{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cebefdc2-7d1e-4a4b-ae25-adf1881f1e35",
          "code": "478-43-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=478-43-3",
          "code_system": "CAS",
          "references": [
            "d57b71f3-482d-4680-9948-adb897961be3",
            "dd53b276-92d8-4fcf-9a96-9532e9ed4d56"
          ]
        },
        {
          "uuid": "5039061b-fd42-490e-9157-f1c750ea8edb",
          "code": "C020491",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67020491",
          "code_system": "MESH",
          "references": [
            "d57b71f3-482d-4680-9948-adb897961be3"
          ]
        },
        {
          "uuid": "a7ae656c-935f-40a1-9885-91a37e6400ab",
          "code": "m9569",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9569?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d57b71f3-482d-4680-9948-adb897961be3"
          ]
        },
        {
          "uuid": "56c76ec0-c684-4b64-a8cf-698799231e7a",
          "code": "207-521-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.839",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d57b71f3-482d-4680-9948-adb897961be3"
          ]
        },
        {
          "uuid": "0bf38fb6-7951-4a9d-8fd3-e5ce54052cb7",
          "code": "10168",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10168",
          "code_system": "PUBCHEM",
          "references": [
            "d57b71f3-482d-4680-9948-adb897961be3"
          ]
        },
        {
          "uuid": "8995ce8b-a350-6022-6efe-0b1a7f1aea5d",
          "code": "DTXSID4026000",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4026000",
          "code_system": "EPA CompTox",
          "references": [
            "59ec15ca-9a6c-0ebc-93d8-c84bccc6b1aa"
          ]
        },
        {
          "uuid": "12ed07a8-813e-3099-c1e8-c54c3c84424a",
          "code": "DB13174",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13174",
          "code_system": "DRUG BANK",
          "references": [
            "f909128d-9798-4dda-9949-2f6c656610b8"
          ]
        },
        {
          "uuid": "955bb080-fccd-4e49-8556-d62c236459b2",
          "code": "YM64C2P6UX",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7c07f6ed-de56-91d9-8703-7006a1fd634a",
          "code": "Rhein (molecule)",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Rhein_(molecule)",
          "code_system": "WIKIPEDIA",
          "references": [
            "7b12ac79-e55a-e1d4-97c2-8e73d8fcef39"
          ]
        },
        {
          "uuid": "c3073d10-7bc0-668b-5133-e2947e1ace99",
          "code": "38629",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=38629",
          "code_system": "NSC",
          "references": [
            "0b000991-f0be-9691-c1d6-d9a3ca9275dc"
          ]
        },
        {
          "uuid": "f7af9406-ab2d-2caa-6a34-ae508f0318dc",
          "code": "300000011234",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "bcd0b5d9-143b-bbfb-8843-8a457eb3f419"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a97ef17d-36bf-44ed-a5f9-4de51afe7fc9",
          "name": "1,8-DIHYDROXYANTHRAQUINONE-3-CARBOXYLIC ACID",
          "stdName": "1,8-DIHYDROXYANTHRAQUINONE-3-CARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36a17373-e7fd-436d-a2b6-54a402862187",
            "3b8405ff-33c9-4797-82e0-e3e09a9bde75"
          ],
          "display_name": false
        },
        {
          "uuid": "4c404628-7152-4cd1-ad40-ce9f2e09616a",
          "name": "4,5-DIHYDROXYANTHRAQUINONE-2-CARBOXYLIC ACID",
          "stdName": "4,5-DIHYDROXYANTHRAQUINONE-2-CARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36a17373-e7fd-436d-a2b6-54a402862187",
            "3b8405ff-33c9-4797-82e0-e3e09a9bde75"
          ],
          "display_name": false
        },
        {
          "uuid": "a37b9b09-2a03-468f-9e8f-5c8153085f40",
          "name": "9,10-DIHYDRO-4,5-DIHYDROXY-9,10-DIOXO-2-ANTHRACENECARBOXYLIC ACID",
          "stdName": "9,10-DIHYDRO-4,5-DIHYDROXY-9,10-DIOXO-2-ANTHRACENECARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36a17373-e7fd-436d-a2b6-54a402862187",
            "3b8405ff-33c9-4797-82e0-e3e09a9bde75"
          ],
          "display_name": false
        },
        {
          "uuid": "4a8acf5d-3201-4da7-9e85-c64f9aef9cec",
          "name": "CASSIC ACID",
          "stdName": "CASSIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36a17373-e7fd-436d-a2b6-54a402862187",
            "3b8405ff-33c9-4797-82e0-e3e09a9bde75"
          ],
          "display_name": false
        },
        {
          "uuid": "1225c864-9503-47cd-9827-431cc4dd7c1a",
          "name": "CHRYSAZIN-3-CARBOXYLIC ACID",
          "stdName": "CHRYSAZIN-3-CARBOXYLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36a17373-e7fd-436d-a2b6-54a402862187",
            "3b8405ff-33c9-4797-82e0-e3e09a9bde75"
          ],
          "display_name": false
        },
        {
          "uuid": "ca8ef415-9b7c-495c-8fa7-37d04ab2cb7e",
          "name": "DIHYDROXY-3-CARBOXYLANTHRAQUINONE, 1,8-",
          "stdName": "DIHYDROXY-3-CARBOXYLANTHRAQUINONE, 1,8-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dae97536-4255-4ae4-9952-29ea6694cbe0"
          ],
          "display_name": false
        },
        {
          "uuid": "a2d0793f-6be0-432b-ace2-b37b2a594bb6",
          "name": "MONORHEIN",
          "stdName": "MONORHEIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36a17373-e7fd-436d-a2b6-54a402862187",
            "3b8405ff-33c9-4797-82e0-e3e09a9bde75"
          ],
          "display_name": false
        },
        {
          "uuid": "a277464a-1603-4bf5-9148-38a8823425c6",
          "name": "NSC-38629",
          "stdName": "NSC-38629",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36a17373-e7fd-436d-a2b6-54a402862187",
            "3b8405ff-33c9-4797-82e0-e3e09a9bde75"
          ],
          "display_name": false
        },
        {
          "uuid": "e2e26041-90df-4c2b-a36b-21d512b55190",
          "name": "PARIETIC ACID",
          "stdName": "PARIETIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36a17373-e7fd-436d-a2b6-54a402862187",
            "3b8405ff-33c9-4797-82e0-e3e09a9bde75"
          ],
          "display_name": false
        },
        {
          "uuid": "eb20a952-bdf9-4ae3-9651-f411ef552901",
          "name": "RHEIC ACID",
          "stdName": "RHEIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36a17373-e7fd-436d-a2b6-54a402862187",
            "3b8405ff-33c9-4797-82e0-e3e09a9bde75"
          ],
          "display_name": false
        },
        {
          "uuid": "1781e391-ed72-42c0-aaa7-a162138164c0",
          "name": "RHEIN",
          "stdName": "RHEIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b20f17d5-21d3-4c37-9b3f-2af16ba5ee6d",
            "e359e88a-ea50-49b2-bcf3-a4b1c85d84dd",
            "36a17373-e7fd-436d-a2b6-54a402862187",
            "3b8405ff-33c9-4797-82e0-e3e09a9bde75",
            "0f8b5999-54e5-4590-9dc2-9d7bac8a8342",
            "fe2e6d27-a2d8-4e5b-8fa2-2353c5c3037f"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "18bf1068-ee6c-486f-897c-a342ff78e3a3",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "dc1f2f3e-2d5c-44a2-a9e2-8515d4da5f9f",
          "name": "RHEIN [MI]",
          "stdName": "RHEIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e359e88a-ea50-49b2-bcf3-a4b1c85d84dd",
            "3b8405ff-33c9-4797-82e0-e3e09a9bde75"
          ],
          "display_name": false
        },
        {
          "uuid": "9f891c52-9e09-490a-92e5-2498b66a379b",
          "name": "RHUBARB YELLOW",
          "stdName": "RHUBARB YELLOW",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36a17373-e7fd-436d-a2b6-54a402862187",
            "3b8405ff-33c9-4797-82e0-e3e09a9bde75"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "dae97536-4255-4ae4-9952-29ea6694cbe0",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e359e88a-ea50-49b2-bcf3-a4b1c85d84dd",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b8405ff-33c9-4797-82e0-e3e09a9bde75",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36a17373-e7fd-436d-a2b6-54a402862187",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe2e6d27-a2d8-4e5b-8fa2-2353c5c3037f",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d57b71f3-482d-4680-9948-adb897961be3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390953000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7757622c-6716-4d7f-a10e-2e0d6d34a556",
          "citation": "SRS import [YM64C2P6UX]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YM64C2P6UX",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390953000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b38ff0f-3606-44bf-89a2-3866ae1a8ea8",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f8b5999-54e5-4590-9dc2-9d7bac8a8342",
          "citation": "RHEIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b20f17d5-21d3-4c37-9b3f-2af16ba5ee6d",
          "citation": "RHEIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "59ec15ca-9a6c-0ebc-93d8-c84bccc6b1aa",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=478-43-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7b12ac79-e55a-e1d4-97c2-8e73d8fcef39",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "f909128d-9798-4dda-9949-2f6c656610b8",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "dd53b276-92d8-4fcf-9a96-9532e9ed4d56",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0b000991-f0be-9691-c1d6-d9a3ca9275dc",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ae82998a-e531-f108-b039-94f21deb5dc4",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "bcd0b5d9-143b-bbfb-8843-8a457eb3f419",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "663828e4-7670-402d-903b-03dc4a0b78e1",
          "id": "663828e4-7670-402d-903b-03dc4a0b78e1",
          "molfile": "\n  Marvin  01132105192D          \n\n 21 23  0  0  0  0            999 V2000\n    9.1452   -6.8434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1452   -6.0264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8613   -5.6202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4182   -5.6096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4182   -4.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7022   -4.3807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7022   -3.5514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9944   -4.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2721   -4.3807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2721   -3.5514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5599   -4.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8478   -4.3807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8478   -3.5514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1255   -4.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1255   -5.6096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8478   -6.0137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5599   -5.6096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2721   -6.0137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2721   -6.8429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9944   -5.6096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7022   -6.0137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n 21  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 20  2  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 17  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 20 18  1  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
          "smiles": "c1cc2c(c(c1)O)C(=O)c3c(cc(cc3O)C(=O)O)C2=O",
          "formula": "C15H8O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "400f39c6-863b-47bc-b9f2-2cc483d8b374"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "284.221",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a793913d-02c7-4241-8e04-3412ad723a47",
      "version": "11",
      "structure": {
        "id": "012cd299-fe9d-4c47-a2b2-5d53bd7f4f60",
        "molfile": "\n  Marvin  01132100222D          \n\n 21 23  0  0  0  0            999 V2000\n    6.9944   -4.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9944   -5.6096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2721   -6.0137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5599   -5.6096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8478   -6.0137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1255   -5.6096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1255   -4.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8478   -4.3807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5599   -4.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2721   -4.3807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2721   -3.5514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8478   -3.5514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2721   -6.8429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7022   -6.0137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4182   -5.6096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1452   -6.0264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1452   -6.8434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8613   -5.6202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4182   -4.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7022   -4.3807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7022   -3.5514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  1 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n  9  4  2  0  0  0  0\n  8 12  1  0  0  0  0\n  3 13  2  0  0  0  0\n  2 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  2  0  0  0  0\n 19 15  1  0  0  0  0\n 20 19  2  0  0  0  0\n  1 20  1  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
        "smiles": "c1cc2c(c(c1)O)C(=O)c3c(cc(cc3O)C(=O)O)C2=O",
        "formula": "C15H8O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "284.221",
        "optical_activity": "NONE",
        "references": [
          "7b38ff0f-3606-44bf-89a2-3866ae1a8ea8",
          "7757622c-6716-4d7f-a10e-2e0d6d34a556"
        ],
        "stereo_centers": 0
      },
      "unii": "YM64C2P6UX"
    }
  ]
}