{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6d8d25d6-2cb1-42fa-af13-1729f0e5b804",
          "code": "76972760",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/76972760",
          "code_system": "PUBCHEM",
          "references": [
            "bafe0f78-f2ea-4077-9174-c43ecc961e47"
          ]
        },
        {
          "uuid": "9636b919-9a6a-48b3-9887-75516b67de50",
          "code": "YTM71D696J",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "be4965dd-c61b-4b53-8ef4-607fd31f911d",
          "name": "ZINC MAGNESIUM ASPARTATE",
          "stdName": "ZINC MAGNESIUM ASPARTATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a0e37499-ad7c-4009-bce4-5e4c0b346e67",
            "ee16c50c-a45b-4f54-bfce-aa0924f53ac8",
            "0dfe0279-bb61-4fa2-ba4d-1346b42849db"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4f06fbd9-485e-4e5e-b978-f0d43fb86a41",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "ee16c50c-a45b-4f54-bfce-aa0924f53ac8",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a0e37499-ad7c-4009-bce4-5e4c0b346e67",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bafe0f78-f2ea-4077-9174-c43ecc961e47",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391628000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f6cd32c-5498-4b72-8f61-cde8f2549072",
          "citation": "SRS import [YTM71D696J]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YTM71D696J",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391628000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe48476e-0466-4a46-869e-3a336dfcd039",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0dfe0279-bb61-4fa2-ba4d-1346b42849db",
          "citation": "ZINC MAGNESIUM ASPARTATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8fa6941f-b3f2-4af5-a9f1-3d6b40b6c8a0",
          "id": "8fa6941f-b3f2-4af5-a9f1-3d6b40b6c8a0",
          "molfile": "\n  Marvin  01132107272D          \n\n  1  0  0  0  1  0            999 V2000\n   12.1716  -10.4283    0.0000 Mg  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Mg+2]",
          "formula": "Mg",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1405958e-83f7-4d3a-b66d-8874f8714007"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "24.3051",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "0f2265f4-6637-4dff-b27b-d1d1138488f0",
          "id": "0f2265f4-6637-4dff-b27b-d1d1138488f0",
          "molfile": "\n  Marvin  01132101012D          \n\n  1  0  0  0  1  0            999 V2000\n   10.2366  -10.4260    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "aff52bea-3678-4dd1-bb4e-2148af449d3e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "2e6d0146-4217-409d-a332-9503f32967c9",
          "id": "2e6d0146-4217-409d-a332-9503f32967c9",
          "molfile": "\n  Marvin  01132102302D          \n\n  9  8  0  0  1  0            999 V2000\n    6.9276   -8.6370    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.2138   -8.2245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9276   -9.4620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2045   -9.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2045  -10.6995    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.4908   -9.4574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6413   -8.2245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3550   -8.6370    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.6413   -7.3995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  7  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  2  0  0  0  0\nM  CHG  2   5  -1   8  -1\nM  END",
          "smiles": "C([C@@H](C(=O)[O-])N)C(=O)[O-]",
          "formula": "C4H5NO4",
          "atropisomerism": "No",
          "charge": -2,
          "count": 2,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "339b90b0-cf94-4fb9-a4db-cfd897458650"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "131.087",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "190fa462-4c0f-41e0-a51d-97a1ef0d9697",
      "version": "3",
      "structure": {
        "id": "d1d0d4b5-c3ef-4927-8c93-82ce6b641d6e",
        "molfile": "\n  Marvin  01132110512D          \n\n 20 16  0  0  1  0            999 V2000\n    8.3550   -8.6370    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.6413   -8.2245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6413   -7.3995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9276   -8.6370    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.2138   -8.2245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9276   -9.4620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2045   -9.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2045  -10.6995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4908   -9.4574    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.2366  -10.4260    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n   12.1716  -10.4283    0.0000 Mg  0  2  0  0  0  0  0  0  0  0  0  0\n    8.3550   -8.6370    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.6413   -8.2245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6413   -7.3995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9276   -8.6370    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.2138   -8.2245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9276   -9.4620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2045   -9.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2045  -10.6995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4908   -9.4574    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  6  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  6  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\nM  CHG  6   1  -1   9  -1  10   2  11   2  12  -1  20  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   1   2   3   4   5   6   7   8   9  12  13  14  15  16  17\nM  SAL   1  3  18  19  20\nM  SPA   1  9   1   2   3   4   5   6   7   8   9\nM  SDI   1  4    5.0708  -11.1195    5.0708   -6.9795\nM  SDI   1  4    8.7750   -6.9795    8.7750  -11.1195\nM  SMT   1 2\nM  END",
        "smiles": "C([C@@H](C(=O)[O-])N)C(=O)[O-].C([C@@H](C(=O)[O-])N)C(=O)[O-].[Mg+2].[Zn+2]",
        "formula": "2C4H5NO4.Mg.Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "351.8746",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "8f6cd32c-5498-4b72-8f61-cde8f2549072",
          "fe48476e-0466-4a46-869e-3a336dfcd039"
        ],
        "stereo_centers": 2
      },
      "unii": "YTM71D696J"
    }
  ]
}