{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "36ca4e2f-879a-4f89-8e65-57c1769e38f0",
          "code": "2162-74-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2162-74-5",
          "code_system": "CAS",
          "references": [
            "169c338a-e1c9-4ea6-b060-8369bdb48791",
            "b3bd53b8-4bd0-46ae-aedd-cbae44412285"
          ]
        },
        {
          "uuid": "1a84b226-f87c-47ff-bafc-193e979df306",
          "code": "218-487-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.016.807",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "169c338a-e1c9-4ea6-b060-8369bdb48791"
          ]
        },
        {
          "uuid": "f250517b-1d49-46a2-8bf9-e7b74b065b2e",
          "code": "75100",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/75100",
          "code_system": "PUBCHEM",
          "references": [
            "169c338a-e1c9-4ea6-b060-8369bdb48791"
          ]
        },
        {
          "uuid": "7dd4ee67-7cbd-9444-c45c-6a9badc7100c",
          "code": "DTXSID5051862",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5051862",
          "code_system": "EPA CompTox",
          "references": [
            "0d1c263c-b832-e2a8-05b5-de140c88c655"
          ]
        },
        {
          "uuid": "3cdf518f-9e53-4911-89b0-064e63027bc7",
          "code": "YPK27Z98PL",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fe42966e-3b55-8501-f7e2-d9ad6a9406bb",
          "code": "300000023951",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ff8fbb41-db60-cadb-50ff-13d2b7a9b79f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "02487aaa-b2e1-48c7-aeb5-b29c1da91099",
          "name": "2,2',6,6'-TETRAISOPROPYLDIPHENYLCARBODIIMIDE",
          "stdName": "2,2',6,6'-TETRAISOPROPYLDIPHENYLCARBODIIMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96da5dee-06c2-4e44-ac18-fc038e213751",
            "7c21ea58-3f6f-4fe5-a26e-bc550a24fcb2"
          ],
          "display_name": false
        },
        {
          "uuid": "563d164c-71d5-4487-b780-08e7e15b302b",
          "name": "BENZENAMINE, N,N'-METHANETETRAYLBIS(2,6-BIS(1-METHYLETHYL)-",
          "stdName": "BENZENAMINE, N,N'-METHANETETRAYLBIS(2,6-BIS(1-METHYLETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96da5dee-06c2-4e44-ac18-fc038e213751",
            "7c21ea58-3f6f-4fe5-a26e-bc550a24fcb2"
          ],
          "display_name": false
        },
        {
          "uuid": "00560a25-d333-441f-b6dc-3046fbb3c119",
          "name": "BIS(2,6-DIISOPROPYLPHENYL)-CARBODIIMIDE",
          "stdName": "BIS(2,6-DIISOPROPYLPHENYL)-CARBODIIMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96da5dee-06c2-4e44-ac18-fc038e213751",
            "c38c09d0-e87c-4bce-a959-8ef32b0c6e82"
          ],
          "display_name": false
        },
        {
          "uuid": "507f5df8-81a4-4d81-8df6-344042a5a11d",
          "name": "BIS(2,6-DIISOPROPYLPHENYL)CARBODIIMIDE",
          "stdName": "BIS(2,6-DIISOPROPYLPHENYL)CARBODIIMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96da5dee-06c2-4e44-ac18-fc038e213751",
            "d8bbf7a5-0c1b-4d4a-ac7d-9b0bd3aed8a3"
          ],
          "display_name": true
        },
        {
          "uuid": "f6c7c494-0503-4013-b345-e4ba6cc503aa",
          "name": "CARBO D",
          "stdName": "CARBO D",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96da5dee-06c2-4e44-ac18-fc038e213751",
            "7c21ea58-3f6f-4fe5-a26e-bc550a24fcb2"
          ],
          "display_name": false
        },
        {
          "uuid": "ad9b998d-a6d4-4f31-be6f-57b1e919edfd",
          "name": "CARBODIIMIDE, BIS(2,6-DIISOPROPYLPHENYL)-",
          "stdName": "CARBODIIMIDE, BIS(2,6-DIISOPROPYLPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96da5dee-06c2-4e44-ac18-fc038e213751",
            "7c21ea58-3f6f-4fe5-a26e-bc550a24fcb2"
          ],
          "display_name": false
        },
        {
          "uuid": "339f3f4d-12db-4cfa-968f-b9f0384d8f1c",
          "name": "N,N'-METHANETETRAYLBIS(2,6-BIS(1-METHYLETHYL)BENZENAMINE)",
          "stdName": "N,N'-METHANETETRAYLBIS(2,6-BIS(1-METHYLETHYL)BENZENAMINE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96da5dee-06c2-4e44-ac18-fc038e213751",
            "7c21ea58-3f6f-4fe5-a26e-bc550a24fcb2"
          ],
          "display_name": false
        },
        {
          "uuid": "f71c8816-5d5e-4734-bac6-b21997e6c65e",
          "name": "STABOXOL 1",
          "stdName": "STABOXOL 1",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96da5dee-06c2-4e44-ac18-fc038e213751",
            "7c21ea58-3f6f-4fe5-a26e-bc550a24fcb2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c38c09d0-e87c-4bce-a959-8ef32b0c6e82",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "96da5dee-06c2-4e44-ac18-fc038e213751",
          "citation": "SWISS MEDIC",
          "doc_type": "SWISS MEDIC",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c21ea58-3f6f-4fe5-a26e-bc550a24fcb2",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8bbf7a5-0c1b-4d4a-ac7d-9b0bd3aed8a3",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "169c338a-e1c9-4ea6-b060-8369bdb48791",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392074000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b270a80-9ead-44cc-af9a-50f2bfebcd68",
          "citation": "SRS import [YPK27Z98PL]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YPK27Z98PL",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392074000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d1c263c-b832-e2a8-05b5-de140c88c655",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2162-74-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b3bd53b8-4bd0-46ae-aedd-cbae44412285",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ff8fbb41-db60-cadb-50ff-13d2b7a9b79f",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2585fe54-4214-442c-a72e-a2cc0491a57c",
          "id": "2585fe54-4214-442c-a72e-a2cc0491a57c",
          "molfile": "\n  Marvin  01132102052D          \n\n 27 28  0  0  0  0            999 V2000\n   10.3457   -2.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6310   -2.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6310   -3.2813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9117   -2.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9117   -1.2162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1969   -0.7993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4822   -1.2162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4822   -2.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7675   -2.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3859   -3.2813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0528   -2.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1969   -2.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1969   -3.2813    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4822   -3.6933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7675   -4.1056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7675   -4.9344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0528   -5.3464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0528   -6.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7675   -6.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4822   -6.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4822   -5.3464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1969   -4.9344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1969   -4.1056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9117   -5.3464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3334   -4.9344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6188   -5.3465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3334   -4.1056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n 12  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 12  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 21  2  0  0  0  0\n 17 18  2  0  0  0  0\n 25 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  1  0  0  0  0\nM  END",
          "smiles": "CC(C)c1cccc(C(C)C)c1N=C=Nc2c(cccc2C(C)C)C(C)C",
          "formula": "C25H34N2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "86ceb102-d05c-4623-a041-a1c0311268ff"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "362.5518",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1103b985-9780-48ca-a7ae-98abb4fd1fdf",
      "version": "4",
      "structure": {
        "id": "2d8dc6e7-2f40-487c-9876-8356bc1d6948",
        "molfile": "\n  Marvin  01132102272D          \n\n 27 28  0  0  0  0            999 V2000\n    6.7675   -4.1056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4822   -3.6933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1969   -3.2813    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1969   -2.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9117   -2.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6310   -2.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3457   -2.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6310   -3.2813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9117   -1.2162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1969   -0.7993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4822   -1.2162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4822   -2.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7675   -2.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3859   -3.2813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0528   -2.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7675   -4.9344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0528   -5.3464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3334   -4.9344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6188   -5.3465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3334   -4.1056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0528   -6.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7675   -6.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4822   -6.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4822   -5.3464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1969   -4.9344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1969   -4.1056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9117   -5.3464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  5  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n  4 12  1  0  0  0  0\n  1 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 17 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 16 24  1  0  0  0  0\nM  END",
        "smiles": "CC(C)c1cccc(C(C)C)c1N=C=Nc2c(cccc2C(C)C)C(C)C",
        "formula": "C25H34N2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "362.5518",
        "optical_activity": "NONE",
        "references": [
          "d8bbf7a5-0c1b-4d4a-ac7d-9b0bd3aed8a3",
          "1b270a80-9ead-44cc-af9a-50f2bfebcd68"
        ],
        "stereo_centers": 0
      },
      "unii": "YPK27Z98PL"
    }
  ]
}