{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "49f76809-089f-4e45-b47b-8f94dc613578",
          "code": "32889-48-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=32889-48-8",
          "code_system": "CAS",
          "references": [
            "b7e8e611-42fe-46cd-8366-f20e976cbee6",
            "e5211f65-b678-4171-85c4-24d5000134bb"
          ]
        },
        {
          "uuid": "2d2f08ce-45c1-4f03-a4f2-2008e66c5316",
          "code": "110101",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3562",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "b7e8e611-42fe-46cd-8366-f20e976cbee6"
          ]
        },
        {
          "uuid": "5ae8abcf-7578-45eb-a7f7-2fcfcf1ed481",
          "code": "36274",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/36274",
          "code_system": "PUBCHEM",
          "references": [
            "b7e8e611-42fe-46cd-8366-f20e976cbee6"
          ]
        },
        {
          "uuid": "dd46f3b2-9e24-1850-79aa-9cca2ecf98c7",
          "code": "DTXSID1034844",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1034844",
          "code_system": "EPA CompTox",
          "references": [
            "bd1161ec-7c35-9b7f-360b-d7de7b799ffc"
          ]
        },
        {
          "uuid": "f0665378-0097-4f1c-8052-87f21b459f48",
          "code": "YLT2TR0PUH",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d82a6128-b457-782e-0b32-3879eeee4b50",
          "code": "procyazine",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/procyazine.html",
          "code_system": "ALANWOOD",
          "references": [
            "43f244f0-f5a8-8b17-51f7-65ac5343a626"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "07d026ea-ac70-4b3a-b261-cd78dd43dd2c",
          "name": "2-((4-CHLORO-6-(CYCLOPROPYLAMINO)-1,3,5-TRIAZIN-2-YL)AMINO)-2-METHYLPROPANENITRILE",
          "stdName": "2-((4-CHLORO-6-(CYCLOPROPYLAMINO)-1,3,5-TRIAZIN-2-YL)AMINO)-2-METHYLPROPANENITRILE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0accc800-02f6-45fc-b095-c54477bf3f6e",
            "88f10d95-a55c-4738-a352-dd418a65cf9f"
          ],
          "display_name": false
        },
        {
          "uuid": "a0161aa1-a9d3-47d4-a620-6fef7b14dc9d",
          "name": "2-(4-CHLORO-6-CYCLOPROPYLAMINO-1,3,5-TRIAZIN-2-YLAMINO)-2-METHYLPROPIONONITRILE",
          "stdName": "2-(4-CHLORO-6-CYCLOPROPYLAMINO-1,3,5-TRIAZIN-2-YLAMINO)-2-METHYLPROPIONONITRILE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc800df2-0eab-478b-b045-ba8d121f4f35",
            "0accc800-02f6-45fc-b095-c54477bf3f6e"
          ],
          "display_name": false
        },
        {
          "uuid": "bf57c2ea-420d-474c-b38d-b8ec9f97de20",
          "name": "CYCLE (HERBICIDE)",
          "stdName": "CYCLE (HERBICIDE)",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95ce56a7-4ffe-43a8-b65f-50332abbac80",
            "8030b542-6e65-4a4f-bb4f-7dc266856943"
          ],
          "display_name": false
        },
        {
          "uuid": "56ab9ae7-4701-4d6c-a6e5-ffea55a8a7ca",
          "name": "PROCYAZINE",
          "stdName": "PROCYAZINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95ce56a7-4ffe-43a8-b65f-50332abbac80",
            "6a413d15-8d42-479a-bc1d-0c2e60f7d13e",
            "b4332382-e1f6-4503-b6f9-c258f17a8fdd",
            "b1af1363-ac2a-4210-8a1b-31741a8930dd"
          ],
          "display_name": true
        },
        {
          "uuid": "afe68481-9044-4073-bf2c-1e6554fda42b",
          "name": "PROCYAZINE [ISO]",
          "stdName": "PROCYAZINE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95ce56a7-4ffe-43a8-b65f-50332abbac80",
            "b1af1363-ac2a-4210-8a1b-31741a8930dd"
          ],
          "display_name": false
        },
        {
          "uuid": "9bdee105-b65c-4464-a669-53078c24b0de",
          "name": "PROPANENITRILE, 2-((4-CHLORO-6-(CYCLOPROPYLAMINO)-1,3,5-TRIAZIN-2-YL)AMINO)-2-METHYL-",
          "stdName": "PROPANENITRILE, 2-((4-CHLORO-6-(CYCLOPROPYLAMINO)-1,3,5-TRIAZIN-2-YL)AMINO)-2-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95ce56a7-4ffe-43a8-b65f-50332abbac80",
            "8030b542-6e65-4a4f-bb4f-7dc266856943"
          ],
          "display_name": false
        },
        {
          "uuid": "8674c111-fab6-45e4-ae92-cbb400f93259",
          "name": "PROPIONITRILE, 2-((4-CHLORO-6-(CYCLOPROPYLAMINO)-S-TRIAZIN-2-YL)AMINO)-2-METHYL-",
          "stdName": "PROPIONITRILE, 2-((4-CHLORO-6-(CYCLOPROPYLAMINO)-S-TRIAZIN-2-YL)AMINO)-2-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95ce56a7-4ffe-43a8-b65f-50332abbac80",
            "8030b542-6e65-4a4f-bb4f-7dc266856943"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6a413d15-8d42-479a-bc1d-0c2e60f7d13e",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0accc800-02f6-45fc-b095-c54477bf3f6e",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc800df2-0eab-478b-b045-ba8d121f4f35",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88f10d95-a55c-4738-a352-dd418a65cf9f",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1af1363-ac2a-4210-8a1b-31741a8930dd",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95ce56a7-4ffe-43a8-b65f-50332abbac80",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8030b542-6e65-4a4f-bb4f-7dc266856943",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7e8e611-42fe-46cd-8366-f20e976cbee6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390938000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67eb76ed-9acf-4e48-8366-80551b0b1800",
          "citation": "SRS import [YLT2TR0PUH]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YLT2TR0PUH",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390938000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "84798603-a361-40de-97d3-ad3d4ce219a6",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4332382-e1f6-4503-b6f9-c258f17a8fdd",
          "citation": "PROCYAZINE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bd1161ec-7c35-9b7f-360b-d7de7b799ffc",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=32889-48-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "43f244f0-f5a8-8b17-51f7-65ac5343a626",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "e5211f65-b678-4171-85c4-24d5000134bb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bc4466ee-5e40-484c-b36e-2d063abfabee",
          "id": "bc4466ee-5e40-484c-b36e-2d063abfabee",
          "molfile": "\n  Marvin  01132109442D          \n\n 17 18  0  0  0  0            999 V2000\n    7.1726   -7.2048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4232   -6.5248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9604   -6.0967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6833   -6.1867    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6833   -5.4576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9409   -5.0221    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9409   -4.1504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1879   -3.7150    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.6833   -3.7150    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4364   -4.1504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1620   -3.7150    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9641   -4.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6117   -4.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4283   -4.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4364   -5.0221    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1656   -6.8593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1656   -7.6928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2 16  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 15  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 15 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 13 14  1  0  0  0  0\n 16 17  3  0  0  0  0\nM  END",
          "smiles": "CC(C)(C#N)Nc1nc(Cl)nc(NC2CC2)n1",
          "formula": "C10H13ClN6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3451e554-ac02-4175-a5d1-b3153d260dec"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "252.7037",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c938e24d-9e20-458d-9787-38e2ebc7f853",
      "version": "4",
      "structure": {
        "id": "7da8dba1-fa87-4669-b0aa-be4948566bad",
        "molfile": "\n  Marvin  01132106312D          \n\n 17 18  0  0  0  0            999 V2000\n    7.4232   -6.5248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6833   -6.1867    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6833   -5.4576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4364   -5.0221    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4364   -4.1504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1620   -3.7150    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9641   -4.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6117   -4.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4283   -4.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6833   -3.7150    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9409   -4.1504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9409   -5.0221    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1879   -3.7150    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.1656   -6.8593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1656   -7.6928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1726   -7.2048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9604   -6.0967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  7  9  1  0  0  0  0\n  5 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n  3 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  3  0  0  0  0\n  1 16  1  0  0  0  0\n  1 17  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C#N)Nc1nc(Cl)nc(NC2CC2)n1",
        "formula": "C10H13ClN6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "252.7037",
        "optical_activity": "NONE",
        "references": [
          "84798603-a361-40de-97d3-ad3d4ce219a6",
          "67eb76ed-9acf-4e48-8366-80551b0b1800"
        ],
        "stereo_centers": 0
      },
      "unii": "YLT2TR0PUH"
    }
  ]
}