{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c0d73ba1-fd94-48e5-adec-e65f2ee14ec8",
          "code": "89-78-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=89-78-1",
          "code_system": "CAS",
          "references": [
            "00390179-62b1-4a08-8fc6-613c3c32253f",
            "2723ea91-ac52-4b6f-a6bb-ccb323bd7bd8"
          ]
        },
        {
          "uuid": "83ef9aae-6e1c-4adb-a7e6-5675cee5645c",
          "code": "C75073",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C75073",
          "code_system": "NCI_THESAURUS",
          "references": [
            "00390179-62b1-4a08-8fc6-613c3c32253f"
          ]
        },
        {
          "uuid": "a818e7ef-2bff-4ac8-8410-72dc8aafe290",
          "code": "6724",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6724",
          "code_system": "INN",
          "references": [
            "00390179-62b1-4a08-8fc6-613c3c32253f"
          ]
        },
        {
          "uuid": "d2db0c6a-80da-4bd2-aafe-4284d0afb329",
          "code": "201-939-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.763",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "00390179-62b1-4a08-8fc6-613c3c32253f"
          ]
        },
        {
          "uuid": "18e4539c-68eb-4bb1-b8c0-ff72436bcc04",
          "code": "1430390",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1430390/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "00390179-62b1-4a08-8fc6-613c3c32253f"
          ]
        },
        {
          "uuid": "fade4674-90de-442a-9c3d-589bf7007554",
          "code": "SUB10232MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "00390179-62b1-4a08-8fc6-613c3c32253f"
          ]
        },
        {
          "uuid": "b3cf27cd-b8a4-4080-bf45-400c200d6bc1",
          "code": "CHEMBL256087",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL256087",
          "code_system": "ChEMBL",
          "references": [
            "00390179-62b1-4a08-8fc6-613c3c32253f"
          ]
        },
        {
          "uuid": "c3e9b13e-aca3-4688-9c55-0021193bb729",
          "code": "CHEMBL2106989",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2106989",
          "code_system": "ChEMBL",
          "references": [
            "00390179-62b1-4a08-8fc6-613c3c32253f"
          ]
        },
        {
          "uuid": "33082977-a6e1-bec3-108f-a1009594d540",
          "code": "89-78-1",
          "type": "PRIMARY",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+89-78-1",
          "code_system": "HSDB",
          "references": [
            "f2935826-c78a-85d0-bfc7-5b1efc4ed1ac"
          ]
        },
        {
          "uuid": "f44ce3c6-33c5-4ced-91ec-eafee563a58e",
          "code": "m7175",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7175",
          "code_system": "MERCK INDEX",
          "references": [
            "83591240-702e-1761-a774-67e3ad796646"
          ]
        },
        {
          "uuid": "1927b72f-59e6-ceea-67a3-b1bfd1dd723b",
          "code": "C245",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anesthetic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C245",
          "code_system": "NCI_THESAURUS",
          "references": [
            "929e696c-7420-c854-6c28-2a941dcf753b"
          ]
        },
        {
          "uuid": "8245217c-d64c-af35-3447-d4f69c727bb7",
          "code": "C860",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Lipid[C616]|Terpene Compound",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C860",
          "code_system": "NCI_THESAURUS",
          "references": [
            "929e696c-7420-c854-6c28-2a941dcf753b"
          ]
        },
        {
          "uuid": "8423fa44-334a-4a8f-8c2c-43a3b81ca8c2",
          "code": "YS08XHA860",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "42fa29ff-a4b3-4486-0fef-ca34cd2e157e",
          "code": "DB14123",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB14123",
          "code_system": "DRUG BANK",
          "references": [
            "929e696c-7420-c854-6c28-2a941dcf753b"
          ]
        },
        {
          "uuid": "84b62ad1-c89c-fb40-babb-247711fddbc0",
          "code": "76310",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:76310",
          "code_system": "CHEBI",
          "references": [
            "929e696c-7420-c854-6c28-2a941dcf753b"
          ]
        },
        {
          "uuid": "bfd46995-7229-eb98-0a38-a572c5de7f64",
          "code": "YS08XHA860",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=YS08XHA860",
          "code_system": "DAILYMED",
          "references": [
            "65e88cb7-5a17-e897-6fd8-e6de107fccc6"
          ]
        },
        {
          "uuid": "58a713dd-c249-2b34-2c50-614700a8cdfb",
          "code": "2603",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=2603",
          "code_system": "NSC",
          "references": [
            "dbaf24d2-096e-c10e-3b0e-5e645ffae072"
          ]
        },
        {
          "uuid": "3854bc9a-508a-bd19-7fdf-f998f977cd37",
          "code": "100000080286",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "519949e0-ccf3-644f-267e-55fe2acd998e"
          ]
        },
        {
          "uuid": "ec9d7eb6-e3cd-b5f5-f07b-2ed79b185212",
          "code": "DTXSID1020805",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1020805",
          "code_system": "EPA CompTox",
          "references": [
            "73bf380a-9b10-5a00-c9d5-9d6ea31c480f"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "be3959f6-81f6-4be2-bf13-e758a450190c",
          "citation": "USP Dictionary 2007",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "33c56ef0-20d6-450f-9702-a4090c8996eb",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a9c6b2f-5cdb-481b-9b3e-d200a197d4a3",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e6d76ca-2e7f-4713-bc0e-f64a703769f1",
          "citation": "INN Proposed List 66",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL66.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9d7a6a93-0e7a-4708-a29f-bc39f8a05ee7",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ba4f865-1d51-4886-9af6-eaf4abcfc063",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "70d2837a-aeac-42e7-8158-5ecbb57eed37",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1340b939-1695-4cce-aba9-42d72e2d99e6",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c63cb246-a4c4-441b-bf8f-361f7f3c6b25",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00390179-62b1-4a08-8fc6-613c3c32253f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390743000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "969f8c70-13df-4dd8-97bd-15a18b780446",
          "citation": "HERBAL MEDICINES 4TH ED",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cdfda0a7-7409-43b0-9cfb-7748ee83caea",
          "citation": "SRS import [YS08XHA860]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YS08XHA860",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390743000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b8964f5-d927-417f-a3ba-60d411997441",
          "citation": "RACEMENTHOL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6f6e1568-1e55-4c7a-8f13-b1f4ebf9441e",
          "citation": "RACEMENTHOL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "98babc09-310d-43b4-a108-35757a56f88d",
          "citation": "RACEMENTHOL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9d1adbf3-9b6e-147d-26f1-94b593fe08e5",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f2935826-c78a-85d0-bfc7-5b1efc4ed1ac",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+89-78-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e34ae3e3-4cdb-8e5d-6ee2-5b7ebc1876be",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=89-78-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "83591240-702e-1761-a774-67e3ad796646",
          "citation": "MI",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "929e696c-7420-c854-6c28-2a941dcf753b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "edc23c83-0a18-6bd5-71b6-9a150d11788b",
          "citation": "JAN",
          "doc_type": "JAN",
          "public_domain": true
        },
        {
          "uuid": "2723ea91-ac52-4b6f-a6bb-ccb323bd7bd8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3b1551a6-78ee-ca67-7d3b-22046e5ce0e9",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "dbaf24d2-096e-c10e-3b0e-5e645ffae072",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "65e88cb7-5a17-e897-6fd8-e6de107fccc6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "73bf380a-9b10-5a00-c9d5-9d6ea31c480f",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "519949e0-ccf3-644f-267e-55fe2acd998e",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "59b5fb83-880e-4683-b6a0-5ff82ade65e2",
          "id": "59b5fb83-880e-4683-b6a0-5ff82ade65e2",
          "molfile": "\n  Marvin  01132104392D          \n\n 11 11  0  0  0  0            999 V2000\n    2.7300   -4.3269    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.0228   -4.7578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4498   -4.7324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1266   -4.3218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1063   -3.4954    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.8211   -3.0671    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.8262   -2.2813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5410   -3.4701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4067   -3.1304    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.3991   -2.2991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7401   -3.5360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1 11  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5  9  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 11  1  0  0  0  0\nM  END",
          "smiles": "CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O",
          "formula": "C10H20O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c077902f-b7b6-4410-bc86-3cc4be3b4c2a"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "156.2656",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e9ea89ce-914c-4dc5-8a22-d1d977065711",
      "version": "30",
      "structure": {
        "id": "1dfef3d8-dac0-4206-bdae-c8dbe81faa81",
        "molfile": "\n  Marvin  01132101432D          \n\n 11 11  0  0  0  0            999 V2000\n    3.4067   -3.1304    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.1063   -3.4954    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.1266   -4.3218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7401   -3.5360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8211   -3.0671    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.3991   -2.2991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4498   -4.7324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7300   -4.3269    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.8262   -2.2813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5410   -3.4701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0228   -4.7578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  2  5  1  6  0  0  0\n  1  6  1  1  0  0  0\n  7  8  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  5  1  0  0  0  0\n  8 11  1  1  0  0  0\n  7  3  1  0  0  0  0\nM  END",
        "smiles": "CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O",
        "formula": "C10H20O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "156.2656",
        "optical_activity": "( + / - )",
        "references": [
          "cdfda0a7-7409-43b0-9cfb-7748ee83caea",
          "be3959f6-81f6-4be2-bf13-e758a450190c",
          "0e6d76ca-2e7f-4713-bc0e-f64a703769f1"
        ],
        "stereo_centers": 3
      },
      "unii": "YS08XHA860",
      "relationships": [
        {
          "uuid": "18dea5e1-aec8-4e4f-a511-a0ab8bae9f4d",
          "amount": {
            "uuid": "a3654ced-f4f1-47c4-b58f-4333df3dade4"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "4a564397-5e4e-438e-8b43-fcf4727758f9",
            "refuuid": "e9ea89ce-914c-4dc5-8a22-d1d977065711",
            "name": "RACEMENTHOL",
            "unii": "YS08XHA860",
            "linking_id": "YS08XHA860",
            "ref_pname": "RACEMENTHOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c7370e8f-2986-4fbd-ac75-5482f24782b4",
          "amount": {
            "uuid": "ea5a198b-1e31-4a59-b56d-9c17ee1e5834"
          },
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "75624a3d-6829-40fc-b2ff-b90ca2bcf5ef",
            "refuuid": "600276a7-d44a-4f68-aec0-143d0f5808db",
            "name": "LEVOMENTHOL",
            "unii": "BZ1R15MTK7",
            "linking_id": "BZ1R15MTK7",
            "ref_pname": "LEVOMENTHOL",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "5915ea58-7859-49ac-80df-a42bc80b100a",
          "name": "(1R,2S,5R)-REL-5-METHYL-2-(1-METHYLETHYL)CYCLOHEXANOL",
          "stdName": "(1R,2S,5R)-REL-5-METHYL-2-(1-METHYLETHYL)CYCLOHEXANOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a9c6b2f-5cdb-481b-9b3e-d200a197d4a3",
            "9d7a6a93-0e7a-4708-a29f-bc39f8a05ee7"
          ],
          "display_name": false
        },
        {
          "uuid": "6f999e1c-ca40-4933-aaa6-f7e860be4835",
          "name": "(±)-(1R*,3R*,4S*)-MENTHOL",
          "stdName": "(+/-)-(1R*,3R*,4S*)-MENTHOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a9c6b2f-5cdb-481b-9b3e-d200a197d4a3",
            "33c56ef0-20d6-450f-9702-a4090c8996eb"
          ],
          "display_name": false
        },
        {
          "uuid": "6f83dfb5-15d4-43c4-9f61-0ae5109f25cb",
          "name": "(±)-MENTHOL",
          "stdName": "(+/-)-MENTHOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a9c6b2f-5cdb-481b-9b3e-d200a197d4a3",
            "9d7a6a93-0e7a-4708-a29f-bc39f8a05ee7"
          ],
          "display_name": false
        },
        {
          "uuid": "7d4f652f-302c-4b8a-8e14-6891fb04a3ae",
          "name": "CYCLOHEXANOL, 5-METHYL-2-(1-METHYLETHYL)-, (1.ALPHA.,2.BETA.,5.ALPHA.)-",
          "stdName": "CYCLOHEXANOL, 5-METHYL-2-(1-METHYLETHYL)-, (1.ALPHA.,2.BETA.,5.ALPHA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a9c6b2f-5cdb-481b-9b3e-d200a197d4a3",
            "9d7a6a93-0e7a-4708-a29f-bc39f8a05ee7"
          ],
          "display_name": false
        },
        {
          "uuid": "dea156b6-6ec7-44c5-8ffb-bbd659526209",
          "name": "CYCLOHEXANOL, 5-METHYL-2-(1-METHYLETHYL)-, (1R,2S,5R)-REL-",
          "stdName": "CYCLOHEXANOL, 5-METHYL-2-(1-METHYLETHYL)-, (1R,2S,5R)-REL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a9c6b2f-5cdb-481b-9b3e-d200a197d4a3",
            "9d7a6a93-0e7a-4708-a29f-bc39f8a05ee7"
          ],
          "display_name": false
        },
        {
          "uuid": "0e60b0aa-9d98-463a-9305-0d17771a3b40",
          "name": "DL-MENTHOL",
          "stdName": "DL-MENTHOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33c56ef0-20d6-450f-9702-a4090c8996eb",
            "7a9c6b2f-5cdb-481b-9b3e-d200a197d4a3"
          ],
          "display_name": false
        },
        {
          "uuid": "af289c79-76ad-b80e-d89e-8ed347b56498",
          "name": "DL-MENTHOL [JAN]",
          "stdName": "DL-MENTHOL [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edc23c83-0a18-6bd5-71b6-9a150d11788b"
          ],
          "display_name": false
        },
        {
          "uuid": "4aa1912a-304e-403b-a8b8-68dea0067e04",
          "name": "FEMA NO. 2665, (±)-",
          "stdName": "FEMA NO. 2665, (+/-)-",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ba4f865-1d51-4886-9af6-eaf4abcfc063",
            "7a9c6b2f-5cdb-481b-9b3e-d200a197d4a3"
          ],
          "display_name": false
        },
        {
          "uuid": "af68a101-486b-456a-8991-343aee9fe543",
          "name": "MEGGEZONE",
          "stdName": "MEGGEZONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a9c6b2f-5cdb-481b-9b3e-d200a197d4a3",
            "c63cb246-a4c4-441b-bf8f-361f7f3c6b25"
          ],
          "display_name": false
        },
        {
          "uuid": "d0fc3df0-ea7c-c599-142e-9788af837b9e",
          "name": "MENTHOL RACEMATE [MI]",
          "stdName": "MENTHOL RACEMATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83591240-702e-1761-a774-67e3ad796646"
          ],
          "display_name": false
        },
        {
          "uuid": "1ae132bf-4736-4628-860e-11b108dcd583",
          "name": "MENTHOL, (±)-",
          "stdName": "MENTHOL, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ba4f865-1d51-4886-9af6-eaf4abcfc063",
            "7a9c6b2f-5cdb-481b-9b3e-d200a197d4a3"
          ],
          "display_name": false
        },
        {
          "uuid": "6bd7bb32-a979-4c1a-8d26-73a8cce36e76",
          "name": "MENTHOL, CIS-1,3,TRANS-1,4-",
          "stdName": "MENTHOL, CIS-1,3,TRANS-1,4-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a9c6b2f-5cdb-481b-9b3e-d200a197d4a3",
            "9d7a6a93-0e7a-4708-a29f-bc39f8a05ee7"
          ],
          "display_name": false
        },
        {
          "uuid": "3480d57c-0447-4d12-9051-3cc61f8c5832",
          "name": "MENTHOL, DL-",
          "stdName": "MENTHOL, DL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a9c6b2f-5cdb-481b-9b3e-d200a197d4a3",
            "9d7a6a93-0e7a-4708-a29f-bc39f8a05ee7"
          ],
          "display_name": false
        },
        {
          "uuid": "6b6472c4-e6c5-47d3-8234-9161795577e5",
          "name": "NSC-2603",
          "stdName": "NSC-2603",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a9c6b2f-5cdb-481b-9b3e-d200a197d4a3",
            "9d7a6a93-0e7a-4708-a29f-bc39f8a05ee7"
          ],
          "display_name": false
        },
        {
          "uuid": "5369a6c9-658c-40d8-8b84-78cd806b6993",
          "name": "RAC-MENTHOL",
          "stdName": "RAC-MENTHOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a9c6b2f-5cdb-481b-9b3e-d200a197d4a3",
            "9d7a6a93-0e7a-4708-a29f-bc39f8a05ee7"
          ],
          "display_name": false
        },
        {
          "uuid": "fd1b474c-3b28-42e4-88d9-993a39218d74",
          "name": "RACEMENTHOL",
          "stdName": "RACEMENTHOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1340b939-1695-4cce-aba9-42d72e2d99e6",
            "6f6e1568-1e55-4c7a-8f13-b1f4ebf9441e",
            "70d2837a-aeac-42e7-8158-5ecbb57eed37",
            "be3959f6-81f6-4be2-bf13-e758a450190c",
            "7a9c6b2f-5cdb-481b-9b3e-d200a197d4a3",
            "4b8964f5-d927-417f-a3ba-60d411997441",
            "98babc09-310d-43b4-a108-35757a56f88d",
            "0e6d76ca-2e7f-4713-bc0e-f64a703769f1"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "18fc9d58-80d5-40ba-836b-842b7da6cea4",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "ef8463b6-2646-4c0c-8c77-b7f1ab8a3f5f",
          "name": "RACEMENTHOL [HSDB]",
          "stdName": "RACEMENTHOL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a9c6b2f-5cdb-481b-9b3e-d200a197d4a3",
            "70d2837a-aeac-42e7-8158-5ecbb57eed37"
          ],
          "display_name": false
        },
        {
          "uuid": "5a20e3b2-752d-4eef-a976-b4b6f16723c4",
          "name": "racementhol [INN]",
          "stdName": "RACEMENTHOL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e6d76ca-2e7f-4713-bc0e-f64a703769f1"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "eb614c38-9ea4-49f5-aa0a-a7e5822cd235"
      }
    }
  ]
}