{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "e56c1ac4-6584-48c0-9166-4fc1f34c64b1", "code": "R06AE07", "comments": "ATC|RESPIRATORY SYSTEM|ANTIHISTAMINES FOR SYSTEMIC USE|ANTIHISTAMINES FOR SYSTEMIC USE|Piperazine derivatives|cetirizine", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=R06AE07&showdescription=yes", "code_system": "WHO-ATC", "references": [ "5f3be7bc-6483-4835-aa82-9cac10e38149" ] }, { "uuid": "2be7c8f5-b1ae-42c0-b0b0-cba030ccbbf5", "code": "N0000175587", "comments": "Established Pharmacologic Class [EPC]|Histamine-1 Receptor Antagonist [EPC]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175587", "code_system": "NDF-RT", "references": [ "5f3be7bc-6483-4835-aa82-9cac10e38149" ] }, { "uuid": "bdd24445-0b39-43c3-9aab-e7fe9181637d", "code": "N0000000190", "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|G-Protein-linked Receptor Interactions [MoA]|Histamine Receptor Interactions [MoA]|Histamine Receptor Antagonists [MoA]|Histamine H1 Receptor Antagonists [MoA]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000190", "code_system": "NDF-RT", "references": [ "5f3be7bc-6483-4835-aa82-9cac10e38149" ] }, { "uuid": "7b8588c0-7cc3-46c9-9343-18f9753ef5b8", "code": "QR06AE07", "comments": "VATC|ANTIHISTAMINES FOR SYSTEMIC USE|ANTIHISTAMINES FOR SYSTEMIC USE|Piperazine derivatives|cetirizine", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR06AE07&showdescription=yes", "code_system": "WHO-VATC", "references": [ "5f3be7bc-6483-4835-aa82-9cac10e38149" ] }, { "uuid": "b777622b-cda2-4841-b7f6-51ca40e760e6", "code": "83881-51-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=83881-51-0", "code_system": "CAS", "references": [ "5f3be7bc-6483-4835-aa82-9cac10e38149", "c299113d-f277-404e-b453-ff3669cacfc0" ] }, { "uuid": "ce252575-2b90-470c-990a-20ec9018ec8b", "code": "C1042", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1042", "code_system": "NCI_THESAURUS", "references": [ "5f3be7bc-6483-4835-aa82-9cac10e38149" ] }, { "uuid": "18910db9-e822-4f56-81c8-dba8d1857eec", "code": "180", "comments": "LiverTox|Respiratory|Allergy symptoms|Antihistamine", "type": "PRIMARY", "url": "https://livertox.nlm.nih.gov/Cetirizine.htm", "code_system": "LIVERTOX", "references": [ "5f3be7bc-6483-4835-aa82-9cac10e38149" ] }, { "uuid": "dd42e85f-7732-4bd0-8733-84f232c84e3e", "code": "D017332", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68017332", "code_system": "MESH", "references": [ "5f3be7bc-6483-4835-aa82-9cac10e38149" ] }, { "uuid": "1fdc745a-8d6a-4bc7-9bda-6644e2f4326b", "code": "CETIRIZINE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Cetirizine", "code_system": "WIKIPEDIA", "references": [ "5f3be7bc-6483-4835-aa82-9cac10e38149" ] }, { "uuid": "61d62208-4138-4780-8eb5-72a32e3f1164", "code": "5520", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5520", "code_system": "INN", "references": [ "5f3be7bc-6483-4835-aa82-9cac10e38149" ] }, { "uuid": "e21020f8-afeb-41fe-a492-23eb7809c555", "code": "1222", "type": "PRIMARY", "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=1222", "code_system": "IUPHAR", "references": [ "5f3be7bc-6483-4835-aa82-9cac10e38149" ] }, { "uuid": "74e2427c-ec07-4b03-970c-1777d739f624", "code": "m3291", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m3291?q=authorize", "code_system": "MERCK INDEX", "references": [ "5f3be7bc-6483-4835-aa82-9cac10e38149" ] }, { "uuid": "93af8085-6f87-4727-b97c-ae77e3b01e3e", "code": "20610", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/20610/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "5f3be7bc-6483-4835-aa82-9cac10e38149" ] }, { "uuid": "5e3612ca-b118-44ab-9c71-6e14222b2984", "code": "DB00341", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB00341", "code_system": "DRUG BANK", "references": [ "5f3be7bc-6483-4835-aa82-9cac10e38149" ] }, { "uuid": "a5d43a4d-fbd7-43c6-bd44-c574c0493c5c", "code": "SUB07451MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "5f3be7bc-6483-4835-aa82-9cac10e38149" ] }, { "uuid": "1e96ba91-4f46-47b7-8a86-6f0ef6f386e3", "code": "CHEMBL1000", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1000", "code_system": "ChEMBL", "references": [ "5f3be7bc-6483-4835-aa82-9cac10e38149" ] }, { "uuid": "9423cfe1-dcf9-4542-9c9a-63399957e2f5", "code": "2678", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2678", "code_system": "PUBCHEM", "references": [ "5f3be7bc-6483-4835-aa82-9cac10e38149" ] }, { "uuid": "ee7b0a99-bcf4-ae2a-0615-ccea2119df2a", "code": "7739", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7739", "code_system": "HSDB", "references": [ "c33aab3e-6a46-0203-f0ef-52cce7022974" ] }, { "uuid": "32f9ea65-1a5d-23d4-9e50-e7c51b462bd2", "code": "DTXSID4022787", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4022787", "code_system": "EPA CompTox", "references": [ "1a3add92-9d69-fbf1-a706-0668f35cbf32" ] }, { "uuid": "1bf46452-a520-acfe-9009-9393c48cfd9e", "code": "C29578", "comments": "Pharmacologic Substance[C1909]|Immunotherapeutic Agent[C308]|Histamine-1 Receptor Antagonist", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29578", "code_system": "NCI_THESAURUS", "references": [ "426ca584-5a6b-bea9-e309-7e3992e52da4" ] }, { "uuid": "f6b6f72c-c7db-400f-8b26-11db473d06de", "code": "YO7261ME24", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "215fa918-238d-649a-96eb-c02612effddc", "code": "Cetirizine", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM62/", "code_system": "LACTMED", "references": [ "426ca584-5a6b-bea9-e309-7e3992e52da4" ] }, { "uuid": "aa19446e-ed11-41d1-7103-4336ee88274b", "code": "581", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/581", "code_system": "DRUG CENTRAL", "references": [ "426ca584-5a6b-bea9-e309-7e3992e52da4" ] }, { "uuid": "b42a726d-0a15-b37f-e0e5-cde0d4eb8c9e", "code": "3561", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3561", "code_system": "CHEBI", "references": [ "426ca584-5a6b-bea9-e309-7e3992e52da4" ] }, { "uuid": "94728ee0-ef21-5186-b652-041449d8d346", "code": "YO7261ME24", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=YO7261ME24", "code_system": "DAILYMED", "references": [ "60ae194a-4f46-9b2e-e7b3-f6c5d27d0d0d" ] }, { "uuid": "853cfa19-8b2c-93d1-02ed-45b1cf7aa630", "code": "100000081513", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "dd198679-127e-e9ba-0982-cdd9253987b7" ] } ], "substance_class": "chemical", "references": [ { "uuid": "528b72c5-d244-4c0f-85d6-3343a13f35ca", "citation": "USP DICTIONARY 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "2158df88-22c9-493e-9629-1a5f82073a59", "citation": "USP DICTIONARY 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a9131706-b877-4dc2-b7d0-ff64e73da8f5", "citation": "INN Proposed List 51", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL51.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "bceec8d9-ff84-4940-b482-310c52435e31", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a3a4c110-6fb6-4d97-b141-f1efa50c7ba0", "citation": "KEGG 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "919ac027-2f04-4da7-a1e8-f2ce8d7018d7", "citation": "D07662", "doc_type": "KEGG", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6b20ff06-3034-4961-82f5-a929510debab", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f741f2f2-501a-4b61-82d3-231a528ac084", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "68377922-f7c0-40e7-9024-63293a3c8a3e", "citation": "CLIN TRIALS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c7ae74de-c48d-48ee-aeb3-62b4d5e087b6", "citation": "NDF-RT", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5f3be7bc-6483-4835-aa82-9cac10e38149", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389917000, "tags": [ "NOMEN" ] }, { "uuid": "9011ab0c-63ad-4cf2-a76e-b01ecf7fe362", "citation": "https://en.wikipedia.org/wiki/Cetirizine", "url": "https://en.wikipedia.org/wiki/Cetirizine", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d4b6e32d-bc60-4738-b31a-adabbac1faaa", "citation": "SRS import [YO7261ME24]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YO7261ME24", "doc_type": "SRS", "public_domain": true, "document_date": 1493389917000, "tags": [ "NOMEN" ] }, { "uuid": "648aaa00-fa0b-4c0f-9fbf-166d590cf588", "citation": "USP Dictionary 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a5c3e0fa-5c3b-431d-b494-0a4cee1d70e7", "citation": "CETIRIZINE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2dfe8c0b-9224-4627-b98f-2f9901eceb2f", "citation": "CETIRIZINE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "a774e41c-82db-41bf-9317-9159af1e9933", "citation": "CETIRIZINE [HSDB]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "f100c370-a97a-4559-a9b1-91cb4d736737", "citation": "CETIRIZINE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "1404bee8-acc0-4d97-b4e4-67f2ab8edeab", "citation": "CETIRIZINE [VANDF]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "77d35478-8ebc-a3d2-7dd2-6b4c4eea0b6a", "citation": "Pharmacol Rev 65:578–640, April 2013", "url": "http://dx.doi.org/10.1124/pr.111.005439", "doc_type": "JA", "public_domain": true }, { "uuid": "c33aab3e-6a46-0203-f0ef-52cce7022974", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+83881-51-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "1a3add92-9d69-fbf1-a706-0668f35cbf32", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=83881-51-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "56409fe7-0fbc-48a9-d277-b79ef25fcf56", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+83881-51-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c0f18ea4-e005-5b0a-f146-1080bf2c000d", "citation": "http://fco.factsandcomparisons.com/lco/action/doc/retrieve/docid/fc_dfc/5549081#f_pharmacokinetics", "doc_type": "LEPINDEX", "public_domain": true }, { "uuid": "426ca584-5a6b-bea9-e309-7e3992e52da4", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "c299113d-f277-404e-b453-ff3669cacfc0", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "60ae194a-4f46-9b2e-e7b3-f6c5d27d0d0d", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "eab9f75e-dfb2-4b5c-39e2-bfe0a3e4b8b7", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "dd198679-127e-e9ba-0982-cdd9253987b7", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "90c3a0f3-13cf-4c69-836d-19402e11f743", "citation": "Kikuchi, Ryota, Sonia M. de Morais, and J. Cory Kalvass. \"In vitro P-glycoprotein efflux ratio can predict the in vivo brain penetration regardless of biopharmaceutics drug disposition classification system class.\" Drug Metabolism and Disposition 41.12 (2013): 2012-2017.", "url": "https://dmd.aspetjournals.org/content/dmd/41/12/2012.full.pdf", "doc_type": "JA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "71a7c513-0726-44e8-bb67-2dce098642d7", "id": "71a7c513-0726-44e8-bb67-2dce098642d7", "molfile": "\n Marvin 01132105542D \n\n 27 29 0 0 0 0 999 V2000\n 4.4564 0.1380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0321 -0.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4564 -1.2962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2148 -0.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7853 -1.2962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9341 -1.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5410 -2.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6924 -2.0095 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2942 -2.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5570 -2.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9501 -2.0095 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5570 -1.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2942 -1.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7986 -2.0095 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n -2.1969 -2.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7986 -3.4463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1969 -4.1621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0481 -4.1621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4490 -3.4463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0481 -2.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1969 -1.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0481 -1.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4490 -0.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0481 0.1380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4724 0.8512 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1969 0.1380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7986 -0.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 2 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 13 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 14 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 15 1 0 0 0 0\n 21 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 20 15 2 0 0 0 0\n 17 16 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 27 21 2 0 0 0 0\n 23 22 2 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 24 26 2 0 0 0 0\n 26 27 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)C(c2ccc(cc2)Cl)N3CCN(CC3)CCOCC(=O)O", "formula": "C21H25ClN2O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "1a46c9ea-6e54-4d60-866b-7c4791cdc525" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "388.8885", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "ea63ab44-6e32-4768-abef-1cf36299ab68", "version": "24", "structure": { "id": "c309a8ae-de5d-427c-8740-06d2a9f1aee9", "molfile": "\n Marvin 01132110052D \n\n 27 29 0 0 0 0 999 V2000\n -0.9501 -2.0095 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7986 -2.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6924 -2.0095 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0321 -0.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1969 -1.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5570 -2.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5570 -1.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4564 0.1380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1969 -2.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0481 -1.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7986 -0.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2942 -2.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2942 -1.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0481 0.1380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4564 -1.2962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4490 -0.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1969 0.1380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4724 0.8512 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5410 -2.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2148 -0.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7853 -1.2962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0481 -2.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7986 -3.4463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9341 -1.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1969 -4.1621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4490 -3.4463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0481 -4.1621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 13 1 0 0 0 0\n 4 20 1 0 0 0 0\n 5 2 1 0 0 0 0\n 6 1 1 0 0 0 0\n 7 1 1 0 0 0 0\n 8 4 2 0 0 0 0\n 2 9 1 0 0 0 0\n 10 5 2 0 0 0 0\n 11 5 1 0 0 0 0\n 12 6 1 0 0 0 0\n 13 7 1 0 0 0 0\n 14 17 1 0 0 0 0\n 15 4 1 0 0 0 0\n 16 10 1 0 0 0 0\n 17 11 2 0 0 0 0\n 18 14 1 0 0 0 0\n 19 3 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 24 1 0 0 0 0\n 22 9 1 0 0 0 0\n 23 9 2 0 0 0 0\n 24 19 1 0 0 0 0\n 25 23 1 0 0 0 0\n 26 22 2 0 0 0 0\n 27 26 1 0 0 0 0\n 12 3 1 0 0 0 0\n 14 16 2 0 0 0 0\n 25 27 2 0 0 0 0\nM END", "smiles": "c1ccc(cc1)C(c2ccc(cc2)Cl)N3CCN(CC3)CCOCC(=O)O", "formula": "C21H25ClN2O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "388.8885", "optical_activity": "( + / - )", "references": [ "648aaa00-fa0b-4c0f-9fbf-166d590cf588", "d4b6e32d-bc60-4738-b31a-adabbac1faaa", "a9131706-b877-4dc2-b7d0-ff64e73da8f5" ], "stereo_centers": 1 }, "unii": "YO7261ME24", "relationships": [ { "uuid": "8256224a-78fa-4a6f-8dcd-00be1926807d", "amount": { "uuid": "fc898936-5294-40ca-a9db-55175059f53e" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "1f97b114-bb0e-4c88-a3ae-7ee92143cc65", "refuuid": "ea63ab44-6e32-4768-abef-1cf36299ab68", "name": "CETIRIZINE", "unii": "YO7261ME24", "linking_id": "YO7261ME24", "ref_pname": "CETIRIZINE", "substance_class": "reference" } }, { "uuid": "487e2295-587f-4e4f-9bf9-0cc2f691b771", "amount": { "uuid": "cdaf23b1-2fcd-4576-b7a8-b14faaa9a5c6" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "8d235a87-70eb-445b-8978-78bcad67fe1b", "refuuid": "58aa462d-af3a-41ac-9b3d-1963efb81bd1", "name": "Cetirizine hydrochloride", "unii": "64O047KTOA", "linking_id": "64O047KTOA", "ref_pname": "Cetirizine hydrochloride", "substance_class": "reference" } }, { "uuid": "db8f6ab2-230b-4382-b42f-aacade0d1954", "amount": { "uuid": "141f853c-e064-4b45-a8e2-7930fc8e3c89" }, "type": "ENANTIOMER->RACEMATE", "related_substance": { "uuid": "d30f4ae6-b262-446c-ae68-687cf759d0c0", "refuuid": "a58716d2-0d43-405b-9e9b-f24cf2267296", "name": "CETIRIZINE, (S)-", "unii": "V57G6B5I8Z", "linking_id": "V57G6B5I8Z", "ref_pname": "CETIRIZINE, (S)-", "substance_class": "reference" } }, { "uuid": "8fc9561e-2c80-4920-a068-38962998f928", "amount": { "uuid": "fce121f1-f2fd-4199-9897-9aee55e8acca" }, "type": "ENANTIOMER->RACEMATE", "related_substance": { "uuid": "320d4ded-3c00-4efc-8115-8afa005af9e0", "refuuid": "ef634e29-f617-47cc-a8cd-6f51228a678a", "name": "LEVOCETIRIZINE", "unii": "6U5EA9RT2O", "linking_id": "6U5EA9RT2O", "ref_pname": "LEVOCETIRIZINE", "substance_class": "reference" } }, { "uuid": "d9c41b69-e549-45b2-b1a6-a69f21840185", "amount": { "uuid": "d1535c5a-c76e-4ddf-bbca-b9c5bb25b803", "average": 63 }, "comments": "in vitro ER in the MDCK-MDR1 cell line from National Institutes of Health", "qualification": "EFFLUX RATIO", "type": "TRANSPORTER->SUBSTRATE", "references": [ "90c3a0f3-13cf-4c69-836d-19402e11f743" ], "related_substance": { "uuid": "3419c7fc-1f81-4ce6-a7c0-9bc59d150f54", "refuuid": "3921aa0b-fd6d-40ec-9c07-d83e5c6f124a", "name": "MULTIDRUG RESISTANCE PROTEIN 1", "unii": "22ES734693", "linking_id": "22ES734693", "ref_pname": "MULTIDRUG RESISTANCE PROTEIN 1", "substance_class": "reference" } }, { "uuid": "44916f83-63fe-4ceb-9e6f-22b77c94cc30", "amount": { "uuid": "367e33ce-9a3a-4012-aa7a-312d33883a10" }, "type": "TARGET->INHIBITOR", "references": [ "9011ab0c-63ad-4cf2-a76e-b01ecf7fe362" ], "related_substance": { "uuid": "0efc2a6c-8f08-405c-8e94-f5f109b16081", "refuuid": "23559f52-21c8-4b43-92f1-981b36cdfe1d", "name": "HISTAMINE H1 RECEPTOR", "unii": "28XBT591QG", "linking_id": "28XBT591QG", "ref_pname": "HISTAMINE H1 RECEPTOR", "substance_class": "reference" } }, { "uuid": "684baa9d-ad63-43cf-a110-f781b48a8eeb", "amount": { "uuid": "f69ad1f3-1dfe-405f-ba82-00436302f060", "average": 93, "units": "%" }, "type": "BINDER->LIGAND", "references": [ "77d35478-8ebc-a3d2-7dd2-6b4c4eea0b6a" ], "related_substance": { "uuid": "3366c545-d94e-4502-b305-2a1fe0695e29", "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30", "name": "PLASMA PROTEIN FRACTION (HUMAN)", "unii": "6D53G0FD0Z", "linking_id": "6D53G0FD0Z", "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)", "substance_class": "reference" } } ], "names": [ { "uuid": "2cee35bc-2f28-4fe2-b7db-a5fd87d831c7", "name": "(±)-(2-(4-(P-CHLORO-A-PHENYLBENZYL)-1-PIPERAZINYL)ETHOXY)ACETIC ACID", "stdName": "(+/-)-(2-(4-(P-CHLORO-A-PHENYLBENZYL)-1-PIPERAZINYL)ETHOXY)ACETIC ACID", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2158df88-22c9-493e-9629-1a5f82073a59" ], "display_name": false }, { "uuid": "3cb3b133-dec6-4840-a5dd-65d024fe2ae4", "name": "AC-170", "stdName": "AC-170", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "68377922-f7c0-40e7-9024-63293a3c8a3e" ], "display_name": false }, { "uuid": "51ca08d7-8173-4d13-b7a2-45fdb7382de6", "name": "ACETIC ACID, (2-(4-((4-CHLOROPHENYL)PHENYLMETHYL)-1-PIPERAZINYL)ETHOXY)-, (±)-", "stdName": "ACETIC ACID, (2-(4-((4-CHLOROPHENYL)PHENYLMETHYL)-1-PIPERAZINYL)ETHOXY)-, (+/-)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2158df88-22c9-493e-9629-1a5f82073a59" ], "display_name": false }, { "uuid": "a72aa77e-fbdf-40a5-a432-0653017064d2", "name": "CETIDERM", "stdName": "CETIDERM", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "a3a4c110-6fb6-4d97-b141-f1efa50c7ba0", "919ac027-2f04-4da7-a1e8-f2ce8d7018d7" ], "display_name": false }, { "uuid": "5c13b0ff-1c96-4254-bd2f-86c1905738d7", "name": "CETIRIZINE", "stdName": "CETIRIZINE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "6b20ff06-3034-4961-82f5-a929510debab", "c7ae74de-c48d-48ee-aeb3-62b4d5e087b6", "f100c370-a97a-4559-a9b1-91cb4d736737", "a5c3e0fa-5c3b-431d-b494-0a4cee1d70e7", "a774e41c-82db-41bf-9317-9159af1e9933", "bceec8d9-ff84-4940-b482-310c52435e31", "1404bee8-acc0-4d97-b4e4-67f2ab8edeab", "a9131706-b877-4dc2-b7d0-ff64e73da8f5", "528b72c5-d244-4c0f-85d6-3343a13f35ca", "2dfe8c0b-9224-4627-b98f-2f9901eceb2f", "f741f2f2-501a-4b61-82d3-231a528ac084" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "a63b3bfa-7f9a-4532-9d1a-b304d38ad066", "name_org": "INN" } ] }, { "uuid": "366cb283-c6aa-4090-a772-9c03028bfa31", "name": "CETIRIZINE [HSDB]", "stdName": "CETIRIZINE [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6b20ff06-3034-4961-82f5-a929510debab" ], "display_name": false }, { "uuid": "0bb2a2fb-3ebc-4aef-91d8-4cdef6725291", "name": "CETIRIZINE [MI]", "stdName": "CETIRIZINE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bceec8d9-ff84-4940-b482-310c52435e31" ], "display_name": false }, { "uuid": "98371fd5-8dfa-4ead-ba96-ac1d4523e48f", "name": "CETIRIZINE [VANDF]", "stdName": "CETIRIZINE [VANDF]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c7ae74de-c48d-48ee-aeb3-62b4d5e087b6" ], "display_name": false }, { "uuid": "47c78203-b2a4-74dc-ab39-99351adb9cb8", "name": "Cetirizine [WHO-DD]", "stdName": "CETIRIZINE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "eab9f75e-dfb2-4b5c-39e2-bfe0a3e4b8b7" ], "display_name": false }, { "uuid": "47a4542a-8efa-473a-8618-1285e49aed5c", "name": "cetirizine [INN]", "stdName": "CETIRIZINE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a9131706-b877-4dc2-b7d0-ff64e73da8f5" ], "display_name": false } ], "properties": [ { "uuid": "13987b96-eee3-42f8-bfd9-832f3980139c", "name": "Biological Half-life", "value": { "uuid": "7a55d90f-9cb0-4bf4-a449-b8a6602f034c", "average": 8, "units": "hours" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "c0f18ea4-e005-5b0a-f146-1080bf2c000d" ] }, { "uuid": "8cce56a9-332a-47c0-981b-8282e387dd8c", "name": "Volume of Distribution", "value": { "uuid": "865fdfd3-911d-4d50-81c0-499ba3b8e1c2", "average": 0.56, "units": "Liters/Kilogram" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "c0f18ea4-e005-5b0a-f146-1080bf2c000d" ] } ] } ] }