{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "4b478bc0-719d-4874-ad18-b738d55b60c3", "code": "2527-58-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2527-58-4", "code_system": "CAS", "references": [ "08c8ee52-73ad-46ad-9d9f-d9d30cb492e0", "3428540e-350e-49ae-80ce-05d82ea0da10" ] }, { "uuid": "a1192b2f-4f86-4c15-915f-4450392d7728", "code": "698902", "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL", "type": "PRIMARY", "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1413", "code_system": "EPA PESTICIDE CODE", "references": [ "08c8ee52-73ad-46ad-9d9f-d9d30cb492e0" ] }, { "uuid": "6cb9be33-a7a7-4f58-9a31-e01e6cbf4066", "code": "219-768-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.971", "code_system": "ECHA (EC/EINECS)", "references": [ "08c8ee52-73ad-46ad-9d9f-d9d30cb492e0" ] }, { "uuid": "9ad5741d-718f-4787-a377-6bceccb761c7", "code": "75662", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/75662", "code_system": "PUBCHEM", "references": [ "08c8ee52-73ad-46ad-9d9f-d9d30cb492e0" ] }, { "uuid": "94b261ff-709b-dc6d-0aa2-54e4e8634275", "code": "DTXSID3062495", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3062495", "code_system": "EPA CompTox", "references": [ "02fcd9cf-fd62-7c1d-95b5-e0652ebce71e" ] }, { "uuid": "85a5396d-f2d3-4b74-801a-9bbc42e4403f", "code": "YLD3A8PP4Z", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "e7d52bbb-5b48-43ec-9185-b7776e30d62b", "name": "BENZAMIDE, 2,2'-DITHIOBIS(N-METHYL-", "stdName": "BENZAMIDE, 2,2'-DITHIOBIS(N-METHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "78f83a5c-3995-4d43-b671-a856b46e6813" ], "display_name": false }, { "uuid": "ede7d95c-5649-4cd8-865f-8628b305f68b", "name": "DENSIL P", "stdName": "DENSIL P", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "924e7fb5-0bfc-4890-9698-4d38e8c41195" ], "display_name": false }, { "uuid": "6393e54c-4619-48ac-aba6-81328682f20b", "name": "Dithio-2,2'-bis(N-methylbenzamide)", "stdName": "DITHIO-2,2'-BIS(N-METHYLBENZAMIDE)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "924e7fb5-0bfc-4890-9698-4d38e8c41195" ], "display_name": true } ], "references": [ { "uuid": "78f83a5c-3995-4d43-b671-a856b46e6813", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "924e7fb5-0bfc-4890-9698-4d38e8c41195", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "08c8ee52-73ad-46ad-9d9f-d9d30cb492e0", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391989000, "tags": [ "NOMEN" ] }, { "uuid": "27cb7df9-124d-44b7-b6a3-b72b06ea9a39", "citation": "SRS import [YLD3A8PP4Z]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YLD3A8PP4Z", "doc_type": "SRS", "public_domain": true, "document_date": 1493391989000, "tags": [ "NOMEN" ] }, { "uuid": "02fcd9cf-fd62-7c1d-95b5-e0652ebce71e", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2527-58-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3428540e-350e-49ae-80ce-05d82ea0da10", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "06a332ff-f913-47a2-8c7d-c3ce95e46b16", "id": "06a332ff-f913-47a2-8c7d-c3ce95e46b16", "molfile": "\n Marvin 01132100382D \n\n 22 23 0 0 0 0 999 V2000\n 3.5712 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8558 -1.2346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1403 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1462 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4307 -1.2346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7154 -0.8135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.2346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.0596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7154 -2.4692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4307 -2.0596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1403 -2.4750 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1403 -3.2942 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8500 -3.7096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5654 -3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2808 -3.7096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2808 -4.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5654 -4.9558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8500 -4.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1403 -4.9442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1346 -5.7692 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4250 -4.5346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7096 -4.9442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 2 0 0 0 0\n 3 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 10 5 2 0 0 0 0\n 6 7 2 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 18 2 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 2 0 0 0 0\n 19 21 1 0 0 0 0\n 21 22 1 0 0 0 0\nM END", "smiles": "CNC(=O)c1ccccc1SSc2ccccc2C(=O)NC", "formula": "C16H16N2O2S2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e9992d37-70a2-4ab4-b5cb-d924851c6292" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "332.4432", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "3b523496-26d0-4d71-b304-fb95da7f52ec", "version": "4", "structure": { "id": "d21acf69-154b-4de4-97e0-74b9b9de9832", "molfile": "\n Marvin 01132110522D \n\n 22 23 0 0 0 0 999 V2000\n 2.1403 -2.4750 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1403 -3.2942 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1403 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8558 -1.2346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1462 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5712 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1403 -4.9442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4250 -4.5346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1346 -5.7692 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7096 -4.9442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4307 -2.0596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4307 -1.2346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7154 -2.4692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7154 -0.8135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.0596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.2346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8500 -3.7096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8500 -4.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5654 -3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5654 -4.9558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2808 -3.7096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2808 -4.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 11 1 0 0 0 0\n 2 17 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 5 2 0 0 0 0\n 3 12 1 0 0 0 0\n 4 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 2 0 0 0 0\n 7 18 1 0 0 0 0\n 8 10 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 13 15 2 0 0 0 0\n 14 16 2 0 0 0 0\n 15 16 1 0 0 0 0\n 17 18 2 0 0 0 0\n 17 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 19 21 2 0 0 0 0\n 20 22 2 0 0 0 0\n 21 22 1 0 0 0 0\nM END", "smiles": "CNC(=O)c1ccccc1SSc2ccccc2C(=O)NC", "formula": "C16H16N2O2S2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "332.4432", "optical_activity": "NONE", "references": [ "78f83a5c-3995-4d43-b671-a856b46e6813", "27cb7df9-124d-44b7-b6a3-b72b06ea9a39" ], "stereo_centers": 0 }, "unii": "YLD3A8PP4Z" } ] }