-5-METHYL-4H-1,2,4-TRIAZOL-4-YL)PHENYL)PHENYLMETHANONE", "substance_class": "reference" } }, { "uuid": "d74d241b-c968-48ee-84e0-64987d682cc7", "amount": { "uuid": "93e63c67-f635-4457-ab62-e2eeb7dfabc4", "type": "RELATIONSHIP_AMOUNT", "units": "WEIGHT PERCENT", "high_limit": 101, "low_limit": 99 }, "qualification": "EP", "type": "BASIS OF STRENGTH->SUBSTANCE", "interaction_type": "CHROMATOGRAPHIC PURITY (TLC)", "references": [ "fdf7e54a-fcde-4041-beb8-6f11be5d9b64" ], "related_substance": { "uuid": "d692ef24-29c6-43c5-9a87-5f35fb289e9d", "refuuid": "4d0b4f64-c90a-42f1-b239-03361fc04d25", "name": "ALPRAZOLAM", "unii": "YU55MQ3IZY", "linking_id": "YU55MQ3IZY", "ref_pname": "ALPRAZOLAM", "substance_class": "reference" } }, { "uuid": "1b7e4452-f70d-44ed-9f38-e82ee36d32cb", "amount": { "uuid": "0b2554ce-017a-4cb3-b92a-8593509c37f5", "type": "RELATIONSHIP_AMOUNT", "units": "WEIGHT PERCENT", "high_limit": 102, "low_limit": 98 }, "qualification": "USP", "type": "BASIS OF STRENGTH->SUBSTANCE", "interaction_type": "ASSAY (HPLC)", "references": [ "48734865-5034-402e-8839-6753cbb4b7c1" ], "related_substance": { "uuid": "ffae2dd6-d8a2-4312-aa7e-37cea9e8a6bd", "refuuid": "4d0b4f64-c90a-42f1-b239-03361fc04d25", "name": "ALPRAZOLAM", "unii": "YU55MQ3IZY", "linking_id": "YU55MQ3IZY", "ref_pname": "ALPRAZOLAM", "substance_class": "reference" } }, { "uuid": "0198c02e-f7e5-4e0f-822c-4a3cadfd123d", "amount": { "uuid": "1d7d9dff-a0b4-44a2-92f0-2a002f16ac93" }, "comments": "UNSPECIFIED", "qualification": "EP", "type": "IMPURITY->PARENT", "references": [ "70aaaa2b-5b15-4c67-801d-cd5ade3abe41" ], "related_substance": { "uuid": "5c2a7257-9cb7-417d-bcaa-936dc98e2add", "refuuid": "97b14877-0d97-4bcc-9296-dd948120e13f", "name": "Oxazepam benzophenone", "unii": "FR80014ZBT", "linking_id": "FR80014ZBT", "ref_pname": "Oxazepam benzophenone", "substance_class": "reference" } }, { "uuid": "761de911-3d9c-4e40-a0f2-7fcdc8bef001", "amount": { "uuid": "209dc479-1550-404d-a599-1699b89e7c5e", "type": "RELATIONSHIP_AMOUNT", "units": "WEIGHT PERCENT", "high_limit": 0.15 }, "qualification": "USP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "4ed5f06c-9bf2-43ea-b4b1-d4200ba2594a" ], "related_substance": { "uuid": "2b13b778-0bcf-48d5-b066-d93a63e4d50b", "refuuid": "97b14877-0d97-4bcc-9296-dd948120e13f", "name": "Oxazepam benzophenone", "unii": "FR80014ZBT", "linking_id": "FR80014ZBT", "ref_pname": "Oxazepam benzophenone", "substance_class": "reference" } }, { "uuid": "fc63aebe-fe27-4f2c-be57-94621b2aadcc", "amount": { "uuid": "0590a7c0-6943-4cdd-9bc4-c879bedc242b", "type": "RELATIONSHIP_AMOUNT", "units": "WEIGHT PERCENT", "high_limit": 0.15 }, "qualification": "USP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "48734865-5034-402e-8839-6753cbb4b7c1" ], "related_substance": { "uuid": "b6d4ec12-f64d-4462-b4cd-5a8c77f3a738", "refuuid": "1d42fbc2-27ef-4f39-9ec1-c42eb4bd4fb0", "name": "2-(2-ACETYLHYDRAZINO)-7-CHLORO-5-PHENYL-3H-1,4-BENZODIAZEPINE", "unii": "50V54399VP", "linking_id": "50V54399VP", "ref_pname": "2-(2-ACETYLHYDRAZINO)-7-CHLORO-5-PHENYL-3H-1,4-BENZODIAZEPINE", "substance_class": "reference" } }, { "uuid": "620c23e6-f271-4a4d-8c95-5333c64d2e1a", "amount": { "uuid": "6ea24d1b-f3f9-427d-8dbd-407c97a78992" }, "comments": "UNSPECIFIED", "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "70aaaa2b-5b15-4c67-801d-cd5ade3abe41" ], "related_substance": { "uuid": "af42bc30-697b-4221-8ec2-e05dc670c075", "refuuid": "bd55478d-d570-425e-9bfe-8b9e3f46cc86", "name": "3-AMINO-6-CHLORO-2-METHYL-4-PHENYL-3,4-DIHYDROQUINAZOLIN-4-OL", "unii": "2XW58UPC7A", "linking_id": "2XW58UPC7A", "ref_pname": "3-AMINO-6-CHLORO-2-METHYL-4-PHENYL-3,4-DIHYDROQUINAZOLIN-4-OL", "substance_class": "reference" } }, { "uuid": "72013d69-3ea9-4523-a093-7ee72794ff39", "amount": { "uuid": "aecba7db-0310-4eff-b198-60ca798bb9d6" }, "comments": "UNSPECIFIED", "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "70aaaa2b-5b15-4c67-801d-cd5ade3abe41" ], "related_substance": { "uuid": "a50d07a0-2963-407f-b58a-48ebb5428fc1", "refuuid": "0e75aa35-6a0e-4741-84a7-1e8538545e7a", "name": "2-[3-(Hydroxymethyl)-5-methyl-4-triazolyl]-5-chlorobenzophenone", "unii": "L5ZA828Y3I", "linking_id": "L5ZA828Y3I", "ref_pname": "2-[3-(Hydroxymethyl)-5-methyl-4-triazolyl]-5-chlorobenzophenone", "substance_class": "reference" } }, { "uuid": "95babcda-20c9-43b6-b566-17ff8bdb33fb", "amount": { "uuid": "86bd445c-7684-4745-9e8b-866d0eb2e8ea" }, "comments": "UNSPECIFIED", "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "70aaaa2b-5b15-4c67-801d-cd5ade3abe41" ], "related_substance": { "uuid": "438426e4-e4c6-4d74-851f-2a5e7b03e770", "refuuid": "0902ca6a-f321-442e-9a6f-719b884ab16a", "name": "(5-CHLORO-2-(3-METHYL-4H-1,2,4-TRIAZOL-4-YL)PHENYL)PHENYLMETHANONE", "unii": "LWT0XBZ74S", "linking_id": "LWT0XBZ74S", "ref_pname": "(5-CHLORO-2-(3-METHYL-4H-1,2,4-TRIAZOL-4-YL)PHENYL)PHENYLMETHANONE", "substance_class": "reference" } }, { "uuid": "374d956c-17f2-4c01-9175-a3b8ff85397d", "amount": { "uuid": "5aa8df3b-7306-4958-9f11-4a5fb9dbc098" }, "comments": "UNSPECIFIED", "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "70aaaa2b-5b15-4c67-801d-cd5ade3abe41" ], "related_substance": { "uuid": "3daeddc7-ba46-411e-a4ad-81f96563def0", "refuuid": "dc0cc384-de75-48fd-aa17-acb6b009c9b7", "name": "8-CHLORO-1-ETHENYL-6-PHENYL-4H-(1,2,4)TRIAZOLO(4,3-A)(1,4)BENZODIAZEPINE", "unii": "XLX381O0GV", "linking_id": "XLX381O0GV", "ref_pname": "8-CHLORO-1-ETHENYL-6-PHENYL-4H-(1,2,4)TRIAZOLO(4,3-A)(1,4)BENZODIAZEPINE", "substance_class": "reference" } }, { "uuid": "42787e5d-4979-4ee6-97db-199ffb23931e", "amount": { "uuid": "14ca2ff1-95f7-49bd-b86f-6fab6d91dce7" }, "comments": "UNSPECIFIED", "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "70aaaa2b-5b15-4c67-801d-cd5ade3abe41" ], "related_substance": { "uuid": "abd276eb-b3d2-4d8e-bb0b-6ec2ec49470e", "refuuid": "234b91ac-d40f-4c89-a50d-a0883ca54be3", "name": "(5-CHLORO-2-(3-(CHLOROMETHYL)-5-METHYL-4H-1,2,4-TRIAZOL-4-YL)PHENYL)(PHENYL)METHANONE", "unii": "87BL93EY98", "linking_id": "87BL93EY98", "ref_pname": "(5-CHLORO-2-(3-(CHLOROMETHYL)-5-METHYL-4H-1,2,4-TRIAZOL-4-YL)PHENYL)(PHENYL)METHANONE", "substance_class": "reference" } }, { "uuid": "90406b86-7a1b-49ee-a52c-24646675fb0e", "amount": { "uuid": "e18f09ff-e54c-4923-afe9-f94f13d077aa" }, "comments": "UNSPECIFIED", "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "70aaaa2b-5b15-4c67-801d-cd5ade3abe41" ], "related_substance": { "uuid": "e179a633-52bd-4c00-a61d-8eedc8286ddd", "refuuid": "ad67576e-38b7-4631-b18b-328fba1096f5", "name": "7-CHLORO-1-METHYL-5-PHENYL(1,2,4)TRIAZOLO(4,3-A)QUINOLIN-4-AMINE", "unii": "R6K8F234S5", "linking_id": "R6K8F234S5", "ref_pname": "7-CHLORO-1-METHYL-5-PHENYL(1,2,4)TRIAZOLO(4,3-A)QUINOLIN-4-AMINE", "substance_class": "reference" } }, { "uuid": "a2c452df-17b9-423e-8a60-ece1821cc6e6", "amount": { "uuid": "49ba37ca-0d2f-4e23-b328-b1268a6852f7" }, "comments": "UNSPECIFIED", "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "70aaaa2b-5b15-4c67-801d-cd5ade3abe41" ], "related_substance": { "uuid": "df7d8143-7fd9-48f6-86f9-875e5bb1aae8", "refuuid": "e9b53667-c7e9-47a3-ae12-ffe8e04232e1", "name": "BIS((4-(2-BENZOYL-4-CHLOROPHENYL)-5-METHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL)AMINE", "unii": "P420EVR6EF", "linking_id": "P420EVR6EF", "ref_pname": "BIS((4-(2-BENZOYL-4-CHLOROPHENYL)-5-METHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL)AMINE", "substance_class": "reference" } }, { "uuid": "5af82bba-8ade-49e6-aab0-528573a88172", "amount": { "uuid": "29457f14-e7a4-4208-99b9-0b2934a804f6" }, "comments": "UNSPECIFIED", "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "70aaaa2b-5b15-4c67-801d-cd5ade3abe41" ], "related_substance": { "uuid": "f1841009-52de-46ac-9549-d1b712d7e90b", "refuuid": "cb827f6f-e7dc-48bc-9fb4-8ab37514c38d", "name": "2,17-DICHLORO-6,13-DIMETHYL-18B,19A-DIPHENYL-8B,19ADIHYDRO-10H,18BH-(1,2,4)TRIAZOLO(4''',3''':1'',2'')QUINOLO(3'',4'':4',5')OXAZOLO(3',2'-D)-1,2,4-TRIAZOLO(4,3-A)(1,4)BENZODIAZEPINE", "unii": "5P7J84859I", "linking_id": "5P7J84859I", "ref_pname": "2,17-DICHLORO-6,13-DIMETHYL-18B,19A-DIPHENYL-8B,19ADIHYDRO-10H,18BH-(1,2,4)TRIAZOLO(4''',3''':1'',2'')QUINOLO(3'',4'':4',5')OXAZOLO(3',2'-D)-1,2,4-TRIAZOLO(4,3-A)(1,4)BENZODIAZEPINE", "substance_class": "reference" } }, { "uuid": "456a8f8e-b5d4-4742-9d33-652a63f2c83b", "amount": { "uuid": "e7c1ac3d-a192-4a1c-aefb-8d2d59b6cb2f" }, "comments": "4-hydroxy alprazolam (4-OHALP) is the major and pharmacologically less active metabolite [of alprazolam]", "type": "METABOLITE LESS ACTIVE->PARENT", "interaction_type": "MAJOR", "references": [ "99fe68d1-566e-4117-af0a-3b70e16c9536" ], "related_substance": { "uuid": "b164de9b-a292-4224-a4f4-44671edbd6ea", "refuuid": "775a6f20-42dd-482d-8355-2ba520363661", "name": "4-HYDROXYALPRAZOLAM", "unii": "U0COM4319X", "linking_id": "U0COM4319X", "ref_pname": "4-HYDROXYALPRAZOLAM", "substance_class": "reference" } }, { "uuid": "5f1acc05-baa9-413f-b161-508203e711ec", "amount": { "uuid": "52be9b5b-ec63-472f-9a98-22898d1cc1d8" }, "type": "METABOLITE LESS ACTIVE->PARENT", "references": [ "9f60cd53-e1ab-498d-ac5a-907835a25523" ], "related_substance": { "uuid": "108e3688-4e88-462f-a321-2bbb8d125db5", "refuuid": "775a6f20-42dd-482d-8355-2ba520363661", "name": "4-HYDROXYALPRAZOLAM", "unii": "U0COM4319X", "linking_id": "U0COM4319X", "ref_pname": "4-HYDROXYALPRAZOLAM", "substance_class": "reference" } }, { "uuid": "0fe826e3-7820-46d4-aa62-8d5fe9367b7f", "amount": { "uuid": "f590b673-d2eb-4e86-987f-67a50e10e46a" }, "comments": "α-Hydroxy alprazolam (α-OHALP) is the minor but pharmacologically active metabolite", "type": "METABOLITE ACTIVE->PARENT", "interaction_type": "MINOR", "mediator_substance": { "uuid": "4b60f796-5e5b-4f65-9473-3fc4e003c55d", "refuuid": "4275827d-e329-4907-95b5-7d690692872a", "name": "CYTOCHROME P450 3A4", "unii": "PUO0521HZV", "linking_id": "PUO0521HZV", "ref_pname": "CYTOCHROME P450 3A4", "substance_class": "reference" }, "references": [ "9c3ec479-9b11-461d-87c8-49af8e35a13f" ], "related_substance": { "uuid": "d07a4394-60a4-4abc-a425-70a5fdbc1278", "refuuid": "979dc170-bd60-42dd-8b07-a936bb916f0d", "name": ".ALPHA.-HYDROXYALPRAZOLAM", "unii": "V7J2Z5Y50U", "linking_id": "V7J2Z5Y50U", "ref_pname": ".ALPHA.-HYDROXYALPRAZOLAM", "substance_class": "reference" } }, { "uuid": "125e6eaa-478f-4600-b02b-68f4c1e576a6", "amount": { "uuid": "de4eb4e1-0ace-4b24-875d-e7d93260ff82" }, "type": "METABOLITE ACTIVE->PARENT", "mediator_substance": { "uuid": "11c5c1bb-5791-458b-9d20-c2fe12255a43", "refuuid": "4275827d-e329-4907-95b5-7d690692872a", "name": "CYTOCHROME P450 3A4", "unii": "PUO0521HZV", "linking_id": "PUO0521HZV", "ref_pname": "CYTOCHROME P450 3A4", "substance_class": "reference" }, "references": [ "357cb819-cef8-4121-9b65-077cd17f1bc1" ], "related_substance": { "uuid": "d5b00d91-6dd5-400d-a33a-5e827269227c", "refuuid": "979dc170-bd60-42dd-8b07-a936bb916f0d", "name": ".ALPHA.-HYDROXYALPRAZOLAM", "unii": "V7J2Z5Y50U", "linking_id": "V7J2Z5Y50U", "ref_pname": ".ALPHA.-HYDROXYALPRAZOLAM", "substance_class": "reference" } }, { "uuid": "f5c319c4-3ee8-4860-8f64-f331df121240", "amount": { "uuid": "46bd9cbe-5433-48b0-9522-2856d026b249", "average": 80, "units": "%" }, "type": "BINDER->LIGAND", "interaction_type": "BINDING", "references": [ "f57aaba2-8b53-9f37-ab00-e9ecaff7c68f" ], "related_substance": { "uuid": "345eb3d7-14b3-4e2f-b159-56f5239a4423", "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30", "name": "PLASMA PROTEIN FRACTION (HUMAN)", "unii": "6D53G0FD0Z", "linking_id": "6D53G0FD0Z", "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)", "substance_class": "reference" } }, { "uuid": "16e10c8a-08d3-4508-8d9d-a53a6dd6d337", "type": "DERIVATIVE->PARENT", "references": [ "93ee75bc-6f97-40fb-9ab8-3d6651158db8" ], "related_substance": { "uuid": "76492d68-08d7-44b8-aa89-b854afeac468", "refuuid": "acef84d2-1e21-44a0-bec6-3843b31c60c6", "name": "BROMAZOLAM", "unii": "YMC9OT97Z1", "linking_id": "YMC9OT97Z1", "ref_pname": "BROMAZOLAM" } }, { "uuid": "361f783f-95ec-405d-84e2-40ede8d2e41a", "type": "SOLVATE->ANHYDROUS", "references": [ "80e6a5d0-9658-4a74-a251-267c5f9595ef" ], "related_substance": { "uuid": "e60e654c-b594-4ceb-8181-2276ed274b91", "refuuid": "5f53234a-2344-4f89-89a5-f7b2b5c8776c", "name": "ALPRAZOLAM DIHYDRATE", "unii": "2I8KVA57TM", "linking_id": "2I8KVA57TM", "ref_pname": "ALPRAZOLAM DIHYDRATE", "substance_class": "reference" } } ], "names": [ { "uuid": "567a419f-db15-431e-8d62-014c4c7a2741", "name": "4H-(1,2,4)TRIAZOLO(4,3-.ALPHA.)(1,4)BENZODIAZEPINE, 8-CHLORO-1-METHYL-6-PHENYL-", "stdName": "4H-(1,2,4)TRIAZOLO(4,3-.ALPHA.)(1,4)BENZODIAZEPINE, 8-CHLORO-1-METHYL-6-PHENYL-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6b803cd6-1493-4de6-aa38-f6cbd094f04f" ], "display_name": false }, { "uuid": "331c912f-b698-4992-9bb1-0e9b714cc8a7", "name": "8-Chloro-1-methyl-6-phenyl-4H-S-triazolo[4,3-α][1,4]benzodiazepine", "stdName": "8-CHLORO-1-METHYL-6-PHENYL-4H-S-TRIAZOLO(4,3-.ALPHA.)(1,4)BENZODIAZEPINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6b803cd6-1493-4de6-aa38-f6cbd094f04f" ], "display_name": false }, { "uuid": "39c04628-c596-4fca-83f7-ea718898ed29", "name": "ALPRAZOLAM", "stdName": "ALPRAZOLAM", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "bf8d9f11-638a-4205-99fd-103c43c25395", "47797be0-f353-48da-ac61-c8dbe3d993ef", "c870d417-6b2b-4d4a-80ca-6acc9102853c", "f7bb6c3d-68d3-44d4-9f9b-ac77ca68e27a", "5443ad1f-6505-43c0-9b68-204168767d1b", "ec7c44fe-7cfc-4ea4-930d-770558901038", "56f8a8d3-8454-4b3e-a8d0-d8e303df2efc", "68dea82d-da1c-4a00-bc98-b8ba26b2d4a1", "f2120f0b-c789-4f11-9470-3c85507d07be", "858a5843-c8d2-4dd3-bee3-e2ce7250c40a", "e0d542ca-4912-4ccc-8528-94e4cff0742f", "6dc0da16-b870-4672-89e0-dab103da8ff1", "d91d8983-a164-43d9-9126-073b2d02b353", "5c878e4d-fe97-449e-9ecb-e1ceed38e01b", "182d1343-ee51-47ba-8caf-14ec2c1abbb5", "ccd77eaa-c4d8-4b95-9258-939c7e8464f7", "449e5de8-f911-4621-99ad-590f3ec368f0", "daddb647-47ad-4f06-a5c0-a813cdc39bac", "ba697409-cf50-4c3f-9e1d-f198322a951b", "ed05e8e0-2ffc-44cd-8f70-f789335e65a7", "ef6bb150-fecf-4e05-afb5-eced1fb8b59d" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "f1221d1d-eeab-44dc-babe-f2dc9e1301c8", "name_org": "INN" }, { "uuid": "fa9f6e9a-d48c-436e-9361-d0718c89a47e", "name_org": "USAN" } ] }, { "uuid": "6ad7bdf3-2bfc-49f7-9118-694ec219f739", "name": "ALPRAZOLAM CIV", "stdName": "ALPRAZOLAM CIV", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "05ba0315-9ac7-439c-aca2-242e835c531e", "85370cc9-5d23-4c2e-ae51-9dcad3990b0b" ], "display_name": false }, { "uuid": "de30e029-408c-3ee6-e953-e656b713957f", "name": "ALPRAZOLAM [EP IMPURITY]", "stdName": "ALPRAZOLAM [EP IMPURITY]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c870d417-6b2b-4d4a-80ca-6acc9102853c" ], "display_name": false }, { "uuid": "146c3670-bf18-c3af-3333-51fbe4f1c8c5", "name": "ALPRAZOLAM [EP MONOGRAPH]", "stdName": "ALPRAZOLAM [EP MONOGRAPH]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "87db9dce-a7a2-f896-e894-76ed822ab19f" ], "display_name": false }, { "uuid": "38e773ba-269c-436b-9cdd-1ac243c99c34", "name": "ALPRAZOLAM [HSDB]", "stdName": "ALPRAZOLAM [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ccd77eaa-c4d8-4b95-9258-939c7e8464f7" ], "display_name": false }, { "uuid": "9de35c80-4646-493c-9ad0-7ceae0fbd57b", "name": "ALPRAZOLAM [JAN]", "stdName": "ALPRAZOLAM [JAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "060b1adc-9146-1c79-aec3-0c9ccb2e93a7" ], "display_name": false }, { "uuid": "ce6b5cd0-0dd6-4f77-8df2-d263ee2f61cc", "name": "ALPRAZOLAM [MART.]", "stdName": "ALPRAZOLAM [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5c878e4d-fe97-449e-9ecb-e1ceed38e01b" ], "display_name": false }, { "uuid": "3f991bed-06d9-44fb-8db4-c01cbb5541c7", "name": "ALPRAZOLAM [MI]", "stdName": "ALPRAZOLAM [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6dc0da16-b870-4672-89e0-dab103da8ff1" ], "display_name": false }, { "uuid": "30865d60-04a7-4e33-a638-b29a1d2d910e", "name": "ALPRAZOLAM [ORANGE BOOK]", "stdName": "ALPRAZOLAM [ORANGE BOOK]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "47797be0-f353-48da-ac61-c8dbe3d993ef" ], "display_name": false }, { "uuid": "e17dfed8-d3ea-4014-94e5-aed38f25f6b8", "name": "ALPRAZOLAM [USAN]", "stdName": "ALPRAZOLAM [USAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ef6bb150-fecf-4e05-afb5-eced1fb8b59d" ], "display_name": false }, { "uuid": "348fe8c4-4321-68fd-1d11-baa0df355cd3", "name": "ALPRAZOLAM [USP MONOGRAPH]", "stdName": "ALPRAZOLAM [USP MONOGRAPH]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fc85f5e6-0375-d326-6e70-cb06d2385e66" ], "display_name": false }, { "uuid": "f177e11d-50eb-467e-9ffd-53bd9fbb3d26", "name": "ALPRAZOLAM [VANDF]", "stdName": "ALPRAZOLAM [VANDF]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ed05e8e0-2ffc-44cd-8f70-f789335e65a7" ], "display_name": false }, { "uuid": "a903915d-7b9d-abb5-32eb-a75fc44784d3", "name": "Alprazolam [WHO-DD]", "stdName": "ALPRAZOLAM [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "be4b49ac-6edf-48ae-785c-33a3db16a946" ], "display_name": false }, { "uuid": "bd42a271-7f6b-4910-9caa-30a788dfe37d", "name": "NIRAVAM", "stdName": "NIRAVAM", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "6b803cd6-1493-4de6-aa38-f6cbd094f04f" ], "display_name": false }, { "uuid": "4a1ddc35-44e6-9c12-c033-dc3298348b6d", "name": "NSC-760140", "stdName": "NSC-760140", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "30b5d3df-0fa3-059a-515b-7ba366d6e718" ], "display_name": false }, { "uuid": "b39b5846-53fe-4f6a-86dc-99887130767e", "name": "U 31,889", "stdName": "U 31,889", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "a2b682f3-7907-474e-8a37-9f4360c92295" ], "display_name": false }, { "uuid": "82bd785c-c70b-4b37-aa02-8c40c35ac3e0", "name": "U-31,889", "stdName": "U-31,889", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "6b803cd6-1493-4de6-aa38-f6cbd094f04f" ], "display_name": false }, { "uuid": "c44cfb23-4c4c-4120-af92-8e88289d2fd4", "name": "U-31889", "stdName": "U-31889", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "a2b682f3-7907-474e-8a37-9f4360c92295" ], "display_name": false }, { "uuid": "7b5d8d3e-ed8d-49a2-bd29-8aa48837a99d", "name": "XANAX", "stdName": "XANAX", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "6b803cd6-1493-4de6-aa38-f6cbd094f04f" ], "display_name": false }, { "uuid": "dda76da8-f326-4116-8cea-89defda35047", "name": "alprazolam [INN]", "stdName": "ALPRAZOLAM [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e0d542ca-4912-4ccc-8528-94e4cff0742f" ], "display_name": false } ], "properties": [ { "uuid": "5e6e0979-1822-4bf5-a9ee-25eb4fab0008", "name": "Biological Half-life", "value": { "uuid": "ef78e59a-afc4-43b1-b270-15da737426ef", "average": 11.2, "high": 26.9, "low": 6.3, "units": "hours", "non_numeric_value": "IMMEDIATE-RELEASE" }, "defining": false, "parameters": [ { "uuid": "21cd1cd2-e8c4-4ba5-9b99-a9bf9c2a1075", "name": "EXTENDED-RELEASE", "value": { "uuid": "5e199cc3-0fb5-4779-961d-0ba3c70724fb", "high": 15.8, "low": 10.7, "units": "hours", "references": [] }, "references": [] }, { "uuid": "267d0198-e6e3-453f-9bcb-7e963f157440", "name": "ORALLY DISINTEGRATING TABLET", "value": { "uuid": "3eab312c-2244-42e3-8b0d-8e8a18653807", "average": 12.5, "high": 19.2, "low": 7.9, "units": "hours", "references": [] }, "references": [] }, { "uuid": "2d317b9b-9317-4d58-b92f-c856ac8cfb6f", "name": "ALCOHOLIC LIVER DISEASE", "value": { "uuid": "24b3cf3e-9f4f-4baf-85f3-31710ada2726", "average": 19.7, "high": 65.3, "low": 5.8, "units": "hours", "references": [] }, "references": [] }, { "uuid": "d178fe84-98a1-40ef-9bb9-5871ede3d710", "name": "ELDERLY", "value": { "uuid": "db3547a4-a2fc-4792-bac8-c0dc5d65c799", "average": 16.3, "high": 26.9, "low": 9, "units": "hours", "references": [] }, "references": [] } ], "property_type": "PHARMACOKINETIC", "references": [ "f57aaba2-8b53-9f37-ab00-e9ecaff7c68f" ] }, { "uuid": "98161589-1013-47a0-8255-947139b3f054", "name": "Volume of Distribution", "value": { "uuid": "1e0d55c1-adb9-4fe1-9cad-0e5c9e364206", "high": 1.42, "low": 0.84, "units": "Liters/Kilogram" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "f57aaba2-8b53-9f37-ab00-e9ecaff7c68f" ] }, { "uuid": "5db7f83e-785d-4380-b3f0-5bdefa193b05", "name": "MAXIMUM TOLERATED DOSE", "value": { "uuid": "d35787f2-1323-489e-be55-410ddde93c16", "average": 4, "units": "mg/day", "non_numeric_value": "IN DIVIDED DOSES" }, "defining": false, "parameters": [ { "uuid": "b622efbb-0d37-4c91-b00c-03056f952c56", "name": "ROUTE OF ADMINISTRATION", "value": { "uuid": "2659df51-b601-4fec-82c1-79c7d3294119", "references": [], "non_numeric_value": "IMMEDIATE-RELEASE OR ORALLY DISINTEGRATING TABLET" }, "references": [] } ], "property_type": "TOXICITY", "references": [ "9fa6f29d-a8a3-3261-d823-b8fca776cc9b" ] }, { "uuid": "c5ad4af1-cf0d-4385-afdb-9fbaa338c992", "name": "Tmax", "value": { "uuid": "051676e2-eb1e-48c7-ab7d-0e2011a19899", "high": 2, "low": 1.5, "units": "hours", "non_numeric_value": "ORAL, DISINTEGRATING TABLET" }, "defining": false, "parameters": [ { "uuid": "b837021d-9fe9-44bc-88b1-a661987e2e66", "name": "ORAL, EXTENDED-RELEASE TABLET", "value": { "uuid": "5d4d6adf-1567-4682-9b4a-83cf43abd464", "high": 11, "low": 5, "units": "hours", "references": [], "non_numeric_value": "DECREASED BY ONE HOUR WITH NIGHT DOSING" }, "references": [] }, { "uuid": "75a9ecee-e32a-4971-8331-7c8351a9d52e", "name": "ORAL, IMMEDIATE-RELEASE TABLET", "value": { "uuid": "0cdd4e40-adbe-43b1-b572-fc3a23d1efb8", "high": 2, "low": 1, "units": "hours", "references": [] }, "references": [] } ], "property_type": "PHARMACOKINETIC", "references": [ "9fa6f29d-a8a3-3261-d823-b8fca776cc9b" ] }, { "uuid": "ba95b4a5-cd95-40ff-ac87-43f048f5669f", "name": "ORAL BIOAVAILABILITY", "value": { "uuid": "ed53d6e1-0f8e-403c-ac6d-395fe7458d6b", "type": "MOLE PERCENT OF AMOUNT ADMINISTERED", "average": 90, "units": "%", "non_numeric_value": "EXTENDED-RELEASE" }, "defining": false, "parameters": [ { "uuid": "4e6f7492-0159-4b05-8f32-d90e6e76800c", "name": "IMMEDIATE-RELEASE", "type": "PHARMACOKINETIC", "value": { "uuid": "11fd9edf-8e8a-4a7f-86f6-dccf4028f530", "type": "MOLE PERCENT OF AMOUNT ADMINISTERED", "high": 92, "low": 84, "units": "%", "references": [] }, "references": [] } ], "property_type": "PHARMACOKINETIC", "references": [ "f57aaba2-8b53-9f37-ab00-e9ecaff7c68f" ] }, { "uuid": "3b8edd9c-2277-4122-9a97-6614b276ce0f", "name": "RENAL CLEARANCE", "value": { "uuid": "a865bd2e-d3e0-4bc7-889e-bea7d9276048", "average": 371, "units": "mL/hr" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "9fa6f29d-a8a3-3261-d823-b8fca776cc9b" ] } ], "modifications": { "uuid": "b65c9fb8-bcec-4101-a660-a3e27271d9f1" } } ] }