{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c37ae56b-b198-4284-9510-482f9eae951c",
          "code": "101289-65-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=101289-65-0",
          "code_system": "CAS",
          "references": [
            "7c0f8182-429b-4b8c-8917-db371950aad9",
            "d2590ba4-b03a-4035-83fe-4c87384c7940"
          ]
        },
        {
          "uuid": "c6f2f310-054b-4c23-9751-fe43a38774c8",
          "code": "7097261",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7097261",
          "code_system": "PUBCHEM",
          "references": [
            "7c0f8182-429b-4b8c-8917-db371950aad9"
          ]
        },
        {
          "uuid": "0d45d56d-0148-3660-621f-a78d823193d9",
          "code": "DTXSID80143823",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80143823",
          "code_system": "EPA CompTox",
          "references": [
            "dbf0a0bd-dd4e-371f-c5b9-62485000c90c"
          ]
        },
        {
          "uuid": "7d641a30-fcdf-4f6d-afc4-7e6edd60ca65",
          "code": "YL6E9848ZV",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e1916ab4-1f65-4414-b01d-8c1d11d13615",
          "name": "ASPARTIC ACID, N-4-INDOL-3-YLBUTYRYL-, L-",
          "stdName": "ASPARTIC ACID, N-4-INDOL-3-YLBUTYRYL-, L-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33693304-6a7d-42b7-a45a-64561a78f8f7",
            "d15c404f-4a78-4fa7-bbb5-f29641b106a1"
          ],
          "display_name": false
        },
        {
          "uuid": "6d5e7d28-b5d9-461d-92d2-a59e3fa4889f",
          "name": "AUXISTIM A",
          "stdName": "AUXISTIM A",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33693304-6a7d-42b7-a45a-64561a78f8f7",
            "60682334-bdc8-45f0-ad09-98a6bb8a4ca0"
          ],
          "display_name": false
        },
        {
          "uuid": "deef0c1b-6e91-40e2-aca8-cf3332ada5d8",
          "name": "INDOLEBUTYROYL ASPARTIC ACID",
          "stdName": "INDOLEBUTYROYL ASPARTIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33693304-6a7d-42b7-a45a-64561a78f8f7",
            "60682334-bdc8-45f0-ad09-98a6bb8a4ca0",
            "16244181-81c1-4d67-9eb7-b1e59dd6f8b0"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "e32b202d-f28d-4e27-a7bb-3d1d9c551fdd",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "45009cc1-5d73-4d6d-a9cf-6210d8183b88",
          "name": "L-ASPARTIC ACID, N-(4-(1H-INDOL-3-YL)-1-OXOBUTYL)-",
          "stdName": "L-ASPARTIC ACID, N-(4-(1H-INDOL-3-YL)-1-OXOBUTYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33693304-6a7d-42b7-a45a-64561a78f8f7",
            "d15c404f-4a78-4fa7-bbb5-f29641b106a1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "60682334-bdc8-45f0-ad09-98a6bb8a4ca0",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "33693304-6a7d-42b7-a45a-64561a78f8f7",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d15c404f-4a78-4fa7-bbb5-f29641b106a1",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c0f8182-429b-4b8c-8917-db371950aad9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391531000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1878336b-84f5-4a1a-b8d6-5c5e641afc29",
          "citation": "SRS import [YL6E9848ZV]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YL6E9848ZV",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391531000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "16244181-81c1-4d67-9eb7-b1e59dd6f8b0",
          "citation": "INDOLEBUTYROYL ASPARTIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dbf0a0bd-dd4e-371f-c5b9-62485000c90c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=101289-65-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d2590ba4-b03a-4035-83fe-4c87384c7940",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2227c983-da30-4d4a-a303-a30b60cbfd6f",
          "id": "2227c983-da30-4d4a-a303-a30b60cbfd6f",
          "molfile": "\n  Marvin  01132101552D          \n\n 23 24  0  0  1  0            999 V2000\n   12.4477   -3.1862    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   11.7332   -2.7737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7332   -1.9487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4477   -1.5362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0188   -1.5362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4477   -4.0112    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7332   -4.4237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0188   -4.0112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7332   -5.2487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0188   -5.6613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0188   -6.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3043   -6.8987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2180   -7.7192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4110   -7.8908    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9986   -7.1763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1916   -7.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9367   -6.2202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4887   -5.6071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2957   -5.7786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5506   -6.5632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1622   -2.7737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8766   -3.1862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1621   -1.9487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  1  1  0  0  0\n  1 21  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 20 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 20 15  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  2  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)c(CCCC(=O)N[C@@H](CC(=O)O)C(=O)O)c[nH]2",
          "formula": "C16H18N2O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "aab5b4a6-2748-4870-879d-23f830c2446f"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "318.3251",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9c1569ea-71c0-4ba9-a4bd-f1c4762fa120",
      "version": "5",
      "structure": {
        "id": "c42c71ef-516e-4bcd-935c-0f37b02f04fa",
        "molfile": "\n  Marvin  01132110082D          \n\n 23 24  0  0  1  0            999 V2000\n   12.4477   -4.0112    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4477   -3.1862    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.1622   -2.7737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8766   -3.1862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1621   -1.9487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7332   -2.7737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7332   -4.4237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0188   -4.0112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7332   -5.2487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0188   -5.6613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0188   -6.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1916   -7.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9367   -6.2202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4887   -5.6071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2957   -5.7786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5506   -6.5632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9986   -7.1763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4110   -7.8908    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2180   -7.7192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3043   -6.8987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4477   -1.5362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0188   -1.5362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7332   -1.9487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  2  6  1  0  0  0  0\n  1  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 20 11  1  0  0  0  0\n 17 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 20  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n  7  9  1  0  0  0  0\n 23 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 23  6  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)c(CCCC(=O)N[C@@H](CC(=O)O)C(=O)O)c[nH]2",
        "formula": "C16H18N2O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "318.3251",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "1878336b-84f5-4a1a-b8d6-5c5e641afc29",
          "d15c404f-4a78-4fa7-bbb5-f29641b106a1"
        ],
        "stereo_centers": 1
      },
      "unii": "YL6E9848ZV"
    }
  ]
}